diff options
| author | Manuel Palenzuela <[email protected]> | 2019-08-19 12:17:51 +0200 |
|---|---|---|
| committer | Manuel Palenzuela <[email protected]> | 2019-08-19 12:17:51 +0200 |
| commit | ea7016bdb1d9fb7de1a66a94b3de3b3c9e0f32c9 (patch) | |
| tree | 22a6413c757bb2cc709a51f851d5718298430c0d /resources/app/node_modules | |
| download | 9anime-client-ea7016bdb1d9fb7de1a66a94b3de3b3c9e0f32c9.tar.gz 9anime-client-ea7016bdb1d9fb7de1a66a94b3de3b3c9e0f32c9.tar.bz2 9anime-client-ea7016bdb1d9fb7de1a66a94b3de3b3c9e0f32c9.zip | |
Diffstat (limited to 'resources/app/node_modules')
140 files changed, 28477 insertions, 0 deletions
diff --git a/resources/app/node_modules/buffer-from/LICENSE b/resources/app/node_modules/buffer-from/LICENSE new file mode 100644 index 0000000..e4bf1d6 --- /dev/null +++ b/resources/app/node_modules/buffer-from/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2016, 2018 Linus Unnebäck + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/resources/app/node_modules/buffer-from/index.js b/resources/app/node_modules/buffer-from/index.js new file mode 100644 index 0000000..d92a83d --- /dev/null +++ b/resources/app/node_modules/buffer-from/index.js @@ -0,0 +1,69 @@ +var toString = Object.prototype.toString + +var isModern = ( + typeof Buffer.alloc === 'function' && + typeof Buffer.allocUnsafe === 'function' && + typeof Buffer.from === 'function' +) + +function isArrayBuffer (input) { + return toString.call(input).slice(8, -1) === 'ArrayBuffer' +} + +function fromArrayBuffer (obj, byteOffset, length) { + byteOffset >>>= 0 + + var maxLength = obj.byteLength - byteOffset + + if (maxLength < 0) { + throw new RangeError("'offset' is out of bounds") + } + + if (length === undefined) { + length = maxLength + } else { + length >>>= 0 + + if (length > maxLength) { + throw new RangeError("'length' is out of bounds") + } + } + + return isModern + ? Buffer.from(obj.slice(byteOffset, byteOffset + length)) + : new Buffer(new Uint8Array(obj.slice(byteOffset, byteOffset + length))) +} + +function fromString (string, encoding) { + if (typeof encoding !== 'string' || encoding === '') { + encoding = 'utf8' + } + + if (!Buffer.isEncoding(encoding)) { + throw new TypeError('"encoding" must be a valid string encoding') + } + + return isModern + ? Buffer.from(string, encoding) + : new Buffer(string, encoding) +} + +function bufferFrom (value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('"value" argument must not be a number') + } + + if (isArrayBuffer(value)) { + return fromArrayBuffer(value, encodingOrOffset, length) + } + + if (typeof value === 'string') { + return fromString(value, encodingOrOffset) + } + + return isModern + ? Buffer.from(value) + : new Buffer(value) +} + +module.exports = bufferFrom diff --git a/resources/app/node_modules/buffer-from/readme.md b/resources/app/node_modules/buffer-from/readme.md new file mode 100644 index 0000000..9880a55 --- /dev/null +++ b/resources/app/node_modules/buffer-from/readme.md @@ -0,0 +1,69 @@ +# Buffer From + +A [ponyfill](https://ponyfill.com) for `Buffer.from`, uses native implementation if available. + +## Installation + +```sh +npm install --save buffer-from +``` + +## Usage + +```js +const bufferFrom = require('buffer-from') + +console.log(bufferFrom([1, 2, 3, 4])) +//=> <Buffer 01 02 03 04> + +const arr = new Uint8Array([1, 2, 3, 4]) +console.log(bufferFrom(arr.buffer, 1, 2)) +//=> <Buffer 02 03> + +console.log(bufferFrom('test', 'utf8')) +//=> <Buffer 74 65 73 74> + +const buf = bufferFrom('test') +console.log(bufferFrom(buf)) +//=> <Buffer 74 65 73 74> +``` + +## API + +### bufferFrom(array) + +- `array` <Array> + +Allocates a new `Buffer` using an `array` of octets. + +### bufferFrom(arrayBuffer[, byteOffset[, length]]) + +- `arrayBuffer` <ArrayBuffer> The `.buffer` property of a TypedArray or ArrayBuffer +- `byteOffset` <Integer> Where to start copying from `arrayBuffer`. **Default:** `0` +- `length` <Integer> How many bytes to copy from `arrayBuffer`. **Default:** `arrayBuffer.length - byteOffset` + +When passed a reference to the `.buffer` property of a TypedArray instance, the +newly created `Buffer` will share the same allocated memory as the TypedArray. + +The optional `byteOffset` and `length` arguments specify a memory range within +the `arrayBuffer` that will be shared by the `Buffer`. + +### bufferFrom(buffer) + +- `buffer` <Buffer> An existing `Buffer` to copy data from + +Copies the passed `buffer` data onto a new `Buffer` instance. + +### bufferFrom(string[, encoding]) + +- `string` <String> A string to encode. +- `encoding` <String> The encoding of `string`. **Default:** `'utf8'` + +Creates a new `Buffer` containing the given JavaScript string `string`. If +provided, the `encoding` parameter identifies the character encoding of +`string`. + +## See also + +- [buffer-alloc](https://github.com/LinusU/buffer-alloc) A ponyfill for `Buffer.alloc` +- [buffer-alloc-unsafe](https://github.com/LinusU/buffer-alloc-unsafe) A ponyfill for `Buffer.allocUnsafe` diff --git a/resources/app/node_modules/debug/.coveralls.yml b/resources/app/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/resources/app/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/resources/app/node_modules/debug/.eslintrc b/resources/app/node_modules/debug/.eslintrc new file mode 100644 index 0000000..8a37ae2 --- /dev/null +++ b/resources/app/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/resources/app/node_modules/debug/.travis.yml b/resources/app/node_modules/debug/.travis.yml new file mode 100644 index 0000000..6c6090c --- /dev/null +++ b/resources/app/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/resources/app/node_modules/debug/CHANGELOG.md b/resources/app/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..eadaa18 --- /dev/null +++ b/resources/app/node_modules/debug/CHANGELOG.md @@ -0,0 +1,362 @@ + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/resources/app/node_modules/debug/LICENSE b/resources/app/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/resources/app/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk <[email protected]> + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/resources/app/node_modules/debug/Makefile b/resources/app/node_modules/debug/Makefile new file mode 100644 index 0000000..584da8b --- /dev/null +++ b/resources/app/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/resources/app/node_modules/debug/README.md b/resources/app/node_modules/debug/README.md new file mode 100644 index 0000000..f67be6b --- /dev/null +++ b/resources/app/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers) +[](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + +  + +  + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + +  + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + +  + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + +  + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + +<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a> + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + +<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a> + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <[email protected]> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/resources/app/node_modules/debug/component.json b/resources/app/node_modules/debug/component.json new file mode 100644 index 0000000..9de2641 --- /dev/null +++ b/resources/app/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/resources/app/node_modules/debug/karma.conf.js b/resources/app/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/resources/app/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/resources/app/node_modules/debug/node.js b/resources/app/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/resources/app/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/resources/app/node_modules/debug/package.json b/resources/app/node_modules/debug/package.json new file mode 100644 index 0000000..b6cc1a0 --- /dev/null +++ b/resources/app/node_modules/debug/package.json @@ -0,0 +1,87 @@ +{ + "_from": "debug@^2.2.0", + "_id": "[email protected]", + "_inBundle": false, + "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "_location": "/debug", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "debug@^2.2.0", + "name": "debug", + "escapedName": "debug", + "rawSpec": "^2.2.0", + "saveSpec": null, + "fetchSpec": "^2.2.0" + }, + "_requiredBy": [ + "/electron-squirrel-startup" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "_shasum": "5d128515df134ff327e90a4c93f4e077a536341f", + "_spec": "debug@^2.2.0", + "author": { + "name": "TJ Holowaychuk", + "email": "[email protected]" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "[email protected]", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "[email protected]" + } + ], + "dependencies": { + "ms": "2.0.0" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "2.6.9" +} diff --git a/resources/app/node_modules/electron-context-menu/index.js b/resources/app/node_modules/electron-context-menu/index.js new file mode 100644 index 0000000..2519347 --- /dev/null +++ b/resources/app/node_modules/electron-context-menu/index.js @@ -0,0 +1,198 @@ +'use strict'; +const electron = require('electron'); +const {download} = require('electron-dl'); +const isDev = require('electron-is-dev'); + +const webContents = win => win.webContents || win.getWebContents(); + +function create(win, options) { + webContents(win).on('context-menu', (event, props) => { + if (typeof options.shouldShowMenu === 'function' && options.shouldShowMenu(event, props) === false) { + return; + } + + const {editFlags} = props; + const hasText = props.selectionText.trim().length > 0; + const can = type => editFlags[`can${type}`] && hasText; + + let menuTpl = [{ + type: 'separator' + }, { + id: 'cut', + label: 'Cut', + // Needed because of macOS limitation: + // https://github.com/electron/electron/issues/5860 + role: can('Cut') ? 'cut' : '', + enabled: can('Cut'), + visible: props.isEditable + }, { + id: 'copy', + label: 'Copy', + role: can('Copy') ? 'copy' : '', + enabled: can('Copy'), + visible: props.isEditable || hasText + }, { + id: 'paste', + label: 'Paste', + role: editFlags.canPaste ? 'paste' : '', + enabled: editFlags.canPaste, + visible: props.isEditable + }, { + type: 'separator' + }]; + + if (props.mediaType === 'image') { + menuTpl = [{ + type: 'separator' + }, { + id: 'save', + label: 'Save Image', + click(item, win) { + download(win, props.srcURL); + } + }]; + + if (options.showSaveImageAs) { + menuTpl.push({ + id: 'saveImageAs', + label: 'Save Image As…', + click(item, win) { + download(win, props.srcURL, {saveAs: true}); + } + }); + } + + menuTpl.push({ + type: 'separator' + }); + } + + if (props.linkURL && props.mediaType === 'none') { + menuTpl = [{ + type: 'separator' + }, { + id: 'copyLink', + label: 'Copy Link', + click() { + electron.clipboard.write({ + bookmark: props.linkText, + text: props.linkURL + }); + } + }, { + type: 'separator' + }]; + } + + if (options.showCopyImageAddress && props.mediaType === 'image') { + menuTpl.push({ + type: 'separator' + }, { + id: 'copyImageAddress', + label: 'Copy Image Address', + click() { + electron.clipboard.write({ + bookmark: props.srcURL, + text: props.srcURL + }); + } + }, { + type: 'separator' + }); + } + + if (options.prepend) { + const result = options.prepend(props, win); + + if (Array.isArray(result)) { + menuTpl.unshift(...result); + } + } + + if (options.append) { + const result = options.append(props, win); + + if (Array.isArray(result)) { + menuTpl.push(...result); + } + } + + if (options.showInspectElement || (options.showInspectElement !== false && isDev)) { + menuTpl.push({ + type: 'separator' + }, { + id: 'inspect', + label: 'Inspect Element', + click() { + win.inspectElement(props.x, props.y); + + if (webContents(win).isDevToolsOpened()) { + webContents(win).devToolsWebContents.focus(); + } + } + }, { + type: 'separator' + }); + } + + // Apply custom labels for default menu items + if (options.labels) { + for (const menuItem of menuTpl) { + if (options.labels[menuItem.id]) { + menuItem.label = options.labels[menuItem.id]; + } + } + } + + // Filter out leading/trailing separators + // TODO: https://github.com/electron/electron/issues/5869 + menuTpl = delUnusedElements(menuTpl); + + if (menuTpl.length > 0) { + const menu = (electron.remote ? electron.remote.Menu : electron.Menu).buildFromTemplate(menuTpl); + + /* + * When electron.remote is not available this runs in the browser process. + * We can safely use win in this case as it refers to the window the + * context-menu should open in. + * When this is being called from a webView, we can't use win as this + * would refere to the webView which is not allowed to render a popup menu. + */ + menu.popup(electron.remote ? electron.remote.getCurrentWindow() : win); + } + }); +} + +function delUnusedElements(menuTpl) { + let notDeletedPrevEl; + return menuTpl.filter(el => el.visible !== false).filter((el, i, array) => { + const toDelete = el.type === 'separator' && (!notDeletedPrevEl || i === array.length - 1 || array[i + 1].type === 'separator'); + notDeletedPrevEl = toDelete ? notDeletedPrevEl : el; + return !toDelete; + }); +} + +module.exports = (options = {}) => { + if (options.window) { + const win = options.window; + const wc = webContents(win); + + // When window is a webview that has not yet finished loading webContents is not available + if (wc === undefined) { + win.addEventListener('dom-ready', () => { + create(win, options); + }, {once: true}); + return; + } + + return create(win, options); + } + + for (const win of (electron.BrowserWindow || electron.remote.BrowserWindow).getAllWindows()) { + create(win, options); + } + + (electron.app || electron.remote.app).on('browser-window-created', (event, win) => { + create(win, options); + }); +}; diff --git a/resources/app/node_modules/electron-context-menu/license b/resources/app/node_modules/electron-context-menu/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/resources/app/node_modules/electron-context-menu/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/resources/app/node_modules/electron-context-menu/readme.md b/resources/app/node_modules/electron-context-menu/readme.md new file mode 100644 index 0000000..8524c2b --- /dev/null +++ b/resources/app/node_modules/electron-context-menu/readme.md @@ -0,0 +1,141 @@ +# electron-context-menu [](https://travis-ci.org/sindresorhus/electron-context-menu) + +> Context menu for your [Electron](https://electronjs.org) app + +<img src="screenshot.png" width="125" align="right"> + +Electron doesn't have a built-in context menu. You're supposed to handle that yourself. But it's both tedious and hard to get right. This module gives you a nice extensible context menu with items like `Cut`/`Copy`/`Paste` for text, `Save Image` for images, and `Copy Link` for links. It also adds an `Inspect Element` menu item when in development to quickly view items in the inspector like in Chrome. + +You can use this module directly in both the main and renderer process. + + +## Install + +``` +$ npm install electron-context-menu +``` + +*Requires Electron 2.0.0 or later.* + +<a href="https://www.patreon.com/sindresorhus"> + <img src="https://c5.patreon.com/external/logo/[email protected]" width="160"> +</a> + + +## Usage + +```js +const {app, BrowserWindow} = require('electron'); + +require('electron-context-menu')({ + prepend: (params, browserWindow) => [{ + label: 'Rainbow', + // Only show it when right-clicking images + visible: params.mediaType === 'image' + }] +}); + +let mainWindow; +app.on('ready', () => { + mainWindow = new BrowserWindow(); +}); +``` + + +## API + +### contextMenu([options]) + +### options + +Type: `Object` + +#### window + +Type: `BrowserWindow` `WebView`<br> + +Window or WebView to add the context menu to. + +When not specified, the context menu will be added to all existing and new windows. + +#### prepend + +Type: `Function` + +Should return an array of [MenuItem](https://electronjs.org/docs/api/menu-item)'s to be prepended to the context menu. The first argument is [this `params` object](https://electronjs.org/docs/api/web-contents#event-context-menu). The second argument is the [BrowserWindow](https://electronjs.org/docs/api/browser-window) the context menu was requested for. + +#### append + +Type: `Function` + +Should return an array of [MenuItem](https://electronjs.org/docs/api/browser-window)'s to be appended to the context menu. The first argument is [this `params` object](https://electronjs.org/docs/api/browser-window). The second argument is the [BrowserWindow](https://electronjs.org/docs/api/browser-window) the context menu was requested for. + +#### showCopyImageAddress + +Type: `boolean`<br> +Default: `false` + +Show the `Copy Image Address` menu item when right-clicking on an image. + +#### showSaveImageAs + +Type: `boolean`<br> +Default: `false` + +Show the `Save Image As…` menu item when right-clicking on an image. + +#### showInspectElement + +Type: `boolean`<br> +Default: [Only in development](https://github.com/sindresorhus/electron-is-dev) + +Force enable or disable the `Inspect Element` menu item. + +#### labels + +Type: `Object`<br> +Default: `{}` + +Overwrite labels for the default menu items. Useful for i18n. + +Format: + +```js +labels: { + cut: 'Configured Cut', + copy: 'Configured Copy', + paste: 'Configured Paste', + save: 'Configured Save Image', + saveImageAs: 'Configured Save Image As…' + copyLink: 'Configured Copy Link', + copyImageAddress: 'Configured Copy Image Address', + inspect: 'Configured Inspect' +} +``` + +#### shouldShowMenu + +Type: `Function` + +Determines whether or not to show the menu. Can be useful if you for example have other code presenting a context menu in some contexts. The second argument is [this `params` object](https://electronjs.org/docs/api/web-contents#event-context-menu). + +Example: + +```js +// Doesn't show the menu if the element is editable +shouldShowMenu: (event, params) => !params.isEditable +``` + +## Related + +- [electron-util](https://github.com/sindresorhus/electron-util) - Useful utilities for developing Electron apps and modules +- [electron-debug](https://github.com/sindresorhus/electron-debug) - Adds useful debug features to your Electron app +- [electron-store](https://github.com/sindresorhus/electron-store) - Save and load data like user preferences, app state, cache, etc +- [electron-reloader](https://github.com/sindresorhus/electron-reloader) - Simple auto-reloading for Electron apps during development +- [electron-serve](https://github.com/sindresorhus/electron-serve) - Static file serving for Electron apps +- [electron-unhandled](https://github.com/sindresorhus/electron-unhandled) - Catch unhandled errors and promise rejections in your Electron app + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/resources/app/node_modules/electron-dl/index.d.ts b/resources/app/node_modules/electron-dl/index.d.ts new file mode 100644 index 0000000..b1fad33 --- /dev/null +++ b/resources/app/node_modules/electron-dl/index.d.ts @@ -0,0 +1,110 @@ +export interface Options { + /** + * Show a `Save As…` dialog instead of downloading immediately. + * + * Note: Only use this option when strictly necessary. Downloading directly without a prompt is a much better user experience. + * + * @default false + */ + saveAs?: boolean; + + /** + * Directory to save the file in. + * + * Default: [User's downloads directory](https://electronjs.org/docs/api/app/#appgetpathname) + */ + directory?: string; + + /** + * Name of the saved file. + * This option only makes sense for `electronDl.download()`. + * + * Default: [`downloadItem.getFilename()`](https://electronjs.org/docs/api/download-item/#downloaditemgetfilename) + */ + filename?: string; + + /** + * Title of the error dialog. Can be customized for localization. + * + * @default 'Download Error' + */ + errorTitle?: string; + + /** + * Message of the error dialog. `{filename}` is replaced with the name of the actual file. Can be customized for localization. + * + * @default 'The download of {filename} was interrupted' + */ + errorMessage?: string; + + /** + * Optional callback that receives the [download item](https://electronjs.org/docs/api/download-item). + * You can use this for advanced handling such as canceling the item like `item.cancel()`. + */ + onStarted?: (item: Electron.DownloadItem) => void; + + /** + * Optional callback that receives a number between `0` and `1` representing the progress of the current download. + */ + onProgress?: (percent: number) => void; + + /** + * Optional callback that receives the [download item](https://electronjs.org/docs/api/download-item) for which the download has been cancelled. + */ + onCancel?: (item: Electron.DownloadItem) => void; + + /** + * Reveal the downloaded file in the system file manager, and if possible, select the file. + * + * @default false + */ + openFolderWhenDone?: boolean; + + /** + * Shows the file count badge on macOS/Linux dock icons when download is in progress. + * + * @default true + */ + showBadge?: boolean; +} + +/** + * Register the helper for all windows. + * + * @example + * + * import {app, BrowserWindow} from 'electron'; + * import electronDl from 'electron-dl'; + * + * electronDl(); + * + * let win; + * app.on('ready', () => { + * win = new BrowserWindow(); + * }); + */ +export default function electronDl(options?: Options): void; + +/** + * This can be useful if you need download functionality in a reusable module. + * + * @param window - Window to register the behavior on. + * @param url - URL to download. + * @param options + * @returns A promise for the downloaded file. + * + * @example + * + * import {BrowserWindow, ipcMain} from 'electron'; + * import {download} from 'electron-dl'; + * + * ipcMain.on('download-button', async (event, {url}) => { + * const win = BrowserWindow.getFocusedWindow(); + * console.log(await download(win, url)); + * }); + */ +export function download( + window: Electron.BrowserWindow, + url: string, + options?: Options +): Promise<Electron.DownloadItem>; diff --git a/resources/app/node_modules/electron-dl/index.js b/resources/app/node_modules/electron-dl/index.js new file mode 100644 index 0000000..e335ab3 --- /dev/null +++ b/resources/app/node_modules/electron-dl/index.js @@ -0,0 +1,146 @@ +'use strict'; +const path = require('path'); +const {app, BrowserWindow, shell, dialog} = require('electron'); +const unusedFilename = require('unused-filename'); +const pupa = require('pupa'); +const extName = require('ext-name'); + +function getFilenameFromMime(name, mime) { + const exts = extName.mime(mime); + + if (exts.length !== 1) { + return name; + } + + return `${name}.${exts[0].ext}`; +} + +function registerListener(session, options, cb = () => {}) { + const downloadItems = new Set(); + let receivedBytes = 0; + let completedBytes = 0; + let totalBytes = 0; + const activeDownloadItems = () => downloadItems.size; + const progressDownloadItems = () => receivedBytes / totalBytes; + + options = Object.assign({ + showBadge: true + }, options); + + const listener = (e, item, webContents) => { + downloadItems.add(item); + totalBytes += item.getTotalBytes(); + + let hostWebContents = webContents; + if (webContents.getType() === 'webview') { + ({hostWebContents} = webContents); + } + + const win = BrowserWindow.fromWebContents(hostWebContents); + + const dir = options.directory || app.getPath('downloads'); + let filePath; + if (options.filename) { + filePath = path.join(dir, options.filename); + } else { + const filename = item.getFilename(); + const name = path.extname(filename) ? filename : getFilenameFromMime(filename, item.getMimeType()); + + filePath = unusedFilename.sync(path.join(dir, name)); + } + + const errorMessage = options.errorMessage || 'The download of {filename} was interrupted'; + const errorTitle = options.errorTitle || 'Download Error'; + + if (!options.saveAs) { + item.setSavePath(filePath); + } + + if (typeof options.onStarted === 'function') { + options.onStarted(item); + } + + item.on('updated', () => { + receivedBytes = [...downloadItems].reduce((receivedBytes, item) => { + receivedBytes += item.getReceivedBytes(); + return receivedBytes; + }, completedBytes); + + if (options.showBadge && ['darwin', 'linux'].includes(process.platform)) { + app.setBadgeCount(activeDownloadItems()); + } + + if (!win.isDestroyed()) { + win.setProgressBar(progressDownloadItems()); + } + + if (typeof options.onProgress === 'function') { + options.onProgress(progressDownloadItems()); + } + }); + + item.on('done', (event, state) => { + completedBytes += item.getTotalBytes(); + downloadItems.delete(item); + + if (options.showBadge && ['darwin', 'linux'].includes(process.platform)) { + app.setBadgeCount(activeDownloadItems()); + } + + if (!win.isDestroyed() && !activeDownloadItems()) { + win.setProgressBar(-1); + receivedBytes = 0; + completedBytes = 0; + totalBytes = 0; + } + + if (options.unregisterWhenDone) { + session.removeListener('will-download', listener); + } + + if (state === 'cancelled') { + if (typeof options.onCancel === 'function') { + options.onCancel(item); + } + } else if (state === 'interrupted') { + const message = pupa(errorMessage, {filename: item.getFilename()}); + dialog.showErrorBox(errorTitle, message); + cb(new Error(message)); + } else if (state === 'completed') { + if (process.platform === 'darwin') { + app.dock.downloadFinished(filePath); + } + + if (options.openFolderWhenDone) { + shell.showItemInFolder(path.join(dir, item.getFilename())); + } + + cb(null, item); + } + }); + }; + + session.on('will-download', listener); +} + +module.exports = (options = {}) => { + app.on('session-created', session => { + registerListener(session, options); + }); +}; + +module.exports.default = module.exports; + +module.exports.download = (win, url, options) => new Promise((resolve, reject) => { + options = Object.assign({}, options, {unregisterWhenDone: true}); + + registerListener(win.webContents.session, options, (err, item) => { + if (err) { + reject(err); + } else { + resolve(item); + } + }); + + win.webContents.downloadURL(url); +}); diff --git a/resources/app/node_modules/electron-dl/license b/resources/app/node_modules/electron-dl/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/resources/app/node_modules/electron-dl/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/resources/app/node_modules/electron-dl/readme.md b/resources/app/node_modules/electron-dl/readme.md new file mode 100644 index 0000000..c3dbbb7 --- /dev/null +++ b/resources/app/node_modules/electron-dl/readme.md @@ -0,0 +1,179 @@ +# electron-dl [](https://travis-ci.org/sindresorhus/electron-dl) + +> Simplified file downloads for your [Electron](https://electronjs.org) app + + +## Why? + +- One function call instead of having to manually implement a lot of [boilerplate](index.js). +- Saves the file to the users Downloads directory instead of prompting. +- Bounces the Downloads directory in the dock when done. *(macOS)* +- Handles multiple downloads. +- Shows badge count *(macOS & Linux only)* and download progress. Example on macOS: + +<img src="screenshot.png" width="82"> + + +## Install + +``` +$ npm install electron-dl +``` + + +## Usage + +### Register it for all windows + +This is probably what you want for your app. + +```js +const {app, BrowserWindow} = require('electron'); +const electronDl = require('electron-dl'); + +electronDl(); + +let win; +(async () => { + await app.whenReady(); + win = new BrowserWindow(); +})(); +``` + +### Use it manually + +This can be useful if you need download functionality in a reusable module. + +```js +const {BrowserWindow, ipcMain} = require('electron'); +const {download} = require('electron-dl'); + +ipcMain.on('download-button', async (event, {url}) => { + const win = BrowserWindow.getFocusedWindow(); + console.log(await download(win, url)); +}); +``` + +## API + +It can only be used in the [main](https://electronjs.org/docs/glossary/#main-process) process. + +### electronDl([options]) + +### electronDl.download(window, url, [options]): Promise<[DownloadItem](https://electronjs.org/docs/api/download-item)> + +### window + +Type: `BrowserWindow` + +Window to register the behavior on. + +### url + +Type: `string` + +URL to download. + +### options + +Type: `Object` + +#### saveAs + +Type: `boolean`<br> +Default: `false` + +Show a `Save As…` dialog instead of downloading immediately. + +Note: Only use this option when strictly necessary. Downloading directly without a prompt is a much better user experience. + +#### directory + +Type: `string`<br> +Default: [User's downloads directory](https://electronjs.org/docs/api/app/#appgetpathname) + +Directory to save the file in. + +#### filename + +Type: `string`<br> +Default: [`downloadItem.getFilename()`](https://electronjs.org/docs/api/download-item/#downloaditemgetfilename) + +Name of the saved file. + +This option only makes sense for `electronDl.download()`. + +#### errorTitle + +Type: `string`<br> +Default: `Download Error` + +Title of the error dialog. Can be customized for localization. + +#### errorMessage + +Type: `string`<br> +Default: `The download of {filename} was interrupted` + +Message of the error dialog. `{filename}` is replaced with the name of the actual file. Can be customized for localization. + +#### onStarted + +Type: `Function` + +Optional callback that receives the [download item](https://electronjs.org/docs/api/download-item). +You can use this for advanced handling such as canceling the item like `item.cancel()`. + +#### onProgress + +Type: `Function` + +Optional callback that receives a number between `0` and `1` representing the progress of the current download. + +#### onCancel + +Type: `Function` + +Optional callback that receives the [download item](https://electronjs.org/docs/api/download-item) for which the download has been cancelled. + +#### openFolderWhenDone + +Type: `boolean`<br> +Default: `false` + +Reveal the downloaded file in the system file manager, and if possible, select the file. + +#### showBadge + +Type: `boolean`<br> +Default: `true` + +Shows the file count badge on macOS/Linux dock icons when download is in progress. + + +## Development + +After making changes, run the automated tests: + +``` +$ npm test +``` + +And before submitting a pull request, run the manual tests to manually verify that everything works: + +``` +npm start +``` + + +## Related + +- [electron-debug](https://github.com/sindresorhus/electron-debug) - Adds useful debug features to your Electron app +- [electron-context-menu](https://github.com/sindresorhus/electron-context-menu) - Context menu for your Electron app +- [electron-store](https://github.com/sindresorhus/electron-store) - Save and load data like user preferences, app state, cache, etc +- [electron-unhandled](https://github.com/sindresorhus/electron-unhandled) - Catch unhandled errors and promise rejections in your Electron app + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/resources/app/node_modules/electron-is-dev/index.js b/resources/app/node_modules/electron-is-dev/index.js new file mode 100644 index 0000000..7dfeb6f --- /dev/null +++ b/resources/app/node_modules/electron-is-dev/index.js @@ -0,0 +1,9 @@ +'use strict'; +const electron = require('electron'); + +const app = electron.app || electron.remote.app; + +const isEnvSet = 'ELECTRON_IS_DEV' in process.env; +const getFromEnv = parseInt(process.env.ELECTRON_IS_DEV, 10) === 1; + +module.exports = isEnvSet ? getFromEnv : !app.isPackaged; diff --git a/resources/app/node_modules/electron-is-dev/license b/resources/app/node_modules/electron-is-dev/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/resources/app/node_modules/electron-is-dev/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/resources/app/node_modules/electron-is-dev/readme.md b/resources/app/node_modules/electron-is-dev/readme.md new file mode 100644 index 0000000..b950c45 --- /dev/null +++ b/resources/app/node_modules/electron-is-dev/readme.md @@ -0,0 +1,42 @@ +# electron-is-dev + +> Check if [Electron](https://electronjs.org) is running in development + +Useful for enabling debug features only during development. + +You can use this module directly in both the main and renderer process. + + +## Install + +``` +$ npm install electron-is-dev +``` + +*Requires Electron 3 or later.* + + +## Usage + +```js +const isDev = require('electron-is-dev'); + +if (isDev) { + console.log('Running in development'); +} else { + console.log('Running in production'); +} +``` + +You can force development mode by setting the `ELECTRON_IS_DEV` environment variable to `1`. + + +## Related + +- [electron-util](https://github.com/sindresorhus/electron-util) - Useful utilities for developing Electron apps +- [electron-debug](https://github.com/sindresorhus/electron-debug) - Adds useful debug features to your Electron app + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/resources/app/node_modules/electron-squirrel-startup/.eslintrc b/resources/app/node_modules/electron-squirrel-startup/.eslintrc new file mode 100644 index 0000000..6a7b34e --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/.eslintrc @@ -0,0 +1,3 @@ +{ + "extends": "mongodb-js/node" +} diff --git a/resources/app/node_modules/electron-squirrel-startup/.jsfmtrc b/resources/app/node_modules/electron-squirrel-startup/.jsfmtrc new file mode 100644 index 0000000..ca34329 --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/.jsfmtrc @@ -0,0 +1,168 @@ +{ + "preset": "default", + "plugins": [ + "esformatter-quotes", + "esformatter-semicolons", + "esformatter-braces" + ], + "quotes": { + "type": "single", + "avoidEscape": false + }, + "indent": { + "value": " " + }, + "whiteSpace" : { + "value" : " ", + "removeTrailing" : 1, + + "before" : { + "ArrayExpressionOpening" : 0, + "ArrayExpressionClosing" : 0, + "ArrayExpressionComma" : 0, + "ArgumentComma" : 0, + "ArgumentList" : 0, + "ArgumentListArrayExpression" : 0, + "ArgumentListFunctionExpression" : 0, + "ArgumentListObjectExpression" : 0, + "AssignmentOperator" : 1, + "BinaryExpression": 0, + "BinaryExpressionOperator" : 1, + "BlockComment" : 1, + "CallExpression" : -1, + "CatchParameterList" : 0, + "CatchOpeningBrace" : 1, + "CatchClosingBrace" : 1, + "CatchKeyword" : 1, + "CommaOperator" : 0, + "ConditionalExpressionConsequent" : 1, + "ConditionalExpressionAlternate" : 1, + "DoWhileStatementOpeningBrace" : 1, + "DoWhileStatementClosingBrace" : 1, + "DoWhileStatementConditional" : 1, + "EmptyStatement" : 0, + "ExpressionClosingParentheses" : 0, + "FinallyKeyword" : -1, + "FinallyOpeningBrace" : 1, + "FinallyClosingBrace" : 1, + "ForInStatement" : 1, + "ForInStatementExpressionOpening" : 1, + "ForInStatementExpressionClosing" : 0, + "ForInStatementOpeningBrace" : 1, + "ForInStatementClosingBrace" : 1, + "ForStatement" : 1, + "ForStatementExpressionOpening" : 1, + "ForStatementExpressionClosing" : 0, + "ForStatementOpeningBrace" : 1, + "ForStatementClosingBrace" : 1, + "ForStatementSemicolon" : 0, + "FunctionDeclarationOpeningBrace" : 1, + "FunctionDeclarationClosingBrace" : 1, + "FunctionExpressionOpeningBrace" : 1, + "FunctionExpressionClosingBrace" : 1, + "IfStatementConditionalOpening" : 1, + "IfStatementConditionalClosing" : 0, + "IfStatementOpeningBrace" : 1, + "IfStatementClosingBrace" : 1, + "ElseStatementOpeningBrace" : 1, + "ElseStatementClosingBrace" : 1, + "ElseIfStatementOpeningBrace" : 1, + "ElseIfStatementClosingBrace" : 1, + "MemberExpressionClosing" : 0, + "LineComment" : 1, + "LogicalExpressionOperator" : 1, + "Property" : 1, + "PropertyValue" : 1, + "ParameterComma" : 0, + "ParameterList" : 0, + "SwitchDiscriminantOpening" : 1, + "SwitchDiscriminantClosing" : 0, + "ThrowKeyword": 1, + "TryKeyword": -1, + "TryOpeningBrace" : 1, + "TryClosingBrace" : 1, + "UnaryExpressionOperator": 0, + "VariableName" : 1, + "VariableValue" : 1, + "WhileStatementConditionalOpening" : 1, + "WhileStatementConditionalClosing" : 0, + "WhileStatementOpeningBrace" : 1, + "WhileStatementClosingBrace" : 1 + }, + + "after" : { + "ArrayExpressionOpening" : 0, + "ArrayExpressionClosing" : 0, + "ArrayExpressionComma" : 1, + "ArgumentComma" : 1, + "ArgumentList" : 0, + "ArgumentListArrayExpression" : 0, + "ArgumentListFunctionExpression" : 0, + "ArgumentListObjectExpression" : 0, + "AssignmentOperator" : 1, + "BinaryExpression": 0, + "BinaryExpressionOperator" : 1, + "BlockComment" : 1, + "CallExpression" : 0, + "CatchParameterList" : 0, + "CatchOpeningBrace" : 1, + "CatchClosingBrace" : 1, + "CatchKeyword" : 1, + "CommaOperator" : 1, + "ConditionalExpressionConsequent" : 1, + "ConditionalExpressionTest" : 1, + "DoWhileStatementOpeningBrace" : 1, + "DoWhileStatementClosingBrace" : 1, + "DoWhileStatementBody" : 1, + "EmptyStatement" : 0, + "ExpressionOpeningParentheses" : 0, + "FinallyKeyword" : -1, + "FinallyOpeningBrace" : 1, + "FinallyClosingBrace" : 1, + "ForInStatement" : 1, + "ForInStatementExpressionOpening" : 0, + "ForInStatementExpressionClosing" : 1, + "ForInStatementOpeningBrace" : 1, + "ForInStatementClosingBrace" : 1, + "ForStatement" : 1, + "ForStatementExpressionOpening" : 0, + "ForStatementExpressionClosing" : 1, + "ForStatementClosingBrace" : 1, + "ForStatementOpeningBrace" : 1, + "ForStatementSemicolon" : 1, + "FunctionReservedWord": 0, + "FunctionName" : 0, + "FunctionExpressionOpeningBrace" : 1, + "FunctionExpressionClosingBrace" : 0, + "FunctionDeclarationOpeningBrace" : 0, + "FunctionDeclarationClosingBrace" : 0, + "IfStatementConditionalOpening" : 0, + "IfStatementConditionalClosing" : 1, + "IfStatementOpeningBrace" : 1, + "IfStatementClosingBrace" : 1, + "ElseStatementOpeningBrace" : 1, + "ElseStatementClosingBrace" : 1, + "ElseIfStatementOpeningBrace" : 1, + "ElseIfStatementClosingBrace" : 1, + "MemberExpressionOpening" : 0, + "LogicalExpressionOperator" : 1, + "ObjectExpressionClosingBrace": 0, + "PropertyName" : 0, + "PropertyValue" : 0, + "ParameterComma" : 1, + "ParameterList" : 0, + "SwitchDiscriminantOpening" : 0, + "SwitchDiscriminantClosing" : 1, + "ThrowKeyword": 1, + "TryKeyword": -1, + "TryOpeningBrace" : 1, + "TryClosingBrace" : 1, + "UnaryExpressionOperator": 0, + "VariableName" : 1, + "WhileStatementConditionalOpening" : 0, + "WhileStatementConditionalClosing" : 1, + "WhileStatementOpeningBrace" : 1, + "WhileStatementClosingBrace" : 1 + } + } +} diff --git a/resources/app/node_modules/electron-squirrel-startup/.travis.yml b/resources/app/node_modules/electron-squirrel-startup/.travis.yml new file mode 100644 index 0000000..d706d87 --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/.travis.yml @@ -0,0 +1,8 @@ +sudo: false +language: node_js +node_js: + - 5 +script: npm run ci +cache: + directories: + - node_modules diff --git a/resources/app/node_modules/electron-squirrel-startup/LICENSE b/resources/app/node_modules/electron-squirrel-startup/LICENSE new file mode 100644 index 0000000..5e0fd33 --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/LICENSE @@ -0,0 +1,201 @@ +Apache License +Version 2.0, January 2004 +http://www.apache.org/licenses/ + +TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + +1. Definitions. + +"License" shall mean the terms and conditions for use, reproduction, +and distribution as defined by Sections 1 through 9 of this document. + +"Licensor" shall mean the copyright owner or entity authorized by +the copyright owner that is granting the License. + +"Legal Entity" shall mean the union of the acting entity and all +other entities that control, are controlled by, or are under common +control with that entity. For the purposes of this definition, +"control" means (i) the power, direct or indirect, to cause the +direction or management of such entity, whether by contract or +otherwise, or (ii) ownership of fifty percent (50%) or more of the +outstanding shares, or (iii) beneficial ownership of such entity. + +"You" (or "Your") shall mean an individual or Legal Entity +exercising permissions granted by this License. + +"Source" form shall mean the preferred form for making modifications, +including but not limited to software source code, documentation +source, and configuration files. + +"Object" form shall mean any form resulting from mechanical +transformation or translation of a Source form, including but +not limited to compiled object code, generated documentation, +and conversions to other media types. + +"Work" shall mean the work of authorship, whether in Source or +Object form, made available under the License, as indicated by a +copyright notice that is included in or attached to the work +(an example is provided in the Appendix below). + +"Derivative Works" shall mean any work, whether in Source or Object +form, that is based on (or derived from) the Work and for which the +editorial revisions, annotations, elaborations, or other modifications +represent, as a whole, an original work of authorship. For the purposes +of this License, Derivative Works shall not include works that remain +separable from, or merely link (or bind by name) to the interfaces of, +the Work and Derivative Works thereof. + +"Contribution" shall mean any work of authorship, including +the original version of the Work and any modifications or additions +to that Work or Derivative Works thereof, that is intentionally +submitted to Licensor for inclusion in the Work by the copyright owner +or by an individual or Legal Entity authorized to submit on behalf of +the copyright owner. For the purposes of this definition, "submitted" +means any form of electronic, verbal, or written communication sent +to the Licensor or its representatives, including but not limited to +communication on electronic mailing lists, source code control systems, +and issue tracking systems that are managed by, or on behalf of, the +Licensor for the purpose of discussing and improving the Work, but +excluding communication that is conspicuously marked or otherwise +designated in writing by the copyright owner as "Not a Contribution." + +"Contributor" shall mean Licensor and any individual or Legal Entity +on behalf of whom a Contribution has been received by Licensor and +subsequently incorporated within the Work. + +2. Grant of Copyright License. Subject to the terms and conditions of +this License, each Contributor hereby grants to You a perpetual, +worldwide, non-exclusive, no-charge, royalty-free, irrevocable +copyright license to reproduce, prepare Derivative Works of, +publicly display, publicly perform, sublicense, and distribute the +Work and such Derivative Works in Source or Object form. + +3. Grant of Patent License. Subject to the terms and conditions of +this License, each Contributor hereby grants to You a perpetual, +worldwide, non-exclusive, no-charge, royalty-free, irrevocable +(except as stated in this section) patent license to make, have made, +use, offer to sell, sell, import, and otherwise transfer the Work, +where such license applies only to those patent claims licensable +by such Contributor that are necessarily infringed by their +Contribution(s) alone or by combination of their Contribution(s) +with the Work to which such Contribution(s) was submitted. If You +institute patent litigation against any entity (including a +cross-claim or counterclaim in a lawsuit) alleging that the Work +or a Contribution incorporated within the Work constitutes direct +or contributory patent infringement, then any patent licenses +granted to You under this License for that Work shall terminate +as of the date such litigation is filed. + +4. Redistribution. You may reproduce and distribute copies of the +Work or Derivative Works thereof in any medium, with or without +modifications, and in Source or Object form, provided that You +meet the following conditions: + +(a) You must give any other recipients of the Work or +Derivative Works a copy of this License; and + +(b) You must cause any modified files to carry prominent notices +stating that You changed the files; and + +(c) You must retain, in the Source form of any Derivative Works +that You distribute, all copyright, patent, trademark, and +attribution notices from the Source form of the Work, +excluding those notices that do not pertain to any part of +the Derivative Works; and + +(d) If the Work includes a "NOTICE" text file as part of its +distribution, then any Derivative Works that You distribute must +include a readable copy of the attribution notices contained +within such NOTICE file, excluding those notices that do not +pertain to any part of the Derivative Works, in at least one +of the following places: within a NOTICE text file distributed +as part of the Derivative Works; within the Source form or +documentation, if provided along with the Derivative Works; or, +within a display generated by the Derivative Works, if and +wherever such third-party notices normally appear. The contents +of the NOTICE file are for informational purposes only and +do not modify the License. You may add Your own attribution +notices within Derivative Works that You distribute, alongside +or as an addendum to the NOTICE text from the Work, provided +that such additional attribution notices cannot be construed +as modifying the License. + +You may add Your own copyright statement to Your modifications and +may provide additional or different license terms and conditions +for use, reproduction, or distribution of Your modifications, or +for any such Derivative Works as a whole, provided Your use, +reproduction, and distribution of the Work otherwise complies with +the conditions stated in this License. + +5. Submission of Contributions. Unless You explicitly state otherwise, +any Contribution intentionally submitted for inclusion in the Work +by You to the Licensor shall be under the terms and conditions of +this License, without any additional terms or conditions. +Notwithstanding the above, nothing herein shall supersede or modify +the terms of any separate license agreement you may have executed +with Licensor regarding such Contributions. + +6. Trademarks. This License does not grant permission to use the trade +names, trademarks, service marks, or product names of the Licensor, +except as required for reasonable and customary use in describing the +origin of the Work and reproducing the content of the NOTICE file. + +7. Disclaimer of Warranty. Unless required by applicable law or +agreed to in writing, Licensor provides the Work (and each +Contributor provides its Contributions) on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or +implied, including, without limitation, any warranties or conditions +of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A +PARTICULAR PURPOSE. You are solely responsible for determining the +appropriateness of using or redistributing the Work and assume any +risks associated with Your exercise of permissions under this License. + +8. Limitation of Liability. In no event and under no legal theory, +whether in tort (including negligence), contract, or otherwise, +unless required by applicable law (such as deliberate and grossly +negligent acts) or agreed to in writing, shall any Contributor be +liable to You for damages, including any direct, indirect, special, +incidental, or consequential damages of any character arising as a +result of this License or out of the use or inability to use the +Work (including but not limited to damages for loss of goodwill, +work stoppage, computer failure or malfunction, or any and all +other commercial damages or losses), even if such Contributor +has been advised of the possibility of such damages. + +9. Accepting Warranty or Additional Liability. While redistributing +the Work or Derivative Works thereof, You may choose to offer, +and charge a fee for, acceptance of support, warranty, indemnity, +or other liability obligations and/or rights consistent with this +License. However, in accepting such obligations, You may act only +on Your own behalf and on Your sole responsibility, not on behalf +of any other Contributor, and only if You agree to indemnify, +defend, and hold each Contributor harmless for any liability +incurred by, or claims asserted against, such Contributor by reason +of your accepting any such warranty or additional liability. + +END OF TERMS AND CONDITIONS + +APPENDIX: How to apply the Apache License to your work. + +To apply the Apache License to your work, attach the following +boilerplate notice, with the fields enclosed by brackets "{}" +replaced with your own identifying information. (Don't include +the brackets!) The text should be enclosed in the appropriate +comment syntax for the file format. We also recommend that a +file or class name and description of purpose be included on the +same "printed page" as the copyright notice for easier +identification within third-party archives. + +Copyright {yyyy} {name of copyright owner} + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + +http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. diff --git a/resources/app/node_modules/electron-squirrel-startup/README.md b/resources/app/node_modules/electron-squirrel-startup/README.md new file mode 100644 index 0000000..54dcfc5 --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/README.md @@ -0,0 +1,32 @@ +# electron-squirrel-startup + +> Default [Squirrel.Windows][squirrel] event handler for your [Electron][electron] apps. + +## Installation + +``` +npm i electron-squirrel-startup +``` + +## Usage + +To handle the most common commands, such as managing desktop shortcuts, just +add the following to the top of your `main.js` and you're good to go: + +```js +if(require('electron-squirrel-startup')) return; +``` + +## Read More + +### [Handling Squirrel Events][squirrel-events] +### [Squirrel.Windows Commands][squirrel-commands] + +## License + +Apache 2.0 + +[squirrel]: https://github.com/Squirrel/Squirrel.Windows +[electron]: https://github.com/atom/electron +[squirrel-commands]: https://github.com/Squirrel/Squirrel.Windows/blob/master/src/Update/Program.cs#L98 +[squirrel-events]: https://github.com/atom/grunt-electron-installer#handling-squirrel-events diff --git a/resources/app/node_modules/electron-squirrel-startup/appveyor.yml b/resources/app/node_modules/electron-squirrel-startup/appveyor.yml new file mode 100644 index 0000000..00047f8 --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/appveyor.yml @@ -0,0 +1,17 @@ +init: + - git config --global core.autocrlf input + +environment: + matrix: + - nodejs_version: 0.12 + +install: + - ps: Update-NodeJsInstallation (Get-NodeJsLatestBuild $env:nodejs_version) + - npm install + +build: off + +test_script: + - node --version + - npm --version + - ps: npm run ci diff --git a/resources/app/node_modules/electron-squirrel-startup/index.js b/resources/app/node_modules/electron-squirrel-startup/index.js new file mode 100644 index 0000000..46a76fc --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/index.js @@ -0,0 +1,36 @@ +var path = require('path'); +var spawn = require('child_process').spawn; +var debug = require('debug')('electron-squirrel-startup'); +var app = require('electron').app; + +var run = function(args, done) { + var updateExe = path.resolve(path.dirname(process.execPath), '..', 'Update.exe'); + debug('Spawning `%s` with args `%s`', updateExe, args); + spawn(updateExe, args, { + detached: true + }).on('close', done); +}; + +var check = function() { + if (process.platform === 'win32') { + var cmd = process.argv[1]; + debug('processing squirrel command `%s`', cmd); + var target = path.basename(process.execPath); + + if (cmd === '--squirrel-install' || cmd === '--squirrel-updated') { + run(['--createShortcut=' + target + ''], app.quit); + return true; + } + if (cmd === '--squirrel-uninstall') { + run(['--removeShortcut=' + target + ''], app.quit); + return true; + } + if (cmd === '--squirrel-obsolete') { + app.quit(); + return true; + } + } + return false; +}; + +module.exports = check(); diff --git a/resources/app/node_modules/electron-squirrel-startup/package.json b/resources/app/node_modules/electron-squirrel-startup/package.json new file mode 100644 index 0000000..535b8cb --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/package.json @@ -0,0 +1,71 @@ +{ + "_from": "electron-squirrel-startup@^1.0.0", + "_id": "[email protected]", + "_inBundle": false, + "_integrity": "sha1-GbTlWTP6Dvj1VnhLnGYPdyVGoLg=", + "_location": "/electron-squirrel-startup", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "electron-squirrel-startup@^1.0.0", + "name": "electron-squirrel-startup", + "escapedName": "electron-squirrel-startup", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/" + ], + "_resolved": "https://registry.npmjs.org/electron-squirrel-startup/-/electron-squirrel-startup-1.0.0.tgz", + "_shasum": "19b4e55933fa0ef8f556784b9c660f772546a0b8", + "_spec": "electron-squirrel-startup@^1.0.0", + "author": { + "name": "Lucas Hrabovsky", + "email": "[email protected]", + "url": "http://imlucas.com" + }, + "bugs": { + "url": "https://github.com/mongodb-js/electron-squirrel-startup/issues" + }, + "bundleDependencies": false, + "dependencies": { + "debug": "^2.2.0" + }, + "dependency-check": { + "ignore": [ + "app" + ] + }, + "deprecated": false, + "description": "Default Squirrel.Windows event handler for your Electron apps.", + "devDependencies": { + "eslint-config-mongodb-js": "^0.1.4", + "mocha": "^2.2.5", + "mongodb-js-precommit": "^0.1.2", + "pre-commit": "^1.0.10" + }, + "homepage": "http://github.com/mongodb-js/electron-squirrel-startup", + "keywords": [ + "mongodb.js", + "electron", + "electron-installer", + "squirrel.windows" + ], + "license": "Apache-2.0", + "name": "electron-squirrel-startup", + "precommit": [ + "check" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/mongodb-js/electron-squirrel-startup.git" + }, + "scripts": { + "check": "mongodb-js-precommit", + "ci": "mocha", + "test": "mocha" + }, + "version": "1.0.0" +} diff --git a/resources/app/node_modules/electron-squirrel-startup/test/index.test.js b/resources/app/node_modules/electron-squirrel-startup/test/index.test.js new file mode 100644 index 0000000..2896d14 --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/test/index.test.js @@ -0,0 +1,9 @@ +var assert = require('assert'); +var startup = require('../'); +var proxyquire = require('proxyquire'); + +describe('electron-squirrel-startup', function() { + it('should return false by default', function() { + assert.equal(startup, false); + }); +}); diff --git a/resources/app/node_modules/electron-squirrel-startup/test/mocha.opts b/resources/app/node_modules/electron-squirrel-startup/test/mocha.opts new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/resources/app/node_modules/electron-squirrel-startup/test/mocha.opts diff --git a/resources/app/node_modules/electron-window-state/index.js b/resources/app/node_modules/electron-window-state/index.js new file mode 100644 index 0000000..ea17e2e --- /dev/null +++ b/resources/app/node_modules/electron-window-state/index.js @@ -0,0 +1,174 @@ +'use strict'; + +var path = require('path'); +var electron = require('electron'); +var jsonfile = require('jsonfile'); +var mkdirp = require('mkdirp'); +var deepEqual = require('deep-equal'); + +module.exports = function (options) { + var app = electron.app || electron.remote.app; + var screen = electron.screen || electron.remote.screen; + var state; + var winRef; + var stateChangeTimer; + var eventHandlingDelay = 100; + var config = Object.assign({ + file: 'window-state.json', + path: app.getPath('userData'), + maximize: true, + fullScreen: true + }, options); + var fullStoreFileName = path.join(config.path, config.file); + + function isNormal(win) { + return !win.isMaximized() && !win.isMinimized() && !win.isFullScreen(); + } + + function hasBounds() { + return state && + Number.isInteger(state.x) && + Number.isInteger(state.y) && + Number.isInteger(state.width) && state.width > 0 && + Number.isInteger(state.height) && state.height > 0; + } + + function validateState() { + var isValid = state && (hasBounds() || state.isMaximized || state.isFullScreen); + if (!isValid) { + state = null; + return; + } + + if (hasBounds() && state.displayBounds) { + // Check if the display where the window was last open is still available + var displayBounds = screen.getDisplayMatching(state).bounds; + var sameBounds = deepEqual(state.displayBounds, displayBounds, {strict: true}); + if (!sameBounds) { + if (displayBounds.width < state.displayBounds.width) { + if (state.x > displayBounds.width) { + state.x = 0; + } + + if (state.width > displayBounds.width) { + state.width = displayBounds.width; + } + } + + if (displayBounds.height < state.displayBounds.height) { + if (state.y > displayBounds.height) { + state.y = 0; + } + + if (state.height > displayBounds.height) { + state.height = displayBounds.height; + } + } + } + } + } + + function updateState(win) { + win = win || winRef; + if (!win) { + return; + } + // don't throw an error when window was closed + try { + var winBounds = win.getBounds(); + if (isNormal(win)) { + state.x = winBounds.x; + state.y = winBounds.y; + state.width = winBounds.width; + state.height = winBounds.height; + } + state.isMaximized = win.isMaximized(); + state.isFullScreen = win.isFullScreen(); + state.displayBounds = screen.getDisplayMatching(winBounds).bounds; + } catch (err) {} + } + + function saveState(win) { + // Update window state only if it was provided + if (win) { + updateState(win); + } + + // Save state + try { + mkdirp.sync(path.dirname(fullStoreFileName)); + jsonfile.writeFileSync(fullStoreFileName, state); + } catch (err) { + // Don't care + } + } + + function stateChangeHandler() { + // Handles both 'resize' and 'move' + clearTimeout(stateChangeTimer); + stateChangeTimer = setTimeout(updateState, eventHandlingDelay); + } + + function closeHandler() { + updateState(); + } + + function closedHandler() { + // Unregister listeners and save state + unmanage(); + saveState(); + } + + function manage(win) { + if (config.maximize && state.isMaximized) { + win.maximize(); + } + if (config.fullScreen && state.isFullScreen) { + win.setFullScreen(true); + } + win.on('resize', stateChangeHandler); + win.on('move', stateChangeHandler); + win.on('close', closeHandler); + win.on('closed', closedHandler); + winRef = win; + } + + function unmanage() { + if (winRef) { + winRef.removeListener('resize', stateChangeHandler); + winRef.removeListener('move', stateChangeHandler); + clearTimeout(stateChangeTimer); + winRef.removeListener('close', closeHandler); + winRef.removeListener('closed', closedHandler); + winRef = null; + } + } + + // Load previous state + try { + state = jsonfile.readFileSync(fullStoreFileName); + } catch (err) { + // Don't care + } + + // Check state validity + validateState(); + + // Set state fallback values + state = Object.assign({ + width: config.defaultWidth || 800, + height: config.defaultHeight || 600 + }, state); + + return { + get x() { return state.x; }, + get y() { return state.y; }, + get width() { return state.width; }, + get height() { return state.height; }, + get isMaximized() { return state.isMaximized; }, + get isFullScreen() { return state.isFullScreen; }, + saveState: saveState, + unmanage: unmanage, + manage: manage + }; +}; diff --git a/resources/app/node_modules/electron-window-state/license b/resources/app/node_modules/electron-window-state/license new file mode 100644 index 0000000..8078dfa --- /dev/null +++ b/resources/app/node_modules/electron-window-state/license @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2015 Jakub Szwacz +Copyright (c) Marcel Wiehle <[email protected]> (http://marcel.wiehle.me) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/electron-window-state/readme.md b/resources/app/node_modules/electron-window-state/readme.md new file mode 100644 index 0000000..f2c905f --- /dev/null +++ b/resources/app/node_modules/electron-window-state/readme.md @@ -0,0 +1,136 @@ +# electron-window-state [](https://travis-ci.org/mawie81/electron-window-state) + +> A library to store and restore window sizes and positions for your +[Electron](http://electron.atom.io) app + +*Heavily influenced by the implementation in [electron-boilerplate](https://github.com/szwacz/electron-boilerplate).* + +## Install + +``` +$ npm install --save electron-window-state +``` + +## Usage + +```js +const windowStateKeeper = require('electron-window-state'); +let win; + +app.on('ready', function () { + // Load the previous state with fallback to defaults + let mainWindowState = windowStateKeeper({ + defaultWidth: 1000, + defaultHeight: 800 + }); + + // Create the window using the state information + win = new BrowserWindow({ + 'x': mainWindowState.x, + 'y': mainWindowState.y, + 'width': mainWindowState.width, + 'height': mainWindowState.height + }); + + // Let us register listeners on the window, so we can update the state + // automatically (the listeners will be removed when the window is closed) + // and restore the maximized or full screen state + mainWindowState.manage(win); +}); +``` + +## API + +#### windowStateKeeper(opts) + +Note: Don't call this function before the `ready` event is fired. + +##### opts + +`defaultWidth` - *Number* + + The width that should be returned if no file exists yet. Defaults to `800`. + +`defaultHeight` - *Number* + + The height that should be returned if no file exists yet. Defaults to `600`. + +`path` - *String* + + The path where the state file should be written to. Defaults to + `app.getPath('userData')` + +`file` - *String* + + The name of file. Defaults to `window-state.json` + +`maximize` - *Boolean* + + Should we automatically maximize the window, if it was last closed + maximized. Defaults to `true` + +`fullScreen` - *Boolean* + + Should we automatically restore the window to full screen, if it was last + closed full screen. Defaults to `true` + +### state object + +```js +const windowState = windowStateKeeper({ + defaultWidth: 1000, + defaultHeight: 800 +}); +``` + +`x` - *Number* + + The saved `x` coordinate of the loaded state. `undefined` if the state has not + been saved yet. + +`y` - *Number* + + The saved `y` coordinate of the loaded state. `undefined` if the state has not + been saved yet. + +`width` - *Number* + + The saved `width` of loaded state. `defaultWidth` if the state has not been + saved yet. + +`height` - *Number* + + The saved `heigth` of loaded state. `defaultHeight` if the state has not been + saved yet. + +`isMaximized` - *Boolean* + + `true` if the window state was saved while the the window was maximized. + `undefined` if the state has not been saved yet. + +`isFullScreen` - *Boolean* + + `true` if the window state was saved while the the window was in full screen + mode. `undefined` if the state has not been saved yet. + +`manage(window)` - *Function* + + Register listeners on the given `BrowserWindow` for events that are + related to size or position changes (`resize`, `move`). It will also restore + the window's maximized or full screen state. + When the window is closed we automatically remove the listeners and save the + state. + +`unmanage` - *Function* + + Removes all listeners of the managed `BrowserWindow` in case it does not + need to be managed anymore. + +`saveState(window)` - *Function* + + Saves the current state of the given `BrowserWindow`. This exists mostly for + legacy purposes, and in most cases it's better to just use `manage`. + +## License + +MIT © [Marcel Wiehle](http://marcel.wiehle.me) diff --git a/resources/app/node_modules/ext-list/index.js b/resources/app/node_modules/ext-list/index.js new file mode 100644 index 0000000..ebee2ce --- /dev/null +++ b/resources/app/node_modules/ext-list/index.js @@ -0,0 +1,18 @@ +'use strict'; +var mimeDb = require('mime-db'); + +module.exports = function () { + var ret = {}; + + Object.keys(mimeDb).forEach(function (x) { + var val = mimeDb[x]; + + if (val.extensions && val.extensions.length > 0) { + val.extensions.forEach(function (y) { + ret[y] = x; + }); + } + }); + + return ret; +}; diff --git a/resources/app/node_modules/ext-list/license b/resources/app/node_modules/ext-list/license new file mode 100644 index 0000000..a8ecbbe --- /dev/null +++ b/resources/app/node_modules/ext-list/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Kevin Mårtensson <[email protected]> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/ext-list/readme.md b/resources/app/node_modules/ext-list/readme.md new file mode 100644 index 0000000..893064d --- /dev/null +++ b/resources/app/node_modules/ext-list/readme.md @@ -0,0 +1,25 @@ +# ext-list [](https://travis-ci.org/kevva/ext-list) + +> Return a list of known [file extensions](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types) and their MIME types + + +## Install + +``` +$ npm install --save ext-list +``` + + +## Usage + +```js +const extList = require('ext-list'); + +extList(); +//=> {'123': 'application/vnd.lotus-1-2-3', ez: 'application/andrew-inset', aw: 'application/applixware', ...} +``` + + +## License + +MIT © [Kevin Mårtensson](https://github.com/kevva) diff --git a/resources/app/node_modules/ext-name/index.js b/resources/app/node_modules/ext-name/index.js new file mode 100644 index 0000000..59ac1f6 --- /dev/null +++ b/resources/app/node_modules/ext-name/index.js @@ -0,0 +1,31 @@ +'use strict'; +const extList = require('ext-list'); +const sortKeysLength = require('sort-keys-length'); + +module.exports = str => { + const obj = sortKeysLength.desc(extList()); + const exts = Object.keys(obj).filter(x => str.endsWith(x)); + + if (exts.length === 0) { + return []; + } + + return exts.map(x => ({ + ext: x, + mime: obj[x] + })); +}; + +module.exports.mime = str => { + const obj = sortKeysLength.desc(extList()); + const exts = Object.keys(obj).filter(x => obj[x] === str); + + if (exts.length === 0) { + return []; + } + + return exts.map(x => ({ + ext: x, + mime: obj[x] + })); +}; diff --git a/resources/app/node_modules/ext-name/license b/resources/app/node_modules/ext-name/license new file mode 100644 index 0000000..a8ecbbe --- /dev/null +++ b/resources/app/node_modules/ext-name/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Kevin Mårtensson <[email protected]> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/ext-name/readme.md b/resources/app/node_modules/ext-name/readme.md new file mode 100644 index 0000000..8df382b --- /dev/null +++ b/resources/app/node_modules/ext-name/readme.md @@ -0,0 +1,57 @@ +# ext-name [](https://travis-ci.org/kevva/ext-name) + +> Get the file extension and MIME type from a file + + +## Install + +``` +$ npm install --save ext-name +``` + + +## Usage + +```js +const extName = require('ext-name'); + +console.log(extName('foobar.tar')); +//=> [{ext: 'tar', mime: 'application/x-tar'}] + +console.log(extName.mime('application/x-tar')); +//=> [{ext: 'tar', mime: 'application/x-tar'}] +``` + + +## API + +### extName(filename) + +Returns an `Array` with objects with the file extension and MIME type. + +#### filename + +Type: `string` + +Get the extension and MIME type from a filename. + +### extName.mime(mimetype) + +Returns an `Array` with objects with the file extension and MIME type. + +#### mimetype + +Type: `string` + +Get the extension and MIME type from a MIME type. + + +## Related + +* [ext-name-cli](https://github.com/kevva/ext-name-cli) - CLI for this module +* [file-type](https://github.com/sindresorhus/file-type) - Detect the file type of a Buffer/Uint8Array + + +## License + +MIT © [Kevin Mårtensson](https://github.com/kevva) diff --git a/resources/app/node_modules/graceful-fs/LICENSE b/resources/app/node_modules/graceful-fs/LICENSE new file mode 100644 index 0000000..9d2c803 --- /dev/null +++ b/resources/app/node_modules/graceful-fs/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter, Ben Noordhuis, and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/resources/app/node_modules/graceful-fs/README.md b/resources/app/node_modules/graceful-fs/README.md new file mode 100644 index 0000000..5273a50 --- /dev/null +++ b/resources/app/node_modules/graceful-fs/README.md @@ -0,0 +1,133 @@ +# graceful-fs + +graceful-fs functions as a drop-in replacement for the fs module, +making various improvements. + +The improvements are meant to normalize behavior across different +platforms and environments, and to make filesystem access more +resilient to errors. + +## Improvements over [fs module](https://nodejs.org/api/fs.html) + +* Queues up `open` and `readdir` calls, and retries them once + something closes if there is an EMFILE error from too many file + descriptors. +* fixes `lchmod` for Node versions prior to 0.6.2. +* implements `fs.lutimes` if possible. Otherwise it becomes a noop. +* ignores `EINVAL` and `EPERM` errors in `chown`, `fchown` or + `lchown` if the user isn't root. +* makes `lchmod` and `lchown` become noops, if not available. +* retries reading a file if `read` results in EAGAIN error. + +On Windows, it retries renaming a file for up to one second if `EACCESS` +or `EPERM` error occurs, likely because antivirus software has locked +the directory. + +## USAGE + +```javascript +// use just like fs +var fs = require('graceful-fs') + +// now go and do stuff with it... +fs.readFileSync('some-file-or-whatever') +``` + +## Global Patching + +If you want to patch the global fs module (or any other fs-like +module) you can do this: + +```javascript +// Make sure to read the caveat below. +var realFs = require('fs') +var gracefulFs = require('graceful-fs') +gracefulFs.gracefulify(realFs) +``` + +This should only ever be done at the top-level application layer, in +order to delay on EMFILE errors from any fs-using dependencies. You +should **not** do this in a library, because it can cause unexpected +delays in other parts of the program. + +## Changes + +This module is fairly stable at this point, and used by a lot of +things. That being said, because it implements a subtle behavior +change in a core part of the node API, even modest changes can be +extremely breaking, and the versioning is thus biased towards +bumping the major when in doubt. + +The main change between major versions has been switching between +providing a fully-patched `fs` module vs monkey-patching the node core +builtin, and the approach by which a non-monkey-patched `fs` was +created. + +The goal is to trade `EMFILE` errors for slower fs operations. So, if +you try to open a zillion files, rather than crashing, `open` +operations will be queued up and wait for something else to `close`. + +There are advantages to each approach. Monkey-patching the fs means +that no `EMFILE` errors can possibly occur anywhere in your +application, because everything is using the same core `fs` module, +which is patched. However, it can also obviously cause undesirable +side-effects, especially if the module is loaded multiple times. + +Implementing a separate-but-identical patched `fs` module is more +surgical (and doesn't run the risk of patching multiple times), but +also imposes the challenge of keeping in sync with the core module. + +The current approach loads the `fs` module, and then creates a +lookalike object that has all the same methods, except a few that are +patched. It is safe to use in all versions of Node from 0.8 through +7.0. + +### v4 + +* Do not monkey-patch the fs module. This module may now be used as a + drop-in dep, and users can opt into monkey-patching the fs builtin + if their app requires it. + +### v3 + +* Monkey-patch fs, because the eval approach no longer works on recent + node. +* fixed possible type-error throw if rename fails on windows +* verify that we *never* get EMFILE errors +* Ignore ENOSYS from chmod/chown +* clarify that graceful-fs must be used as a drop-in + +### v2.1.0 + +* Use eval rather than monkey-patching fs. +* readdir: Always sort the results +* win32: requeue a file if error has an OK status + +### v2.0 + +* A return to monkey patching +* wrap process.cwd + +### v1.1 + +* wrap readFile +* Wrap fs.writeFile. +* readdir protection +* Don't clobber the fs builtin +* Handle fs.read EAGAIN errors by trying again +* Expose the curOpen counter +* No-op lchown/lchmod if not implemented +* fs.rename patch only for win32 +* Patch fs.rename to handle AV software on Windows +* Close #4 Chown should not fail on einval or eperm if non-root +* Fix isaacs/fstream#1 Only wrap fs one time +* Fix #3 Start at 1024 max files, then back off on EMFILE +* lutimes that doens't blow up on Linux +* A full on-rewrite using a queue instead of just swallowing the EMFILE error +* Wrap Read/Write streams as well + +### 1.0 + +* Update engines for node 0.6 +* Be lstat-graceful on Windows +* first diff --git a/resources/app/node_modules/graceful-fs/clone.js b/resources/app/node_modules/graceful-fs/clone.js new file mode 100644 index 0000000..028356c --- /dev/null +++ b/resources/app/node_modules/graceful-fs/clone.js @@ -0,0 +1,19 @@ +'use strict' + +module.exports = clone + +function clone (obj) { + if (obj === null || typeof obj !== 'object') + return obj + + if (obj instanceof Object) + var copy = { __proto__: obj.__proto__ } + else + var copy = Object.create(null) + + Object.getOwnPropertyNames(obj).forEach(function (key) { + Object.defineProperty(copy, key, Object.getOwnPropertyDescriptor(obj, key)) + }) + + return copy +} diff --git a/resources/app/node_modules/graceful-fs/graceful-fs.js b/resources/app/node_modules/graceful-fs/graceful-fs.js new file mode 100644 index 0000000..ac20675 --- /dev/null +++ b/resources/app/node_modules/graceful-fs/graceful-fs.js @@ -0,0 +1,279 @@ +var fs = require('fs') +var polyfills = require('./polyfills.js') +var legacy = require('./legacy-streams.js') +var clone = require('./clone.js') + +var queue = [] + +var util = require('util') + +function noop () {} + +var debug = noop +if (util.debuglog) + debug = util.debuglog('gfs4') +else if (/\bgfs4\b/i.test(process.env.NODE_DEBUG || '')) + debug = function() { + var m = util.format.apply(util, arguments) + m = 'GFS4: ' + m.split(/\n/).join('\nGFS4: ') + console.error(m) + } + +if (/\bgfs4\b/i.test(process.env.NODE_DEBUG || '')) { + process.on('exit', function() { + debug(queue) + require('assert').equal(queue.length, 0) + }) +} + +module.exports = patch(clone(fs)) +if (process.env.TEST_GRACEFUL_FS_GLOBAL_PATCH && !fs.__patched) { + module.exports = patch(fs) + fs.__patched = true; +} + +// Always patch fs.close/closeSync, because we want to +// retry() whenever a close happens *anywhere* in the program. +// This is essential when multiple graceful-fs instances are +// in play at the same time. +module.exports.close = (function (fs$close) { return function (fd, cb) { + return fs$close.call(fs, fd, function (err) { + if (!err) + retry() + + if (typeof cb === 'function') + cb.apply(this, arguments) + }) +}})(fs.close) + +module.exports.closeSync = (function (fs$closeSync) { return function (fd) { + // Note that graceful-fs also retries when fs.closeSync() fails. + // Looks like a bug to me, although it's probably a harmless one. + var rval = fs$closeSync.apply(fs, arguments) + retry() + return rval +}})(fs.closeSync) + +// Only patch fs once, otherwise we'll run into a memory leak if +// graceful-fs is loaded multiple times, such as in test environments that +// reset the loaded modules between tests. +// We look for the string `graceful-fs` from the comment above. This +// way we are not adding any extra properties and it will detect if older +// versions of graceful-fs are installed. +if (!/\bgraceful-fs\b/.test(fs.closeSync.toString())) { + fs.closeSync = module.exports.closeSync; + fs.close = module.exports.close; +} + +function patch (fs) { + // Everything that references the open() function needs to be in here + polyfills(fs) + fs.gracefulify = patch + fs.FileReadStream = ReadStream; // Legacy name. + fs.FileWriteStream = WriteStream; // Legacy name. + fs.createReadStream = createReadStream + fs.createWriteStream = createWriteStream + var fs$readFile = fs.readFile + fs.readFile = readFile + function readFile (path, options, cb) { + if (typeof options === 'function') + cb = options, options = null + + return go$readFile(path, options, cb) + + function go$readFile (path, options, cb) { + return fs$readFile(path, options, function (err) { + if (err && (err.code === 'EMFILE' || err.code === 'ENFILE')) + enqueue([go$readFile, [path, options, cb]]) + else { + if (typeof cb === 'function') + cb.apply(this, arguments) + retry() + } + }) + } + } + + var fs$writeFile = fs.writeFile + fs.writeFile = writeFile + function writeFile (path, data, options, cb) { + if (typeof options === 'function') + cb = options, options = null + + return go$writeFile(path, data, options, cb) + + function go$writeFile (path, data, options, cb) { + return fs$writeFile(path, data, options, function (err) { + if (err && (err.code === 'EMFILE' || err.code === 'ENFILE')) + enqueue([go$writeFile, [path, data, options, cb]]) + else { + if (typeof cb === 'function') + cb.apply(this, arguments) + retry() + } + }) + } + } + + var fs$appendFile = fs.appendFile + if (fs$appendFile) + fs.appendFile = appendFile + function appendFile (path, data, options, cb) { + if (typeof options === 'function') + cb = options, options = null + + return go$appendFile(path, data, options, cb) + + function go$appendFile (path, data, options, cb) { + return fs$appendFile(path, data, options, function (err) { + if (err && (err.code === 'EMFILE' || err.code === 'ENFILE')) + enqueue([go$appendFile, [path, data, options, cb]]) + else { + if (typeof cb === 'function') + cb.apply(this, arguments) + retry() + } + }) + } + } + + var fs$readdir = fs.readdir + fs.readdir = readdir + function readdir (path, options, cb) { + var args = [path] + if (typeof options !== 'function') { + args.push(options) + } else { + cb = options + } + args.push(go$readdir$cb) + + return go$readdir(args) + + function go$readdir$cb (err, files) { + if (files && files.sort) + files.sort() + + if (err && (err.code === 'EMFILE' || err.code === 'ENFILE')) + enqueue([go$readdir, [args]]) + + else { + if (typeof cb === 'function') + cb.apply(this, arguments) + retry() + } + } + } + + function go$readdir (args) { + return fs$readdir.apply(fs, args) + } + + if (process.version.substr(0, 4) === 'v0.8') { + var legStreams = legacy(fs) + ReadStream = legStreams.ReadStream + WriteStream = legStreams.WriteStream + } + + var fs$ReadStream = fs.ReadStream + if (fs$ReadStream) { + ReadStream.prototype = Object.create(fs$ReadStream.prototype) + ReadStream.prototype.open = ReadStream$open + } + + var fs$WriteStream = fs.WriteStream + if (fs$WriteStream) { + WriteStream.prototype = Object.create(fs$WriteStream.prototype) + WriteStream.prototype.open = WriteStream$open + } + + fs.ReadStream = ReadStream + fs.WriteStream = WriteStream + + function ReadStream (path, options) { + if (this instanceof ReadStream) + return fs$ReadStream.apply(this, arguments), this + else + return ReadStream.apply(Object.create(ReadStream.prototype), arguments) + } + + function ReadStream$open () { + var that = this + open(that.path, that.flags, that.mode, function (err, fd) { + if (err) { + if (that.autoClose) + that.destroy() + + that.emit('error', err) + } else { + that.fd = fd + that.emit('open', fd) + that.read() + } + }) + } + + function WriteStream (path, options) { + if (this instanceof WriteStream) + return fs$WriteStream.apply(this, arguments), this + else + return WriteStream.apply(Object.create(WriteStream.prototype), arguments) + } + + function WriteStream$open () { + var that = this + open(that.path, that.flags, that.mode, function (err, fd) { + if (err) { + that.destroy() + that.emit('error', err) + } else { + that.fd = fd + that.emit('open', fd) + } + }) + } + + function createReadStream (path, options) { + return new ReadStream(path, options) + } + + function createWriteStream (path, options) { + return new WriteStream(path, options) + } + + var fs$open = fs.open + fs.open = open + function open (path, flags, mode, cb) { + if (typeof mode === 'function') + cb = mode, mode = null + + return go$open(path, flags, mode, cb) + + function go$open (path, flags, mode, cb) { + return fs$open(path, flags, mode, function (err, fd) { + if (err && (err.code === 'EMFILE' || err.code === 'ENFILE')) + enqueue([go$open, [path, flags, mode, cb]]) + else { + if (typeof cb === 'function') + cb.apply(this, arguments) + retry() + } + }) + } + } + + return fs +} + +function enqueue (elem) { + debug('ENQUEUE', elem[0].name, elem[1]) + queue.push(elem) +} + +function retry () { + var elem = queue.shift() + if (elem) { + debug('RETRY', elem[0].name, elem[1]) + elem[0].apply(null, elem[1]) + } +} diff --git a/resources/app/node_modules/graceful-fs/legacy-streams.js b/resources/app/node_modules/graceful-fs/legacy-streams.js new file mode 100644 index 0000000..d617b50 --- /dev/null +++ b/resources/app/node_modules/graceful-fs/legacy-streams.js @@ -0,0 +1,118 @@ +var Stream = require('stream').Stream + +module.exports = legacy + +function legacy (fs) { + return { + ReadStream: ReadStream, + WriteStream: WriteStream + } + + function ReadStream (path, options) { + if (!(this instanceof ReadStream)) return new ReadStream(path, options); + + Stream.call(this); + + var self = this; + + this.path = path; + this.fd = null; + this.readable = true; + this.paused = false; + + this.flags = 'r'; + this.mode = 438; /*=0666*/ + this.bufferSize = 64 * 1024; + + options = options || {}; + + // Mixin options into this + var keys = Object.keys(options); + for (var index = 0, length = keys.length; index < length; index++) { + var key = keys[index]; + this[key] = options[key]; + } + + if (this.encoding) this.setEncoding(this.encoding); + + if (this.start !== undefined) { + if ('number' !== typeof this.start) { + throw TypeError('start must be a Number'); + } + if (this.end === undefined) { + this.end = Infinity; + } else if ('number' !== typeof this.end) { + throw TypeError('end must be a Number'); + } + + if (this.start > this.end) { + throw new Error('start must be <= end'); + } + + this.pos = this.start; + } + + if (this.fd !== null) { + process.nextTick(function() { + self._read(); + }); + return; + } + + fs.open(this.path, this.flags, this.mode, function (err, fd) { + if (err) { + self.emit('error', err); + self.readable = false; + return; + } + + self.fd = fd; + self.emit('open', fd); + self._read(); + }) + } + + function WriteStream (path, options) { + if (!(this instanceof WriteStream)) return new WriteStream(path, options); + + Stream.call(this); + + this.path = path; + this.fd = null; + this.writable = true; + + this.flags = 'w'; + this.encoding = 'binary'; + this.mode = 438; /*=0666*/ + this.bytesWritten = 0; + + options = options || {}; + + // Mixin options into this + var keys = Object.keys(options); + for (var index = 0, length = keys.length; index < length; index++) { + var key = keys[index]; + this[key] = options[key]; + } + + if (this.start !== undefined) { + if ('number' !== typeof this.start) { + throw TypeError('start must be a Number'); + } + if (this.start < 0) { + throw new Error('start must be >= zero'); + } + + this.pos = this.start; + } + + this.busy = false; + this._queue = []; + + if (this.fd === null) { + this._open = fs.open; + this._queue.push([this._open, this.path, this.flags, this.mode, undefined]); + this.flush(); + } + } +} diff --git a/resources/app/node_modules/graceful-fs/polyfills.js b/resources/app/node_modules/graceful-fs/polyfills.js new file mode 100644 index 0000000..b964ed0 --- /dev/null +++ b/resources/app/node_modules/graceful-fs/polyfills.js @@ -0,0 +1,329 @@ +var constants = require('constants') + +var origCwd = process.cwd +var cwd = null + +var platform = process.env.GRACEFUL_FS_PLATFORM || process.platform + +process.cwd = function() { + if (!cwd) + cwd = origCwd.call(process) + return cwd +} +try { + process.cwd() +} catch (er) {} + +var chdir = process.chdir +process.chdir = function(d) { + cwd = null + chdir.call(process, d) +} + +module.exports = patch + +function patch (fs) { + // (re-)implement some things that are known busted or missing. + + // lchmod, broken prior to 0.6.2 + // back-port the fix here. + if (constants.hasOwnProperty('O_SYMLINK') && + process.version.match(/^v0\.6\.[0-2]|^v0\.5\./)) { + patchLchmod(fs) + } + + // lutimes implementation, or no-op + if (!fs.lutimes) { + patchLutimes(fs) + } + + // https://github.com/isaacs/node-graceful-fs/issues/4 + // Chown should not fail on einval or eperm if non-root. + // It should not fail on enosys ever, as this just indicates + // that a fs doesn't support the intended operation. + + fs.chown = chownFix(fs.chown) + fs.fchown = chownFix(fs.fchown) + fs.lchown = chownFix(fs.lchown) + + fs.chmod = chmodFix(fs.chmod) + fs.fchmod = chmodFix(fs.fchmod) + fs.lchmod = chmodFix(fs.lchmod) + + fs.chownSync = chownFixSync(fs.chownSync) + fs.fchownSync = chownFixSync(fs.fchownSync) + fs.lchownSync = chownFixSync(fs.lchownSync) + + fs.chmodSync = chmodFixSync(fs.chmodSync) + fs.fchmodSync = chmodFixSync(fs.fchmodSync) + fs.lchmodSync = chmodFixSync(fs.lchmodSync) + + fs.stat = statFix(fs.stat) + fs.fstat = statFix(fs.fstat) + fs.lstat = statFix(fs.lstat) + + fs.statSync = statFixSync(fs.statSync) + fs.fstatSync = statFixSync(fs.fstatSync) + fs.lstatSync = statFixSync(fs.lstatSync) + + // if lchmod/lchown do not exist, then make them no-ops + if (!fs.lchmod) { + fs.lchmod = function (path, mode, cb) { + if (cb) process.nextTick(cb) + } + fs.lchmodSync = function () {} + } + if (!fs.lchown) { + fs.lchown = function (path, uid, gid, cb) { + if (cb) process.nextTick(cb) + } + fs.lchownSync = function () {} + } + + // on Windows, A/V software can lock the directory, causing this + // to fail with an EACCES or EPERM if the directory contains newly + // created files. Try again on failure, for up to 60 seconds. + + // Set the timeout this long because some Windows Anti-Virus, such as Parity + // bit9, may lock files for up to a minute, causing npm package install + // failures. Also, take care to yield the scheduler. Windows scheduling gives + // CPU to a busy looping process, which can cause the program causing the lock + // contention to be starved of CPU by node, so the contention doesn't resolve. + if (platform === "win32") { + fs.rename = (function (fs$rename) { return function (from, to, cb) { + var start = Date.now() + var backoff = 0; + fs$rename(from, to, function CB (er) { + if (er + && (er.code === "EACCES" || er.code === "EPERM") + && Date.now() - start < 60000) { + setTimeout(function() { + fs.stat(to, function (stater, st) { + if (stater && stater.code === "ENOENT") + fs$rename(from, to, CB); + else + cb(er) + }) + }, backoff) + if (backoff < 100) + backoff += 10; + return; + } + if (cb) cb(er) + }) + }})(fs.rename) + } + + // if read() returns EAGAIN, then just try it again. + fs.read = (function (fs$read) { return function (fd, buffer, offset, length, position, callback_) { + var callback + if (callback_ && typeof callback_ === 'function') { + var eagCounter = 0 + callback = function (er, _, __) { + if (er && er.code === 'EAGAIN' && eagCounter < 10) { + eagCounter ++ + return fs$read.call(fs, fd, buffer, offset, length, position, callback) + } + callback_.apply(this, arguments) + } + } + return fs$read.call(fs, fd, buffer, offset, length, position, callback) + }})(fs.read) + + fs.readSync = (function (fs$readSync) { return function (fd, buffer, offset, length, position) { + var eagCounter = 0 + while (true) { + try { + return fs$readSync.call(fs, fd, buffer, offset, length, position) + } catch (er) { + if (er.code === 'EAGAIN' && eagCounter < 10) { + eagCounter ++ + continue + } + throw er + } + } + }})(fs.readSync) + + function patchLchmod (fs) { + fs.lchmod = function (path, mode, callback) { + fs.open( path + , constants.O_WRONLY | constants.O_SYMLINK + , mode + , function (err, fd) { + if (err) { + if (callback) callback(err) + return + } + // prefer to return the chmod error, if one occurs, + // but still try to close, and report closing errors if they occur. + fs.fchmod(fd, mode, function (err) { + fs.close(fd, function(err2) { + if (callback) callback(err || err2) + }) + }) + }) + } + + fs.lchmodSync = function (path, mode) { + var fd = fs.openSync(path, constants.O_WRONLY | constants.O_SYMLINK, mode) + + // prefer to return the chmod error, if one occurs, + // but still try to close, and report closing errors if they occur. + var threw = true + var ret + try { + ret = fs.fchmodSync(fd, mode) + threw = false + } finally { + if (threw) { + try { + fs.closeSync(fd) + } catch (er) {} + } else { + fs.closeSync(fd) + } + } + return ret + } + } + + function patchLutimes (fs) { + if (constants.hasOwnProperty("O_SYMLINK")) { + fs.lutimes = function (path, at, mt, cb) { + fs.open(path, constants.O_SYMLINK, function (er, fd) { + if (er) { + if (cb) cb(er) + return + } + fs.futimes(fd, at, mt, function (er) { + fs.close(fd, function (er2) { + if (cb) cb(er || er2) + }) + }) + }) + } + + fs.lutimesSync = function (path, at, mt) { + var fd = fs.openSync(path, constants.O_SYMLINK) + var ret + var threw = true + try { + ret = fs.futimesSync(fd, at, mt) + threw = false + } finally { + if (threw) { + try { + fs.closeSync(fd) + } catch (er) {} + } else { + fs.closeSync(fd) + } + } + return ret + } + + } else { + fs.lutimes = function (_a, _b, _c, cb) { if (cb) process.nextTick(cb) } + fs.lutimesSync = function () {} + } + } + + function chmodFix (orig) { + if (!orig) return orig + return function (target, mode, cb) { + return orig.call(fs, target, mode, function (er) { + if (chownErOk(er)) er = null + if (cb) cb.apply(this, arguments) + }) + } + } + + function chmodFixSync (orig) { + if (!orig) return orig + return function (target, mode) { + try { + return orig.call(fs, target, mode) + } catch (er) { + if (!chownErOk(er)) throw er + } + } + } + + + function chownFix (orig) { + if (!orig) return orig + return function (target, uid, gid, cb) { + return orig.call(fs, target, uid, gid, function (er) { + if (chownErOk(er)) er = null + if (cb) cb.apply(this, arguments) + }) + } + } + + function chownFixSync (orig) { + if (!orig) return orig + return function (target, uid, gid) { + try { + return orig.call(fs, target, uid, gid) + } catch (er) { + if (!chownErOk(er)) throw er + } + } + } + + + function statFix (orig) { + if (!orig) return orig + // Older versions of Node erroneously returned signed integers for + // uid + gid. + return function (target, cb) { + return orig.call(fs, target, function (er, stats) { + if (!stats) return cb.apply(this, arguments) + if (stats.uid < 0) stats.uid += 0x100000000 + if (stats.gid < 0) stats.gid += 0x100000000 + if (cb) cb.apply(this, arguments) + }) + } + } + + function statFixSync (orig) { + if (!orig) return orig + // Older versions of Node erroneously returned signed integers for + // uid + gid. + return function (target) { + var stats = orig.call(fs, target) + if (stats.uid < 0) stats.uid += 0x100000000 + if (stats.gid < 0) stats.gid += 0x100000000 + return stats; + } + } + + // ENOSYS means that the fs doesn't support the op. Just ignore + // that, because it doesn't matter. + // + // if there's no getuid, or if getuid() is something other + // than 0, and the error is EINVAL or EPERM, then just ignore + // it. + // + // This specific case is a silent failure in cp, install, tar, + // and most other unix tools that manage permissions. + // + // When running as root, or if other types of errors are + // encountered, then it's strict. + function chownErOk (er) { + if (!er) + return true + + if (er.code === "ENOSYS") + return true + + var nonroot = !process.getuid || process.getuid() !== 0 + if (nonroot) { + if (er.code === "EINVAL" || er.code === "EPERM") + return true + } + + return false + } +} diff --git a/resources/app/node_modules/is-plain-obj/index.js b/resources/app/node_modules/is-plain-obj/index.js new file mode 100644 index 0000000..0d1ba9e --- /dev/null +++ b/resources/app/node_modules/is-plain-obj/index.js @@ -0,0 +1,7 @@ +'use strict'; +var toString = Object.prototype.toString; + +module.exports = function (x) { + var prototype; + return toString.call(x) === '[object Object]' && (prototype = Object.getPrototypeOf(x), prototype === null || prototype === Object.getPrototypeOf({})); +}; diff --git a/resources/app/node_modules/is-plain-obj/license b/resources/app/node_modules/is-plain-obj/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/resources/app/node_modules/is-plain-obj/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/is-plain-obj/readme.md b/resources/app/node_modules/is-plain-obj/readme.md new file mode 100644 index 0000000..269e56a --- /dev/null +++ b/resources/app/node_modules/is-plain-obj/readme.md @@ -0,0 +1,35 @@ +# is-plain-obj [](https://travis-ci.org/sindresorhus/is-plain-obj) + +> Check if a value is a plain object + +An object is plain if it's created by either `{}`, `new Object()` or `Object.create(null)`. + + +## Install + +``` +$ npm install --save is-plain-obj +``` + + +## Usage + +```js +var isPlainObj = require('is-plain-obj'); + +isPlainObj({foo: 'bar'}); +//=> true + +isPlainObj([1, 2, 3]); +//=> false +``` + + +## Related + +- [is-obj](https://github.com/sindresorhus/is-obj) - Check if a value is an object + + +## License + +MIT © [Sindre Sorhus](http://sindresorhus.com) diff --git a/resources/app/node_modules/loglevel/.editorconfig b/resources/app/node_modules/loglevel/.editorconfig new file mode 100644 index 0000000..e773d8d --- /dev/null +++ b/resources/app/node_modules/loglevel/.editorconfig @@ -0,0 +1,21 @@ + +# EditorConfig defines and maintains consistent coding styles between different +# editors and IDEs: http://EditorConfig.org/ +# Top-most EditorConfig file +root = true + +# All files +[*.*] +charset = utf-8 +end_of_line = lf +insert_final_newline = true +indent_style = space +indent_size = 4 +trim_trailing_whitespace = true +max_line_length = 80 + +[*.md] +indent_size = 2 + +[*.json] +indent_size = 2 diff --git a/resources/app/node_modules/loglevel/.jshintrc b/resources/app/node_modules/loglevel/.jshintrc new file mode 100644 index 0000000..7813175 --- /dev/null +++ b/resources/app/node_modules/loglevel/.jshintrc @@ -0,0 +1,14 @@ +{ + "curly": false, + "eqeqeq": true, + "immed": true, + "latedef": true, + "newcap": true, + "noarg": true, + "sub": true, + "undef": true, + "unused": true, + "boss": true, + "eqnull": true, + "node": true +} diff --git a/resources/app/node_modules/loglevel/.travis.yml b/resources/app/node_modules/loglevel/.travis.yml new file mode 100644 index 0000000..b21853c --- /dev/null +++ b/resources/app/node_modules/loglevel/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - "0.10" +script: "npm run-script ci" \ No newline at end of file diff --git a/resources/app/node_modules/loglevel/CONTRIBUTING.md b/resources/app/node_modules/loglevel/CONTRIBUTING.md new file mode 100644 index 0000000..5754e85 --- /dev/null +++ b/resources/app/node_modules/loglevel/CONTRIBUTING.md @@ -0,0 +1,60 @@ +Filing tickets against loglevel +=============================== + +If you'd like to file a bug or a feature request for loglevel, the best option is to [open an issue on Github](https://github.com/pimterry/loglevel/issues/new). + +If you're filing a feature request, please remember: + +* Feature requests significantly expanding the scope of loglevel outside the description in [the readme](https://github.com/pimterry/loglevel/blob/master/README.md) will probably be rejected. +* Features that can't be meaningfully implemented in a cross-environment compatible manner won't be implemented. +* Please check the previously opened issues to see if somebody else has suggested it first. +* Consider submitting a pull request to add the feature instead, if you're confident it fits within the above + +If you're filing a bug, please remember: + +* To provide detailed steps to reproduce the behaviour +* If possible, provide a Jasmine test which reproduces the behaviour +* Please specify the exact details of the environment in which it fails: OS + Environment (i.e. Browser or Node) + version +* Consider submitting a pull request to fix the bug instead + +Helping develop loglevel +================================ + +If you'd like to help develop loglevel further, please submit a pull request! I'm very keen to improve loglevel further, and good pull requests will be enthusiastically merged. + +Before submitting a pull request to fix a bug or add a new feature, please check the lists above to ensure it'll be accepted. Browser compatibility is particularly important here; if you add a feature or fix a bug which breaks things on other browsers it will not be merged, no matter how awesome it may be. + +To be more specific, before submitting your pull request please ensure: + +* You haven't broken the existing test suite in any obvious browsers (at least check latest IE/FF/Chrome - automatic saucelabs tests for this are coming soon too) +* You've added relevant tests for the bug you're fixing/the new feature you're adding/etc, which pass in all the relevant browsers +* JSHint is happy with your new code +* You've updated the API docs (in README.md) to detail any changes you've made to the public interface +* Your change is backward compatible (or you've explicitly said if it's not; this isn't great, but will be considered) +* You haven't changed any files in dist/ (these are auto-generated, and should only be changed on release) + +Project structure +----------------- + +The core project code is all in lib/loglevel.js, and this should be the only file you need to touch for functional changes themselves. + +The released code is in dist/*.js, and should not be touched by anything except releases + +The test suite is entirely in test/*.js: + +* Every file ending in '-test.js' is a unit test, is written in RequireJS, and should pass in any environment +* global-integration.js and node-integration.js are quick integration smoke tests for node and for browser global usage +* test-helpers.js contains some test utilities +* manual-test.html is a test page which includes the current loglevel build, so you can manually check it works in a given browser + +How to make your change and submit it +------------------------------------- + +1. Fork loglevel +2. Clone your fork locally +3. Create a branch from master for your change +4. Write some tests in /test for your change, as relevant +5. Make your code changes in /lib/loglevel.js +6. Check your code all passes (run `grunt`) - if you have any issues try running `grunt jasmine:requirejs:src:build` (or a different test build instead of 'requirejs': see the jasmine config in Gruntfile.js) and debugging the generated _SpecRunner.html in a browser +7. Commit your changes +8. Open a pull request back to master in loglevel diff --git a/resources/app/node_modules/loglevel/Gruntfile.js b/resources/app/node_modules/loglevel/Gruntfile.js new file mode 100644 index 0000000..eab0cba --- /dev/null +++ b/resources/app/node_modules/loglevel/Gruntfile.js @@ -0,0 +1,228 @@ +'use strict'; + +module.exports = function (grunt) { + + // Project configuration. + grunt.initConfig({ + // Metadata. + pkg: grunt.file.readJSON('package.json'), + banner: '/*! <%= pkg.name %> - v<%= pkg.version %>' + + ' - <%= pkg.homepage %>' + + ' - (c) <%= grunt.template.today("yyyy") %> <%= pkg.author.name %>' + + ' - licensed <%= pkg.license %> */\n', + // Task configuration. + concat: { + options: { + banner: '<%= banner %>', + stripBanners: true + }, + dist: { + src: ['lib/<%= pkg.name %>.js'], + dest: 'dist/<%= pkg.name %>.js' + } + }, + uglify: { + options: { + banner: '<%= banner %>' + }, + dist: { + src: '<%= concat.dist.dest %>', + dest: 'dist/<%= pkg.name %>.min.js' + } + }, + jasmine: { + requirejs: { + src: [], + options: { + specs: 'test/*-test.js', + vendor: 'test/vendor/*.js', + helpers: 'test/*-helper.js', + template: require('grunt-template-jasmine-requirejs') + } + }, + global: { + src: 'lib/**/*.js', + options: { + specs: 'test/global-integration.js', + vendor: 'test/vendor/*.js' + } + }, + context: { + src: 'test/test-context-using-apply.generated.js', + options: { + specs: 'test/global-integration-with-new-context.js', + vendor: 'test/vendor/*.js' + } + }, + withCoverage: { + src: 'lib/**/*.js', + options: { + specs: 'test/*-test.js', + vendor: 'test/vendor/*.js', + helpers: 'test/*-helper.js', + template: require('grunt-template-jasmine-istanbul'), + templateOptions: { + coverage: 'coverage/coverage.json', + report: [ + { + type: 'html', + options: { + dir: 'coverage' + } + }, + { + type: 'lcov', + options: { + dir: 'coverage' + } + } + ], + + template: require('grunt-template-jasmine-requirejs'), + templateOptions: { + requireConfig: { + paths: { + "lib": '.grunt/grunt-contrib-jasmine/lib/' + } + } + } + } + } + } + }, + "jasmine_node": { + options: { + match: "node-integration.", + matchall: true, + projectRoot: "./test", + useHelpers: false + } + }, + coveralls: { + src: 'coverage/lcov.info' + }, + open: { + jasmine: { + path: 'http://127.0.0.1:8000/_SpecRunner.html' + } + }, + connect: { + test: { + port: 8000, + keepalive: true + } + }, + 'saucelabs-jasmine': { + // Requires valid SAUCE_USERNAME and SAUCE_ACCESS_KEY in env to run. + all: { + options: { + urls: ['http://localhost:8000/_SpecRunner.html'], + browsers: [ + {"browserName": "firefox", "platform": "Windows 2003", "version": "3.6"}, + {"browserName": "firefox", "platform": "Windows 2003", "version": "4"}, + {"browserName": "firefox", "platform": "Windows 2003", "version": "25"}, + {"browserName": "safari", "platform": "Mac 10.6", "version": "5"}, + {"browserName": "safari", "platform": "Mac 10.8", "version": "6"}, + {"browserName": "googlechrome", "platform": "Windows 7"}, + {"browserName": "opera", "platform": "Windows 2003", "version": "12"}, + // Disabled because old IE breaks the Jasmine runner; these have to be manually tested + // {"browserName": "iehta", "platform": "Windows XP", "version": "6"}, + // {"browserName": "iehta", "platform": "Windows XP", "version": "7"}, + // {"browserName": "iehta", "platform": "Windows XP", "version": "8"}, + {"browserName": "iehta", "platform": "Windows 7", "version": "9"}, + {"browserName": "iehta", "platform": "Windows 7", "version": "10"}, + {"browserName": "opera", "platform": "Windows 7", "version": "12"}, + {"browserName": "android", "platform": "Linux", "version": "4.0"}, + {"browserName": "iphone", "platform": "OS X 10.8", "version": "6"} + ], + concurrency: 3, + detailedError: true, + testTimeout:10000, + testInterval:1000, + testReadyTimeout:2000, + testname: 'loglevel jasmine test', + tags: [process.env.TRAVIS_REPO_SLUG || "local", process.env.TRAVIS_COMMIT || "manual"] + } + } + }, + jshint: { + options: { + jshintrc: '.jshintrc' + }, + gruntfile: { + src: 'Gruntfile.js' + }, + lib: { + options: { + jshintrc: 'lib/.jshintrc' + }, + src: ['lib/**/*.js'] + }, + test: { + options: { + jshintrc: 'test/.jshintrc' + }, + src: ['test/*.js', '!test/*.generated.js'] + } + }, + watch: { + gruntfile: { + files: '<%= jshint.gruntfile.src %>', + tasks: ['jshint:gruntfile'] + }, + lib: { + files: '<%= jshint.lib.src %>', + tasks: ['jshint:lib', 'test'] + }, + test: { + files: '<%= jshint.test.src %>', + tasks: ['jshint:test', 'test'] + } + }, + qunit: { + all: ['test/*-qunit.html'] + }, + preprocess: { + "test-context-using-apply": { + src: 'test/test-context-using-apply.js', + dest: 'test/test-context-using-apply.generated.js' + } + }, + clean:{ + test:['test/test-context-using-apply.generated.js'] + } + }); + + // These plugins provide necessary tasks. + grunt.loadNpmTasks('grunt-contrib-concat'); + grunt.loadNpmTasks('grunt-contrib-uglify'); + grunt.loadNpmTasks('grunt-contrib-jasmine'); + grunt.loadNpmTasks('grunt-coveralls'); + grunt.loadNpmTasks('grunt-jasmine-node'); + grunt.loadNpmTasks('grunt-contrib-jshint'); + grunt.loadNpmTasks('grunt-contrib-watch'); + grunt.loadNpmTasks('grunt-contrib-qunit'); + + grunt.loadNpmTasks('grunt-contrib-connect'); + grunt.loadNpmTasks('grunt-open'); + grunt.loadNpmTasks('grunt-saucelabs'); + grunt.loadNpmTasks('grunt-preprocess'); + grunt.loadNpmTasks('grunt-contrib-clean'); + + // Build a distributable release + grunt.registerTask('dist', ['test', 'concat', 'uglify']); + + // Check everything is good + grunt.registerTask('test', ['jshint', 'jasmine:requirejs', 'jasmine:global', 'preprocess', 'jasmine:context', 'clean:test', 'jasmine_node', 'jasmine:withCoverage', 'qunit']); + + // Test with a live server and an actual browser + grunt.registerTask('integration-test', ['jasmine:requirejs:src:build', 'open:jasmine', 'connect:test:keepalive']); + + // Test with lots of browsers on saucelabs. Requires valid SAUCE_USERNAME and SAUCE_ACCESS_KEY in env to run. + grunt.registerTask('saucelabs', ['jasmine:requirejs:src:build', 'connect:test', 'saucelabs-jasmine']); + + // Default task. + grunt.registerTask('default', 'test'); + grunt.registerTask('ci', ['test', 'coveralls']); + +}; diff --git a/resources/app/node_modules/loglevel/LICENSE-MIT b/resources/app/node_modules/loglevel/LICENSE-MIT new file mode 100644 index 0000000..d384208 --- /dev/null +++ b/resources/app/node_modules/loglevel/LICENSE-MIT @@ -0,0 +1,22 @@ +Copyright (c) 2013 Tim Perry + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/resources/app/node_modules/loglevel/README.md b/resources/app/node_modules/loglevel/README.md new file mode 100644 index 0000000..072a04b --- /dev/null +++ b/resources/app/node_modules/loglevel/README.md @@ -0,0 +1,305 @@ + +# loglevel [![NPM version][npm-image]][npm-url] [](https://www.npmjs.com/package/loglevel) [](https://travis-ci.org/pimterry/loglevel) [](https://coveralls.io/r/pimterry/loglevel?branch=master) + +[npm-image]: https://img.shields.io/npm/v/loglevel.svg?style=flat +[npm-url]: https://npmjs.org/package/loglevel + +Minimal lightweight simple logging for JavaScript. loglevel replaces console.log() and friends with level-based logging and filtering, with none of console's downsides. + +This is a barebones reliable everyday logging library. It does not do fancy things, it does not let you reconfigure appenders or add complex log filtering rules or boil tea (more's the pity), but it does have the all core functionality that you actually use: + +## Features + +### Simple + +* Log things at a given level (trace/debug/info/warn/error) to the console object (as seen in all modern browsers & node.js) +* Filter logging by level (all the above or 'silent'), so you can disable all but error logging in production, and then run log.setLevel("trace") in your console to turn it all back on for a furious debugging session +* Single file, no dependencies, weighs in at 1.1KB minified and gzipped + +### Effective + +* Log methods gracefully fall back to simpler console logging methods if more specific ones aren't available: so calls to log.debug() go to console.debug() if possible, or console.log() if not +* Logging calls still succeed even if there's no console object at all, so your site doesn't break when people visit with old browsers that don't support the console object (here's looking at you IE) and similar +* This then comes together giving a consistent reliable API that works in every JavaScript environment with a console available, and never breaks anything anywhere else + +### Convenient + +* Log output keeps line numbers: most JS logging frameworks call console.log methods through wrapper functions, clobbering your stacktrace and making the extra info many browsers provide useless. We'll have none of that thanks. +* It works with all the standard JavaScript loading systems out of the box (CommonJS, AMD, or just as a global) +* Logging is filtered to "warn" level by default, to keep your live site clean in normal usage (or you can trivially re-enable everything with an initial log.enableAll() call) +* Magically handles situations where console logging is not initially available (IE8/9), and automatically enables logging as soon as it does become available (when developer console is opened) +* Extensible, to add other log redirection, filtering, or formatting functionality, while keeping all the above (except you will clobber your stacktrace, see Plugins below) + +## Downloading loglevel + +If you're using NPM, you can just run `npm install loglevel`. + +Alternatively, loglevel is also available via [Bower](https://github.com/bower/bower) (`bower install loglevel`), as a [Webjar](http://www.webjars.org/), or an [Atmosphere package](https://atmospherejs.com/spacejamio/loglevel) (for Meteor) + +Alternatively if you just want to grab the file yourself, you can download either the current stable [production version][min] or the [development version][max] directly, or reference it remotely on unpkg at [`https://unpkg.com/loglevel/dist/loglevel.min.js`][cdn] (this will redirect to a latest version, use the resulting redirected URL if you want to pin that version). + +Finally, if you want to tweak loglevel to your own needs or you immediately need the cutting-edge version, clone this repo and see [Developing & Contributing](#developing--contributing) below for build instructions. + +[min]: https://raw.github.com/pimterry/loglevel/master/dist/loglevel.min.js +[max]: https://raw.github.com/pimterry/loglevel/master/dist/loglevel.js +[cdn]: https://unpkg.com/loglevel/dist/loglevel.min.js + +## Setting it up + +loglevel supports AMD (e.g. RequireJS), CommonJS (e.g. Node.js) and direct usage (e.g. loading globally with a <script> tag) loading methods. You should be able to do nearly anything, and then skip to the next section anyway and have it work. Just in case though, here's some specific examples that definitely do the right thing: + +### CommonsJS (e.g. Node) + +```javascript +var log = require('loglevel'); +log.warn("unreasonably simple"); +``` + +### AMD (e.g. RequireJS) + +```javascript +define(['loglevel'], function(log) { + log.warn("dangerously convenient"); +}); +``` + +### Directly in your web page: + +```html +<script src="loglevel.min.js"></script> +<script> +log.warn("too easy"); +</script> +``` + +### As an ES6 module (assuming some transpilation step): + +```javascript +import * as log from 'loglevel'; +log.warn("ultra-compatible"); +``` + +### With noConflict(): + +If you're using another JavaScript library that exposes a 'log' global, you can run into conflicts with loglevel. Similarly to jQuery, you can solve this by putting loglevel into no-conflict mode immediately after it is loaded onto the page. This resets to 'log' global to its value before loglevel was loaded (typically `undefined`), and returns the loglevel object, which you can then bind to another name yourself. + +For example: + +```html +<script src="loglevel.min.js"></script> +<script> +var logging = log.noConflict(); + +logging.warn("still pretty easy"); +</script> +``` + +## Documentation + +The loglevel API is extremely minimal. All methods are available on the root loglevel object, which it's suggested you name 'log' (this is the default if you import it in globally, and is what's set up in the above examples). The API consists of: + +* 5 actual logging methods, ordered and available as: + * `log.trace(msg)` + * `log.debug(msg)` + * `log.info(msg)` + * `log.warn(msg)` + * `log.error(msg)` + + `log.log(msg)` is also available, as an alias for `log.debug(msg)`, to improve compatibility with `console`, and make migration easier. + + Exact output formatting of these will depend on the console available in the current context of your application. For example, many environments will include a full stack trace with all trace() calls, and icons or similar to highlight other calls. + + These methods should never fail in any environment, even if no console object is currently available, and should always fall back to an available log method even if the specific method called (e.g. warn) isn't available. + + Be aware that all this means that these method won't necessarily always produce exactly the output you expect in every environment; loglevel only guarantees that these methods will never explode on you, and that it will call the most relevant method it can find, with your argument. Firefox is a notable example here: due to a [current Firefox bug](https://bugzilla.mozilla.org/show_bug.cgi?id=1172314) `log.trace(msg)` calls in Firefox will print only the stacktrace, and won't include any passed message arguments. + +* A `log.setLevel(level, [persist])` method. + + This disables all logging below the given level, so that after a log.setLevel("warn") call log.warn("something") or log.error("something") will output messages, but log.info("something") will not. + + This can take either a log level name or 'silent' (which disables everything) in one of a few forms: + * As a log level from the internal levels list, e.g. log.levels.SILENT ← _for type safety_ + * As a string, like 'error' (case-insensitive) ← _for a reasonable practical balance_ + * As a numeric index from 0 (trace) to 5 (silent) ← _deliciously terse, and more easily programmable (...although, why?)_ + + Where possible the log level will be persisted. LocalStorage will be used if available, falling back to cookies if not. If neither is available in the current environment (i.e. in Node), or if you pass `false` as the optional 'persist' second argument, persistence will be skipped. + + If log.setLevel() is called when a console object is not available (in IE 8 or 9 before the developer tools have been opened, for example) logging will remain silent until the console becomes available, and then begin logging at the requested level. + +* A `log.setDefaultLevel(level)` method. + + This sets the current log level only if one has not been persisted and can’t be loaded. This is useful when initializing scripts; if a developer or user has previously called `setLevel()`, this won’t alter their settings. For example, your application might set the log level to `error` in a production environment, but when debugging an issue, you might call `setLevel("trace")` on the console to see all the logs. If that `error` setting was set using `setDefaultLevel()`, it will still say as `trace` on subsequent page loads and refreshes instead of resetting to `error`. + + The `level` argument takes is the same values that you might pass to `setLevel()`. Levels set using `setDefaultLevel()` never persist to subsequent page loads. + +* `log.enableAll()` and `log.disableAll()` methods. + + These enable or disable all log messages, and are equivalent to log.setLevel("trace") and log.setLevel("silent") respectively. + +* A `log.getLevel()` method. + + Returns the current logging level, as a number from 0 (trace) to 5 (silent) + + It's very unlikely you'll need to use this for normal application logging; it's provided partly to help plugin development, and partly to let you optimize logging code as below, where debug data is only generated if the level is set such that it'll actually be logged. This probably doesn't affect you, unless you've run profiling on your code and you have hard numbers telling you that your log data generation is a real performance problem. + + ```javascript + if (log.getLevel() <= log.levels.DEBUG) { + var logData = runExpensiveDataGeneration(); + log.debug(logData); + } + ``` + + This notably isn't the right solution to avoid the cost of string concatenation in your logging. Firstly, it's very unlikely that string concatenation in your logging is really an important performance problem. Even if you do genuinely have hard metrics showing that it is though, the better solution that wrapping your log statements in this is to use multiple arguments, as below. The underlying console API will automatically concatenate these for you if logging is enabled, and if it isn't then all log methods are no-ops, and no concatenation will be done at all. + + ```javascript + // Prints 'My concatenated log message' + log.debug("My ", "concatenated ", "log message"); + ``` + +* A `log.getLogger(loggerName)` method. + + This gets you a new logger object that works exactly like the root `log` object, but can have its level and logging methods set independently. All loggers must have a name (which is a non-empty string). Calling `getLogger()` multiple times with the same name will return an identical logger object. + + In large applications, it can be incredibly useful to turn logging on and off for particular modules as you are working with them. Using the `getLogger()` method lets you create a separate logger for each part of your application with its own logging level. + + Likewise, for small, independent modules, using a named logger instead of the default root logger allows developers using your module to selectively turn on deep, trace-level logging when trying to debug problems, while logging only errors or silencing logging altogether under normal circumstances. + + Example usage *(using CommonJS modules, but you could do the same with any module system):* + + ```javascript + // In module-one.js: + var log = require("loglevel").getLogger("module-one"); + function doSomethingAmazing() { + log.debug("Amazing message from module one."); + } + + // In module-two.js: + var log = require("loglevel").getLogger("module-two"); + function doSomethingSpecial() { + log.debug("Special message from module two."); + } + + // In your main application module: + var log = require("loglevel"); + var moduleOne = require("module-one"); + var moduleTwo = require("module-two"); + log.getLogger("module-two").setLevel("TRACE"); + + moduleOne.doSomethingAmazing(); + moduleTwo.doSomethingSpecial(); + // logs "Special message from module two." + // (but nothing from module one.) + ``` + + Loggers returned by `getLogger()` support all the same properties and methods as the default root logger, excepting `noConflict()` and the `getLogger()` method itself. + + Like the root logger, other loggers can have their logging level saved. If a logger’s level has not been saved, it will inherit the root logger’s level when it is first created. If the root logger’s level changes later, the new level will not affect other loggers that have already been created. + + Likewise, loggers will inherit the root logger’s `methodFactory`. After creation, each logger can have its `methodFactory` independently set. See the *plugins* section below for more about `methodFactory`. + +* A `log.getLoggers()` method. + + This will return you the dictionary of all loggers created with `getLogger`, keyed off of their names. + +## Plugins + +### Existing plugins: + +[loglevel-plugin-prefix](https://github.com/kutuluk/loglevel-plugin-prefix) - plugin for loglevel message prefixing. + +[loglevel-plugin-remote](https://github.com/kutuluk/loglevel-plugin-remote) - plugin for sending loglevel messages to a remote log server. + +ServerSend - https://github.com/artemyarulin/loglevel-serverSend - Forward your log messages to a remote server. + +Standard Streams - https://github.com/NatLibFi/loglevel-std-streams - Route logging through STDERR in Node for easier log management. + +Message Prefix - https://github.com/NatLibFi/loglevel-message-prefix - Dynamic (timestamp/level) and static ('foo') message prefixing. + +Message Buffer - https://github.com/NatLibFi/loglevel-message-buffer - Buffer messages, and flush them on-demand later. + +DEBUG - https://github.com/vectrlabs/loglevel-debug - Control logging from a DEBUG environmental variable (similar to the classic [Debug](https://github.com/visionmedia/debug) module) + +### Writing plugins: + +Loglevel provides a simple reliable minimal base for console logging that works everywhere. This means it doesn't include lots of fancy functionality that might be useful in some cases, such as log formatting and redirection (e.g. also sending log messages to a server over AJAX) + +Including that would increase the size and complexity of the library, but more importantly would remove stacktrace information. Currently log methods are either disabled, or enabled with directly bound versions of the console.log methods (where possible). This means your browser shows the log message as coming from your code at the call to `log.info("message!")` not from within loglevel, since it really calls the bound console method directly, without indirection. The indirection required to dynamically format, further filter, or redirect log messages would stop this. + +There's clearly enough enthusiasm for this even at that cost though that loglevel now includes a plugin API. To use it, redefine log.methodFactory(methodName, logLevel, loggerName) with a function of your own. This will be called for each enabled method each time the level is set (including initially), and should return a function to be used for the given log method, at the given level, for a logger with the given name. If you'd like to retain all the reliability and features of loglevel, it's recommended that this wraps the initially provided value of `log.methodFactory` + +For example, a plugin to prefix all log messages with "Newsflash: " would look like: + +```javascript +var originalFactory = log.methodFactory; +log.methodFactory = function (methodName, logLevel, loggerName) { + var rawMethod = originalFactory(methodName, logLevel, loggerName); + + return function (message) { + rawMethod("Newsflash: " + message); + }; +}; +log.setLevel(log.getLevel()); // Be sure to call setLevel method in order to apply plugin +``` + +*(The above supports only a single log.warn("") argument for clarity, but it's easy to extend to a [fuller varadic version](http://jsbin.com/xehoye/edit?html,console))* + +If you develop and release a plugin, please get in contact! I'd be happy to reference it here for future users. Some consistency is helpful; naming your plugin 'loglevel-PLUGINNAME' (e.g. loglevel-newsflash) is preferred, as is giving it the 'loglevel-plugin' keyword in your package.json + +## Developing & Contributing +In lieu of a formal styleguide, take care to maintain the existing coding style. Add unit tests for any new or changed functionality. + +Builds can be run with npm: run `npm run dist` to build a distributable version of the project (in /dist), or `npm test` to just run the tests and linting. During development you can run `npm run watch` and it will monitor source files, and rerun the tests and linting as appropriate when they're changed. + +_Also, please don't manually edit files in the "dist" subdirectory as they are generated via Grunt. You'll find source code in the "lib" subdirectory!_ + +#### Release process + +To do a release of loglevel: + +* Update the version number in package.json and bower.json +* Run `npm run dist` to build a distributable version in dist/ +* Update the release history in this file (below) +* Commit the built code, tagging it with the version number and a brief message about the release +* Push to Github +* Run `npm publish .` to publish to NPM + +## Release History +v0.1.0 - First working release with apparent compatibility with everything tested + +v0.2.0 - Updated release with various tweaks and polish and real proper documentation attached + +v0.3.0 - Some bugfixes (#12, #14), cookie-based log level persistence, doc tweaks, support for Bower and JamJS + +v0.3.1 - Fixed incorrect text in release build banner, various other minor tweaks + +v0.4.0 - Use LocalStorage for level persistence if available, compatibility improvements for IE, improved error messages, multi-environment tests + +v0.5.0 - Fix for Modernizr+IE8 issues, improved setLevel error handling, support for auto-activation of desired logging when console eventually turns up in IE8 + +v0.6.0 - Handle logging in Safari private browsing mode (#33), fix TRACE level persistence bug (#35), plus various minor tweaks + +v1.0.0 - Official stable release! Fixed a bug with localStorage in Android webviews, improved CommonJS detection, and added noConflict(). + +v1.1.0 - Added support for including loglevel with preprocessing and .apply() (#50), and fixed QUnit dep version which made tests potentially unstable. + +v1.2.0 - New plugin API! Plus various bits of refactoring and tidy up, nicely simplifying things and trimming the size down. + +v1.3.0 - Make persistence optional in setLevel, plus lots of documentation updates and other small tweaks + +v1.3.1 - With the new optional persistence, stop unnecessarily persisting the initially set default level (warn) + +v1.4.0 - Add getLevel(), setDefaultLevel() and getLogger() functionality for more fine-grained log level control + +v1.4.1 - Reorder UMD (#92) to improve bundling tool compatibility + +v1.5.0 - Fix log.debug (#111) after V8 changes deprecating console.debug, check for `window` upfront (#104), and add `.log` alias for `.debug` (#64) + +v1.5.1 - Fix bug (#112) in level-persistence cookie fallback, which failed if it wasn't the first cookie present + +v1.6.0 - Add a name property to loggers and add log.getLoggers() (#114), and recommend unpkg as CDN instead of CDNJS. + +v1.6.1 - Various small documentation & test updates + +## License +Copyright (c) 2013 Tim Perry +Licensed under the MIT license. diff --git a/resources/app/node_modules/loglevel/_config.yml b/resources/app/node_modules/loglevel/_config.yml new file mode 100644 index 0000000..2f7efbe --- /dev/null +++ b/resources/app/node_modules/loglevel/_config.yml @@ -0,0 +1 @@ +theme: jekyll-theme-minimal \ No newline at end of file diff --git a/resources/app/node_modules/loglevel/bower.json b/resources/app/node_modules/loglevel/bower.json new file mode 100644 index 0000000..cc50ae8 --- /dev/null +++ b/resources/app/node_modules/loglevel/bower.json @@ -0,0 +1,11 @@ +{ + "name": "loglevel", + "version": "1.6.1", + "main": "dist/loglevel.min.js", + "dependencies": {}, + "ignore": [ + "**/.*", + "node_modules", + "components" + ] +} diff --git a/resources/app/node_modules/loglevel/dist/loglevel.js b/resources/app/node_modules/loglevel/dist/loglevel.js new file mode 100644 index 0000000..ec1423b --- /dev/null +++ b/resources/app/node_modules/loglevel/dist/loglevel.js @@ -0,0 +1,245 @@ +/*! loglevel - v1.6.1 - https://github.com/pimterry/loglevel - (c) 2018 Tim Perry - licensed MIT */ +(function (root, definition) { + "use strict"; + if (typeof define === 'function' && define.amd) { + define(definition); + } else if (typeof module === 'object' && module.exports) { + module.exports = definition(); + } else { + root.log = definition(); + } +}(this, function () { + "use strict"; + + // Slightly dubious tricks to cut down minimized file size + var noop = function() {}; + var undefinedType = "undefined"; + + var logMethods = [ + "trace", + "debug", + "info", + "warn", + "error" + ]; + + // Cross-browser bind equivalent that works at least back to IE6 + function bindMethod(obj, methodName) { + var method = obj[methodName]; + if (typeof method.bind === 'function') { + return method.bind(obj); + } else { + try { + return Function.prototype.bind.call(method, obj); + } catch (e) { + // Missing bind shim or IE8 + Modernizr, fallback to wrapping + return function() { + return Function.prototype.apply.apply(method, [obj, arguments]); + }; + } + } + } + + // Build the best logging method possible for this env + // Wherever possible we want to bind, not wrap, to preserve stack traces + function realMethod(methodName) { + if (methodName === 'debug') { + methodName = 'log'; + } + + if (typeof console === undefinedType) { + return false; // No method possible, for now - fixed later by enableLoggingWhenConsoleArrives + } else if (console[methodName] !== undefined) { + return bindMethod(console, methodName); + } else if (console.log !== undefined) { + return bindMethod(console, 'log'); + } else { + return noop; + } + } + + // These private functions always need `this` to be set properly + + function replaceLoggingMethods(level, loggerName) { + /*jshint validthis:true */ + for (var i = 0; i < logMethods.length; i++) { + var methodName = logMethods[i]; + this[methodName] = (i < level) ? + noop : + this.methodFactory(methodName, level, loggerName); + } + + // Define log.log as an alias for log.debug + this.log = this.debug; + } + + // In old IE versions, the console isn't present until you first open it. + // We build realMethod() replacements here that regenerate logging methods + function enableLoggingWhenConsoleArrives(methodName, level, loggerName) { + return function () { + if (typeof console !== undefinedType) { + replaceLoggingMethods.call(this, level, loggerName); + this[methodName].apply(this, arguments); + } + }; + } + + // By default, we use closely bound real methods wherever possible, and + // otherwise we wait for a console to appear, and then try again. + function defaultMethodFactory(methodName, level, loggerName) { + /*jshint validthis:true */ + return realMethod(methodName) || + enableLoggingWhenConsoleArrives.apply(this, arguments); + } + + function Logger(name, defaultLevel, factory) { + var self = this; + var currentLevel; + var storageKey = "loglevel"; + if (name) { + storageKey += ":" + name; + } + + function persistLevelIfPossible(levelNum) { + var levelName = (logMethods[levelNum] || 'silent').toUpperCase(); + + if (typeof window === undefinedType) return; + + // Use localStorage if available + try { + window.localStorage[storageKey] = levelName; + return; + } catch (ignore) {} + + // Use session cookie as fallback + try { + window.document.cookie = + encodeURIComponent(storageKey) + "=" + levelName + ";"; + } catch (ignore) {} + } + + function getPersistedLevel() { + var storedLevel; + + if (typeof window === undefinedType) return; + + try { + storedLevel = window.localStorage[storageKey]; + } catch (ignore) {} + + // Fallback to cookies if local storage gives us nothing + if (typeof storedLevel === undefinedType) { + try { + var cookie = window.document.cookie; + var location = cookie.indexOf( + encodeURIComponent(storageKey) + "="); + if (location !== -1) { + storedLevel = /^([^;]+)/.exec(cookie.slice(location))[1]; + } + } catch (ignore) {} + } + + // If the stored level is not valid, treat it as if nothing was stored. + if (self.levels[storedLevel] === undefined) { + storedLevel = undefined; + } + + return storedLevel; + } + + /* + * + * Public logger API - see https://github.com/pimterry/loglevel for details + * + */ + + self.name = name; + + self.levels = { "TRACE": 0, "DEBUG": 1, "INFO": 2, "WARN": 3, + "ERROR": 4, "SILENT": 5}; + + self.methodFactory = factory || defaultMethodFactory; + + self.getLevel = function () { + return currentLevel; + }; + + self.setLevel = function (level, persist) { + if (typeof level === "string" && self.levels[level.toUpperCase()] !== undefined) { + level = self.levels[level.toUpperCase()]; + } + if (typeof level === "number" && level >= 0 && level <= self.levels.SILENT) { + currentLevel = level; + if (persist !== false) { // defaults to true + persistLevelIfPossible(level); + } + replaceLoggingMethods.call(self, level, name); + if (typeof console === undefinedType && level < self.levels.SILENT) { + return "No console available for logging"; + } + } else { + throw "log.setLevel() called with invalid level: " + level; + } + }; + + self.setDefaultLevel = function (level) { + if (!getPersistedLevel()) { + self.setLevel(level, false); + } + }; + + self.enableAll = function(persist) { + self.setLevel(self.levels.TRACE, persist); + }; + + self.disableAll = function(persist) { + self.setLevel(self.levels.SILENT, persist); + }; + + // Initialize with the right level + var initialLevel = getPersistedLevel(); + if (initialLevel == null) { + initialLevel = defaultLevel == null ? "WARN" : defaultLevel; + } + self.setLevel(initialLevel, false); + } + + /* + * + * Top-level API + * + */ + + var defaultLogger = new Logger(); + + var _loggersByName = {}; + defaultLogger.getLogger = function getLogger(name) { + if (typeof name !== "string" || name === "") { + throw new TypeError("You must supply a name when creating a logger."); + } + + var logger = _loggersByName[name]; + if (!logger) { + logger = _loggersByName[name] = new Logger( + name, defaultLogger.getLevel(), defaultLogger.methodFactory); + } + return logger; + }; + + // Grab the current global log variable in case of overwrite + var _log = (typeof window !== undefinedType) ? window.log : undefined; + defaultLogger.noConflict = function() { + if (typeof window !== undefinedType && + window.log === defaultLogger) { + window.log = _log; + } + + return defaultLogger; + }; + + defaultLogger.getLoggers = function getLoggers() { + return _loggersByName; + }; + + return defaultLogger; +})); diff --git a/resources/app/node_modules/loglevel/dist/loglevel.min.js b/resources/app/node_modules/loglevel/dist/loglevel.min.js new file mode 100644 index 0000000..5b94728 --- /dev/null +++ b/resources/app/node_modules/loglevel/dist/loglevel.min.js @@ -0,0 +1,2 @@ +/*! loglevel - v1.6.1 - https://github.com/pimterry/loglevel - (c) 2018 Tim Perry - licensed MIT */ +!function(a,b){"use strict";"function"==typeof define&&define.amd?define(b):"object"==typeof module&&module.exports?module.exports=b():a.log=b()}(this,function(){"use strict";function a(a,b){var c=a[b];if("function"==typeof c.bind)return c.bind(a);try{return Function.prototype.bind.call(c,a)}catch(b){return function(){return Function.prototype.apply.apply(c,[a,arguments])}}}function b(b){return"debug"===b&&(b="log"),typeof console!==h&&(void 0!==console[b]?a(console,b):void 0!==console.log?a(console,"log"):g)}function c(a,b){for(var c=0;c<i.length;c++){var d=i[c];this[d]=c<a?g:this.methodFactory(d,a,b)}this.log=this.debug}function d(a,b,d){return function(){typeof console!==h&&(c.call(this,b,d),this[a].apply(this,arguments))}}function e(a,c,e){return b(a)||d.apply(this,arguments)}function f(a,b,d){function f(a){var b=(i[a]||"silent").toUpperCase();if(typeof window!==h){try{return void(window.localStorage[l]=b)}catch(a){}try{window.document.cookie=encodeURIComponent(l)+"="+b+";"}catch(a){}}}function g(){var a;if(typeof window!==h){try{a=window.localStorage[l]}catch(a){}if(typeof a===h)try{var b=window.document.cookie,c=b.indexOf(encodeURIComponent(l)+"=");-1!==c&&(a=/^([^;]+)/.exec(b.slice(c))[1])}catch(a){}return void 0===k.levels[a]&&(a=void 0),a}}var j,k=this,l="loglevel";a&&(l+=":"+a),k.name=a,k.levels={TRACE:0,DEBUG:1,INFO:2,WARN:3,ERROR:4,SILENT:5},k.methodFactory=d||e,k.getLevel=function(){return j},k.setLevel=function(b,d){if("string"==typeof b&&void 0!==k.levels[b.toUpperCase()]&&(b=k.levels[b.toUpperCase()]),!("number"==typeof b&&b>=0&&b<=k.levels.SILENT))throw"log.setLevel() called with invalid level: "+b;if(j=b,!1!==d&&f(b),c.call(k,b,a),typeof console===h&&b<k.levels.SILENT)return"No console available for logging"},k.setDefaultLevel=function(a){g()||k.setLevel(a,!1)},k.enableAll=function(a){k.setLevel(k.levels.TRACE,a)},k.disableAll=function(a){k.setLevel(k.levels.SILENT,a)};var m=g();null==m&&(m=null==b?"WARN":b),k.setLevel(m,!1)}var g=function(){},h="undefined",i=["trace","debug","info","warn","error"],j=new f,k={};j.getLogger=function(a){if("string"!=typeof a||""===a)throw new TypeError("You must supply a name when creating a logger.");var b=k[a];return b||(b=k[a]=new f(a,j.getLevel(),j.methodFactory)),b};var l=typeof window!==h?window.log:void 0;return j.noConflict=function(){return typeof window!==h&&window.log===j&&(window.log=l),j},j.getLoggers=function(){return k},j}); \ No newline at end of file diff --git a/resources/app/node_modules/loglevel/lib/.jshintrc b/resources/app/node_modules/loglevel/lib/.jshintrc new file mode 100644 index 0000000..30c8c89 --- /dev/null +++ b/resources/app/node_modules/loglevel/lib/.jshintrc @@ -0,0 +1,20 @@ +{ + "curly": false, + "eqeqeq": true, + "immed": true, + "latedef": true, + "newcap": true, + "noarg": true, + "sub": true, + "undef": true, + "boss": true, + "eqnull": true, + "es3": true, + "globals": { + "console": false, + "exports": false, + "define": false, + "module": false, + "window": false + } +} diff --git a/resources/app/node_modules/loglevel/lib/loglevel.js b/resources/app/node_modules/loglevel/lib/loglevel.js new file mode 100644 index 0000000..5e10a37 --- /dev/null +++ b/resources/app/node_modules/loglevel/lib/loglevel.js @@ -0,0 +1,250 @@ +/* +* loglevel - https://github.com/pimterry/loglevel +* +* Copyright (c) 2013 Tim Perry +* Licensed under the MIT license. +*/ +(function (root, definition) { + "use strict"; + if (typeof define === 'function' && define.amd) { + define(definition); + } else if (typeof module === 'object' && module.exports) { + module.exports = definition(); + } else { + root.log = definition(); + } +}(this, function () { + "use strict"; + + // Slightly dubious tricks to cut down minimized file size + var noop = function() {}; + var undefinedType = "undefined"; + + var logMethods = [ + "trace", + "debug", + "info", + "warn", + "error" + ]; + + // Cross-browser bind equivalent that works at least back to IE6 + function bindMethod(obj, methodName) { + var method = obj[methodName]; + if (typeof method.bind === 'function') { + return method.bind(obj); + } else { + try { + return Function.prototype.bind.call(method, obj); + } catch (e) { + // Missing bind shim or IE8 + Modernizr, fallback to wrapping + return function() { + return Function.prototype.apply.apply(method, [obj, arguments]); + }; + } + } + } + + // Build the best logging method possible for this env + // Wherever possible we want to bind, not wrap, to preserve stack traces + function realMethod(methodName) { + if (methodName === 'debug') { + methodName = 'log'; + } + + if (typeof console === undefinedType) { + return false; // No method possible, for now - fixed later by enableLoggingWhenConsoleArrives + } else if (console[methodName] !== undefined) { + return bindMethod(console, methodName); + } else if (console.log !== undefined) { + return bindMethod(console, 'log'); + } else { + return noop; + } + } + + // These private functions always need `this` to be set properly + + function replaceLoggingMethods(level, loggerName) { + /*jshint validthis:true */ + for (var i = 0; i < logMethods.length; i++) { + var methodName = logMethods[i]; + this[methodName] = (i < level) ? + noop : + this.methodFactory(methodName, level, loggerName); + } + + // Define log.log as an alias for log.debug + this.log = this.debug; + } + + // In old IE versions, the console isn't present until you first open it. + // We build realMethod() replacements here that regenerate logging methods + function enableLoggingWhenConsoleArrives(methodName, level, loggerName) { + return function () { + if (typeof console !== undefinedType) { + replaceLoggingMethods.call(this, level, loggerName); + this[methodName].apply(this, arguments); + } + }; + } + + // By default, we use closely bound real methods wherever possible, and + // otherwise we wait for a console to appear, and then try again. + function defaultMethodFactory(methodName, level, loggerName) { + /*jshint validthis:true */ + return realMethod(methodName) || + enableLoggingWhenConsoleArrives.apply(this, arguments); + } + + function Logger(name, defaultLevel, factory) { + var self = this; + var currentLevel; + var storageKey = "loglevel"; + if (name) { + storageKey += ":" + name; + } + + function persistLevelIfPossible(levelNum) { + var levelName = (logMethods[levelNum] || 'silent').toUpperCase(); + + if (typeof window === undefinedType) return; + + // Use localStorage if available + try { + window.localStorage[storageKey] = levelName; + return; + } catch (ignore) {} + + // Use session cookie as fallback + try { + window.document.cookie = + encodeURIComponent(storageKey) + "=" + levelName + ";"; + } catch (ignore) {} + } + + function getPersistedLevel() { + var storedLevel; + + if (typeof window === undefinedType) return; + + try { + storedLevel = window.localStorage[storageKey]; + } catch (ignore) {} + + // Fallback to cookies if local storage gives us nothing + if (typeof storedLevel === undefinedType) { + try { + var cookie = window.document.cookie; + var location = cookie.indexOf( + encodeURIComponent(storageKey) + "="); + if (location !== -1) { + storedLevel = /^([^;]+)/.exec(cookie.slice(location))[1]; + } + } catch (ignore) {} + } + + // If the stored level is not valid, treat it as if nothing was stored. + if (self.levels[storedLevel] === undefined) { + storedLevel = undefined; + } + + return storedLevel; + } + + /* + * + * Public logger API - see https://github.com/pimterry/loglevel for details + * + */ + + self.name = name; + + self.levels = { "TRACE": 0, "DEBUG": 1, "INFO": 2, "WARN": 3, + "ERROR": 4, "SILENT": 5}; + + self.methodFactory = factory || defaultMethodFactory; + + self.getLevel = function () { + return currentLevel; + }; + + self.setLevel = function (level, persist) { + if (typeof level === "string" && self.levels[level.toUpperCase()] !== undefined) { + level = self.levels[level.toUpperCase()]; + } + if (typeof level === "number" && level >= 0 && level <= self.levels.SILENT) { + currentLevel = level; + if (persist !== false) { // defaults to true + persistLevelIfPossible(level); + } + replaceLoggingMethods.call(self, level, name); + if (typeof console === undefinedType && level < self.levels.SILENT) { + return "No console available for logging"; + } + } else { + throw "log.setLevel() called with invalid level: " + level; + } + }; + + self.setDefaultLevel = function (level) { + if (!getPersistedLevel()) { + self.setLevel(level, false); + } + }; + + self.enableAll = function(persist) { + self.setLevel(self.levels.TRACE, persist); + }; + + self.disableAll = function(persist) { + self.setLevel(self.levels.SILENT, persist); + }; + + // Initialize with the right level + var initialLevel = getPersistedLevel(); + if (initialLevel == null) { + initialLevel = defaultLevel == null ? "WARN" : defaultLevel; + } + self.setLevel(initialLevel, false); + } + + /* + * + * Top-level API + * + */ + + var defaultLogger = new Logger(); + + var _loggersByName = {}; + defaultLogger.getLogger = function getLogger(name) { + if (typeof name !== "string" || name === "") { + throw new TypeError("You must supply a name when creating a logger."); + } + + var logger = _loggersByName[name]; + if (!logger) { + logger = _loggersByName[name] = new Logger( + name, defaultLogger.getLevel(), defaultLogger.methodFactory); + } + return logger; + }; + + // Grab the current global log variable in case of overwrite + var _log = (typeof window !== undefinedType) ? window.log : undefined; + defaultLogger.noConflict = function() { + if (typeof window !== undefinedType && + window.log === defaultLogger) { + window.log = _log; + } + + return defaultLogger; + }; + + defaultLogger.getLoggers = function getLoggers() { + return _loggersByName; + }; + + return defaultLogger; +})); diff --git a/resources/app/node_modules/loglevel/package.json b/resources/app/node_modules/loglevel/package.json new file mode 100644 index 0000000..0b550d2 --- /dev/null +++ b/resources/app/node_modules/loglevel/package.json @@ -0,0 +1,80 @@ +{ + "_from": "loglevel@^1.5.1", + "_id": "[email protected]", + "_inBundle": false, + "_integrity": "sha1-4PyVEztu8nbNyIh82vJKpvFW+Po=", + "_location": "/loglevel", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "loglevel@^1.5.1", + "name": "loglevel", + "escapedName": "loglevel", + "rawSpec": "^1.5.1", + "saveSpec": null, + "fetchSpec": "^1.5.1" + }, + "_requiredBy": [ + "/" + ], + "_resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.6.1.tgz", + "_shasum": "e0fc95133b6ef276cdc8887cdaf24aa6f156f8fa", + "_spec": "loglevel@^1.5.1", + "author": { + "name": "Tim Perry", + "email": "[email protected]", + "url": "http://tim-perry.co.uk" + }, + "bugs": { + "url": "https://github.com/pimterry/loglevel/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Minimal lightweight logging for JavaScript, adding reliable log level methods to any available console.log methods", + "devDependencies": { + "grunt": "~0.4.5", + "grunt-cli": "~0.1.13", + "grunt-contrib-clean": "^0.6.0", + "grunt-contrib-concat": "~0.5.0", + "grunt-contrib-connect": "~0.8.0", + "grunt-contrib-jasmine": "~0.5.2", + "grunt-contrib-jshint": "^1.1.0", + "grunt-contrib-qunit": "~0.5.2", + "grunt-contrib-uglify": "~0.5.1", + "grunt-contrib-watch": "~0.6.1", + "grunt-coveralls": "^1.0.0", + "grunt-jasmine-node": "~0.2.1", + "grunt-open": "~0.2.3", + "grunt-preprocess": "^4.0.0", + "grunt-saucelabs": "^8.2.0", + "grunt-template-jasmine-istanbul": "~0.2.5", + "grunt-template-jasmine-requirejs": "~0.1.6", + "qunitjs": "1.14.0" + }, + "engines": { + "node": ">= 0.6.0" + }, + "homepage": "https://github.com/pimterry/loglevel", + "keywords": [ + "log", + "logger", + "logging", + "browser" + ], + "license": "MIT", + "main": "lib/loglevel", + "name": "loglevel", + "repository": { + "type": "git", + "url": "git://github.com/pimterry/loglevel.git" + }, + "scripts": { + "ci": "grunt ci", + "dist": "grunt dist", + "test": "grunt test", + "watch": "grunt watch" + }, + "version": "1.6.1" +} diff --git a/resources/app/node_modules/loglevel/test/.jshintrc b/resources/app/node_modules/loglevel/test/.jshintrc new file mode 100644 index 0000000..cfbbfc7 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/.jshintrc @@ -0,0 +1,34 @@ +{ + "curly": true, + "globalstrict": true, + "eqeqeq": true, + "immed": true, + "latedef": true, + "newcap": true, + "noarg": true, + "sub": true, + "undef": true, + "boss": true, + "eqnull": true, + "es3": true, + "globals": { + "window": true, + "console": true, + "define": false, + "require": false, + "exports": false, + "_": false, + "afterEach": false, + "beforeEach": false, + "confirm": false, + "context": false, + "describe": false, + "xdescribe": false, + "expect": false, + "it": false, + "jasmine": false, + "waitsFor": false, + "runs": false, + "Symbol": false + } +} diff --git a/resources/app/node_modules/loglevel/test/console-fallback-test.js b/resources/app/node_modules/loglevel/test/console-fallback-test.js new file mode 100644 index 0000000..58fda9d --- /dev/null +++ b/resources/app/node_modules/loglevel/test/console-fallback-test.js @@ -0,0 +1,98 @@ +"use strict"; + +function consoleLogIsCalledBy(log, methodName) { + it(methodName + " calls console.log", function() { + log.setLevel(log.levels.TRACE); + log[methodName]("Log message for call to " + methodName); + expect(console.log.calls.length).toEqual(1); + }); +} + +function mockConsole() { + return {"log" : jasmine.createSpy("console.log")}; +} + +define(['../lib/loglevel'], function(log) { + var originalConsole = window.console; + + describe("Fallback functionality:", function() { + describe("with no console present", function() { + beforeEach(function() { + window.console = undefined; + }); + + afterEach(function() { + window.console = originalConsole; + }); + + it("silent method calls are allowed", function() { + var result = log.setLevel(log.levels.SILENT); + log.trace("hello"); + + expect(result).toBeUndefined(); + }); + + it("setting an active level gently returns an error string", function() { + var result = log.setLevel(log.levels.TRACE); + expect(result).toEqual("No console available for logging"); + }); + + it("active method calls are allowed, once the active setLevel fails", function() { + log.setLevel(log.levels.TRACE); + log.trace("hello"); + }); + + describe("if a console later appears", function () { + it("logging is re-enabled and works correctly when next used", function () { + log.setLevel(log.levels.WARN); + + window.console = mockConsole(); + log.error("error"); + + expect(window.console.log).toHaveBeenCalled(); + }); + + it("logging is re-enabled but does nothing when used at a blocked level", function () { + log.setLevel(log.levels.WARN); + + window.console = mockConsole(); + log.trace("trace"); + + expect(window.console.log).not.toHaveBeenCalled(); + }); + + it("changing level works correctly from that point", function () { + window.console = mockConsole(); + var result = log.setLevel(log.levels.WARN); + + expect(result).toBeUndefined(); + }); + }); + }); + + describe("with a console that only supports console.log", function() { + beforeEach(function() { + window.console = mockConsole(); + }); + + afterEach(function() { + window.console = originalConsole; + }); + + it("log can be set to silent", function() { + log.setLevel(log.levels.SILENT); + }); + + it("log can be set to an active level", function() { + log.setLevel(log.levels.ERROR); + }); + + consoleLogIsCalledBy(log, "trace"); + consoleLogIsCalledBy(log, "debug"); + consoleLogIsCalledBy(log, "info"); + consoleLogIsCalledBy(log, "warn"); + consoleLogIsCalledBy(log, "trace"); + }); + }); +}); + diff --git a/resources/app/node_modules/loglevel/test/cookie-test.js b/resources/app/node_modules/loglevel/test/cookie-test.js new file mode 100644 index 0000000..ebe2f8f --- /dev/null +++ b/resources/app/node_modules/loglevel/test/cookie-test.js @@ -0,0 +1,122 @@ +"use strict"; + +define(['test/test-helpers'], function(testHelpers) { + var describeIf = testHelpers.describeIf; + var it = testHelpers.itWithFreshLog; + + var originalConsole = window.console; + var originalDocument = window.document; + + describeIf(testHelpers.isCookieStorageAvailable() && !testHelpers.isLocalStorageAvailable(), + "Cookie-only persistence tests:", function() { + + beforeEach(function() { + window.console = {"log" : jasmine.createSpy("console.log")}; + this.addMatchers({ + "toBeAtLevel" : testHelpers.toBeAtLevel, + "toBeTheStoredLevel" : testHelpers.toBeTheLevelStoredByCookie + }); + }); + + afterEach(function() { + window.console = originalConsole; + }); + + describe("If no level is saved", function() { + beforeEach(function() { + testHelpers.clearStoredLevels(); + }); + + it("log level is set to warn by default", function(log) { + expect(log).toBeAtLevel("warn"); + }); + + it("warn is persisted as the current level", function(log) { + expect("warn").toBeTheStoredLevel(); + }); + + it("log can be set to info level", function(log) { + log.setLevel("info"); + expect(log).toBeAtLevel("info"); + }); + + it("log.setLevel() sets a cookie with the given level", function(log) { + log.setLevel("debug"); + expect("debug").toBeTheStoredLevel(); + }); + }); + + describe("If info level is saved", function() { + beforeEach(function() { + testHelpers.setStoredLevel("info"); + }); + + it("info is the default log level", function(log) { + expect(log).toBeAtLevel("info"); + }); + + it("log can be changed to warn level", function(log) { + log.setLevel("warn"); + expect(log).toBeAtLevel("warn"); + }); + + it("log.setLevel() overwrites the saved level", function(log) { + log.setLevel("error"); + + expect("error").toBeTheStoredLevel(); + expect("info").not.toBeTheStoredLevel(); + }); + }); + + describe("If the level is saved with other data", function() { + beforeEach(function() { + window.document.cookie = "qwe=asd"; + window.document.cookie = "loglevel=ERROR"; + window.document.cookie = "msg=hello world"; + }); + + it("error is the default log level", function(log) { + expect(log).toBeAtLevel("error"); + }); + + it("log can be changed to silent level", function(log) { + log.setLevel("silent"); + expect(log).toBeAtLevel("silent"); + }); + + it("log.setLevel() overrides the saved level only", function(log) { + log.setLevel("debug"); + + expect('debug').toBeTheStoredLevel(); + expect(window.document.cookie).toContain("msg=hello world"); + }); + }); + + describe("If the level cookie is set incorrectly", function() { + beforeEach(function() { + testHelpers.setCookieStoredLevel('gibberish'); + }); + + it("warn is the default log level", function(log) { + expect(log).toBeAtLevel("warn"); + }); + + it("warn is persisted as the current level, overriding the invalid cookie", function(log) { + expect("warn").toBeTheStoredLevel(); + }); + + it("log can be changed to info level", function(log) { + log.setLevel("info"); + expect(log).toBeAtLevel("info"); + }); + + it("log.setLevel() overrides the saved level with the new level", function(log) { + expect('debug').not.toBeTheStoredLevel(); + + log.setLevel("debug"); + + expect('debug').toBeTheStoredLevel(); + }); + }); + }); +}); diff --git a/resources/app/node_modules/loglevel/test/default-level-test.js b/resources/app/node_modules/loglevel/test/default-level-test.js new file mode 100644 index 0000000..6e3e3c7 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/default-level-test.js @@ -0,0 +1,60 @@ +"use strict"; + +define(['test/test-helpers'], function(testHelpers) { + var describeIf = testHelpers.describeIf; + var it = testHelpers.itWithFreshLog; + + var originalConsole = window.console; + + describe("Setting default log level tests:", function() { + + beforeEach(function() { + window.console = {"log" : jasmine.createSpy("console.log")}; + this.addMatchers({ + "toBeAtLevel" : testHelpers.toBeAtLevel, + "toBeTheStoredLevel" : testHelpers.toBeTheLevelStoredByLocalStorage + }); + + testHelpers.clearStoredLevels(); + }); + + afterEach(function() { + window.console = originalConsole; + }); + + describe("If no level is saved", function() { + it("new level is always set", function(log) { + log.setDefaultLevel("trace"); + expect(log).toBeAtLevel("trace"); + }); + + it("level is not persisted", function(log) { + log.setDefaultLevel("debug"); + expect("debug").not.toBeTheStoredLevel(); + }); + }); + + describe("If a level is saved", function () { + beforeEach(function () { + testHelpers.setStoredLevel("trace"); + }); + + it("saved level is not modified", function (log) { + log.setDefaultLevel("debug"); + expect(log).toBeAtLevel("trace"); + }); + }); + + describe("If the level is stored incorrectly", function() { + beforeEach(function() { + testHelpers.setLocalStorageStoredLevel("gibberish"); + }); + + it("new level is set", function(log) { + log.setDefaultLevel("debug"); + expect(log).toBeAtLevel("debug"); + expect("debug").not.toBeTheStoredLevel(); + }); + }); + }); +}); diff --git a/resources/app/node_modules/loglevel/test/get-current-level-test.js b/resources/app/node_modules/loglevel/test/get-current-level-test.js new file mode 100644 index 0000000..01902ae --- /dev/null +++ b/resources/app/node_modules/loglevel/test/get-current-level-test.js @@ -0,0 +1,48 @@ +"use strict"; + +define(['test/test-helpers'], function(testHelpers) { + var describeIf = testHelpers.describeIf; + var it = testHelpers.itWithFreshLog; + + var originalConsole = window.console; + + describe("Setting default log level tests:", function() { + + beforeEach(function() { + window.console = {"log" : jasmine.createSpy("console.log")}; + }); + + afterEach(function() { + window.console = originalConsole; + }); + + describe("If no level is saved", function() { + it("current level is the default level", function(log) { + log.setDefaultLevel("trace"); + expect(log.getLevel()).toBe(log.levels.TRACE); + }); + }); + + describe("If a level is saved", function () { + beforeEach(function () { + testHelpers.setStoredLevel("trace"); + }); + + it("current level is the level which has been saved", function (log) { + log.setDefaultLevel("debug"); + expect(log.getLevel()).toBe(log.levels.TRACE); + }); + }); + + describe("If the level is stored incorrectly", function() { + beforeEach(function() { + testHelpers.setLocalStorageStoredLevel("gibberish"); + }); + + it("current level is the default level", function(log) { + log.setDefaultLevel("debug"); + expect(log.getLevel()).toBe(log.levels.DEBUG); + }); + }); + }); +}); diff --git a/resources/app/node_modules/loglevel/test/global-integration-with-new-context.js b/resources/app/node_modules/loglevel/test/global-integration-with-new-context.js new file mode 100644 index 0000000..b7324e5 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/global-integration-with-new-context.js @@ -0,0 +1,29 @@ +/* global MyCustomLogger, log */ +"use strict"; + +describe("loglevel from a global <script> tag with a custom context", function () { + it("is available globally", function () { + expect(MyCustomLogger).not.toBeUndefined(); + }); + + it("doesn't have log defined globally", function () { + expect(window.log).not.toBeDefined(); + }); + + it("allows setting the logging level", function () { + MyCustomLogger.setLevel(MyCustomLogger.levels.TRACE); + MyCustomLogger.setLevel(MyCustomLogger.levels.DEBUG); + MyCustomLogger.setLevel(MyCustomLogger.levels.INFO); + MyCustomLogger.setLevel(MyCustomLogger.levels.WARN); + MyCustomLogger.setLevel(MyCustomLogger.levels.ERROR); + }); + + it("successfully logs", function () { + window.console = { "log": jasmine.createSpy("log") }; + + MyCustomLogger.setLevel(MyCustomLogger.levels.INFO); + MyCustomLogger.info("test message"); + + expect(console.log).toHaveBeenCalledWith("test message"); + }); +}); diff --git a/resources/app/node_modules/loglevel/test/global-integration.js b/resources/app/node_modules/loglevel/test/global-integration.js new file mode 100644 index 0000000..149474c --- /dev/null +++ b/resources/app/node_modules/loglevel/test/global-integration.js @@ -0,0 +1,25 @@ +/* global log */ +"use strict"; + +describe("loglevel from a global <script> tag", function () { + it("is available globally", function () { + expect(log).not.toBeUndefined(); + }); + + it("allows setting the logging level", function () { + log.setLevel(log.levels.TRACE); + log.setLevel(log.levels.DEBUG); + log.setLevel(log.levels.INFO); + log.setLevel(log.levels.WARN); + log.setLevel(log.levels.ERROR); + }); + + it("successfully logs", function () { + window.console = { "log": jasmine.createSpy("log") }; + + log.setLevel(log.levels.INFO); + log.info("test message"); + + expect(console.log).toHaveBeenCalledWith("test message"); + }); +}); \ No newline at end of file diff --git a/resources/app/node_modules/loglevel/test/integration-smoke-test.js b/resources/app/node_modules/loglevel/test/integration-smoke-test.js new file mode 100644 index 0000000..7c7850e --- /dev/null +++ b/resources/app/node_modules/loglevel/test/integration-smoke-test.js @@ -0,0 +1,71 @@ +"use strict"; + +define(['../lib/loglevel', 'test/test-helpers'], function(log, testHelpers) { + var describeIf = testHelpers.describeIf; + var itIf = testHelpers.itIf; + + describe("Integration smoke tests:", function() { + describe("log methods", function() { + it("can all be disabled", function() { + log.setLevel(log.levels.SILENT); + log.trace("trace"); + log.debug("debug"); + log.log("log"); + log.info("info"); + log.warn("warn"); + log.error("error"); + }); + }); + + describeIf(typeof console !== "undefined", "log methods", function() { + it("can all be called", function() { + if (typeof console !== "undefined") { + log.setLevel(log.levels.TRACE); + } + + log.trace("trace"); + log.debug("debug"); + log.log("log"); + log.info("info"); + log.warn("warn"); + log.error("error"); + }); + }); + + describeIf(typeof console !== "undefined", "log levels", function() { + beforeEach(function() { + this.addMatchers({ + "toBeTheStoredLevel" : testHelpers.toBeTheStoredLevel + }); + }); + + it("are all settable", function() { + log.setLevel(log.levels.TRACE); + log.setLevel(log.levels.DEBUG); + log.setLevel(log.levels.INFO); + log.setLevel(log.levels.WARN); + log.setLevel(log.levels.ERROR); + }); + + itIf(testHelpers.isAnyLevelStoragePossible(), "are persisted", function() { + log.setLevel(log.levels.TRACE); + expect('trace').toBeTheStoredLevel(); + + log.setLevel(log.levels.DEBUG); + expect('debug').toBeTheStoredLevel(); + + log.setLevel(log.levels.INFO); + expect('info').toBeTheStoredLevel(); + + log.setLevel(log.levels.WARN); + expect('warn').toBeTheStoredLevel(); + + log.setLevel(log.levels.ERROR); + expect('error').toBeTheStoredLevel(); + + log.setLevel(log.levels.SILENT); + expect('silent').toBeTheStoredLevel(); + }); + }); + }); +}); diff --git a/resources/app/node_modules/loglevel/test/level-setting-test.js b/resources/app/node_modules/loglevel/test/level-setting-test.js new file mode 100644 index 0000000..f5d6d13 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/level-setting-test.js @@ -0,0 +1,281 @@ +"use strict"; + +var logMethods = [ + "trace", + "debug", + "info", + "warn", + "error" +]; + +function getConsoleMethod(logMethodName) { + if (logMethodName === 'debug') { + return console.log; + } else { + return console[logMethodName]; + } +} + +define(['../lib/loglevel'], function(log) { + var originalConsole = window.console; + + describe("Basic log levels changing tests:", function() { + beforeEach(function() { + window.console = {}; + + for (var ii = 0; ii < logMethods.length; ii++) { + window.console[logMethods[ii]] = jasmine.createSpy(logMethods[ii]); + } + + window.console.log = jasmine.createSpy('log'); + }); + + afterEach(function() { + window.console = originalConsole; + }); + + describe("log.enableAll()", function() { + it("enables all log methods", function() { + log.enableAll(false); + + for (var ii = 0; ii < logMethods.length; ii++) { + var method = logMethods[ii]; + log[method]("a log message"); + + expect(getConsoleMethod(method)).toHaveBeenCalled(); + } + }); + }); + + describe("log.disableAll()", function() { + it("disables all log methods", function() { + log.disableAll(false); + + for (var ii = 0; ii < logMethods.length; ii++) { + var method = logMethods[ii]; + log[method]("a log message"); + + expect(getConsoleMethod(method)).not.toHaveBeenCalled(); + } + }); + }); + + describe("log.setLevel() throws errors if given", function() { + it("no level argument", function() { + expect(function() { + log.setLevel(); + }).toThrow("log.setLevel() called with invalid level: undefined"); + }); + + it("a null level argument", function() { + expect(function() { + log.setLevel(null); + }).toThrow("log.setLevel() called with invalid level: null"); + }); + + it("an undefined level argument", function() { + expect(function() { + log.setLevel(undefined); + }).toThrow("log.setLevel() called with invalid level: undefined"); + }); + + it("an invalid log level index", function() { + expect(function() { + log.setLevel(-1); + }).toThrow("log.setLevel() called with invalid level: -1"); + }); + + it("an invalid log level name", function() { + expect(function() { + log.setLevel("InvalidLevelName"); + }).toThrow("log.setLevel() called with invalid level: InvalidLevelName"); + }); + }); + + describe("setting log level by name", function() { + function itCanSetLogLevelTo(level) { + it("can set log level to " + level, function() { + log.setLevel(level, false); + + log[level]("log message"); + expect(getConsoleMethod(level)).toHaveBeenCalled(); + }); + } + + itCanSetLogLevelTo("trace"); + itCanSetLogLevelTo("debug"); + itCanSetLogLevelTo("info"); + itCanSetLogLevelTo("warn"); + itCanSetLogLevelTo("error"); + }); + + describe("log level settings", function() { + describe("log.trace", function() { + it("is enabled at trace level", function() { + log.setLevel(log.levels.TRACE); + + log.trace("a log message"); + expect(console.trace).toHaveBeenCalled(); + }); + + it("is disabled at debug level", function() { + log.setLevel(log.levels.DEBUG); + + log.trace("a log message"); + expect(console.trace).not.toHaveBeenCalled(); + }); + + it("is disabled at silent level", function() { + log.setLevel(log.levels.SILENT); + + log.trace("a log message"); + expect(console.trace).not.toHaveBeenCalled(); + }); + }); + + describe("log.debug", function() { + it("is enabled at trace level", function() { + log.setLevel(log.levels.TRACE); + + log.debug("a log message"); + expect(console.log).toHaveBeenCalled(); + }); + + it("is enabled at debug level", function() { + log.setLevel(log.levels.DEBUG); + + log.debug("a log message"); + expect(console.log).toHaveBeenCalled(); + }); + + it("is disabled at info level", function() { + log.setLevel(log.levels.INFO); + + log.debug("a log message"); + expect(console.log).not.toHaveBeenCalled(); + }); + + it("is disabled at silent level", function() { + log.setLevel(log.levels.SILENT); + + log.debug("a log message"); + expect(console.log).not.toHaveBeenCalled(); + }); + }); + + describe("log.log", function() { + it("is enabled at trace level", function() { + log.setLevel(log.levels.TRACE); + + log.log("a log message"); + expect(console.log).toHaveBeenCalled(); + }); + + it("is enabled at debug level", function() { + log.setLevel(log.levels.DEBUG); + + log.log("a log message"); + expect(console.log).toHaveBeenCalled(); + }); + + it("is disabled at info level", function() { + log.setLevel(log.levels.INFO); + + log.log("a log message"); + expect(console.log).not.toHaveBeenCalled(); + }); + + it("is disabled at silent level", function() { + log.setLevel(log.levels.SILENT); + + log.log("a log message"); + expect(console.log).not.toHaveBeenCalled(); + }); + }); + + describe("log.info", function() { + it("is enabled at debug level", function() { + log.setLevel(log.levels.DEBUG); + + log.info("a log message"); + expect(console.info).toHaveBeenCalled(); + }); + + it("is enabled at info level", function() { + log.setLevel(log.levels.INFO); + + log.info("a log message"); + expect(console.info).toHaveBeenCalled(); + }); + + it("is disabled at warn level", function() { + log.setLevel(log.levels.WARN); + + log.info("a log message"); + expect(console.info).not.toHaveBeenCalled(); + }); + + it("is disabled at silent level", function() { + log.setLevel(log.levels.SILENT); + + log.info("a log message"); + expect(console.info).not.toHaveBeenCalled(); + }); + }); + + describe("log.warn", function() { + it("is enabled at info level", function() { + log.setLevel(log.levels.INFO); + + log.warn("a log message"); + expect(console.warn).toHaveBeenCalled(); + }); + + it("is enabled at warn level", function() { + log.setLevel(log.levels.WARN); + + log.warn("a log message"); + expect(console.warn).toHaveBeenCalled(); + }); + + it("is disabled at error level", function() { + log.setLevel(log.levels.ERROR); + + log.warn("a log message"); + expect(console.warn).not.toHaveBeenCalled(); + }); + + it("is disabled at silent level", function() { + log.setLevel(log.levels.SILENT); + + log.warn("a log message"); + expect(console.warn).not.toHaveBeenCalled(); + }); + }); + + describe("log.error", function() { + it("is enabled at warn level", function() { + log.setLevel(log.levels.WARN); + + log.error("a log message"); + expect(console.error).toHaveBeenCalled(); + }); + + it("is enabled at error level", function() { + log.setLevel(log.levels.ERROR); + + log.error("a log message"); + expect(console.error).toHaveBeenCalled(); + }); + + it("is disabled at silent level", function() { + log.setLevel(log.levels.SILENT); + + log.error("a log message"); + expect(console.error).not.toHaveBeenCalled(); + }); + }); + }); + }); +}); + diff --git a/resources/app/node_modules/loglevel/test/local-storage-test.js b/resources/app/node_modules/loglevel/test/local-storage-test.js new file mode 100644 index 0000000..2f843df --- /dev/null +++ b/resources/app/node_modules/loglevel/test/local-storage-test.js @@ -0,0 +1,201 @@ +"use strict"; + +define(['test/test-helpers'], function(testHelpers) { + var describeIf = testHelpers.describeIf; + var it = testHelpers.itWithFreshLog; + + var originalConsole = window.console; + + describeIf(testHelpers.isLocalStorageAvailable(), "Local storage persistence tests:", function() { + + beforeEach(function() { + window.console = {"log" : jasmine.createSpy("console.log")}; + this.addMatchers({ + "toBeAtLevel" : testHelpers.toBeAtLevel, + "toBeTheStoredLevel" : testHelpers.toBeTheLevelStoredByLocalStorage, + "toBeTheLevelStoredByLocalStorage": testHelpers.toBeTheLevelStoredByLocalStorage, + "toBeTheLevelStoredByCookie": testHelpers.toBeTheLevelStoredByCookie + }); + + testHelpers.clearStoredLevels(); + }); + + afterEach(function() { + window.console = originalConsole; + }); + + describe("If no level is saved", function() { + it("log level is set to warn by default", function(log) { + expect(log).toBeAtLevel("warn"); + }); + + it("warn is not persisted as the current level", function(log) { + expect("warn").not.toBeTheStoredLevel(); + }); + + it("log can be set to info level", function(log) { + log.setLevel("info"); + expect(log).toBeAtLevel("info"); + }); + + it("log.setLevel() sets a cookie with the given level", function(log) { + log.setLevel("debug"); + expect("debug").toBeTheStoredLevel(); + }); + + it("log.setLevel() does not set a cookie if `persist` argument is false", function(log) { + log.setLevel("debug", false); + expect("debug").not.toBeTheStoredLevel(); + }); + }); + + describe("If trace level is saved", function () { + beforeEach(function () { + testHelpers.setStoredLevel("trace"); + }); + + it("trace is the default log level", function (log) { + expect(log).toBeAtLevel("trace"); + }); + }); + + describe("If debug level is saved", function () { + beforeEach(function () { + testHelpers.setStoredLevel("debug"); + }); + + it("debug is the default log level", function (log) { + expect(log).toBeAtLevel("debug"); + }); + }); + + describe("If info level is saved", function() { + beforeEach(function() { + testHelpers.setStoredLevel("info"); + }); + + it("info is the default log level", function(log) { + expect(log).toBeAtLevel("info"); + }); + + it("log can be changed to warn level", function(log) { + log.setLevel("warn"); + expect(log).toBeAtLevel("warn"); + }); + + it("log.setLevel() overwrites the saved level", function(log) { + log.setLevel("error"); + + expect("error").toBeTheStoredLevel(); + expect("info").not.toBeTheStoredLevel(); + }); + + it("log.setLevel() does not overwrite the saved level if `persist` argument is false", function(log) { + log.setLevel("error", false); + + expect("info").toBeTheStoredLevel(); + expect("error").not.toBeTheStoredLevel(); + }); + }); + + describe("If warn level is saved", function () { + beforeEach(function () { + testHelpers.setStoredLevel("warn"); + }); + + it("warn is the default log level", function (log) { + expect(log).toBeAtLevel("warn"); + }); + }); + + describe("If error level is saved", function () { + beforeEach(function () { + testHelpers.setStoredLevel("error"); + }); + + it("error is the default log level", function (log) { + expect(log).toBeAtLevel("error"); + }); + }); + + + describe("If the level is saved with other data", function() { + beforeEach(function() { + window.localStorage['qwe'] = "asd"; + window.localStorage['loglevel'] = "ERROR"; + window.localStorage['msg'] = "hello world"; + }); + + it("error is the default log level", function(log) { + expect(log).toBeAtLevel("error"); + }); + + it("log can be changed to silent level", function(log) { + log.setLevel("silent"); + expect(log).toBeAtLevel("silent"); + }); + + it("log.setLevel() overrides the saved level only", function(log) { + log.setLevel("debug"); + + expect('debug').toBeTheStoredLevel(); + expect(window.localStorage['msg']).toBe("hello world"); + }); + }); + + describe("If the level is stored incorrectly", function() { + beforeEach(function() { + testHelpers.setLocalStorageStoredLevel('gibberish'); + }); + + it("warn is the default log level", function(log) { + expect(log).toBeAtLevel("warn"); + }); + + it("warn is not persisted as the current level", function(log) { + expect("warn").not.toBeTheStoredLevel(); + }); + + it("log can be changed to info level", function(log) { + log.setLevel("info"); + expect(log).toBeAtLevel("info"); + }); + + it("log.setLevel() overrides the saved level with the new level", function(log) { + expect('debug').not.toBeTheStoredLevel(); + + log.setLevel("debug"); + + expect('debug').toBeTheStoredLevel(); + }); + }); + + describeIf(testHelpers.isCookieStorageAvailable() && testHelpers.isLocalStorageAvailable(), + "if localStorage and cookies are both available", function () { + + it("the level stored in cookies is ignored if a local storage level is set", function () { + testHelpers.setCookieStoredLevel("info"); + testHelpers.setLocalStorageStoredLevel("debug"); + + testHelpers.withFreshLog(function (log) { + expect(log).toBeAtLevel("debug"); + }); + }); + + it("the level stored in cookies is used if no local storage level is set", function () { + testHelpers.setCookieStoredLevel("info"); + window.localStorage.clear(); + + testHelpers.withFreshLog(function (log) { + expect(log).toBeAtLevel("info"); + }); + }); + + it("the local storage level is set and the cookie level is not", function (log) { + log.setLevel("error"); + expect("error").toBeTheLevelStoredByLocalStorage(); + expect("error").not.toBeTheLevelStoredByCookie(); + }); + }); + }); +}); diff --git a/resources/app/node_modules/loglevel/test/manual-test.html b/resources/app/node_modules/loglevel/test/manual-test.html new file mode 100644 index 0000000..9b24a65 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/manual-test.html @@ -0,0 +1,8 @@ +<html> +<head> + <title>Standalone manual test bed for loglevel</title> +</head> +<body> +<script src="../lib/loglevel.js"></script> +</body> +</html> \ No newline at end of file diff --git a/resources/app/node_modules/loglevel/test/method-factory-test.js b/resources/app/node_modules/loglevel/test/method-factory-test.js new file mode 100644 index 0000000..aa80fc6 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/method-factory-test.js @@ -0,0 +1,42 @@ +"use strict"; + +define(['test/test-helpers'], function(testHelpers) { + var it = testHelpers.itWithFreshLog; + + describe("Setting the methodFactory tests:", function() { + + it("methodFactory should be called once for each loggable level", function(log) { + log.methodFactory = jasmine.createSpy("methodFactory"); + + log.setLevel("trace"); + expect(log.methodFactory.calls.length).toEqual(5); + expect(log.methodFactory.argsForCall[0]).toEqual(["trace", 0, undefined]); + expect(log.methodFactory.argsForCall[1]).toEqual(["debug", 0, undefined]); + expect(log.methodFactory.argsForCall[2]).toEqual(["info", 0, undefined]); + expect(log.methodFactory.argsForCall[3]).toEqual(["warn", 0, undefined]); + expect(log.methodFactory.argsForCall[4]).toEqual(["error", 0, undefined]); + + log.setLevel("error"); + expect(log.methodFactory.calls.length).toEqual(6); + expect(log.methodFactory.argsForCall[5]).toEqual(["error", 4, undefined]); + }); + + it("functions returned by methodFactory should be used as logging functions", function(log) { + var logFunction = function() {}; + log.methodFactory = function() { return logFunction; }; + log.setLevel("error"); + + expect(log.warn).not.toEqual(logFunction); + expect(log.error).toEqual(logFunction); + }); + + it("the third argument should be logger's name", function(log) { + var logger = log.getLogger("newLogger"); + logger.methodFactory = jasmine.createSpy("methodFactory"); + + logger.setLevel("error"); + expect(logger.methodFactory.argsForCall[0]).toEqual(["error", 4, "newLogger"]); + }); + + }); +}); diff --git a/resources/app/node_modules/loglevel/test/multiple-logger-test.js b/resources/app/node_modules/loglevel/test/multiple-logger-test.js new file mode 100644 index 0000000..ba132e6 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/multiple-logger-test.js @@ -0,0 +1,139 @@ +"use strict"; + +define(['test/test-helpers'], function(testHelpers) { + var describeIf = testHelpers.describeIf; + var it = testHelpers.itWithFreshLog; + + var originalConsole = window.console; + + describe("Multiple logger instances tests:", function() { + + describe("log.getLogger()", function() { + it("returns a new logger that is not the default one", function(log) { + var newLogger = log.getLogger("newLogger"); + expect(newLogger).not.toEqual(log); + expect(newLogger.trace).toBeDefined(); + expect(newLogger.debug).toBeDefined(); + expect(newLogger.info).toBeDefined(); + expect(newLogger.warn).toBeDefined(); + expect(newLogger.error).toBeDefined(); + expect(newLogger.setLevel).toBeDefined(); + expect(newLogger.setDefaultLevel).toBeDefined(); + expect(newLogger.enableAll).toBeDefined(); + expect(newLogger.disableAll).toBeDefined(); + expect(newLogger.methodFactory).toBeDefined(); + }); + + it("returns loggers without `getLogger()` and `noConflict()`", function(log) { + var newLogger = log.getLogger("newLogger"); + expect(newLogger.getLogger).toBeUndefined(); + expect(newLogger.noConflict).toBeUndefined(); + }); + + it("returns the same instance when called repeatedly with the same name", function(log) { + var logger1 = log.getLogger("newLogger"); + var logger2 = log.getLogger("newLogger"); + + expect(logger1).toEqual(logger2); + }); + + it("should throw if called with no name", function(log) { + expect(function() { + log.getLogger(); + }).toThrow(); + }); + + it("should throw if called with empty string for name", function(log) { + expect(function() { + log.getLogger(""); + }).toThrow(); + }); + + it("should throw if called with a non-string name", function(log) { + expect(function() { log.getLogger(true); }).toThrow(); + expect(function() { log.getLogger({}); }).toThrow(); + expect(function() { log.getLogger([]); }).toThrow(); + expect(function() { log.getLogger(10); }).toThrow(); + expect(function() { log.getLogger(function(){}); }).toThrow(); + expect(function() { log.getLogger(null); }).toThrow(); + expect(function() { log.getLogger(undefined); }).toThrow(); + if (window.Symbol) { + expect(function() { log.getLogger(Symbol()); }).toThrow(); + } + }); + }); + + describe("inheritance", function() { + beforeEach(function() { + window.console = {"log" : jasmine.createSpy("console.log")}; + this.addMatchers({ + "toBeAtLevel" : testHelpers.toBeAtLevel + }); + testHelpers.clearStoredLevels(); + }); + + afterEach(function() { + window.console = originalConsole; + }); + + it("loggers are created with the same level as the default logger", function(log) { + log.setLevel("ERROR"); + var newLogger = log.getLogger("newLogger"); + expect(newLogger).toBeAtLevel("error"); + }); + + it("if a logger's level is persisted, it uses that level rather than the default logger's level", function(log) { + testHelpers.setStoredLevel("error", "newLogger"); + log.setLevel("TRACE"); + var newLogger = log.getLogger("newLogger"); + expect(newLogger).toBeAtLevel("error"); + }); + + it("other loggers do not change when the default logger's level is changed", function(log) { + log.setLevel("TRACE"); + var newLogger = log.getLogger("newLogger"); + log.setLevel("ERROR"); + expect(newLogger).toBeAtLevel("TRACE"); + expect(log.getLogger("newLogger")).toBeAtLevel("TRACE"); + }); + + it("loggers are created with the same methodFactory as the default logger", function(log) { + log.methodFactory = function(methodName, level) { + return function() {}; + }; + + var newLogger = log.getLogger("newLogger"); + expect(newLogger.methodFactory).toEqual(log.methodFactory); + }); + + it("loggers have independent method factories", function(log) { + var log1 = log.getLogger('logger1'); + var log2 = log.getLogger('logger2'); + + var log1Spy = jasmine.createSpy('log1spy'); + log1.methodFactory = function(methodName, level) { + return log1Spy; + }; + log1.setLevel(log1.getLevel()); + + var log2Spy = jasmine.createSpy('log2spy'); + log2.methodFactory = function(methodName, level) { + return log2Spy; + }; + log2.setLevel(log2.getLevel()); + + log1.error('test1'); + log2.error('test2'); + + expect(log1Spy).toHaveBeenCalledWith("test1"); + expect(log2Spy).toHaveBeenCalledWith("test2"); + }); + + it("new loggers correctly inherit a logging level of `0`", function(log) { + log.setLevel(0); + var newLogger = log.getLogger("newLogger"); + expect(newLogger).toBeAtLevel("trace"); + }); + }); + }); +}); diff --git a/resources/app/node_modules/loglevel/test/node-integration.js b/resources/app/node_modules/loglevel/test/node-integration.js new file mode 100644 index 0000000..f1d1d1f --- /dev/null +++ b/resources/app/node_modules/loglevel/test/node-integration.js @@ -0,0 +1,27 @@ +"use strict"; + +describe("loglevel included via node", function () { + it("is included successfully", function () { + expect(require('../lib/loglevel')).not.toBeUndefined(); + }); + + it("allows setting the logging level", function () { + var log = require('../lib/loglevel'); + + log.setLevel(log.levels.TRACE); + log.setLevel(log.levels.DEBUG); + log.setLevel(log.levels.INFO); + log.setLevel(log.levels.WARN); + log.setLevel(log.levels.ERROR); + }); + + it("successfully logs", function () { + var log = require('../lib/loglevel'); + console.info = jasmine.createSpy("info"); + + log.setLevel(log.levels.INFO); + log.info("test message"); + + expect(console.info).toHaveBeenCalledWith("test message"); + }); +}); \ No newline at end of file diff --git a/resources/app/node_modules/loglevel/test/test-context-using-apply.js b/resources/app/node_modules/loglevel/test/test-context-using-apply.js new file mode 100644 index 0000000..4e57669 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/test-context-using-apply.js @@ -0,0 +1,6 @@ +"use strict"; +/* jshint node:true */ +var MyCustomLogger = (function() { + // @include ../lib/loglevel.js + return this.log; +}).apply({}); diff --git a/resources/app/node_modules/loglevel/test/test-helpers.js b/resources/app/node_modules/loglevel/test/test-helpers.js new file mode 100644 index 0000000..12cc4e5 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/test-helpers.js @@ -0,0 +1,168 @@ +"use strict"; + +if (typeof window === "undefined") { + window = {}; +} + +var logMethods = [ + "trace", + "debug", + "info", + "warn", + "error" +]; + +define(function () { + function getStorageKey(loggerName) { + var key = "loglevel"; + if (loggerName) { + key += ":" + loggerName; + } + return key; + } + + var self = {}; + + // Jasmine matcher to check the log level of a log object + self.toBeAtLevel = function toBeAtLevel(level) { + var log = this.actual; + var expectedWorkingCalls = log.levels.SILENT - log.levels[level.toUpperCase()]; + var realLogMethod = window.console.log; + var priorCalls = realLogMethod.calls.length; + + for (var ii = 0; ii < logMethods.length; ii++) { + var methodName = logMethods[ii]; + log[methodName](methodName); + } + + expect(realLogMethod.calls.length - priorCalls).toEqual(expectedWorkingCalls); + return true; + }; + + self.isCookieStorageAvailable = function isCookieStorageAvailable() { + if (window && window.document && window.document.cookie) { + // We need to check not just that the cookie objects are available, but that they work, because + // if we run from file:// URLs they appear present but are non-functional + window.document.cookie = "test=hi;"; + + var result = window.document.cookie.indexOf('test=hi') !== -1; + window.document.cookie = "test=; expires=Thu, 01 Jan 1970 00:00:01 GMT;"; + + return result; + } else { + return false; + } + }; + + self.isLocalStorageAvailable = function isLocalStorageAvailable() { + try { + return !!window.localStorage; + } catch (e){ + return false; + } + }; + + self.isAnyLevelStoragePossible = function isAnyLevelStoragePossible() { + return self.isCookieStorageAvailable() || self.isLocalStorageAvailable(); + }; + + self.toBeTheLevelStoredByCookie = function toBeTheLevelStoredByCookie(name) { + var level = this.actual.toUpperCase(); + var storageKey = encodeURIComponent(getStorageKey(name)); + + if (window.document.cookie.indexOf(storageKey + "=" + level) !== -1) { + return true; + } else { + return false; + } + }; + + self.toBeTheLevelStoredByLocalStorage = function toBeTheLevelStoredByLocalStorage(name) { + var level = this.actual.toUpperCase(); + + if (window.localStorage[getStorageKey(name)] === level) { + return true; + } + + return false; + }; + + // Jasmine matcher to check whether a given string was saved by loglevel + self.toBeTheStoredLevel = function toBeTheStoredLevel(name) { + return self.toBeTheLevelStoredByLocalStorage.call(this, name) || + self.toBeTheLevelStoredByCookie.call(this, name); + }; + + self.setCookieStoredLevel = function setCookieStoredLevel(level, name) { + window.document.cookie = + encodeURIComponent(getStorageKey(name)) + "=" + + level.toUpperCase() + ";"; + }; + + self.setLocalStorageStoredLevel = function setLocalStorageStoredLevel(level, name) { + window.localStorage[getStorageKey(name)] = level.toUpperCase(); + }; + + self.setStoredLevel = function setStoredLevel(level, name) { + if (self.isCookieStorageAvailable()) { + self.setCookieStoredLevel(level, name); + } + if (self.isLocalStorageAvailable()) { + self.setLocalStorageStoredLevel(level, name); + } + }; + + self.clearStoredLevels = function clearStoredLevels() { + if (self.isLocalStorageAvailable()) { + window.localStorage.clear(); + } + if (self.isCookieStorageAvailable()) { + var storedKeys = window.document.cookie.match(/(?:^|;\s)(loglevel(\:\w+)?)(?=\=)/g); + if (storedKeys) { + for (var i = 0; i < storedKeys.length; i++) { + window.document.cookie = storedKeys[i] + "=; expires=Thu, 01 Jan 1970 00:00:01 GMT;"; + } + } + } + }; + + self.describeIf = function describeIf(condition, name, test) { + if (condition) { + jasmine.getEnv().describe(name, test); + } + }; + + self.itIf = function itIf(condition, name, test) { + if (condition) { + jasmine.getEnv().it(name, test); + } + }; + + // Forcibly reloads loglevel, and asynchronously hands the resulting log back to the given callback + // via Jasmine async magic + self.withFreshLog = function withFreshLog(toRun) { + require.undef("lib/loglevel"); + + var freshLog; + + waitsFor(function() { + require(['lib/loglevel'], function(log) { + freshLog = log; + }); + return typeof freshLog !== "undefined"; + }); + + runs(function() { + toRun(freshLog); + }); + }; + + // Wraps Jasmine's it(name, test) call to reload the loglevel dependency for the given test + self.itWithFreshLog = function itWithFreshLog(name, test) { + jasmine.getEnv().it(name, function() { + self.withFreshLog(test); + }); + }; + + return self; +}); diff --git a/resources/app/node_modules/loglevel/test/test-qunit.html b/resources/app/node_modules/loglevel/test/test-qunit.html new file mode 100644 index 0000000..d2b8c5d --- /dev/null +++ b/resources/app/node_modules/loglevel/test/test-qunit.html @@ -0,0 +1,19 @@ +<!DOCTYPE html> +<html> +<head> + <meta charset="utf-8"> + <title>QUnit Integration Test</title> + <link rel="stylesheet" href="../node_modules/qunitjs/qunit/qunit.css"> +</head> +<body> + <script src="../lib/loglevel.js" loglevel-name="logging"></script> + <script> + var logging = log.noConflict(); + </script> + <!-- Pretend the users code is included here --> + <div id="qunit"></div> + <div id="qunit-fixture"></div> + <script src="../node_modules/qunitjs/qunit/qunit.js"></script> + <script src="test-qunit.js"></script> +</body> +</html> diff --git a/resources/app/node_modules/loglevel/test/test-qunit.js b/resources/app/node_modules/loglevel/test/test-qunit.js new file mode 100644 index 0000000..b0f7670 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/test-qunit.js @@ -0,0 +1,51 @@ +"use strict"; + +/*global document*/ +var fixture = document.getElementById("qunit-fixture"); + +/*global QUnit*/ +QUnit.module('loglevel', { + setup: function() { + }, + teardown: function() { + } +}); + +/*global test*/ +test('basic test', function() { + /*global ok*/ + /*global logging*/ + /*global log*/ + + // Check that noConflict restored the original log + ok(typeof log === "function", "log is a function"); + ok(log === QUnit.log, "log is Qunit.log"); + + // Check that noConflict setup logging + ok(typeof logging !== "undefined", "logging is defined"); + ok(typeof logging === "object", "logging is an object"); + ok(typeof logging.trace === "function", "trace is a function"); + ok(typeof logging.debug === "function", "debug is a function"); + ok(typeof logging.info === "function", "info is a function"); + ok(typeof logging.warn === "function", "warn is a function"); + ok(typeof logging.error === "function", "error is a function"); + ok(typeof logging.setLevel === "function", "setLevel is a function"); + ok(typeof logging.setDefaultLevel === "function", "setDefaultLevel is a function"); + ok(typeof logging.enableAll === "function", "enableAll is a function"); + ok(typeof logging.disableAll === "function", "disableAll is a function"); + ok(typeof logging.getLogger === "function", "getLogger is a function"); + + // Use the API to make sure it doesn't blantantly fail with exceptions + logging.trace("a trace message"); + logging.debug("a debug message"); + logging.info("an info message"); + logging.warn("a warn message"); + logging.error("an error message"); + + var newLogger = logging.getLogger("newLogger"); + newLogger.trace("a trace message"); + newLogger.debug("a debug message"); + newLogger.info("an info message"); + newLogger.warn("a warn message"); + newLogger.error("an error message"); +}); diff --git a/resources/app/node_modules/loglevel/test/vendor/json2.js b/resources/app/node_modules/loglevel/test/vendor/json2.js new file mode 100644 index 0000000..f7eb646 --- /dev/null +++ b/resources/app/node_modules/loglevel/test/vendor/json2.js @@ -0,0 +1,486 @@ +/* + json2.js + 2012-10-08 + + Public Domain. + + NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK. + + See http://www.JSON.org/js.html + + + This code should be minified before deployment. + See http://javascript.crockford.com/jsmin.html + + USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO + NOT CONTROL. + + + This file creates a global JSON object containing two methods: stringify + and parse. + + JSON.stringify(value, replacer, space) + value any JavaScript value, usually an object or array. + + replacer an optional parameter that determines how object + values are stringified for objects. It can be a + function or an array of strings. + + space an optional parameter that specifies the indentation + of nested structures. If it is omitted, the text will + be packed without extra whitespace. If it is a number, + it will specify the number of spaces to indent at each + level. If it is a string (such as '\t' or ' '), + it contains the characters used to indent at each level. + + This method produces a JSON text from a JavaScript value. + + When an object value is found, if the object contains a toJSON + method, its toJSON method will be called and the result will be + stringified. A toJSON method does not serialize: it returns the + value represented by the name/value pair that should be serialized, + or undefined if nothing should be serialized. The toJSON method + will be passed the key associated with the value, and this will be + bound to the value + + For example, this would serialize Dates as ISO strings. + + Date.prototype.toJSON = function (key) { + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + return this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z'; + }; + + You can provide an optional replacer method. It will be passed the + key and value of each member, with this bound to the containing + object. The value that is returned from your method will be + serialized. If your method returns undefined, then the member will + be excluded from the serialization. + + If the replacer parameter is an array of strings, then it will be + used to select the members to be serialized. It filters the results + such that only members with keys listed in the replacer array are + stringified. + + Values that do not have JSON representations, such as undefined or + functions, will not be serialized. Such values in objects will be + dropped; in arrays they will be replaced with null. You can use + a replacer function to replace those with JSON values. + JSON.stringify(undefined) returns undefined. + + The optional space parameter produces a stringification of the + value that is filled with line breaks and indentation to make it + easier to read. + + If the space parameter is a non-empty string, then that string will + be used for indentation. If the space parameter is a number, then + the indentation will be that many spaces. + + Example: + + text = JSON.stringify(['e', {pluribus: 'unum'}]); + // text is '["e",{"pluribus":"unum"}]' + + + text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t'); + // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]' + + text = JSON.stringify([new Date()], function (key, value) { + return this[key] instanceof Date ? + 'Date(' + this[key] + ')' : value; + }); + // text is '["Date(---current time---)"]' + + + JSON.parse(text, reviver) + This method parses a JSON text to produce an object or array. + It can throw a SyntaxError exception. + + The optional reviver parameter is a function that can filter and + transform the results. It receives each of the keys and values, + and its return value is used instead of the original value. + If it returns what it received, then the structure is not modified. + If it returns undefined then the member is deleted. + + Example: + + // Parse the text. Values that look like ISO date strings will + // be converted to Date objects. + + myData = JSON.parse(text, function (key, value) { + var a; + if (typeof value === 'string') { + a = +/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value); + if (a) { + return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4], + +a[5], +a[6])); + } + } + return value; + }); + + myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) { + var d; + if (typeof value === 'string' && + value.slice(0, 5) === 'Date(' && + value.slice(-1) === ')') { + d = new Date(value.slice(5, -1)); + if (d) { + return d; + } + } + return value; + }); + + + This is a reference implementation. You are free to copy, modify, or + redistribute. +*/ + +/*jslint evil: true, regexp: true */ + +/*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply, + call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours, + getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join, + lastIndex, length, parse, prototype, push, replace, slice, stringify, + test, toJSON, toString, valueOf +*/ + + +// Create a JSON object only if one does not already exist. We create the +// methods in a closure to avoid creating global variables. + +if (typeof JSON !== 'object') { + JSON = {}; +} + +(function () { + 'use strict'; + + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + if (typeof Date.prototype.toJSON !== 'function') { + + Date.prototype.toJSON = function (key) { + + return isFinite(this.valueOf()) + ? this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z' + : null; + }; + + String.prototype.toJSON = + Number.prototype.toJSON = + Boolean.prototype.toJSON = function (key) { + return this.valueOf(); + }; + } + + var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + gap, + indent, + meta = { // table of character substitutions + '\b': '\\b', + '\t': '\\t', + '\n': '\\n', + '\f': '\\f', + '\r': '\\r', + '"' : '\\"', + '\\': '\\\\' + }, + rep; + + + function quote(string) { + +// If the string contains no control characters, no quote characters, and no +// backslash characters, then we can safely slap some quotes around it. +// Otherwise we must also replace the offending characters with safe escape +// sequences. + + escapable.lastIndex = 0; + return escapable.test(string) ? '"' + string.replace(escapable, function (a) { + var c = meta[a]; + return typeof c === 'string' + ? c + : '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }) + '"' : '"' + string + '"'; + } + + + function str(key, holder) { + +// Produce a string from holder[key]. + + var i, // The loop counter. + k, // The member key. + v, // The member value. + length, + mind = gap, + partial, + value = holder[key]; + +// If the value has a toJSON method, call it to obtain a replacement value. + + if (value && typeof value === 'object' && + typeof value.toJSON === 'function') { + value = value.toJSON(key); + } + +// If we were called with a replacer function, then call the replacer to +// obtain a replacement value. + + if (typeof rep === 'function') { + value = rep.call(holder, key, value); + } + +// What happens next depends on the value's type. + + switch (typeof value) { + case 'string': + return quote(value); + + case 'number': + +// JSON numbers must be finite. Encode non-finite numbers as null. + + return isFinite(value) ? String(value) : 'null'; + + case 'boolean': + case 'null': + +// If the value is a boolean or null, convert it to a string. Note: +// typeof null does not produce 'null'. The case is included here in +// the remote chance that this gets fixed someday. + + return String(value); + +// If the type is 'object', we might be dealing with an object or an array or +// null. + + case 'object': + +// Due to a specification blunder in ECMAScript, typeof null is 'object', +// so watch out for that case. + + if (!value) { + return 'null'; + } + +// Make an array to hold the partial results of stringifying this object value. + + gap += indent; + partial = []; + +// Is the value an array? + + if (Object.prototype.toString.apply(value) === '[object Array]') { + +// The value is an array. Stringify every element. Use null as a placeholder +// for non-JSON values. + + length = value.length; + for (i = 0; i < length; i += 1) { + partial[i] = str(i, value) || 'null'; + } + +// Join all of the elements together, separated with commas, and wrap them in +// brackets. + + v = partial.length === 0 + ? '[]' + : gap + ? '[\n' + gap + partial.join(',\n' + gap) + '\n' + mind + ']' + : '[' + partial.join(',') + ']'; + gap = mind; + return v; + } + +// If the replacer is an array, use it to select the members to be stringified. + + if (rep && typeof rep === 'object') { + length = rep.length; + for (i = 0; i < length; i += 1) { + if (typeof rep[i] === 'string') { + k = rep[i]; + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } else { + +// Otherwise, iterate through all of the keys in the object. + + for (k in value) { + if (Object.prototype.hasOwnProperty.call(value, k)) { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } + +// Join all of the member texts together, separated with commas, +// and wrap them in braces. + + v = partial.length === 0 + ? '{}' + : gap + ? '{\n' + gap + partial.join(',\n' + gap) + '\n' + mind + '}' + : '{' + partial.join(',') + '}'; + gap = mind; + return v; + } + } + +// If the JSON object does not yet have a stringify method, give it one. + + if (typeof JSON.stringify !== 'function') { + JSON.stringify = function (value, replacer, space) { + +// The stringify method takes a value and an optional replacer, and an optional +// space parameter, and returns a JSON text. The replacer can be a function +// that can replace values, or an array of strings that will select the keys. +// A default replacer method can be provided. Use of the space parameter can +// produce text that is more easily readable. + + var i; + gap = ''; + indent = ''; + +// If the space parameter is a number, make an indent string containing that +// many spaces. + + if (typeof space === 'number') { + for (i = 0; i < space; i += 1) { + indent += ' '; + } + +// If the space parameter is a string, it will be used as the indent string. + + } else if (typeof space === 'string') { + indent = space; + } + +// If there is a replacer, it must be a function or an array. +// Otherwise, throw an error. + + rep = replacer; + if (replacer && typeof replacer !== 'function' && + (typeof replacer !== 'object' || + typeof replacer.length !== 'number')) { + throw new Error('JSON.stringify'); + } + +// Make a fake root object containing our value under the key of ''. +// Return the result of stringifying the value. + + return str('', {'': value}); + }; + } + + +// If the JSON object does not yet have a parse method, give it one. + + if (typeof JSON.parse !== 'function') { + JSON.parse = function (text, reviver) { + +// The parse method takes a text and an optional reviver function, and returns +// a JavaScript value if the text is a valid JSON text. + + var j; + + function walk(holder, key) { + +// The walk method is used to recursively walk the resulting structure so +// that modifications can be made. + + var k, v, value = holder[key]; + if (value && typeof value === 'object') { + for (k in value) { + if (Object.prototype.hasOwnProperty.call(value, k)) { + v = walk(value, k); + if (v !== undefined) { + value[k] = v; + } else { + delete value[k]; + } + } + } + } + return reviver.call(holder, key, value); + } + + +// Parsing happens in four stages. In the first stage, we replace certain +// Unicode characters with escape sequences. JavaScript handles many characters +// incorrectly, either silently deleting them, or treating them as line endings. + + text = String(text); + cx.lastIndex = 0; + if (cx.test(text)) { + text = text.replace(cx, function (a) { + return '\\u' + + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }); + } + +// In the second stage, we run the text against regular expressions that look +// for non-JSON patterns. We are especially concerned with '()' and 'new' +// because they can cause invocation, and '=' because it can cause mutation. +// But just to be safe, we want to reject all unexpected forms. + +// We split the second stage into 4 regexp operations in order to work around +// crippling inefficiencies in IE's and Safari's regexp engines. First we +// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we +// replace all simple value tokens with ']' characters. Third, we delete all +// open brackets that follow a colon or comma or that begin the text. Finally, +// we look to see that the remaining characters are only whitespace or ']' or +// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval. + + if (/^[\],:{}\s]*$/ + .test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@') + .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']') + .replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) { + +// In the third stage we use the eval function to compile the text into a +// JavaScript structure. The '{' operator is subject to a syntactic ambiguity +// in JavaScript: it can begin a block or an object literal. We wrap the text +// in parens to eliminate the ambiguity. + + j = eval('(' + text + ')'); + +// In the optional fourth stage, we recursively walk the new structure, passing +// each name/value pair to a reviver function for possible transformation. + + return typeof reviver === 'function' + ? walk({'': j}, '') + : j; + } + +// If the text is not JSON parseable, then a SyntaxError is thrown. + + throw new SyntaxError('JSON.parse'); + }; + } +}()); diff --git a/resources/app/node_modules/mime-db/HISTORY.md b/resources/app/node_modules/mime-db/HISTORY.md new file mode 100644 index 0000000..577194c --- /dev/null +++ b/resources/app/node_modules/mime-db/HISTORY.md @@ -0,0 +1,405 @@ +1.38.0 / 2019-02-04 +=================== + + * Add extension `.nq` to `application/n-quads` + * Add extension `.nt` to `application/n-triples` + * Add new upstream MIME types + * Mark `text/less` as compressible + +1.37.0 / 2018-10-19 +=================== + + * Add extensions to HEIC image types + * Add new upstream MIME types + +1.36.0 / 2018-08-20 +=================== + + * Add Apple file extensions from IANA + * Add extensions from IANA for `image/*` types + * Add new upstream MIME types + +1.35.0 / 2018-07-15 +=================== + + * Add extension `.owl` to `application/rdf+xml` + * Add new upstream MIME types + - Removes extension `.woff` from `application/font-woff` + +1.34.0 / 2018-06-03 +=================== + + * Add extension `.csl` to `application/vnd.citationstyles.style+xml` + * Add extension `.es` to `application/ecmascript` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/turtle` + * Mark all XML-derived types as compressible + +1.33.0 / 2018-02-15 +=================== + + * Add extensions from IANA for `message/*` types + * Add new upstream MIME types + * Fix some incorrect OOXML types + * Remove `application/font-woff2` + +1.32.0 / 2017-11-29 +=================== + + * Add new upstream MIME types + * Update `text/hjson` to registered `application/hjson` + * Add `text/shex` with extension `.shex` + +1.31.0 / 2017-10-25 +=================== + + * Add `application/raml+yaml` with extension `.raml` + * Add `application/wasm` with extension `.wasm` + * Add new `font` type from IANA + * Add new upstream font extensions + * Add new upstream MIME types + * Add extensions for JPEG-2000 images + +1.30.0 / 2017-08-27 +=================== + + * Add `application/vnd.ms-outlook` + * Add `application/x-arj` + * Add extension `.mjs` to `application/javascript` + * Add glTF types and extensions + * Add new upstream MIME types + * Add `text/x-org` + * Add VirtualBox MIME types + * Fix `source` records for `video/*` types that are IANA + * Update `font/opentype` to registered `font/otf` + +1.29.0 / 2017-07-10 +=================== + + * Add `application/fido.trusted-apps+json` + * Add extension `.wadl` to `application/vnd.sun.wadl+xml` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/css` + +1.28.0 / 2017-05-14 +=================== + + * Add new upstream MIME types + * Add extension `.gz` to `application/gzip` + * Update extensions `.md` and `.markdown` to be `text/markdown` + +1.27.0 / 2017-03-16 +=================== + + * Add new upstream MIME types + * Add `image/apng` with extension `.apng` + +1.26.0 / 2017-01-14 +=================== + + * Add new upstream MIME types + * Add extension `.geojson` to `application/geo+json` + +1.25.0 / 2016-11-11 +=================== + + * Add new upstream MIME types + +1.24.0 / 2016-09-18 +=================== + + * Add `audio/mp3` + * Add new upstream MIME types + +1.23.0 / 2016-05-01 +=================== + + * Add new upstream MIME types + * Add extension `.3gpp` to `audio/3gpp` + +1.22.0 / 2016-02-15 +=================== + + * Add `text/slim` + * Add extension `.rng` to `application/xml` + * Add new upstream MIME types + * Fix extension of `application/dash+xml` to be `.mpd` + * Update primary extension to `.m4a` for `audio/mp4` + +1.21.0 / 2016-01-06 +=================== + + * Add Google document types + * Add new upstream MIME types + +1.20.0 / 2015-11-10 +=================== + + * Add `text/x-suse-ymp` + * Add new upstream MIME types + +1.19.0 / 2015-09-17 +=================== + + * Add `application/vnd.apple.pkpass` + * Add new upstream MIME types + +1.18.0 / 2015-09-03 +=================== + + * Add new upstream MIME types + +1.17.0 / 2015-08-13 +=================== + + * Add `application/x-msdos-program` + * Add `audio/g711-0` + * Add `image/vnd.mozilla.apng` + * Add extension `.exe` to `application/x-msdos-program` + +1.16.0 / 2015-07-29 +=================== + + * Add `application/vnd.uri-map` + +1.15.0 / 2015-07-13 +=================== + + * Add `application/x-httpd-php` + +1.14.0 / 2015-06-25 +=================== + + * Add `application/scim+json` + * Add `application/vnd.3gpp.ussd+xml` + * Add `application/vnd.biopax.rdf+xml` + * Add `text/x-processing` + +1.13.0 / 2015-06-07 +=================== + + * Add nginx as a source + * Add `application/x-cocoa` + * Add `application/x-java-archive-diff` + * Add `application/x-makeself` + * Add `application/x-perl` + * Add `application/x-pilot` + * Add `application/x-redhat-package-manager` + * Add `application/x-sea` + * Add `audio/x-m4a` + * Add `audio/x-realaudio` + * Add `image/x-jng` + * Add `text/mathml` + +1.12.0 / 2015-06-05 +=================== + + * Add `application/bdoc` + * Add `application/vnd.hyperdrive+json` + * Add `application/x-bdoc` + * Add extension `.rtf` to `text/rtf` + +1.11.0 / 2015-05-31 +=================== + + * Add `audio/wav` + * Add `audio/wave` + * Add extension `.litcoffee` to `text/coffeescript` + * Add extension `.sfd-hdstx` to `application/vnd.hydrostatix.sof-data` + * Add extension `.n-gage` to `application/vnd.nokia.n-gage.symbian.install` + +1.10.0 / 2015-05-19 +=================== + + * Add `application/vnd.balsamiq.bmpr` + * Add `application/vnd.microsoft.portable-executable` + * Add `application/x-ns-proxy-autoconfig` + +1.9.1 / 2015-04-19 +================== + + * Remove `.json` extension from `application/manifest+json` + - This is causing bugs downstream + +1.9.0 / 2015-04-19 +================== + + * Add `application/manifest+json` + * Add `application/vnd.micro+json` + * Add `image/vnd.zbrush.pcx` + * Add `image/x-ms-bmp` + +1.8.0 / 2015-03-13 +================== + + * Add `application/vnd.citationstyles.style+xml` + * Add `application/vnd.fastcopy-disk-image` + * Add `application/vnd.gov.sk.xmldatacontainer+xml` + * Add extension `.jsonld` to `application/ld+json` + +1.7.0 / 2015-02-08 +================== + + * Add `application/vnd.gerber` + * Add `application/vnd.msa-disk-image` + +1.6.1 / 2015-02-05 +================== + + * Community extensions ownership transferred from `node-mime` + +1.6.0 / 2015-01-29 +================== + + * Add `application/jose` + * Add `application/jose+json` + * Add `application/json-seq` + * Add `application/jwk+json` + * Add `application/jwk-set+json` + * Add `application/jwt` + * Add `application/rdap+json` + * Add `application/vnd.gov.sk.e-form+xml` + * Add `application/vnd.ims.imsccv1p3` + +1.5.0 / 2014-12-30 +================== + + * Add `application/vnd.oracle.resource+json` + * Fix various invalid MIME type entries + - `application/mbox+xml` + - `application/oscp-response` + - `application/vwg-multiplexed` + - `audio/g721` + +1.4.0 / 2014-12-21 +================== + + * Add `application/vnd.ims.imsccv1p2` + * Fix various invalid MIME type entries + - `application/vnd-acucobol` + - `application/vnd-curl` + - `application/vnd-dart` + - `application/vnd-dxr` + - `application/vnd-fdf` + - `application/vnd-mif` + - `application/vnd-sema` + - `application/vnd-wap-wmlc` + - `application/vnd.adobe.flash-movie` + - `application/vnd.dece-zip` + - `application/vnd.dvb_service` + - `application/vnd.micrografx-igx` + - `application/vnd.sealed-doc` + - `application/vnd.sealed-eml` + - `application/vnd.sealed-mht` + - `application/vnd.sealed-ppt` + - `application/vnd.sealed-tiff` + - `application/vnd.sealed-xls` + - `application/vnd.sealedmedia.softseal-html` + - `application/vnd.sealedmedia.softseal-pdf` + - `application/vnd.wap-slc` + - `application/vnd.wap-wbxml` + - `audio/vnd.sealedmedia.softseal-mpeg` + - `image/vnd-djvu` + - `image/vnd-svf` + - `image/vnd-wap-wbmp` + - `image/vnd.sealed-png` + - `image/vnd.sealedmedia.softseal-gif` + - `image/vnd.sealedmedia.softseal-jpg` + - `model/vnd-dwf` + - `model/vnd.parasolid.transmit-binary` + - `model/vnd.parasolid.transmit-text` + - `text/vnd-a` + - `text/vnd-curl` + - `text/vnd.wap-wml` + * Remove example template MIME types + - `application/example` + - `audio/example` + - `image/example` + - `message/example` + - `model/example` + - `multipart/example` + - `text/example` + - `video/example` + +1.3.1 / 2014-12-16 +================== + + * Fix missing extensions + - `application/json5` + - `text/hjson` + +1.3.0 / 2014-12-07 +================== + + * Add `application/a2l` + * Add `application/aml` + * Add `application/atfx` + * Add `application/atxml` + * Add `application/cdfx+xml` + * Add `application/dii` + * Add `application/json5` + * Add `application/lxf` + * Add `application/mf4` + * Add `application/vnd.apache.thrift.compact` + * Add `application/vnd.apache.thrift.json` + * Add `application/vnd.coffeescript` + * Add `application/vnd.enphase.envoy` + * Add `application/vnd.ims.imsccv1p1` + * Add `text/csv-schema` + * Add `text/hjson` + * Add `text/markdown` + * Add `text/yaml` + +1.2.0 / 2014-11-09 +================== + + * Add `application/cea` + * Add `application/dit` + * Add `application/vnd.gov.sk.e-form+zip` + * Add `application/vnd.tmd.mediaflex.api+xml` + * Type `application/epub+zip` is now IANA-registered + +1.1.2 / 2014-10-23 +================== + + * Rebuild database for `application/x-www-form-urlencoded` change + +1.1.1 / 2014-10-20 +================== + + * Mark `application/x-www-form-urlencoded` as compressible. + +1.1.0 / 2014-09-28 +================== + + * Add `application/font-woff2` + +1.0.3 / 2014-09-25 +================== + + * Fix engine requirement in package + +1.0.2 / 2014-09-25 +================== + + * Add `application/coap-group+json` + * Add `application/dcd` + * Add `application/vnd.apache.thrift.binary` + * Add `image/vnd.tencent.tap` + * Mark all JSON-derived types as compressible + * Update `text/vtt` data + +1.0.1 / 2014-08-30 +================== + + * Fix extension ordering + +1.0.0 / 2014-08-30 +================== + + * Add `application/atf` + * Add `application/merge-patch+json` + * Add `multipart/x-mixed-replace` + * Add `source: 'apache'` metadata + * Add `source: 'iana'` metadata + * Remove badly-assumed charset data diff --git a/resources/app/node_modules/mime-db/LICENSE b/resources/app/node_modules/mime-db/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/resources/app/node_modules/mime-db/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong [email protected] + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/mime-db/README.md b/resources/app/node_modules/mime-db/README.md new file mode 100644 index 0000000..dcc9d09 --- /dev/null +++ b/resources/app/node_modules/mime-db/README.md @@ -0,0 +1,94 @@ +# mime-db + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +This is a database of all mime types. +It consists of a single, public JSON file and does not include any logic, +allowing it to remain as un-opinionated as possible with an API. +It aggregates data from the following sources: + +- http://www.iana.org/assignments/media-types/media-types.xhtml +- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types +- http://hg.nginx.org/nginx/raw-file/default/conf/mime.types + +## Installation + +```bash +npm install mime-db +``` + +### Database Download + +If you're crazy enough to use this in the browser, you can just grab the +JSON file using [jsDelivr](https://www.jsdelivr.com/). It is recommended to +replace `master` with [a release tag](https://github.com/jshttp/mime-db/tags) +as the JSON format may change in the future. + +``` +https://cdn.jsdelivr.net/gh/jshttp/mime-db@master/db.json +``` + +## Usage + +```js +var db = require('mime-db'); + +// grab data on .js files +var data = db['application/javascript']; +``` + +## Data Structure + +The JSON file is a map lookup for lowercased mime types. +Each mime type has the following properties: + +- `.source` - where the mime type is defined. + If not set, it's probably a custom media type. + - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types) + - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml) + - `nginx` - [nginx media types](http://hg.nginx.org/nginx/raw-file/default/conf/mime.types) +- `.extensions[]` - known extensions associated with this mime type. +- `.compressible` - whether a file of this type can be gzipped. +- `.charset` - the default charset associated with this type, if any. + +If unknown, every property could be `undefined`. + +## Contributing + +To edit the database, only make PRs against `src/custom.json` or +`src/custom-suffix.json`. + +The `src/custom.json` file is a JSON object with the MIME type as the keys +and the values being an object with the following keys: + +- `compressible` - leave out if you don't know, otherwise `true`/`false` to + indicate whether the data represented by the type is typically compressible. +- `extensions` - include an array of file extensions that are associated with + the type. +- `notes` - human-readable notes about the type, typically what the type is. +- `sources` - include an array of URLs of where the MIME type and the associated + extensions are sourced from. This needs to be a [primary source](https://en.wikipedia.org/wiki/Primary_source); + links to type aggregating sites and Wikipedia are _not acceptable_. + +To update the build, run `npm run build`. + +## Adding Custom Media Types + +The best way to get new media types included in this library is to register +them with the IANA. The community registration procedure is outlined in +[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types +registered with the IANA are automatically pulled into this library. + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-db/master +[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master +[node-image]: https://badgen.net/npm/node/mime-db +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/mime-db +[npm-url]: https://npmjs.org/package/mime-db +[npm-version-image]: https://badgen.net/npm/v/mime-db +[travis-image]: https://badgen.net/travis/jshttp/mime-db/master +[travis-url]: https://travis-ci.org/jshttp/mime-db diff --git a/resources/app/node_modules/mime-db/db.json b/resources/app/node_modules/mime-db/db.json new file mode 100644 index 0000000..ba4db79 --- /dev/null +++ b/resources/app/node_modules/mime-db/db.json @@ -0,0 +1,7797 @@ +{ + "application/1d-interleaved-parityfec": { + "source": "iana" + }, + "application/3gpdash-qoe-report+xml": { + "source": "iana", + "compressible": true + }, + "application/3gpp-ims+xml": { + "source": "iana", + "compressible": true + }, + "application/a2l": { + "source": "iana" + }, + "application/activemessage": { + "source": "iana" + }, + "application/activity+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-directory+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcost+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcostparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointprop+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointpropparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-error+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/aml": { + "source": "iana" + }, + "application/andrew-inset": { + "source": "iana", + "extensions": ["ez"] + }, + "application/applefile": { + "source": "iana" + }, + "application/applixware": { + "source": "apache", + "extensions": ["aw"] + }, + "application/atf": { + "source": "iana" + }, + "application/atfx": { + "source": "iana" + }, + "application/atom+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atom"] + }, + "application/atomcat+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomcat"] + }, + "application/atomdeleted+xml": { + "source": "iana", + "compressible": true + }, + "application/atomicmail": { + "source": "iana" + }, + "application/atomsvc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomsvc"] + }, + "application/atxml": { + "source": "iana" + }, + "application/auth-policy+xml": { + "source": "iana", + "compressible": true + }, + "application/bacnet-xdd+zip": { + "source": "iana", + "compressible": false + }, + "application/batch-smtp": { + "source": "iana" + }, + "application/bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/beep+xml": { + "source": "iana", + "compressible": true + }, + "application/calendar+json": { + "source": "iana", + "compressible": true + }, + "application/calendar+xml": { + "source": "iana", + "compressible": true + }, + "application/call-completion": { + "source": "iana" + }, + "application/cals-1840": { + "source": "iana" + }, + "application/cbor": { + "source": "iana" + }, + "application/cccex": { + "source": "iana" + }, + "application/ccmp+xml": { + "source": "iana", + "compressible": true + }, + "application/ccxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ccxml"] + }, + "application/cdfx+xml": { + "source": "iana", + "compressible": true + }, + "application/cdmi-capability": { + "source": "iana", + "extensions": ["cdmia"] + }, + "application/cdmi-container": { + "source": "iana", + "extensions": ["cdmic"] + }, + "application/cdmi-domain": { + "source": "iana", + "extensions": ["cdmid"] + }, + "application/cdmi-object": { + "source": "iana", + "extensions": ["cdmio"] + }, + "application/cdmi-queue": { + "source": "iana", + "extensions": ["cdmiq"] + }, + "application/cdni": { + "source": "iana" + }, + "application/cea": { + "source": "iana" + }, + "application/cea-2018+xml": { + "source": "iana", + "compressible": true + }, + "application/cellml+xml": { + "source": "iana", + "compressible": true + }, + "application/cfw": { + "source": "iana" + }, + "application/clue_info+xml": { + "source": "iana", + "compressible": true + }, + "application/cms": { + "source": "iana" + }, + "application/cnrp+xml": { + "source": "iana", + "compressible": true + }, + "application/coap-group+json": { + "source": "iana", + "compressible": true + }, + "application/coap-payload": { + "source": "iana" + }, + "application/commonground": { + "source": "iana" + }, + "application/conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/cose": { + "source": "iana" + }, + "application/cose-key": { + "source": "iana" + }, + "application/cose-key-set": { + "source": "iana" + }, + "application/cpl+xml": { + "source": "iana", + "compressible": true + }, + "application/csrattrs": { + "source": "iana" + }, + "application/csta+xml": { + "source": "iana", + "compressible": true + }, + "application/cstadata+xml": { + "source": "iana", + "compressible": true + }, + "application/csvm+json": { + "source": "iana", + "compressible": true + }, + "application/cu-seeme": { + "source": "apache", + "extensions": ["cu"] + }, + "application/cwt": { + "source": "iana" + }, + "application/cybercash": { + "source": "iana" + }, + "application/dart": { + "compressible": true + }, + "application/dash+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpd"] + }, + "application/dashdelta": { + "source": "iana" + }, + "application/davmount+xml": { + "source": "iana", + "compressible": true, + "extensions": ["davmount"] + }, + "application/dca-rft": { + "source": "iana" + }, + "application/dcd": { + "source": "iana" + }, + "application/dec-dx": { + "source": "iana" + }, + "application/dialog-info+xml": { + "source": "iana", + "compressible": true + }, + "application/dicom": { + "source": "iana" + }, + "application/dicom+json": { + "source": "iana", + "compressible": true + }, + "application/dicom+xml": { + "source": "iana", + "compressible": true + }, + "application/dii": { + "source": "iana" + }, + "application/dit": { + "source": "iana" + }, + "application/dns": { + "source": "iana" + }, + "application/dns+json": { + "source": "iana", + "compressible": true + }, + "application/dns-message": { + "source": "iana" + }, + "application/docbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dbk"] + }, + "application/dskpp+xml": { + "source": "iana", + "compressible": true + }, + "application/dssc+der": { + "source": "iana", + "extensions": ["dssc"] + }, + "application/dssc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdssc"] + }, + "application/dvcs": { + "source": "iana" + }, + "application/ecmascript": { + "source": "iana", + "compressible": true, + "extensions": ["ecma","es"] + }, + "application/edi-consent": { + "source": "iana" + }, + "application/edi-x12": { + "source": "iana", + "compressible": false + }, + "application/edifact": { + "source": "iana", + "compressible": false + }, + "application/efi": { + "source": "iana" + }, + "application/emergencycalldata.comment+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.control+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.deviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.ecall.msd": { + "source": "iana" + }, + "application/emergencycalldata.providerinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.serviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.subscriberinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.veds+xml": { + "source": "iana", + "compressible": true + }, + "application/emma+xml": { + "source": "iana", + "compressible": true, + "extensions": ["emma"] + }, + "application/emotionml+xml": { + "source": "iana", + "compressible": true + }, + "application/encaprtp": { + "source": "iana" + }, + "application/epp+xml": { + "source": "iana", + "compressible": true + }, + "application/epub+zip": { + "source": "iana", + "compressible": false, + "extensions": ["epub"] + }, + "application/eshop": { + "source": "iana" + }, + "application/exi": { + "source": "iana", + "extensions": ["exi"] + }, + "application/expect-ct-report+json": { + "source": "iana", + "compressible": true + }, + "application/fastinfoset": { + "source": "iana" + }, + "application/fastsoap": { + "source": "iana" + }, + "application/fdt+xml": { + "source": "iana", + "compressible": true + }, + "application/fhir+json": { + "source": "iana", + "compressible": true + }, + "application/fhir+xml": { + "source": "iana", + "compressible": true + }, + "application/fido.trusted-apps+json": { + "compressible": true + }, + "application/fits": { + "source": "iana" + }, + "application/font-sfnt": { + "source": "iana" + }, + "application/font-tdpfr": { + "source": "iana", + "extensions": ["pfr"] + }, + "application/font-woff": { + "source": "iana", + "compressible": false + }, + "application/framework-attributes+xml": { + "source": "iana", + "compressible": true + }, + "application/geo+json": { + "source": "iana", + "compressible": true, + "extensions": ["geojson"] + }, + "application/geo+json-seq": { + "source": "iana" + }, + "application/geopackage+sqlite3": { + "source": "iana" + }, + "application/geoxacml+xml": { + "source": "iana", + "compressible": true + }, + "application/gltf-buffer": { + "source": "iana" + }, + "application/gml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["gml"] + }, + "application/gpx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["gpx"] + }, + "application/gxf": { + "source": "apache", + "extensions": ["gxf"] + }, + "application/gzip": { + "source": "iana", + "compressible": false, + "extensions": ["gz"] + }, + "application/h224": { + "source": "iana" + }, + "application/held+xml": { + "source": "iana", + "compressible": true + }, + "application/hjson": { + "extensions": ["hjson"] + }, + "application/http": { + "source": "iana" + }, + "application/hyperstudio": { + "source": "iana", + "extensions": ["stk"] + }, + "application/ibe-key-request+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pkg-reply+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pp-data": { + "source": "iana" + }, + "application/iges": { + "source": "iana" + }, + "application/im-iscomposing+xml": { + "source": "iana", + "compressible": true + }, + "application/index": { + "source": "iana" + }, + "application/index.cmd": { + "source": "iana" + }, + "application/index.obj": { + "source": "iana" + }, + "application/index.response": { + "source": "iana" + }, + "application/index.vnd": { + "source": "iana" + }, + "application/inkml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ink","inkml"] + }, + "application/iotp": { + "source": "iana" + }, + "application/ipfix": { + "source": "iana", + "extensions": ["ipfix"] + }, + "application/ipp": { + "source": "iana" + }, + "application/isup": { + "source": "iana" + }, + "application/its+xml": { + "source": "iana", + "compressible": true + }, + "application/java-archive": { + "source": "apache", + "compressible": false, + "extensions": ["jar","war","ear"] + }, + "application/java-serialized-object": { + "source": "apache", + "compressible": false, + "extensions": ["ser"] + }, + "application/java-vm": { + "source": "apache", + "compressible": false, + "extensions": ["class"] + }, + "application/javascript": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["js","mjs"] + }, + "application/jf2feed+json": { + "source": "iana", + "compressible": true + }, + "application/jose": { + "source": "iana" + }, + "application/jose+json": { + "source": "iana", + "compressible": true + }, + "application/jrd+json": { + "source": "iana", + "compressible": true + }, + "application/json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["json","map"] + }, + "application/json-patch+json": { + "source": "iana", + "compressible": true + }, + "application/json-seq": { + "source": "iana" + }, + "application/json5": { + "extensions": ["json5"] + }, + "application/jsonml+json": { + "source": "apache", + "compressible": true, + "extensions": ["jsonml"] + }, + "application/jwk+json": { + "source": "iana", + "compressible": true + }, + "application/jwk-set+json": { + "source": "iana", + "compressible": true + }, + "application/jwt": { + "source": "iana" + }, + "application/kpml-request+xml": { + "source": "iana", + "compressible": true + }, + "application/kpml-response+xml": { + "source": "iana", + "compressible": true + }, + "application/ld+json": { + "source": "iana", + "compressible": true, + "extensions": ["jsonld"] + }, + "application/lgr+xml": { + "source": "iana", + "compressible": true + }, + "application/link-format": { + "source": "iana" + }, + "application/load-control+xml": { + "source": "iana", + "compressible": true + }, + "application/lost+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lostxml"] + }, + "application/lostsync+xml": { + "source": "iana", + "compressible": true + }, + "application/lxf": { + "source": "iana" + }, + "application/mac-binhex40": { + "source": "iana", + "extensions": ["hqx"] + }, + "application/mac-compactpro": { + "source": "apache", + "extensions": ["cpt"] + }, + "application/macwriteii": { + "source": "iana" + }, + "application/mads+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mads"] + }, + "application/manifest+json": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["webmanifest"] + }, + "application/marc": { + "source": "iana", + "extensions": ["mrc"] + }, + "application/marcxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mrcx"] + }, + "application/mathematica": { + "source": "iana", + "extensions": ["ma","nb","mb"] + }, + "application/mathml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mathml"] + }, + "application/mathml-content+xml": { + "source": "iana", + "compressible": true + }, + "application/mathml-presentation+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-associated-procedure-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-deregister+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-envelope+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-protection-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-reception-report+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-schedule+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-user-service-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbox": { + "source": "iana", + "extensions": ["mbox"] + }, + "application/media-policy-dataset+xml": { + "source": "iana", + "compressible": true + }, + "application/media_control+xml": { + "source": "iana", + "compressible": true + }, + "application/mediaservercontrol+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mscml"] + }, + "application/merge-patch+json": { + "source": "iana", + "compressible": true + }, + "application/metalink+xml": { + "source": "apache", + "compressible": true, + "extensions": ["metalink"] + }, + "application/metalink4+xml": { + "source": "iana", + "compressible": true, + "extensions": ["meta4"] + }, + "application/mets+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mets"] + }, + "application/mf4": { + "source": "iana" + }, + "application/mikey": { + "source": "iana" + }, + "application/mmt-usd+xml": { + "source": "iana", + "compressible": true + }, + "application/mods+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mods"] + }, + "application/moss-keys": { + "source": "iana" + }, + "application/moss-signature": { + "source": "iana" + }, + "application/mosskey-data": { + "source": "iana" + }, + "application/mosskey-request": { + "source": "iana" + }, + "application/mp21": { + "source": "iana", + "extensions": ["m21","mp21"] + }, + "application/mp4": { + "source": "iana", + "extensions": ["mp4s","m4p"] + }, + "application/mpeg4-generic": { + "source": "iana" + }, + "application/mpeg4-iod": { + "source": "iana" + }, + "application/mpeg4-iod-xmt": { + "source": "iana" + }, + "application/mrb-consumer+xml": { + "source": "iana", + "compressible": true + }, + "application/mrb-publish+xml": { + "source": "iana", + "compressible": true + }, + "application/msc-ivr+xml": { + "source": "iana", + "compressible": true + }, + "application/msc-mixer+xml": { + "source": "iana", + "compressible": true + }, + "application/msword": { + "source": "iana", + "compressible": false, + "extensions": ["doc","dot"] + }, + "application/mud+json": { + "source": "iana", + "compressible": true + }, + "application/mxf": { + "source": "iana", + "extensions": ["mxf"] + }, + "application/n-quads": { + "source": "iana", + "extensions": ["nq"] + }, + "application/n-triples": { + "source": "iana", + "extensions": ["nt"] + }, + "application/nasdata": { + "source": "iana" + }, + "application/news-checkgroups": { + "source": "iana" + }, + "application/news-groupinfo": { + "source": "iana" + }, + "application/news-transmission": { + "source": "iana" + }, + "application/nlsml+xml": { + "source": "iana", + "compressible": true + }, + "application/node": { + "source": "iana" + }, + "application/nss": { + "source": "iana" + }, + "application/ocsp-request": { + "source": "iana" + }, + "application/ocsp-response": { + "source": "iana" + }, + "application/octet-stream": { + "source": "iana", + "compressible": false, + "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"] + }, + "application/oda": { + "source": "iana", + "extensions": ["oda"] + }, + "application/odm+xml": { + "source": "iana", + "compressible": true + }, + "application/odx": { + "source": "iana" + }, + "application/oebps-package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["opf"] + }, + "application/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogx"] + }, + "application/omdoc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["omdoc"] + }, + "application/onenote": { + "source": "apache", + "extensions": ["onetoc","onetoc2","onetmp","onepkg"] + }, + "application/oxps": { + "source": "iana", + "extensions": ["oxps"] + }, + "application/p2p-overlay+xml": { + "source": "iana", + "compressible": true + }, + "application/parityfec": { + "source": "iana" + }, + "application/passport": { + "source": "iana" + }, + "application/patch-ops-error+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xer"] + }, + "application/pdf": { + "source": "iana", + "compressible": false, + "extensions": ["pdf"] + }, + "application/pdx": { + "source": "iana" + }, + "application/pem-certificate-chain": { + "source": "iana" + }, + "application/pgp-encrypted": { + "source": "iana", + "compressible": false, + "extensions": ["pgp"] + }, + "application/pgp-keys": { + "source": "iana" + }, + "application/pgp-signature": { + "source": "iana", + "extensions": ["asc","sig"] + }, + "application/pics-rules": { + "source": "apache", + "extensions": ["prf"] + }, + "application/pidf+xml": { + "source": "iana", + "compressible": true + }, + "application/pidf-diff+xml": { + "source": "iana", + "compressible": true + }, + "application/pkcs10": { + "source": "iana", + "extensions": ["p10"] + }, + "application/pkcs12": { + "source": "iana" + }, + "application/pkcs7-mime": { + "source": "iana", + "extensions": ["p7m","p7c"] + }, + "application/pkcs7-signature": { + "source": "iana", + "extensions": ["p7s"] + }, + "application/pkcs8": { + "source": "iana", + "extensions": ["p8"] + }, + "application/pkcs8-encrypted": { + "source": "iana" + }, + "application/pkix-attr-cert": { + "source": "iana", + "extensions": ["ac"] + }, + "application/pkix-cert": { + "source": "iana", + "extensions": ["cer"] + }, + "application/pkix-crl": { + "source": "iana", + "extensions": ["crl"] + }, + "application/pkix-pkipath": { + "source": "iana", + "extensions": ["pkipath"] + }, + "application/pkixcmp": { + "source": "iana", + "extensions": ["pki"] + }, + "application/pls+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pls"] + }, + "application/poc-settings+xml": { + "source": "iana", + "compressible": true + }, + "application/postscript": { + "source": "iana", + "compressible": true, + "extensions": ["ai","eps","ps"] + }, + "application/ppsp-tracker+json": { + "source": "iana", + "compressible": true + }, + "application/problem+json": { + "source": "iana", + "compressible": true + }, + "application/problem+xml": { + "source": "iana", + "compressible": true + }, + "application/provenance+xml": { + "source": "iana", + "compressible": true + }, + "application/prs.alvestrand.titrax-sheet": { + "source": "iana" + }, + "application/prs.cww": { + "source": "iana", + "extensions": ["cww"] + }, + "application/prs.hpub+zip": { + "source": "iana", + "compressible": false + }, + "application/prs.nprend": { + "source": "iana" + }, + "application/prs.plucker": { + "source": "iana" + }, + "application/prs.rdf-xml-crypt": { + "source": "iana" + }, + "application/prs.xsf+xml": { + "source": "iana", + "compressible": true + }, + "application/pskc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pskcxml"] + }, + "application/qsig": { + "source": "iana" + }, + "application/raml+yaml": { + "compressible": true, + "extensions": ["raml"] + }, + "application/raptorfec": { + "source": "iana" + }, + "application/rdap+json": { + "source": "iana", + "compressible": true + }, + "application/rdf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rdf","owl"] + }, + "application/reginfo+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rif"] + }, + "application/relax-ng-compact-syntax": { + "source": "iana", + "extensions": ["rnc"] + }, + "application/remote-printing": { + "source": "iana" + }, + "application/reputon+json": { + "source": "iana", + "compressible": true + }, + "application/resource-lists+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rl"] + }, + "application/resource-lists-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rld"] + }, + "application/rfc+xml": { + "source": "iana", + "compressible": true + }, + "application/riscos": { + "source": "iana" + }, + "application/rlmi+xml": { + "source": "iana", + "compressible": true + }, + "application/rls-services+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rs"] + }, + "application/route-apd+xml": { + "source": "iana", + "compressible": true + }, + "application/route-s-tsid+xml": { + "source": "iana", + "compressible": true + }, + "application/route-usd+xml": { + "source": "iana", + "compressible": true + }, + "application/rpki-ghostbusters": { + "source": "iana", + "extensions": ["gbr"] + }, + "application/rpki-manifest": { + "source": "iana", + "extensions": ["mft"] + }, + "application/rpki-publication": { + "source": "iana" + }, + "application/rpki-roa": { + "source": "iana", + "extensions": ["roa"] + }, + "application/rpki-updown": { + "source": "iana" + }, + "application/rsd+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rsd"] + }, + "application/rss+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rss"] + }, + "application/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "application/rtploopback": { + "source": "iana" + }, + "application/rtx": { + "source": "iana" + }, + "application/samlassertion+xml": { + "source": "iana", + "compressible": true + }, + "application/samlmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/sbml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sbml"] + }, + "application/scaip+xml": { + "source": "iana", + "compressible": true + }, + "application/scim+json": { + "source": "iana", + "compressible": true + }, + "application/scvp-cv-request": { + "source": "iana", + "extensions": ["scq"] + }, + "application/scvp-cv-response": { + "source": "iana", + "extensions": ["scs"] + }, + "application/scvp-vp-request": { + "source": "iana", + "extensions": ["spq"] + }, + "application/scvp-vp-response": { + "source": "iana", + "extensions": ["spp"] + }, + "application/sdp": { + "source": "iana", + "extensions": ["sdp"] + }, + "application/secevent+jwt": { + "source": "iana" + }, + "application/senml+cbor": { + "source": "iana" + }, + "application/senml+json": { + "source": "iana", + "compressible": true + }, + "application/senml+xml": { + "source": "iana", + "compressible": true + }, + "application/senml-exi": { + "source": "iana" + }, + "application/sensml+cbor": { + "source": "iana" + }, + "application/sensml+json": { + "source": "iana", + "compressible": true + }, + "application/sensml+xml": { + "source": "iana", + "compressible": true + }, + "application/sensml-exi": { + "source": "iana" + }, + "application/sep+xml": { + "source": "iana", + "compressible": true + }, + "application/sep-exi": { + "source": "iana" + }, + "application/session-info": { + "source": "iana" + }, + "application/set-payment": { + "source": "iana" + }, + "application/set-payment-initiation": { + "source": "iana", + "extensions": ["setpay"] + }, + "application/set-registration": { + "source": "iana" + }, + "application/set-registration-initiation": { + "source": "iana", + "extensions": ["setreg"] + }, + "application/sgml": { + "source": "iana" + }, + "application/sgml-open-catalog": { + "source": "iana" + }, + "application/shf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["shf"] + }, + "application/sieve": { + "source": "iana" + }, + "application/simple-filter+xml": { + "source": "iana", + "compressible": true + }, + "application/simple-message-summary": { + "source": "iana" + }, + "application/simplesymbolcontainer": { + "source": "iana" + }, + "application/slate": { + "source": "iana" + }, + "application/smil": { + "source": "iana" + }, + "application/smil+xml": { + "source": "iana", + "compressible": true, + "extensions": ["smi","smil"] + }, + "application/smpte336m": { + "source": "iana" + }, + "application/soap+fastinfoset": { + "source": "iana" + }, + "application/soap+xml": { + "source": "iana", + "compressible": true + }, + "application/sparql-query": { + "source": "iana", + "extensions": ["rq"] + }, + "application/sparql-results+xml": { + "source": "iana", + "compressible": true, + "extensions": ["srx"] + }, + "application/spirits-event+xml": { + "source": "iana", + "compressible": true + }, + "application/sql": { + "source": "iana" + }, + "application/srgs": { + "source": "iana", + "extensions": ["gram"] + }, + "application/srgs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["grxml"] + }, + "application/sru+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sru"] + }, + "application/ssdl+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ssdl"] + }, + "application/ssml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ssml"] + }, + "application/stix+json": { + "source": "iana", + "compressible": true + }, + "application/tamp-apex-update": { + "source": "iana" + }, + "application/tamp-apex-update-confirm": { + "source": "iana" + }, + "application/tamp-community-update": { + "source": "iana" + }, + "application/tamp-community-update-confirm": { + "source": "iana" + }, + "application/tamp-error": { + "source": "iana" + }, + "application/tamp-sequence-adjust": { + "source": "iana" + }, + "application/tamp-sequence-adjust-confirm": { + "source": "iana" + }, + "application/tamp-status-query": { + "source": "iana" + }, + "application/tamp-status-response": { + "source": "iana" + }, + "application/tamp-update": { + "source": "iana" + }, + "application/tamp-update-confirm": { + "source": "iana" + }, + "application/tar": { + "compressible": true + }, + "application/taxii+json": { + "source": "iana", + "compressible": true + }, + "application/tei+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tei","teicorpus"] + }, + "application/tetra_isi": { + "source": "iana" + }, + "application/thraud+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tfi"] + }, + "application/timestamp-query": { + "source": "iana" + }, + "application/timestamp-reply": { + "source": "iana" + }, + "application/timestamped-data": { + "source": "iana", + "extensions": ["tsd"] + }, + "application/tlsrpt+gzip": { + "source": "iana" + }, + "application/tlsrpt+json": { + "source": "iana", + "compressible": true + }, + "application/tnauthlist": { + "source": "iana" + }, + "application/trickle-ice-sdpfrag": { + "source": "iana" + }, + "application/trig": { + "source": "iana" + }, + "application/ttml+xml": { + "source": "iana", + "compressible": true + }, + "application/tve-trigger": { + "source": "iana" + }, + "application/tzif": { + "source": "iana" + }, + "application/tzif-leap": { + "source": "iana" + }, + "application/ulpfec": { + "source": "iana" + }, + "application/urc-grpsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-ressheet+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-targetdesc+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-uisocketdesc+xml": { + "source": "iana", + "compressible": true + }, + "application/vcard+json": { + "source": "iana", + "compressible": true + }, + "application/vcard+xml": { + "source": "iana", + "compressible": true + }, + "application/vemmi": { + "source": "iana" + }, + "application/vividence.scriptfile": { + "source": "apache" + }, + "application/vnd.1000minds.decision-model+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose-pc3ch+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-v2x-local-service-information": { + "source": "iana" + }, + "application/vnd.3gpp.access-transfer-events+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.bsf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.gmop+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mc-signalling-ear": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-payload": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-signalling": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-floor-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-signed+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-init-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-affiliation-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-transmission-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mid-call+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.pic-bw-large": { + "source": "iana", + "extensions": ["plb"] + }, + "application/vnd.3gpp.pic-bw-small": { + "source": "iana", + "extensions": ["psb"] + }, + "application/vnd.3gpp.pic-bw-var": { + "source": "iana", + "extensions": ["pvb"] + }, + "application/vnd.3gpp.sms": { + "source": "iana" + }, + "application/vnd.3gpp.sms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-ext+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.state-and-event-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.ussd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.bcmcsinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.sms": { + "source": "iana" + }, + "application/vnd.3gpp2.tcap": { + "source": "iana", + "extensions": ["tcap"] + }, + "application/vnd.3lightssoftware.imagescal": { + "source": "iana" + }, + "application/vnd.3m.post-it-notes": { + "source": "iana", + "extensions": ["pwn"] + }, + "application/vnd.accpac.simply.aso": { + "source": "iana", + "extensions": ["aso"] + }, + "application/vnd.accpac.simply.imp": { + "source": "iana", + "extensions": ["imp"] + }, + "application/vnd.acucobol": { + "source": "iana", + "extensions": ["acu"] + }, + "application/vnd.acucorp": { + "source": "iana", + "extensions": ["atc","acutc"] + }, + "application/vnd.adobe.air-application-installer-package+zip": { + "source": "apache", + "compressible": false, + "extensions": ["air"] + }, + "application/vnd.adobe.flash.movie": { + "source": "iana" + }, + "application/vnd.adobe.formscentral.fcdt": { + "source": "iana", + "extensions": ["fcdt"] + }, + "application/vnd.adobe.fxp": { + "source": "iana", + "extensions": ["fxp","fxpl"] + }, + "application/vnd.adobe.partial-upload": { + "source": "iana" + }, + "application/vnd.adobe.xdp+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdp"] + }, + "application/vnd.adobe.xfdf": { + "source": "iana", + "extensions": ["xfdf"] + }, + "application/vnd.aether.imp": { + "source": "iana" + }, + "application/vnd.afpc.afplinedata": { + "source": "iana" + }, + "application/vnd.afpc.modca": { + "source": "iana" + }, + "application/vnd.ah-barcode": { + "source": "iana" + }, + "application/vnd.ahead.space": { + "source": "iana", + "extensions": ["ahead"] + }, + "application/vnd.airzip.filesecure.azf": { + "source": "iana", + "extensions": ["azf"] + }, + "application/vnd.airzip.filesecure.azs": { + "source": "iana", + "extensions": ["azs"] + }, + "application/vnd.amadeus+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.amazon.ebook": { + "source": "apache", + "extensions": ["azw"] + }, + "application/vnd.amazon.mobi8-ebook": { + "source": "iana" + }, + "application/vnd.americandynamics.acc": { + "source": "iana", + "extensions": ["acc"] + }, + "application/vnd.amiga.ami": { + "source": "iana", + "extensions": ["ami"] + }, + "application/vnd.amundsen.maze+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.android.package-archive": { + "source": "apache", + "compressible": false, + "extensions": ["apk"] + }, + "application/vnd.anki": { + "source": "iana" + }, + "application/vnd.anser-web-certificate-issue-initiation": { + "source": "iana", + "extensions": ["cii"] + }, + "application/vnd.anser-web-funds-transfer-initiation": { + "source": "apache", + "extensions": ["fti"] + }, + "application/vnd.antix.game-component": { + "source": "iana", + "extensions": ["atx"] + }, + "application/vnd.apache.thrift.binary": { + "source": "iana" + }, + "application/vnd.apache.thrift.compact": { + "source": "iana" + }, + "application/vnd.apache.thrift.json": { + "source": "iana" + }, + "application/vnd.api+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apothekende.reservation+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apple.installer+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpkg"] + }, + "application/vnd.apple.keynote": { + "source": "iana", + "extensions": ["keynote"] + }, + "application/vnd.apple.mpegurl": { + "source": "iana", + "extensions": ["m3u8"] + }, + "application/vnd.apple.numbers": { + "source": "iana", + "extensions": ["numbers"] + }, + "application/vnd.apple.pages": { + "source": "iana", + "extensions": ["pages"] + }, + "application/vnd.apple.pkpass": { + "compressible": false, + "extensions": ["pkpass"] + }, + "application/vnd.arastra.swi": { + "source": "iana" + }, + "application/vnd.aristanetworks.swi": { + "source": "iana", + "extensions": ["swi"] + }, + "application/vnd.artisan+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.artsquare": { + "source": "iana" + }, + "application/vnd.astraea-software.iota": { + "source": "iana", + "extensions": ["iota"] + }, + "application/vnd.audiograph": { + "source": "iana", + "extensions": ["aep"] + }, + "application/vnd.autopackage": { + "source": "iana" + }, + "application/vnd.avalon+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.avistar+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.balsamiq.bmml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.balsamiq.bmpr": { + "source": "iana" + }, + "application/vnd.banana-accounting": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bekitzur-stech+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bint.med-content": { + "source": "iana" + }, + "application/vnd.biopax.rdf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.blink-idb-value-wrapper": { + "source": "iana" + }, + "application/vnd.blueice.multipass": { + "source": "iana", + "extensions": ["mpm"] + }, + "application/vnd.bluetooth.ep.oob": { + "source": "iana" + }, + "application/vnd.bluetooth.le.oob": { + "source": "iana" + }, + "application/vnd.bmi": { + "source": "iana", + "extensions": ["bmi"] + }, + "application/vnd.businessobjects": { + "source": "iana", + "extensions": ["rep"] + }, + "application/vnd.byu.uapi+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cab-jscript": { + "source": "iana" + }, + "application/vnd.canon-cpdl": { + "source": "iana" + }, + "application/vnd.canon-lips": { + "source": "iana" + }, + "application/vnd.capasystems-pg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cendio.thinlinc.clientconf": { + "source": "iana" + }, + "application/vnd.century-systems.tcp_stream": { + "source": "iana" + }, + "application/vnd.chemdraw+xml": { + "source": "iana", + "compressible": true, + "extensions": ["cdxml"] + }, + "application/vnd.chess-pgn": { + "source": "iana" + }, + "application/vnd.chipnuts.karaoke-mmd": { + "source": "iana", + "extensions": ["mmd"] + }, + "application/vnd.cinderella": { + "source": "iana", + "extensions": ["cdy"] + }, + "application/vnd.cirpack.isdn-ext": { + "source": "iana" + }, + "application/vnd.citationstyles.style+xml": { + "source": "iana", + "compressible": true, + "extensions": ["csl"] + }, + "application/vnd.claymore": { + "source": "iana", + "extensions": ["cla"] + }, + "application/vnd.cloanto.rp9": { + "source": "iana", + "extensions": ["rp9"] + }, + "application/vnd.clonk.c4group": { + "source": "iana", + "extensions": ["c4g","c4d","c4f","c4p","c4u"] + }, + "application/vnd.cluetrust.cartomobile-config": { + "source": "iana", + "extensions": ["c11amc"] + }, + "application/vnd.cluetrust.cartomobile-config-pkg": { + "source": "iana", + "extensions": ["c11amz"] + }, + "application/vnd.coffeescript": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet-template": { + "source": "iana" + }, + "application/vnd.collection+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.doc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.next+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.comicbook+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.comicbook-rar": { + "source": "iana" + }, + "application/vnd.commerce-battelle": { + "source": "iana" + }, + "application/vnd.commonspace": { + "source": "iana", + "extensions": ["csp"] + }, + "application/vnd.contact.cmsg": { + "source": "iana", + "extensions": ["cdbcmsg"] + }, + "application/vnd.coreos.ignition+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cosmocaller": { + "source": "iana", + "extensions": ["cmc"] + }, + "application/vnd.crick.clicker": { + "source": "iana", + "extensions": ["clkx"] + }, + "application/vnd.crick.clicker.keyboard": { + "source": "iana", + "extensions": ["clkk"] + }, + "application/vnd.crick.clicker.palette": { + "source": "iana", + "extensions": ["clkp"] + }, + "application/vnd.crick.clicker.template": { + "source": "iana", + "extensions": ["clkt"] + }, + "application/vnd.crick.clicker.wordbank": { + "source": "iana", + "extensions": ["clkw"] + }, + "application/vnd.criticaltools.wbs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wbs"] + }, + "application/vnd.ctc-posml": { + "source": "iana", + "extensions": ["pml"] + }, + "application/vnd.ctct.ws+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cups-pdf": { + "source": "iana" + }, + "application/vnd.cups-postscript": { + "source": "iana" + }, + "application/vnd.cups-ppd": { + "source": "iana", + "extensions": ["ppd"] + }, + "application/vnd.cups-raster": { + "source": "iana" + }, + "application/vnd.cups-raw": { + "source": "iana" + }, + "application/vnd.curl": { + "source": "iana" + }, + "application/vnd.curl.car": { + "source": "apache", + "extensions": ["car"] + }, + "application/vnd.curl.pcurl": { + "source": "apache", + "extensions": ["pcurl"] + }, + "application/vnd.cyan.dean.root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cybank": { + "source": "iana" + }, + "application/vnd.d2l.coursepackage1p0+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.dart": { + "source": "iana", + "compressible": true, + "extensions": ["dart"] + }, + "application/vnd.data-vision.rdz": { + "source": "iana", + "extensions": ["rdz"] + }, + "application/vnd.datapackage+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dataresource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.debian.binary-package": { + "source": "iana" + }, + "application/vnd.dece.data": { + "source": "iana", + "extensions": ["uvf","uvvf","uvd","uvvd"] + }, + "application/vnd.dece.ttml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uvt","uvvt"] + }, + "application/vnd.dece.unspecified": { + "source": "iana", + "extensions": ["uvx","uvvx"] + }, + "application/vnd.dece.zip": { + "source": "iana", + "extensions": ["uvz","uvvz"] + }, + "application/vnd.denovo.fcselayout-link": { + "source": "iana", + "extensions": ["fe_launch"] + }, + "application/vnd.desmume.movie": { + "source": "iana" + }, + "application/vnd.dir-bi.plate-dl-nosuffix": { + "source": "iana" + }, + "application/vnd.dm.delegation+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dna": { + "source": "iana", + "extensions": ["dna"] + }, + "application/vnd.document+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dolby.mlp": { + "source": "apache", + "extensions": ["mlp"] + }, + "application/vnd.dolby.mobile.1": { + "source": "iana" + }, + "application/vnd.dolby.mobile.2": { + "source": "iana" + }, + "application/vnd.doremir.scorecloud-binary-document": { + "source": "iana" + }, + "application/vnd.dpgraph": { + "source": "iana", + "extensions": ["dpg"] + }, + "application/vnd.dreamfactory": { + "source": "iana", + "extensions": ["dfac"] + }, + "application/vnd.drive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ds-keypoint": { + "source": "apache", + "extensions": ["kpxx"] + }, + "application/vnd.dtg.local": { + "source": "iana" + }, + "application/vnd.dtg.local.flash": { + "source": "iana" + }, + "application/vnd.dtg.local.html": { + "source": "iana" + }, + "application/vnd.dvb.ait": { + "source": "iana", + "extensions": ["ait"] + }, + "application/vnd.dvb.dvbj": { + "source": "iana" + }, + "application/vnd.dvb.esgcontainer": { + "source": "iana" + }, + "application/vnd.dvb.ipdcdftnotifaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess2": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgpdd": { + "source": "iana" + }, + "application/vnd.dvb.ipdcroaming": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-base": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-enhancement": { + "source": "iana" + }, + "application/vnd.dvb.notif-aggregate-root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-container+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-generic+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-msglist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-response+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-init+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.pfr": { + "source": "iana" + }, + "application/vnd.dvb.service": { + "source": "iana", + "extensions": ["svc"] + }, + "application/vnd.dxr": { + "source": "iana" + }, + "application/vnd.dynageo": { + "source": "iana", + "extensions": ["geo"] + }, + "application/vnd.dzr": { + "source": "iana" + }, + "application/vnd.easykaraoke.cdgdownload": { + "source": "iana" + }, + "application/vnd.ecdis-update": { + "source": "iana" + }, + "application/vnd.ecip.rlp": { + "source": "iana" + }, + "application/vnd.ecowin.chart": { + "source": "iana", + "extensions": ["mag"] + }, + "application/vnd.ecowin.filerequest": { + "source": "iana" + }, + "application/vnd.ecowin.fileupdate": { + "source": "iana" + }, + "application/vnd.ecowin.series": { + "source": "iana" + }, + "application/vnd.ecowin.seriesrequest": { + "source": "iana" + }, + "application/vnd.ecowin.seriesupdate": { + "source": "iana" + }, + "application/vnd.efi.img": { + "source": "iana" + }, + "application/vnd.efi.iso": { + "source": "iana" + }, + "application/vnd.emclient.accessrequest+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.enliven": { + "source": "iana", + "extensions": ["nml"] + }, + "application/vnd.enphase.envoy": { + "source": "iana" + }, + "application/vnd.eprints.data+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.epson.esf": { + "source": "iana", + "extensions": ["esf"] + }, + "application/vnd.epson.msf": { + "source": "iana", + "extensions": ["msf"] + }, + "application/vnd.epson.quickanime": { + "source": "iana", + "extensions": ["qam"] + }, + "application/vnd.epson.salt": { + "source": "iana", + "extensions": ["slt"] + }, + "application/vnd.epson.ssf": { + "source": "iana", + "extensions": ["ssf"] + }, + "application/vnd.ericsson.quickcall": { + "source": "iana" + }, + "application/vnd.espass-espass+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.eszigno3+xml": { + "source": "iana", + "compressible": true, + "extensions": ["es3","et3"] + }, + "application/vnd.etsi.aoc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.asic-e+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.asic-s+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.cug+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvcommand+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-bc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-cod+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-npvr+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvservice+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsync+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mcid+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mheg5": { + "source": "iana" + }, + "application/vnd.etsi.overload-control-policy-dataset+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.pstn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.sci+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.simservs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.timestamp-token": { + "source": "iana" + }, + "application/vnd.etsi.tsl+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.tsl.der": { + "source": "iana" + }, + "application/vnd.eudora.data": { + "source": "iana" + }, + "application/vnd.evolv.ecig.profile": { + "source": "iana" + }, + "application/vnd.evolv.ecig.settings": { + "source": "iana" + }, + "application/vnd.evolv.ecig.theme": { + "source": "iana" + }, + "application/vnd.exstream-empower+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.exstream-package": { + "source": "iana" + }, + "application/vnd.ezpix-album": { + "source": "iana", + "extensions": ["ez2"] + }, + "application/vnd.ezpix-package": { + "source": "iana", + "extensions": ["ez3"] + }, + "application/vnd.f-secure.mobile": { + "source": "iana" + }, + "application/vnd.fastcopy-disk-image": { + "source": "iana" + }, + "application/vnd.fdf": { + "source": "iana", + "extensions": ["fdf"] + }, + "application/vnd.fdsn.mseed": { + "source": "iana", + "extensions": ["mseed"] + }, + "application/vnd.fdsn.seed": { + "source": "iana", + "extensions": ["seed","dataless"] + }, + "application/vnd.ffsns": { + "source": "iana" + }, + "application/vnd.filmit.zfc": { + "source": "iana" + }, + "application/vnd.fints": { + "source": "iana" + }, + "application/vnd.firemonkeys.cloudcell": { + "source": "iana" + }, + "application/vnd.flographit": { + "source": "iana", + "extensions": ["gph"] + }, + "application/vnd.fluxtime.clip": { + "source": "iana", + "extensions": ["ftc"] + }, + "application/vnd.font-fontforge-sfd": { + "source": "iana" + }, + "application/vnd.framemaker": { + "source": "iana", + "extensions": ["fm","frame","maker","book"] + }, + "application/vnd.frogans.fnc": { + "source": "iana", + "extensions": ["fnc"] + }, + "application/vnd.frogans.ltf": { + "source": "iana", + "extensions": ["ltf"] + }, + "application/vnd.fsc.weblaunch": { + "source": "iana", + "extensions": ["fsc"] + }, + "application/vnd.fujitsu.oasys": { + "source": "iana", + "extensions": ["oas"] + }, + "application/vnd.fujitsu.oasys2": { + "source": "iana", + "extensions": ["oa2"] + }, + "application/vnd.fujitsu.oasys3": { + "source": "iana", + "extensions": ["oa3"] + }, + "application/vnd.fujitsu.oasysgp": { + "source": "iana", + "extensions": ["fg5"] + }, + "application/vnd.fujitsu.oasysprs": { + "source": "iana", + "extensions": ["bh2"] + }, + "application/vnd.fujixerox.art-ex": { + "source": "iana" + }, + "application/vnd.fujixerox.art4": { + "source": "iana" + }, + "application/vnd.fujixerox.ddd": { + "source": "iana", + "extensions": ["ddd"] + }, + "application/vnd.fujixerox.docuworks": { + "source": "iana", + "extensions": ["xdw"] + }, + "application/vnd.fujixerox.docuworks.binder": { + "source": "iana", + "extensions": ["xbd"] + }, + "application/vnd.fujixerox.docuworks.container": { + "source": "iana" + }, + "application/vnd.fujixerox.hbpl": { + "source": "iana" + }, + "application/vnd.fut-misnet": { + "source": "iana" + }, + "application/vnd.futoin+cbor": { + "source": "iana" + }, + "application/vnd.futoin+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.fuzzysheet": { + "source": "iana", + "extensions": ["fzs"] + }, + "application/vnd.genomatix.tuxedo": { + "source": "iana", + "extensions": ["txd"] + }, + "application/vnd.geo+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.geocube+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.geogebra.file": { + "source": "iana", + "extensions": ["ggb"] + }, + "application/vnd.geogebra.tool": { + "source": "iana", + "extensions": ["ggt"] + }, + "application/vnd.geometry-explorer": { + "source": "iana", + "extensions": ["gex","gre"] + }, + "application/vnd.geonext": { + "source": "iana", + "extensions": ["gxt"] + }, + "application/vnd.geoplan": { + "source": "iana", + "extensions": ["g2w"] + }, + "application/vnd.geospace": { + "source": "iana", + "extensions": ["g3w"] + }, + "application/vnd.gerber": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt-response": { + "source": "iana" + }, + "application/vnd.gmx": { + "source": "iana", + "extensions": ["gmx"] + }, + "application/vnd.google-apps.document": { + "compressible": false, + "extensions": ["gdoc"] + }, + "application/vnd.google-apps.presentation": { + "compressible": false, + "extensions": ["gslides"] + }, + "application/vnd.google-apps.spreadsheet": { + "compressible": false, + "extensions": ["gsheet"] + }, + "application/vnd.google-earth.kml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["kml"] + }, + "application/vnd.google-earth.kmz": { + "source": "iana", + "compressible": false, + "extensions": ["kmz"] + }, + "application/vnd.gov.sk.e-form+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.gov.sk.e-form+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.gov.sk.xmldatacontainer+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.grafeq": { + "source": "iana", + "extensions": ["gqf","gqs"] + }, + "application/vnd.gridmp": { + "source": "iana" + }, + "application/vnd.groove-account": { + "source": "iana", + "extensions": ["gac"] + }, + "application/vnd.groove-help": { + "source": "iana", + "extensions": ["ghf"] + }, + "application/vnd.groove-identity-message": { + "source": "iana", + "extensions": ["gim"] + }, + "application/vnd.groove-injector": { + "source": "iana", + "extensions": ["grv"] + }, + "application/vnd.groove-tool-message": { + "source": "iana", + "extensions": ["gtm"] + }, + "application/vnd.groove-tool-template": { + "source": "iana", + "extensions": ["tpl"] + }, + "application/vnd.groove-vcard": { + "source": "iana", + "extensions": ["vcg"] + }, + "application/vnd.hal+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hal+xml": { + "source": "iana", + "compressible": true, + "extensions": ["hal"] + }, + "application/vnd.handheld-entertainment+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zmm"] + }, + "application/vnd.hbci": { + "source": "iana", + "extensions": ["hbci"] + }, + "application/vnd.hc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hcl-bireports": { + "source": "iana" + }, + "application/vnd.hdt": { + "source": "iana" + }, + "application/vnd.heroku+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hhe.lesson-player": { + "source": "iana", + "extensions": ["les"] + }, + "application/vnd.hp-hpgl": { + "source": "iana", + "extensions": ["hpgl"] + }, + "application/vnd.hp-hpid": { + "source": "iana", + "extensions": ["hpid"] + }, + "application/vnd.hp-hps": { + "source": "iana", + "extensions": ["hps"] + }, + "application/vnd.hp-jlyt": { + "source": "iana", + "extensions": ["jlt"] + }, + "application/vnd.hp-pcl": { + "source": "iana", + "extensions": ["pcl"] + }, + "application/vnd.hp-pclxl": { + "source": "iana", + "extensions": ["pclxl"] + }, + "application/vnd.httphone": { + "source": "iana" + }, + "application/vnd.hydrostatix.sof-data": { + "source": "iana", + "extensions": ["sfd-hdstx"] + }, + "application/vnd.hyper+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyper-item+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyperdrive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hzn-3d-crossword": { + "source": "iana" + }, + "application/vnd.ibm.afplinedata": { + "source": "iana" + }, + "application/vnd.ibm.electronic-media": { + "source": "iana" + }, + "application/vnd.ibm.minipay": { + "source": "iana", + "extensions": ["mpy"] + }, + "application/vnd.ibm.modcap": { + "source": "iana", + "extensions": ["afp","listafp","list3820"] + }, + "application/vnd.ibm.rights-management": { + "source": "iana", + "extensions": ["irm"] + }, + "application/vnd.ibm.secure-container": { + "source": "iana", + "extensions": ["sc"] + }, + "application/vnd.iccprofile": { + "source": "iana", + "extensions": ["icc","icm"] + }, + "application/vnd.ieee.1905": { + "source": "iana" + }, + "application/vnd.igloader": { + "source": "iana", + "extensions": ["igl"] + }, + "application/vnd.imagemeter.folder+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.imagemeter.image+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.immervision-ivp": { + "source": "iana", + "extensions": ["ivp"] + }, + "application/vnd.immervision-ivu": { + "source": "iana", + "extensions": ["ivu"] + }, + "application/vnd.ims.imsccv1p1": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p2": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p3": { + "source": "iana" + }, + "application/vnd.ims.lis.v2.result+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolconsumerprofile+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy.id+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings.simple+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.informedcontrol.rms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.informix-visionary": { + "source": "iana" + }, + "application/vnd.infotech.project": { + "source": "iana" + }, + "application/vnd.infotech.project+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.innopath.wamp.notification": { + "source": "iana" + }, + "application/vnd.insors.igm": { + "source": "iana", + "extensions": ["igm"] + }, + "application/vnd.intercon.formnet": { + "source": "iana", + "extensions": ["xpw","xpx"] + }, + "application/vnd.intergeo": { + "source": "iana", + "extensions": ["i2g"] + }, + "application/vnd.intertrust.digibox": { + "source": "iana" + }, + "application/vnd.intertrust.nncp": { + "source": "iana" + }, + "application/vnd.intu.qbo": { + "source": "iana", + "extensions": ["qbo"] + }, + "application/vnd.intu.qfx": { + "source": "iana", + "extensions": ["qfx"] + }, + "application/vnd.iptc.g2.catalogitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.conceptitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.knowledgeitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.packageitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.planningitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ipunplugged.rcprofile": { + "source": "iana", + "extensions": ["rcprofile"] + }, + "application/vnd.irepository.package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["irp"] + }, + "application/vnd.is-xpr": { + "source": "iana", + "extensions": ["xpr"] + }, + "application/vnd.isac.fcs": { + "source": "iana", + "extensions": ["fcs"] + }, + "application/vnd.jam": { + "source": "iana", + "extensions": ["jam"] + }, + "application/vnd.japannet-directory-service": { + "source": "iana" + }, + "application/vnd.japannet-jpnstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-payment-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-registration": { + "source": "iana" + }, + "application/vnd.japannet-registration-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-setstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-verification": { + "source": "iana" + }, + "application/vnd.japannet-verification-wakeup": { + "source": "iana" + }, + "application/vnd.jcp.javame.midlet-rms": { + "source": "iana", + "extensions": ["rms"] + }, + "application/vnd.jisp": { + "source": "iana", + "extensions": ["jisp"] + }, + "application/vnd.joost.joda-archive": { + "source": "iana", + "extensions": ["joda"] + }, + "application/vnd.jsk.isdn-ngn": { + "source": "iana" + }, + "application/vnd.kahootz": { + "source": "iana", + "extensions": ["ktz","ktr"] + }, + "application/vnd.kde.karbon": { + "source": "iana", + "extensions": ["karbon"] + }, + "application/vnd.kde.kchart": { + "source": "iana", + "extensions": ["chrt"] + }, + "application/vnd.kde.kformula": { + "source": "iana", + "extensions": ["kfo"] + }, + "application/vnd.kde.kivio": { + "source": "iana", + "extensions": ["flw"] + }, + "application/vnd.kde.kontour": { + "source": "iana", + "extensions": ["kon"] + }, + "application/vnd.kde.kpresenter": { + "source": "iana", + "extensions": ["kpr","kpt"] + }, + "application/vnd.kde.kspread": { + "source": "iana", + "extensions": ["ksp"] + }, + "application/vnd.kde.kword": { + "source": "iana", + "extensions": ["kwd","kwt"] + }, + "application/vnd.kenameaapp": { + "source": "iana", + "extensions": ["htke"] + }, + "application/vnd.kidspiration": { + "source": "iana", + "extensions": ["kia"] + }, + "application/vnd.kinar": { + "source": "iana", + "extensions": ["kne","knp"] + }, + "application/vnd.koan": { + "source": "iana", + "extensions": ["skp","skd","skt","skm"] + }, + "application/vnd.kodak-descriptor": { + "source": "iana", + "extensions": ["sse"] + }, + "application/vnd.las.las+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.las.las+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lasxml"] + }, + "application/vnd.leap+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.liberty-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.llamagraphics.life-balance.desktop": { + "source": "iana", + "extensions": ["lbd"] + }, + "application/vnd.llamagraphics.life-balance.exchange+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lbe"] + }, + "application/vnd.lotus-1-2-3": { + "source": "iana", + "extensions": ["123"] + }, + "application/vnd.lotus-approach": { + "source": "iana", + "extensions": ["apr"] + }, + "application/vnd.lotus-freelance": { + "source": "iana", + "extensions": ["pre"] + }, + "application/vnd.lotus-notes": { + "source": "iana", + "extensions": ["nsf"] + }, + "application/vnd.lotus-organizer": { + "source": "iana", + "extensions": ["org"] + }, + "application/vnd.lotus-screencam": { + "source": "iana", + "extensions": ["scm"] + }, + "application/vnd.lotus-wordpro": { + "source": "iana", + "extensions": ["lwp"] + }, + "application/vnd.macports.portpkg": { + "source": "iana", + "extensions": ["portpkg"] + }, + "application/vnd.mapbox-vector-tile": { + "source": "iana" + }, + "application/vnd.marlin.drm.actiontoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.conftoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.license+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.mdcf": { + "source": "iana" + }, + "application/vnd.mason+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.maxmind.maxmind-db": { + "source": "iana" + }, + "application/vnd.mcd": { + "source": "iana", + "extensions": ["mcd"] + }, + "application/vnd.medcalcdata": { + "source": "iana", + "extensions": ["mc1"] + }, + "application/vnd.mediastation.cdkey": { + "source": "iana", + "extensions": ["cdkey"] + }, + "application/vnd.meridian-slingshot": { + "source": "iana" + }, + "application/vnd.mfer": { + "source": "iana", + "extensions": ["mwf"] + }, + "application/vnd.mfmp": { + "source": "iana", + "extensions": ["mfm"] + }, + "application/vnd.micro+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.micrografx.flo": { + "source": "iana", + "extensions": ["flo"] + }, + "application/vnd.micrografx.igx": { + "source": "iana", + "extensions": ["igx"] + }, + "application/vnd.microsoft.portable-executable": { + "source": "iana" + }, + "application/vnd.microsoft.windows.thumbnail-cache": { + "source": "iana" + }, + "application/vnd.miele+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.mif": { + "source": "iana", + "extensions": ["mif"] + }, + "application/vnd.minisoft-hp3000-save": { + "source": "iana" + }, + "application/vnd.mitsubishi.misty-guard.trustweb": { + "source": "iana" + }, + "application/vnd.mobius.daf": { + "source": "iana", + "extensions": ["daf"] + }, + "application/vnd.mobius.dis": { + "source": "iana", + "extensions": ["dis"] + }, + "application/vnd.mobius.mbk": { + "source": "iana", + "extensions": ["mbk"] + }, + "application/vnd.mobius.mqy": { + "source": "iana", + "extensions": ["mqy"] + }, + "application/vnd.mobius.msl": { + "source": "iana", + "extensions": ["msl"] + }, + "application/vnd.mobius.plc": { + "source": "iana", + "extensions": ["plc"] + }, + "application/vnd.mobius.txf": { + "source": "iana", + "extensions": ["txf"] + }, + "application/vnd.mophun.application": { + "source": "iana", + "extensions": ["mpn"] + }, + "application/vnd.mophun.certificate": { + "source": "iana", + "extensions": ["mpc"] + }, + "application/vnd.motorola.flexsuite": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.adsi": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.fis": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.gotap": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.kmr": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.ttc": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.wem": { + "source": "iana" + }, + "application/vnd.motorola.iprm": { + "source": "iana" + }, + "application/vnd.mozilla.xul+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xul"] + }, + "application/vnd.ms-3mfdocument": { + "source": "iana" + }, + "application/vnd.ms-artgalry": { + "source": "iana", + "extensions": ["cil"] + }, + "application/vnd.ms-asf": { + "source": "iana" + }, + "application/vnd.ms-cab-compressed": { + "source": "iana", + "extensions": ["cab"] + }, + "application/vnd.ms-color.iccprofile": { + "source": "apache" + }, + "application/vnd.ms-excel": { + "source": "iana", + "compressible": false, + "extensions": ["xls","xlm","xla","xlc","xlt","xlw"] + }, + "application/vnd.ms-excel.addin.macroenabled.12": { + "source": "iana", + "extensions": ["xlam"] + }, + "application/vnd.ms-excel.sheet.binary.macroenabled.12": { + "source": "iana", + "extensions": ["xlsb"] + }, + "application/vnd.ms-excel.sheet.macroenabled.12": { + "source": "iana", + "extensions": ["xlsm"] + }, + "application/vnd.ms-excel.template.macroenabled.12": { + "source": "iana", + "extensions": ["xltm"] + }, + "application/vnd.ms-fontobject": { + "source": "iana", + "compressible": true, + "extensions": ["eot"] + }, + "application/vnd.ms-htmlhelp": { + "source": "iana", + "extensions": ["chm"] + }, + "application/vnd.ms-ims": { + "source": "iana", + "extensions": ["ims"] + }, + "application/vnd.ms-lrm": { + "source": "iana", + "extensions": ["lrm"] + }, + "application/vnd.ms-office.activex+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-officetheme": { + "source": "iana", + "extensions": ["thmx"] + }, + "application/vnd.ms-opentype": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-outlook": { + "compressible": false, + "extensions": ["msg"] + }, + "application/vnd.ms-package.obfuscated-opentype": { + "source": "apache" + }, + "application/vnd.ms-pki.seccat": { + "source": "apache", + "extensions": ["cat"] + }, + "application/vnd.ms-pki.stl": { + "source": "apache", + "extensions": ["stl"] + }, + "application/vnd.ms-playready.initiator+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-powerpoint": { + "source": "iana", + "compressible": false, + "extensions": ["ppt","pps","pot"] + }, + "application/vnd.ms-powerpoint.addin.macroenabled.12": { + "source": "iana", + "extensions": ["ppam"] + }, + "application/vnd.ms-powerpoint.presentation.macroenabled.12": { + "source": "iana", + "extensions": ["pptm"] + }, + "application/vnd.ms-powerpoint.slide.macroenabled.12": { + "source": "iana", + "extensions": ["sldm"] + }, + "application/vnd.ms-powerpoint.slideshow.macroenabled.12": { + "source": "iana", + "extensions": ["ppsm"] + }, + "application/vnd.ms-powerpoint.template.macroenabled.12": { + "source": "iana", + "extensions": ["potm"] + }, + "application/vnd.ms-printdevicecapabilities+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-printing.printticket+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-printschematicket+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-project": { + "source": "iana", + "extensions": ["mpp","mpt"] + }, + "application/vnd.ms-tnef": { + "source": "iana" + }, + "application/vnd.ms-windows.devicepairing": { + "source": "iana" + }, + "application/vnd.ms-windows.nwprinting.oob": { + "source": "iana" + }, + "application/vnd.ms-windows.printerpairing": { + "source": "iana" + }, + "application/vnd.ms-windows.wsd.oob": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-resp": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-resp": { + "source": "iana" + }, + "application/vnd.ms-word.document.macroenabled.12": { + "source": "iana", + "extensions": ["docm"] + }, + "application/vnd.ms-word.template.macroenabled.12": { + "source": "iana", + "extensions": ["dotm"] + }, + "application/vnd.ms-works": { + "source": "iana", + "extensions": ["wps","wks","wcm","wdb"] + }, + "application/vnd.ms-wpl": { + "source": "iana", + "extensions": ["wpl"] + }, + "application/vnd.ms-xpsdocument": { + "source": "iana", + "compressible": false, + "extensions": ["xps"] + }, + "application/vnd.msa-disk-image": { + "source": "iana" + }, + "application/vnd.mseq": { + "source": "iana", + "extensions": ["mseq"] + }, + "application/vnd.msign": { + "source": "iana" + }, + "application/vnd.multiad.creator": { + "source": "iana" + }, + "application/vnd.multiad.creator.cif": { + "source": "iana" + }, + "application/vnd.music-niff": { + "source": "iana" + }, + "application/vnd.musician": { + "source": "iana", + "extensions": ["mus"] + }, + "application/vnd.muvee.style": { + "source": "iana", + "extensions": ["msty"] + }, + "application/vnd.mynfc": { + "source": "iana", + "extensions": ["taglet"] + }, + "application/vnd.ncd.control": { + "source": "iana" + }, + "application/vnd.ncd.reference": { + "source": "iana" + }, + "application/vnd.nearst.inv+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nervana": { + "source": "iana" + }, + "application/vnd.netfpx": { + "source": "iana" + }, + "application/vnd.neurolanguage.nlu": { + "source": "iana", + "extensions": ["nlu"] + }, + "application/vnd.nimn": { + "source": "iana" + }, + "application/vnd.nintendo.nitro.rom": { + "source": "iana" + }, + "application/vnd.nintendo.snes.rom": { + "source": "iana" + }, + "application/vnd.nitf": { + "source": "iana", + "extensions": ["ntf","nitf"] + }, + "application/vnd.noblenet-directory": { + "source": "iana", + "extensions": ["nnd"] + }, + "application/vnd.noblenet-sealer": { + "source": "iana", + "extensions": ["nns"] + }, + "application/vnd.noblenet-web": { + "source": "iana", + "extensions": ["nnw"] + }, + "application/vnd.nokia.catalogs": { + "source": "iana" + }, + "application/vnd.nokia.conml+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.conml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.iptv.config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.isds-radio-presets": { + "source": "iana" + }, + "application/vnd.nokia.landmark+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.landmark+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.landmarkcollection+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.n-gage.ac+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.n-gage.data": { + "source": "iana", + "extensions": ["ngdat"] + }, + "application/vnd.nokia.n-gage.symbian.install": { + "source": "iana", + "extensions": ["n-gage"] + }, + "application/vnd.nokia.ncd": { + "source": "iana" + }, + "application/vnd.nokia.pcd+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.pcd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.radio-preset": { + "source": "iana", + "extensions": ["rpst"] + }, + "application/vnd.nokia.radio-presets": { + "source": "iana", + "extensions": ["rpss"] + }, + "application/vnd.novadigm.edm": { + "source": "iana", + "extensions": ["edm"] + }, + "application/vnd.novadigm.edx": { + "source": "iana", + "extensions": ["edx"] + }, + "application/vnd.novadigm.ext": { + "source": "iana", + "extensions": ["ext"] + }, + "application/vnd.ntt-local.content-share": { + "source": "iana" + }, + "application/vnd.ntt-local.file-transfer": { + "source": "iana" + }, + "application/vnd.ntt-local.ogw_remote-access": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_remote": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_tcp_stream": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.chart": { + "source": "iana", + "extensions": ["odc"] + }, + "application/vnd.oasis.opendocument.chart-template": { + "source": "iana", + "extensions": ["otc"] + }, + "application/vnd.oasis.opendocument.database": { + "source": "iana", + "extensions": ["odb"] + }, + "application/vnd.oasis.opendocument.formula": { + "source": "iana", + "extensions": ["odf"] + }, + "application/vnd.oasis.opendocument.formula-template": { + "source": "iana", + "extensions": ["odft"] + }, + "application/vnd.oasis.opendocument.graphics": { + "source": "iana", + "compressible": false, + "extensions": ["odg"] + }, + "application/vnd.oasis.opendocument.graphics-template": { + "source": "iana", + "extensions": ["otg"] + }, + "application/vnd.oasis.opendocument.image": { + "source": "iana", + "extensions": ["odi"] + }, + "application/vnd.oasis.opendocument.image-template": { + "source": "iana", + "extensions": ["oti"] + }, + "application/vnd.oasis.opendocument.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["odp"] + }, + "application/vnd.oasis.opendocument.presentation-template": { + "source": "iana", + "extensions": ["otp"] + }, + "application/vnd.oasis.opendocument.spreadsheet": { + "source": "iana", + "compressible": false, + "extensions": ["ods"] + }, + "application/vnd.oasis.opendocument.spreadsheet-template": { + "source": "iana", + "extensions": ["ots"] + }, + "application/vnd.oasis.opendocument.text": { + "source": "iana", + "compressible": false, + "extensions": ["odt"] + }, + "application/vnd.oasis.opendocument.text-master": { + "source": "iana", + "extensions": ["odm"] + }, + "application/vnd.oasis.opendocument.text-template": { + "source": "iana", + "extensions": ["ott"] + }, + "application/vnd.oasis.opendocument.text-web": { + "source": "iana", + "extensions": ["oth"] + }, + "application/vnd.obn": { + "source": "iana" + }, + "application/vnd.ocf+cbor": { + "source": "iana" + }, + "application/vnd.oftn.l10n+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessdownload+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessstreaming+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.cspg-hexbinary": { + "source": "iana" + }, + "application/vnd.oipf.dae.svg+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.dae.xhtml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.mippvcontrolmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.pae.gem": { + "source": "iana" + }, + "application/vnd.oipf.spdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.spdlist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.ueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.userprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.olpc-sugar": { + "source": "iana", + "extensions": ["xo"] + }, + "application/vnd.oma-scws-config": { + "source": "iana" + }, + "application/vnd.oma-scws-http-request": { + "source": "iana" + }, + "application/vnd.oma-scws-http-response": { + "source": "iana" + }, + "application/vnd.oma.bcast.associated-procedure-parameter+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.drm-trigger+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.imd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.ltkm": { + "source": "iana" + }, + "application/vnd.oma.bcast.notification+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.provisioningtrigger": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgboot": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.sgdu": { + "source": "iana" + }, + "application/vnd.oma.bcast.simple-symbol-container": { + "source": "iana" + }, + "application/vnd.oma.bcast.smartcard-trigger+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.sprov+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.stkm": { + "source": "iana" + }, + "application/vnd.oma.cab-address-book+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-feature-handler+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-pcc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-subs-invite+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-user-prefs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.dcd": { + "source": "iana" + }, + "application/vnd.oma.dcdc": { + "source": "iana" + }, + "application/vnd.oma.dd2+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dd2"] + }, + "application/vnd.oma.drm.risd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.group-usage-list+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+tlv": { + "source": "iana" + }, + "application/vnd.oma.pal+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.detailed-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.final-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.groups+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.invocation-descriptor+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.optimized-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.push": { + "source": "iana" + }, + "application/vnd.oma.scidm.messages+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.xcap-directory+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-email+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-file+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-folder+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omaloc-supl-init": { + "source": "iana" + }, + "application/vnd.onepager": { + "source": "iana" + }, + "application/vnd.onepagertamp": { + "source": "iana" + }, + "application/vnd.onepagertamx": { + "source": "iana" + }, + "application/vnd.onepagertat": { + "source": "iana" + }, + "application/vnd.onepagertatp": { + "source": "iana" + }, + "application/vnd.onepagertatx": { + "source": "iana" + }, + "application/vnd.openblox.game+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openblox.game-binary": { + "source": "iana" + }, + "application/vnd.openeye.oeb": { + "source": "iana" + }, + "application/vnd.openofficeorg.extension": { + "source": "apache", + "extensions": ["oxt"] + }, + "application/vnd.openstreetmap.data+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.custom-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawing+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.extended-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["pptx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide": { + "source": "iana", + "extensions": ["sldx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow": { + "source": "iana", + "extensions": ["ppsx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.template": { + "source": "iana", + "extensions": ["potx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": { + "source": "iana", + "compressible": false, + "extensions": ["xlsx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template": { + "source": "iana", + "extensions": ["xltx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.theme+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.themeoverride+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.vmldrawing": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document": { + "source": "iana", + "compressible": false, + "extensions": ["docx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template": { + "source": "iana", + "extensions": ["dotx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.core-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.relationships+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oracle.resource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.orange.indata": { + "source": "iana" + }, + "application/vnd.osa.netdeploy": { + "source": "iana" + }, + "application/vnd.osgeo.mapguide.package": { + "source": "iana", + "extensions": ["mgp"] + }, + "application/vnd.osgi.bundle": { + "source": "iana" + }, + "application/vnd.osgi.dp": { + "source": "iana", + "extensions": ["dp"] + }, + "application/vnd.osgi.subsystem": { + "source": "iana", + "extensions": ["esa"] + }, + "application/vnd.otps.ct-kip+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oxli.countgraph": { + "source": "iana" + }, + "application/vnd.pagerduty+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.palm": { + "source": "iana", + "extensions": ["pdb","pqa","oprc"] + }, + "application/vnd.panoply": { + "source": "iana" + }, + "application/vnd.paos.xml": { + "source": "iana" + }, + "application/vnd.patentdive": { + "source": "iana" + }, + "application/vnd.patientecommsdoc": { + "source": "iana" + }, + "application/vnd.pawaafile": { + "source": "iana", + "extensions": ["paw"] + }, + "application/vnd.pcos": { + "source": "iana" + }, + "application/vnd.pg.format": { + "source": "iana", + "extensions": ["str"] + }, + "application/vnd.pg.osasli": { + "source": "iana", + "extensions": ["ei6"] + }, + "application/vnd.piaccess.application-licence": { + "source": "iana" + }, + "application/vnd.picsel": { + "source": "iana", + "extensions": ["efif"] + }, + "application/vnd.pmi.widget": { + "source": "iana", + "extensions": ["wg"] + }, + "application/vnd.poc.group-advertisement+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.pocketlearn": { + "source": "iana", + "extensions": ["plf"] + }, + "application/vnd.powerbuilder6": { + "source": "iana", + "extensions": ["pbd"] + }, + "application/vnd.powerbuilder6-s": { + "source": "iana" + }, + "application/vnd.powerbuilder7": { + "source": "iana" + }, + "application/vnd.powerbuilder7-s": { + "source": "iana" + }, + "application/vnd.powerbuilder75": { + "source": "iana" + }, + "application/vnd.powerbuilder75-s": { + "source": "iana" + }, + "application/vnd.preminet": { + "source": "iana" + }, + "application/vnd.previewsystems.box": { + "source": "iana", + "extensions": ["box"] + }, + "application/vnd.proteus.magazine": { + "source": "iana", + "extensions": ["mgz"] + }, + "application/vnd.psfs": { + "source": "iana" + }, + "application/vnd.publishare-delta-tree": { + "source": "iana", + "extensions": ["qps"] + }, + "application/vnd.pvi.ptid1": { + "source": "iana", + "extensions": ["ptid"] + }, + "application/vnd.pwg-multiplexed": { + "source": "iana" + }, + "application/vnd.pwg-xhtml-print+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.qualcomm.brew-app-res": { + "source": "iana" + }, + "application/vnd.quarantainenet": { + "source": "iana" + }, + "application/vnd.quark.quarkxpress": { + "source": "iana", + "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"] + }, + "application/vnd.quobject-quoxdocument": { + "source": "iana" + }, + "application/vnd.radisys.moml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-stream+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-base+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-detect+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-group+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-speech+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-transform+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.rainstor.data": { + "source": "iana" + }, + "application/vnd.rapid": { + "source": "iana" + }, + "application/vnd.rar": { + "source": "iana" + }, + "application/vnd.realvnc.bed": { + "source": "iana", + "extensions": ["bed"] + }, + "application/vnd.recordare.musicxml": { + "source": "iana", + "extensions": ["mxl"] + }, + "application/vnd.recordare.musicxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["musicxml"] + }, + "application/vnd.renlearn.rlprint": { + "source": "iana" + }, + "application/vnd.restful+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.rig.cryptonote": { + "source": "iana", + "extensions": ["cryptonote"] + }, + "application/vnd.rim.cod": { + "source": "apache", + "extensions": ["cod"] + }, + "application/vnd.rn-realmedia": { + "source": "apache", + "extensions": ["rm"] + }, + "application/vnd.rn-realmedia-vbr": { + "source": "apache", + "extensions": ["rmvb"] + }, + "application/vnd.route66.link66+xml": { + "source": "iana", + "compressible": true, + "extensions": ["link66"] + }, + "application/vnd.rs-274x": { + "source": "iana" + }, + "application/vnd.ruckus.download": { + "source": "iana" + }, + "application/vnd.s3sms": { + "source": "iana" + }, + "application/vnd.sailingtracker.track": { + "source": "iana", + "extensions": ["st"] + }, + "application/vnd.sbm.cid": { + "source": "iana" + }, + "application/vnd.sbm.mid2": { + "source": "iana" + }, + "application/vnd.scribus": { + "source": "iana" + }, + "application/vnd.sealed.3df": { + "source": "iana" + }, + "application/vnd.sealed.csf": { + "source": "iana" + }, + "application/vnd.sealed.doc": { + "source": "iana" + }, + "application/vnd.sealed.eml": { + "source": "iana" + }, + "application/vnd.sealed.mht": { + "source": "iana" + }, + "application/vnd.sealed.net": { + "source": "iana" + }, + "application/vnd.sealed.ppt": { + "source": "iana" + }, + "application/vnd.sealed.tiff": { + "source": "iana" + }, + "application/vnd.sealed.xls": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.html": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.pdf": { + "source": "iana" + }, + "application/vnd.seemail": { + "source": "iana", + "extensions": ["see"] + }, + "application/vnd.sema": { + "source": "iana", + "extensions": ["sema"] + }, + "application/vnd.semd": { + "source": "iana", + "extensions": ["semd"] + }, + "application/vnd.semf": { + "source": "iana", + "extensions": ["semf"] + }, + "application/vnd.shana.informed.formdata": { + "source": "iana", + "extensions": ["ifm"] + }, + "application/vnd.shana.informed.formtemplate": { + "source": "iana", + "extensions": ["itp"] + }, + "application/vnd.shana.informed.interchange": { + "source": "iana", + "extensions": ["iif"] + }, + "application/vnd.shana.informed.package": { + "source": "iana", + "extensions": ["ipk"] + }, + "application/vnd.shootproof+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.sigrok.session": { + "source": "iana" + }, + "application/vnd.simtech-mindmapper": { + "source": "iana", + "extensions": ["twd","twds"] + }, + "application/vnd.siren+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.smaf": { + "source": "iana", + "extensions": ["mmf"] + }, + "application/vnd.smart.notebook": { + "source": "iana" + }, + "application/vnd.smart.teacher": { + "source": "iana", + "extensions": ["teacher"] + }, + "application/vnd.software602.filler.form+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.software602.filler.form-xml-zip": { + "source": "iana" + }, + "application/vnd.solent.sdkm+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sdkm","sdkd"] + }, + "application/vnd.spotfire.dxp": { + "source": "iana", + "extensions": ["dxp"] + }, + "application/vnd.spotfire.sfs": { + "source": "iana", + "extensions": ["sfs"] + }, + "application/vnd.sqlite3": { + "source": "iana" + }, + "application/vnd.sss-cod": { + "source": "iana" + }, + "application/vnd.sss-dtf": { + "source": "iana" + }, + "application/vnd.sss-ntf": { + "source": "iana" + }, + "application/vnd.stardivision.calc": { + "source": "apache", + "extensions": ["sdc"] + }, + "application/vnd.stardivision.draw": { + "source": "apache", + "extensions": ["sda"] + }, + "application/vnd.stardivision.impress": { + "source": "apache", + "extensions": ["sdd"] + }, + "application/vnd.stardivision.math": { + "source": "apache", + "extensions": ["smf"] + }, + "application/vnd.stardivision.writer": { + "source": "apache", + "extensions": ["sdw","vor"] + }, + "application/vnd.stardivision.writer-global": { + "source": "apache", + "extensions": ["sgl"] + }, + "application/vnd.stepmania.package": { + "source": "iana", + "extensions": ["smzip"] + }, + "application/vnd.stepmania.stepchart": { + "source": "iana", + "extensions": ["sm"] + }, + "application/vnd.street-stream": { + "source": "iana" + }, + "application/vnd.sun.wadl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wadl"] + }, + "application/vnd.sun.xml.calc": { + "source": "apache", + "extensions": ["sxc"] + }, + "application/vnd.sun.xml.calc.template": { + "source": "apache", + "extensions": ["stc"] + }, + "application/vnd.sun.xml.draw": { + "source": "apache", + "extensions": ["sxd"] + }, + "application/vnd.sun.xml.draw.template": { + "source": "apache", + "extensions": ["std"] + }, + "application/vnd.sun.xml.impress": { + "source": "apache", + "extensions": ["sxi"] + }, + "application/vnd.sun.xml.impress.template": { + "source": "apache", + "extensions": ["sti"] + }, + "application/vnd.sun.xml.math": { + "source": "apache", + "extensions": ["sxm"] + }, + "application/vnd.sun.xml.writer": { + "source": "apache", + "extensions": ["sxw"] + }, + "application/vnd.sun.xml.writer.global": { + "source": "apache", + "extensions": ["sxg"] + }, + "application/vnd.sun.xml.writer.template": { + "source": "apache", + "extensions": ["stw"] + }, + "application/vnd.sus-calendar": { + "source": "iana", + "extensions": ["sus","susp"] + }, + "application/vnd.svd": { + "source": "iana", + "extensions": ["svd"] + }, + "application/vnd.swiftview-ics": { + "source": "iana" + }, + "application/vnd.symbian.install": { + "source": "apache", + "extensions": ["sis","sisx"] + }, + "application/vnd.syncml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xsm"] + }, + "application/vnd.syncml.dm+wbxml": { + "source": "iana", + "extensions": ["bdm"] + }, + "application/vnd.syncml.dm+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdm"] + }, + "application/vnd.syncml.dm.notification": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.syncml.dmtnds+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.syncml.ds.notification": { + "source": "iana" + }, + "application/vnd.tableschema+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tao.intent-module-archive": { + "source": "iana", + "extensions": ["tao"] + }, + "application/vnd.tcpdump.pcap": { + "source": "iana", + "extensions": ["pcap","cap","dmp"] + }, + "application/vnd.think-cell.ppttc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tmd.mediaflex.api+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.tml": { + "source": "iana" + }, + "application/vnd.tmobile-livetv": { + "source": "iana", + "extensions": ["tmo"] + }, + "application/vnd.tri.onesource": { + "source": "iana" + }, + "application/vnd.trid.tpt": { + "source": "iana", + "extensions": ["tpt"] + }, + "application/vnd.triscape.mxs": { + "source": "iana", + "extensions": ["mxs"] + }, + "application/vnd.trueapp": { + "source": "iana", + "extensions": ["tra"] + }, + "application/vnd.truedoc": { + "source": "iana" + }, + "application/vnd.ubisoft.webplayer": { + "source": "iana" + }, + "application/vnd.ufdl": { + "source": "iana", + "extensions": ["ufd","ufdl"] + }, + "application/vnd.uiq.theme": { + "source": "iana", + "extensions": ["utz"] + }, + "application/vnd.umajin": { + "source": "iana", + "extensions": ["umj"] + }, + "application/vnd.unity": { + "source": "iana", + "extensions": ["unityweb"] + }, + "application/vnd.uoml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uoml"] + }, + "application/vnd.uplanet.alert": { + "source": "iana" + }, + "application/vnd.uplanet.alert-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.channel": { + "source": "iana" + }, + "application/vnd.uplanet.channel-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.list": { + "source": "iana" + }, + "application/vnd.uplanet.list-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.signal": { + "source": "iana" + }, + "application/vnd.uri-map": { + "source": "iana" + }, + "application/vnd.valve.source.material": { + "source": "iana" + }, + "application/vnd.vcx": { + "source": "iana", + "extensions": ["vcx"] + }, + "application/vnd.vd-study": { + "source": "iana" + }, + "application/vnd.vectorworks": { + "source": "iana" + }, + "application/vnd.vel+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.verimatrix.vcas": { + "source": "iana" + }, + "application/vnd.veryant.thin": { + "source": "iana" + }, + "application/vnd.vidsoft.vidconference": { + "source": "iana" + }, + "application/vnd.visio": { + "source": "iana", + "extensions": ["vsd","vst","vss","vsw"] + }, + "application/vnd.visionary": { + "source": "iana", + "extensions": ["vis"] + }, + "application/vnd.vividence.scriptfile": { + "source": "iana" + }, + "application/vnd.vsf": { + "source": "iana", + "extensions": ["vsf"] + }, + "application/vnd.wap.sic": { + "source": "iana" + }, + "application/vnd.wap.slc": { + "source": "iana" + }, + "application/vnd.wap.wbxml": { + "source": "iana", + "extensions": ["wbxml"] + }, + "application/vnd.wap.wmlc": { + "source": "iana", + "extensions": ["wmlc"] + }, + "application/vnd.wap.wmlscriptc": { + "source": "iana", + "extensions": ["wmlsc"] + }, + "application/vnd.webturbo": { + "source": "iana", + "extensions": ["wtb"] + }, + "application/vnd.wfa.p2p": { + "source": "iana" + }, + "application/vnd.wfa.wsc": { + "source": "iana" + }, + "application/vnd.windows.devicepairing": { + "source": "iana" + }, + "application/vnd.wmc": { + "source": "iana" + }, + "application/vnd.wmf.bootstrap": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica.package": { + "source": "iana" + }, + "application/vnd.wolfram.player": { + "source": "iana", + "extensions": ["nbp"] + }, + "application/vnd.wordperfect": { + "source": "iana", + "extensions": ["wpd"] + }, + "application/vnd.wqd": { + "source": "iana", + "extensions": ["wqd"] + }, + "application/vnd.wrq-hp3000-labelled": { + "source": "iana" + }, + "application/vnd.wt.stf": { + "source": "iana", + "extensions": ["stf"] + }, + "application/vnd.wv.csp+wbxml": { + "source": "iana" + }, + "application/vnd.wv.csp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.wv.ssp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xacml+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.xara": { + "source": "iana", + "extensions": ["xar"] + }, + "application/vnd.xfdl": { + "source": "iana", + "extensions": ["xfdl"] + }, + "application/vnd.xfdl.webform": { + "source": "iana" + }, + "application/vnd.xmi+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xmpie.cpkg": { + "source": "iana" + }, + "application/vnd.xmpie.dpkg": { + "source": "iana" + }, + "application/vnd.xmpie.plan": { + "source": "iana" + }, + "application/vnd.xmpie.ppkg": { + "source": "iana" + }, + "application/vnd.xmpie.xlim": { + "source": "iana" + }, + "application/vnd.yamaha.hv-dic": { + "source": "iana", + "extensions": ["hvd"] + }, + "application/vnd.yamaha.hv-script": { + "source": "iana", + "extensions": ["hvs"] + }, + "application/vnd.yamaha.hv-voice": { + "source": "iana", + "extensions": ["hvp"] + }, + "application/vnd.yamaha.openscoreformat": { + "source": "iana", + "extensions": ["osf"] + }, + "application/vnd.yamaha.openscoreformat.osfpvg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["osfpvg"] + }, + "application/vnd.yamaha.remote-setup": { + "source": "iana" + }, + "application/vnd.yamaha.smaf-audio": { + "source": "iana", + "extensions": ["saf"] + }, + "application/vnd.yamaha.smaf-phrase": { + "source": "iana", + "extensions": ["spf"] + }, + "application/vnd.yamaha.through-ngn": { + "source": "iana" + }, + "application/vnd.yamaha.tunnel-udpencap": { + "source": "iana" + }, + "application/vnd.yaoweme": { + "source": "iana" + }, + "application/vnd.yellowriver-custom-menu": { + "source": "iana", + "extensions": ["cmp"] + }, + "application/vnd.youtube.yt": { + "source": "iana" + }, + "application/vnd.zul": { + "source": "iana", + "extensions": ["zir","zirz"] + }, + "application/vnd.zzazz.deck+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zaz"] + }, + "application/voicexml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["vxml"] + }, + "application/voucher-cms+json": { + "source": "iana", + "compressible": true + }, + "application/vq-rtcpxr": { + "source": "iana" + }, + "application/wasm": { + "compressible": true, + "extensions": ["wasm"] + }, + "application/watcherinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/webpush-options+json": { + "source": "iana", + "compressible": true + }, + "application/whoispp-query": { + "source": "iana" + }, + "application/whoispp-response": { + "source": "iana" + }, + "application/widget": { + "source": "iana", + "extensions": ["wgt"] + }, + "application/winhlp": { + "source": "apache", + "extensions": ["hlp"] + }, + "application/wita": { + "source": "iana" + }, + "application/wordperfect5.1": { + "source": "iana" + }, + "application/wsdl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wsdl"] + }, + "application/wspolicy+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wspolicy"] + }, + "application/x-7z-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["7z"] + }, + "application/x-abiword": { + "source": "apache", + "extensions": ["abw"] + }, + "application/x-ace-compressed": { + "source": "apache", + "extensions": ["ace"] + }, + "application/x-amf": { + "source": "apache" + }, + "application/x-apple-diskimage": { + "source": "apache", + "extensions": ["dmg"] + }, + "application/x-arj": { + "compressible": false, + "extensions": ["arj"] + }, + "application/x-authorware-bin": { + "source": "apache", + "extensions": ["aab","x32","u32","vox"] + }, + "application/x-authorware-map": { + "source": "apache", + "extensions": ["aam"] + }, + "application/x-authorware-seg": { + "source": "apache", + "extensions": ["aas"] + }, + "application/x-bcpio": { + "source": "apache", + "extensions": ["bcpio"] + }, + "application/x-bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/x-bittorrent": { + "source": "apache", + "extensions": ["torrent"] + }, + "application/x-blorb": { + "source": "apache", + "extensions": ["blb","blorb"] + }, + "application/x-bzip": { + "source": "apache", + "compressible": false, + "extensions": ["bz"] + }, + "application/x-bzip2": { + "source": "apache", + "compressible": false, + "extensions": ["bz2","boz"] + }, + "application/x-cbr": { + "source": "apache", + "extensions": ["cbr","cba","cbt","cbz","cb7"] + }, + "application/x-cdlink": { + "source": "apache", + "extensions": ["vcd"] + }, + "application/x-cfs-compressed": { + "source": "apache", + "extensions": ["cfs"] + }, + "application/x-chat": { + "source": "apache", + "extensions": ["chat"] + }, + "application/x-chess-pgn": { + "source": "apache", + "extensions": ["pgn"] + }, + "application/x-chrome-extension": { + "extensions": ["crx"] + }, + "application/x-cocoa": { + "source": "nginx", + "extensions": ["cco"] + }, + "application/x-compress": { + "source": "apache" + }, + "application/x-conference": { + "source": "apache", + "extensions": ["nsc"] + }, + "application/x-cpio": { + "source": "apache", + "extensions": ["cpio"] + }, + "application/x-csh": { + "source": "apache", + "extensions": ["csh"] + }, + "application/x-deb": { + "compressible": false + }, + "application/x-debian-package": { + "source": "apache", + "extensions": ["deb","udeb"] + }, + "application/x-dgc-compressed": { + "source": "apache", + "extensions": ["dgc"] + }, + "application/x-director": { + "source": "apache", + "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"] + }, + "application/x-doom": { + "source": "apache", + "extensions": ["wad"] + }, + "application/x-dtbncx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ncx"] + }, + "application/x-dtbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dtb"] + }, + "application/x-dtbresource+xml": { + "source": "apache", + "compressible": true, + "extensions": ["res"] + }, + "application/x-dvi": { + "source": "apache", + "compressible": false, + "extensions": ["dvi"] + }, + "application/x-envoy": { + "source": "apache", + "extensions": ["evy"] + }, + "application/x-eva": { + "source": "apache", + "extensions": ["eva"] + }, + "application/x-font-bdf": { + "source": "apache", + "extensions": ["bdf"] + }, + "application/x-font-dos": { + "source": "apache" + }, + "application/x-font-framemaker": { + "source": "apache" + }, + "application/x-font-ghostscript": { + "source": "apache", + "extensions": ["gsf"] + }, + "application/x-font-libgrx": { + "source": "apache" + }, + "application/x-font-linux-psf": { + "source": "apache", + "extensions": ["psf"] + }, + "application/x-font-pcf": { + "source": "apache", + "extensions": ["pcf"] + }, + "application/x-font-snf": { + "source": "apache", + "extensions": ["snf"] + }, + "application/x-font-speedo": { + "source": "apache" + }, + "application/x-font-sunos-news": { + "source": "apache" + }, + "application/x-font-type1": { + "source": "apache", + "extensions": ["pfa","pfb","pfm","afm"] + }, + "application/x-font-vfont": { + "source": "apache" + }, + "application/x-freearc": { + "source": "apache", + "extensions": ["arc"] + }, + "application/x-futuresplash": { + "source": "apache", + "extensions": ["spl"] + }, + "application/x-gca-compressed": { + "source": "apache", + "extensions": ["gca"] + }, + "application/x-glulx": { + "source": "apache", + "extensions": ["ulx"] + }, + "application/x-gnumeric": { + "source": "apache", + "extensions": ["gnumeric"] + }, + "application/x-gramps-xml": { + "source": "apache", + "extensions": ["gramps"] + }, + "application/x-gtar": { + "source": "apache", + "extensions": ["gtar"] + }, + "application/x-gzip": { + "source": "apache" + }, + "application/x-hdf": { + "source": "apache", + "extensions": ["hdf"] + }, + "application/x-httpd-php": { + "compressible": true, + "extensions": ["php"] + }, + "application/x-install-instructions": { + "source": "apache", + "extensions": ["install"] + }, + "application/x-iso9660-image": { + "source": "apache", + "extensions": ["iso"] + }, + "application/x-java-archive-diff": { + "source": "nginx", + "extensions": ["jardiff"] + }, + "application/x-java-jnlp-file": { + "source": "apache", + "compressible": false, + "extensions": ["jnlp"] + }, + "application/x-javascript": { + "compressible": true + }, + "application/x-latex": { + "source": "apache", + "compressible": false, + "extensions": ["latex"] + }, + "application/x-lua-bytecode": { + "extensions": ["luac"] + }, + "application/x-lzh-compressed": { + "source": "apache", + "extensions": ["lzh","lha"] + }, + "application/x-makeself": { + "source": "nginx", + "extensions": ["run"] + }, + "application/x-mie": { + "source": "apache", + "extensions": ["mie"] + }, + "application/x-mobipocket-ebook": { + "source": "apache", + "extensions": ["prc","mobi"] + }, + "application/x-mpegurl": { + "compressible": false + }, + "application/x-ms-application": { + "source": "apache", + "extensions": ["application"] + }, + "application/x-ms-shortcut": { + "source": "apache", + "extensions": ["lnk"] + }, + "application/x-ms-wmd": { + "source": "apache", + "extensions": ["wmd"] + }, + "application/x-ms-wmz": { + "source": "apache", + "extensions": ["wmz"] + }, + "application/x-ms-xbap": { + "source": "apache", + "extensions": ["xbap"] + }, + "application/x-msaccess": { + "source": "apache", + "extensions": ["mdb"] + }, + "application/x-msbinder": { + "source": "apache", + "extensions": ["obd"] + }, + "application/x-mscardfile": { + "source": "apache", + "extensions": ["crd"] + }, + "application/x-msclip": { + "source": "apache", + "extensions": ["clp"] + }, + "application/x-msdos-program": { + "extensions": ["exe"] + }, + "application/x-msdownload": { + "source": "apache", + "extensions": ["exe","dll","com","bat","msi"] + }, + "application/x-msmediaview": { + "source": "apache", + "extensions": ["mvb","m13","m14"] + }, + "application/x-msmetafile": { + "source": "apache", + "extensions": ["wmf","wmz","emf","emz"] + }, + "application/x-msmoney": { + "source": "apache", + "extensions": ["mny"] + }, + "application/x-mspublisher": { + "source": "apache", + "extensions": ["pub"] + }, + "application/x-msschedule": { + "source": "apache", + "extensions": ["scd"] + }, + "application/x-msterminal": { + "source": "apache", + "extensions": ["trm"] + }, + "application/x-mswrite": { + "source": "apache", + "extensions": ["wri"] + }, + "application/x-netcdf": { + "source": "apache", + "extensions": ["nc","cdf"] + }, + "application/x-ns-proxy-autoconfig": { + "compressible": true, + "extensions": ["pac"] + }, + "application/x-nzb": { + "source": "apache", + "extensions": ["nzb"] + }, + "application/x-perl": { + "source": "nginx", + "extensions": ["pl","pm"] + }, + "application/x-pilot": { + "source": "nginx", + "extensions": ["prc","pdb"] + }, + "application/x-pkcs12": { + "source": "apache", + "compressible": false, + "extensions": ["p12","pfx"] + }, + "application/x-pkcs7-certificates": { + "source": "apache", + "extensions": ["p7b","spc"] + }, + "application/x-pkcs7-certreqresp": { + "source": "apache", + "extensions": ["p7r"] + }, + "application/x-rar-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["rar"] + }, + "application/x-redhat-package-manager": { + "source": "nginx", + "extensions": ["rpm"] + }, + "application/x-research-info-systems": { + "source": "apache", + "extensions": ["ris"] + }, + "application/x-sea": { + "source": "nginx", + "extensions": ["sea"] + }, + "application/x-sh": { + "source": "apache", + "compressible": true, + "extensions": ["sh"] + }, + "application/x-shar": { + "source": "apache", + "extensions": ["shar"] + }, + "application/x-shockwave-flash": { + "source": "apache", + "compressible": false, + "extensions": ["swf"] + }, + "application/x-silverlight-app": { + "source": "apache", + "extensions": ["xap"] + }, + "application/x-sql": { + "source": "apache", + "extensions": ["sql"] + }, + "application/x-stuffit": { + "source": "apache", + "compressible": false, + "extensions": ["sit"] + }, + "application/x-stuffitx": { + "source": "apache", + "extensions": ["sitx"] + }, + "application/x-subrip": { + "source": "apache", + "extensions": ["srt"] + }, + "application/x-sv4cpio": { + "source": "apache", + "extensions": ["sv4cpio"] + }, + "application/x-sv4crc": { + "source": "apache", + "extensions": ["sv4crc"] + }, + "application/x-t3vm-image": { + "source": "apache", + "extensions": ["t3"] + }, + "application/x-tads": { + "source": "apache", + "extensions": ["gam"] + }, + "application/x-tar": { + "source": "apache", + "compressible": true, + "extensions": ["tar"] + }, + "application/x-tcl": { + "source": "apache", + "extensions": ["tcl","tk"] + }, + "application/x-tex": { + "source": "apache", + "extensions": ["tex"] + }, + "application/x-tex-tfm": { + "source": "apache", + "extensions": ["tfm"] + }, + "application/x-texinfo": { + "source": "apache", + "extensions": ["texinfo","texi"] + }, + "application/x-tgif": { + "source": "apache", + "extensions": ["obj"] + }, + "application/x-ustar": { + "source": "apache", + "extensions": ["ustar"] + }, + "application/x-virtualbox-hdd": { + "compressible": true, + "extensions": ["hdd"] + }, + "application/x-virtualbox-ova": { + "compressible": true, + "extensions": ["ova"] + }, + "application/x-virtualbox-ovf": { + "compressible": true, + "extensions": ["ovf"] + }, + "application/x-virtualbox-vbox": { + "compressible": true, + "extensions": ["vbox"] + }, + "application/x-virtualbox-vbox-extpack": { + "compressible": false, + "extensions": ["vbox-extpack"] + }, + "application/x-virtualbox-vdi": { + "compressible": true, + "extensions": ["vdi"] + }, + "application/x-virtualbox-vhd": { + "compressible": true, + "extensions": ["vhd"] + }, + "application/x-virtualbox-vmdk": { + "compressible": true, + "extensions": ["vmdk"] + }, + "application/x-wais-source": { + "source": "apache", + "extensions": ["src"] + }, + "application/x-web-app-manifest+json": { + "compressible": true, + "extensions": ["webapp"] + }, + "application/x-www-form-urlencoded": { + "source": "iana", + "compressible": true + }, + "application/x-x509-ca-cert": { + "source": "apache", + "extensions": ["der","crt","pem"] + }, + "application/x-xfig": { + "source": "apache", + "extensions": ["fig"] + }, + "application/x-xliff+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xlf"] + }, + "application/x-xpinstall": { + "source": "apache", + "compressible": false, + "extensions": ["xpi"] + }, + "application/x-xz": { + "source": "apache", + "extensions": ["xz"] + }, + "application/x-zmachine": { + "source": "apache", + "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"] + }, + "application/x400-bp": { + "source": "iana" + }, + "application/xacml+xml": { + "source": "iana", + "compressible": true + }, + "application/xaml+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xaml"] + }, + "application/xcap-att+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-caps+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdf"] + }, + "application/xcap-el+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-error+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-ns+xml": { + "source": "iana", + "compressible": true + }, + "application/xcon-conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/xcon-conference-info-diff+xml": { + "source": "iana", + "compressible": true + }, + "application/xenc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xenc"] + }, + "application/xhtml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xhtml","xht"] + }, + "application/xhtml-voice+xml": { + "source": "apache", + "compressible": true + }, + "application/xliff+xml": { + "source": "iana", + "compressible": true + }, + "application/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml","xsl","xsd","rng"] + }, + "application/xml-dtd": { + "source": "iana", + "compressible": true, + "extensions": ["dtd"] + }, + "application/xml-external-parsed-entity": { + "source": "iana" + }, + "application/xml-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/xmpp+xml": { + "source": "iana", + "compressible": true + }, + "application/xop+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xop"] + }, + "application/xproc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xpl"] + }, + "application/xslt+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xslt"] + }, + "application/xspf+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xspf"] + }, + "application/xv+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mxml","xhvml","xvml","xvm"] + }, + "application/yang": { + "source": "iana", + "extensions": ["yang"] + }, + "application/yang-data+json": { + "source": "iana", + "compressible": true + }, + "application/yang-data+xml": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+json": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/yin+xml": { + "source": "iana", + "compressible": true, + "extensions": ["yin"] + }, + "application/zip": { + "source": "iana", + "compressible": false, + "extensions": ["zip"] + }, + "application/zlib": { + "source": "iana" + }, + "application/zstd": { + "source": "iana" + }, + "audio/1d-interleaved-parityfec": { + "source": "iana" + }, + "audio/32kadpcm": { + "source": "iana" + }, + "audio/3gpp": { + "source": "iana", + "compressible": false, + "extensions": ["3gpp"] + }, + "audio/3gpp2": { + "source": "iana" + }, + "audio/aac": { + "source": "iana" + }, + "audio/ac3": { + "source": "iana" + }, + "audio/adpcm": { + "source": "apache", + "extensions": ["adp"] + }, + "audio/amr": { + "source": "iana" + }, + "audio/amr-wb": { + "source": "iana" + }, + "audio/amr-wb+": { + "source": "iana" + }, + "audio/aptx": { + "source": "iana" + }, + "audio/asc": { + "source": "iana" + }, + "audio/atrac-advanced-lossless": { + "source": "iana" + }, + "audio/atrac-x": { + "source": "iana" + }, + "audio/atrac3": { + "source": "iana" + }, + "audio/basic": { + "source": "iana", + "compressible": false, + "extensions": ["au","snd"] + }, + "audio/bv16": { + "source": "iana" + }, + "audio/bv32": { + "source": "iana" + }, + "audio/clearmode": { + "source": "iana" + }, + "audio/cn": { + "source": "iana" + }, + "audio/dat12": { + "source": "iana" + }, + "audio/dls": { + "source": "iana" + }, + "audio/dsr-es201108": { + "source": "iana" + }, + "audio/dsr-es202050": { + "source": "iana" + }, + "audio/dsr-es202211": { + "source": "iana" + }, + "audio/dsr-es202212": { + "source": "iana" + }, + "audio/dv": { + "source": "iana" + }, + "audio/dvi4": { + "source": "iana" + }, + "audio/eac3": { + "source": "iana" + }, + "audio/encaprtp": { + "source": "iana" + }, + "audio/evrc": { + "source": "iana" + }, + "audio/evrc-qcp": { + "source": "iana" + }, + "audio/evrc0": { + "source": "iana" + }, + "audio/evrc1": { + "source": "iana" + }, + "audio/evrcb": { + "source": "iana" + }, + "audio/evrcb0": { + "source": "iana" + }, + "audio/evrcb1": { + "source": "iana" + }, + "audio/evrcnw": { + "source": "iana" + }, + "audio/evrcnw0": { + "source": "iana" + }, + "audio/evrcnw1": { + "source": "iana" + }, + "audio/evrcwb": { + "source": "iana" + }, + "audio/evrcwb0": { + "source": "iana" + }, + "audio/evrcwb1": { + "source": "iana" + }, + "audio/evs": { + "source": "iana" + }, + "audio/fwdred": { + "source": "iana" + }, + "audio/g711-0": { + "source": "iana" + }, + "audio/g719": { + "source": "iana" + }, + "audio/g722": { + "source": "iana" + }, + "audio/g7221": { + "source": "iana" + }, + "audio/g723": { + "source": "iana" + }, + "audio/g726-16": { + "source": "iana" + }, + "audio/g726-24": { + "source": "iana" + }, + "audio/g726-32": { + "source": "iana" + }, + "audio/g726-40": { + "source": "iana" + }, + "audio/g728": { + "source": "iana" + }, + "audio/g729": { + "source": "iana" + }, + "audio/g7291": { + "source": "iana" + }, + "audio/g729d": { + "source": "iana" + }, + "audio/g729e": { + "source": "iana" + }, + "audio/gsm": { + "source": "iana" + }, + "audio/gsm-efr": { + "source": "iana" + }, + "audio/gsm-hr-08": { + "source": "iana" + }, + "audio/ilbc": { + "source": "iana" + }, + "audio/ip-mr_v2.5": { + "source": "iana" + }, + "audio/isac": { + "source": "apache" + }, + "audio/l16": { + "source": "iana" + }, + "audio/l20": { + "source": "iana" + }, + "audio/l24": { + "source": "iana", + "compressible": false + }, + "audio/l8": { + "source": "iana" + }, + "audio/lpc": { + "source": "iana" + }, + "audio/melp": { + "source": "iana" + }, + "audio/melp1200": { + "source": "iana" + }, + "audio/melp2400": { + "source": "iana" + }, + "audio/melp600": { + "source": "iana" + }, + "audio/midi": { + "source": "apache", + "extensions": ["mid","midi","kar","rmi"] + }, + "audio/mobile-xmf": { + "source": "iana" + }, + "audio/mp3": { + "compressible": false, + "extensions": ["mp3"] + }, + "audio/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["m4a","mp4a"] + }, + "audio/mp4a-latm": { + "source": "iana" + }, + "audio/mpa": { + "source": "iana" + }, + "audio/mpa-robust": { + "source": "iana" + }, + "audio/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"] + }, + "audio/mpeg4-generic": { + "source": "iana" + }, + "audio/musepack": { + "source": "apache" + }, + "audio/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["oga","ogg","spx"] + }, + "audio/opus": { + "source": "iana" + }, + "audio/parityfec": { + "source": "iana" + }, + "audio/pcma": { + "source": "iana" + }, + "audio/pcma-wb": { + "source": "iana" + }, + "audio/pcmu": { + "source": "iana" + }, + "audio/pcmu-wb": { + "source": "iana" + }, + "audio/prs.sid": { + "source": "iana" + }, + "audio/qcelp": { + "source": "iana" + }, + "audio/raptorfec": { + "source": "iana" + }, + "audio/red": { + "source": "iana" + }, + "audio/rtp-enc-aescm128": { + "source": "iana" + }, + "audio/rtp-midi": { + "source": "iana" + }, + "audio/rtploopback": { + "source": "iana" + }, + "audio/rtx": { + "source": "iana" + }, + "audio/s3m": { + "source": "apache", + "extensions": ["s3m"] + }, + "audio/silk": { + "source": "apache", + "extensions": ["sil"] + }, + "audio/smv": { + "source": "iana" + }, + "audio/smv-qcp": { + "source": "iana" + }, + "audio/smv0": { + "source": "iana" + }, + "audio/sp-midi": { + "source": "iana" + }, + "audio/speex": { + "source": "iana" + }, + "audio/t140c": { + "source": "iana" + }, + "audio/t38": { + "source": "iana" + }, + "audio/telephone-event": { + "source": "iana" + }, + "audio/tetra_acelp": { + "source": "iana" + }, + "audio/tone": { + "source": "iana" + }, + "audio/uemclip": { + "source": "iana" + }, + "audio/ulpfec": { + "source": "iana" + }, + "audio/usac": { + "source": "iana" + }, + "audio/vdvi": { + "source": "iana" + }, + "audio/vmr-wb": { + "source": "iana" + }, + "audio/vnd.3gpp.iufp": { + "source": "iana" + }, + "audio/vnd.4sb": { + "source": "iana" + }, + "audio/vnd.audiokoz": { + "source": "iana" + }, + "audio/vnd.celp": { + "source": "iana" + }, + "audio/vnd.cisco.nse": { + "source": "iana" + }, + "audio/vnd.cmles.radio-events": { + "source": "iana" + }, + "audio/vnd.cns.anp1": { + "source": "iana" + }, + "audio/vnd.cns.inf1": { + "source": "iana" + }, + "audio/vnd.dece.audio": { + "source": "iana", + "extensions": ["uva","uvva"] + }, + "audio/vnd.digital-winds": { + "source": "iana", + "extensions": ["eol"] + }, + "audio/vnd.dlna.adts": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.1": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.2": { + "source": "iana" + }, + "audio/vnd.dolby.mlp": { + "source": "iana" + }, + "audio/vnd.dolby.mps": { + "source": "iana" + }, + "audio/vnd.dolby.pl2": { + "source": "iana" + }, + "audio/vnd.dolby.pl2x": { + "source": "iana" + }, + "audio/vnd.dolby.pl2z": { + "source": "iana" + }, + "audio/vnd.dolby.pulse.1": { + "source": "iana" + }, + "audio/vnd.dra": { + "source": "iana", + "extensions": ["dra"] + }, + "audio/vnd.dts": { + "source": "iana", + "extensions": ["dts"] + }, + "audio/vnd.dts.hd": { + "source": "iana", + "extensions": ["dtshd"] + }, + "audio/vnd.dts.uhd": { + "source": "iana" + }, + "audio/vnd.dvb.file": { + "source": "iana" + }, + "audio/vnd.everad.plj": { + "source": "iana" + }, + "audio/vnd.hns.audio": { + "source": "iana" + }, + "audio/vnd.lucent.voice": { + "source": "iana", + "extensions": ["lvp"] + }, + "audio/vnd.ms-playready.media.pya": { + "source": "iana", + "extensions": ["pya"] + }, + "audio/vnd.nokia.mobile-xmf": { + "source": "iana" + }, + "audio/vnd.nortel.vbk": { + "source": "iana" + }, + "audio/vnd.nuera.ecelp4800": { + "source": "iana", + "extensions": ["ecelp4800"] + }, + "audio/vnd.nuera.ecelp7470": { + "source": "iana", + "extensions": ["ecelp7470"] + }, + "audio/vnd.nuera.ecelp9600": { + "source": "iana", + "extensions": ["ecelp9600"] + }, + "audio/vnd.octel.sbc": { + "source": "iana" + }, + "audio/vnd.presonus.multitrack": { + "source": "iana" + }, + "audio/vnd.qcelp": { + "source": "iana" + }, + "audio/vnd.rhetorex.32kadpcm": { + "source": "iana" + }, + "audio/vnd.rip": { + "source": "iana", + "extensions": ["rip"] + }, + "audio/vnd.rn-realaudio": { + "compressible": false + }, + "audio/vnd.sealedmedia.softseal.mpeg": { + "source": "iana" + }, + "audio/vnd.vmx.cvsd": { + "source": "iana" + }, + "audio/vnd.wave": { + "compressible": false + }, + "audio/vorbis": { + "source": "iana", + "compressible": false + }, + "audio/vorbis-config": { + "source": "iana" + }, + "audio/wav": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/wave": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/webm": { + "source": "apache", + "compressible": false, + "extensions": ["weba"] + }, + "audio/x-aac": { + "source": "apache", + "compressible": false, + "extensions": ["aac"] + }, + "audio/x-aiff": { + "source": "apache", + "extensions": ["aif","aiff","aifc"] + }, + "audio/x-caf": { + "source": "apache", + "compressible": false, + "extensions": ["caf"] + }, + "audio/x-flac": { + "source": "apache", + "extensions": ["flac"] + }, + "audio/x-m4a": { + "source": "nginx", + "extensions": ["m4a"] + }, + "audio/x-matroska": { + "source": "apache", + "extensions": ["mka"] + }, + "audio/x-mpegurl": { + "source": "apache", + "extensions": ["m3u"] + }, + "audio/x-ms-wax": { + "source": "apache", + "extensions": ["wax"] + }, + "audio/x-ms-wma": { + "source": "apache", + "extensions": ["wma"] + }, + "audio/x-pn-realaudio": { + "source": "apache", + "extensions": ["ram","ra"] + }, + "audio/x-pn-realaudio-plugin": { + "source": "apache", + "extensions": ["rmp"] + }, + "audio/x-realaudio": { + "source": "nginx", + "extensions": ["ra"] + }, + "audio/x-tta": { + "source": "apache" + }, + "audio/x-wav": { + "source": "apache", + "extensions": ["wav"] + }, + "audio/xm": { + "source": "apache", + "extensions": ["xm"] + }, + "chemical/x-cdx": { + "source": "apache", + "extensions": ["cdx"] + }, + "chemical/x-cif": { + "source": "apache", + "extensions": ["cif"] + }, + "chemical/x-cmdf": { + "source": "apache", + "extensions": ["cmdf"] + }, + "chemical/x-cml": { + "source": "apache", + "extensions": ["cml"] + }, + "chemical/x-csml": { + "source": "apache", + "extensions": ["csml"] + }, + "chemical/x-pdb": { + "source": "apache" + }, + "chemical/x-xyz": { + "source": "apache", + "extensions": ["xyz"] + }, + "font/collection": { + "source": "iana", + "extensions": ["ttc"] + }, + "font/otf": { + "source": "iana", + "compressible": true, + "extensions": ["otf"] + }, + "font/sfnt": { + "source": "iana" + }, + "font/ttf": { + "source": "iana", + "extensions": ["ttf"] + }, + "font/woff": { + "source": "iana", + "extensions": ["woff"] + }, + "font/woff2": { + "source": "iana", + "extensions": ["woff2"] + }, + "image/aces": { + "source": "iana", + "extensions": ["exr"] + }, + "image/apng": { + "compressible": false, + "extensions": ["apng"] + }, + "image/avci": { + "source": "iana" + }, + "image/avcs": { + "source": "iana" + }, + "image/bmp": { + "source": "iana", + "compressible": true, + "extensions": ["bmp"] + }, + "image/cgm": { + "source": "iana", + "extensions": ["cgm"] + }, + "image/dicom-rle": { + "source": "iana", + "extensions": ["drle"] + }, + "image/emf": { + "source": "iana", + "extensions": ["emf"] + }, + "image/fits": { + "source": "iana", + "extensions": ["fits"] + }, + "image/g3fax": { + "source": "iana", + "extensions": ["g3"] + }, + "image/gif": { + "source": "iana", + "compressible": false, + "extensions": ["gif"] + }, + "image/heic": { + "source": "iana", + "extensions": ["heic"] + }, + "image/heic-sequence": { + "source": "iana", + "extensions": ["heics"] + }, + "image/heif": { + "source": "iana", + "extensions": ["heif"] + }, + "image/heif-sequence": { + "source": "iana", + "extensions": ["heifs"] + }, + "image/ief": { + "source": "iana", + "extensions": ["ief"] + }, + "image/jls": { + "source": "iana", + "extensions": ["jls"] + }, + "image/jp2": { + "source": "iana", + "compressible": false, + "extensions": ["jp2","jpg2"] + }, + "image/jpeg": { + "source": "iana", + "compressible": false, + "extensions": ["jpeg","jpg","jpe"] + }, + "image/jpm": { + "source": "iana", + "compressible": false, + "extensions": ["jpm"] + }, + "image/jpx": { + "source": "iana", + "compressible": false, + "extensions": ["jpx","jpf"] + }, + "image/ktx": { + "source": "iana", + "extensions": ["ktx"] + }, + "image/naplps": { + "source": "iana" + }, + "image/pjpeg": { + "compressible": false + }, + "image/png": { + "source": "iana", + "compressible": false, + "extensions": ["png"] + }, + "image/prs.btif": { + "source": "iana", + "extensions": ["btif"] + }, + "image/prs.pti": { + "source": "iana", + "extensions": ["pti"] + }, + "image/pwg-raster": { + "source": "iana" + }, + "image/sgi": { + "source": "apache", + "extensions": ["sgi"] + }, + "image/svg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["svg","svgz"] + }, + "image/t38": { + "source": "iana", + "extensions": ["t38"] + }, + "image/tiff": { + "source": "iana", + "compressible": false, + "extensions": ["tif","tiff"] + }, + "image/tiff-fx": { + "source": "iana", + "extensions": ["tfx"] + }, + "image/vnd.adobe.photoshop": { + "source": "iana", + "compressible": true, + "extensions": ["psd"] + }, + "image/vnd.airzip.accelerator.azv": { + "source": "iana", + "extensions": ["azv"] + }, + "image/vnd.cns.inf2": { + "source": "iana" + }, + "image/vnd.dece.graphic": { + "source": "iana", + "extensions": ["uvi","uvvi","uvg","uvvg"] + }, + "image/vnd.djvu": { + "source": "iana", + "extensions": ["djvu","djv"] + }, + "image/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "image/vnd.dwg": { + "source": "iana", + "extensions": ["dwg"] + }, + "image/vnd.dxf": { + "source": "iana", + "extensions": ["dxf"] + }, + "image/vnd.fastbidsheet": { + "source": "iana", + "extensions": ["fbs"] + }, + "image/vnd.fpx": { + "source": "iana", + "extensions": ["fpx"] + }, + "image/vnd.fst": { + "source": "iana", + "extensions": ["fst"] + }, + "image/vnd.fujixerox.edmics-mmr": { + "source": "iana", + "extensions": ["mmr"] + }, + "image/vnd.fujixerox.edmics-rlc": { + "source": "iana", + "extensions": ["rlc"] + }, + "image/vnd.globalgraphics.pgb": { + "source": "iana" + }, + "image/vnd.microsoft.icon": { + "source": "iana", + "extensions": ["ico"] + }, + "image/vnd.mix": { + "source": "iana" + }, + "image/vnd.mozilla.apng": { + "source": "iana" + }, + "image/vnd.ms-modi": { + "source": "iana", + "extensions": ["mdi"] + }, + "image/vnd.ms-photo": { + "source": "apache", + "extensions": ["wdp"] + }, + "image/vnd.net-fpx": { + "source": "iana", + "extensions": ["npx"] + }, + "image/vnd.radiance": { + "source": "iana" + }, + "image/vnd.sealed.png": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.gif": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.jpg": { + "source": "iana" + }, + "image/vnd.svf": { + "source": "iana" + }, + "image/vnd.tencent.tap": { + "source": "iana", + "extensions": ["tap"] + }, + "image/vnd.valve.source.texture": { + "source": "iana", + "extensions": ["vtf"] + }, + "image/vnd.wap.wbmp": { + "source": "iana", + "extensions": ["wbmp"] + }, + "image/vnd.xiff": { + "source": "iana", + "extensions": ["xif"] + }, + "image/vnd.zbrush.pcx": { + "source": "iana", + "extensions": ["pcx"] + }, + "image/webp": { + "source": "apache", + "extensions": ["webp"] + }, + "image/wmf": { + "source": "iana", + "extensions": ["wmf"] + }, + "image/x-3ds": { + "source": "apache", + "extensions": ["3ds"] + }, + "image/x-cmu-raster": { + "source": "apache", + "extensions": ["ras"] + }, + "image/x-cmx": { + "source": "apache", + "extensions": ["cmx"] + }, + "image/x-freehand": { + "source": "apache", + "extensions": ["fh","fhc","fh4","fh5","fh7"] + }, + "image/x-icon": { + "source": "apache", + "compressible": true, + "extensions": ["ico"] + }, + "image/x-jng": { + "source": "nginx", + "extensions": ["jng"] + }, + "image/x-mrsid-image": { + "source": "apache", + "extensions": ["sid"] + }, + "image/x-ms-bmp": { + "source": "nginx", + "compressible": true, + "extensions": ["bmp"] + }, + "image/x-pcx": { + "source": "apache", + "extensions": ["pcx"] + }, + "image/x-pict": { + "source": "apache", + "extensions": ["pic","pct"] + }, + "image/x-portable-anymap": { + "source": "apache", + "extensions": ["pnm"] + }, + "image/x-portable-bitmap": { + "source": "apache", + "extensions": ["pbm"] + }, + "image/x-portable-graymap": { + "source": "apache", + "extensions": ["pgm"] + }, + "image/x-portable-pixmap": { + "source": "apache", + "extensions": ["ppm"] + }, + "image/x-rgb": { + "source": "apache", + "extensions": ["rgb"] + }, + "image/x-tga": { + "source": "apache", + "extensions": ["tga"] + }, + "image/x-xbitmap": { + "source": "apache", + "extensions": ["xbm"] + }, + "image/x-xcf": { + "compressible": false + }, + "image/x-xpixmap": { + "source": "apache", + "extensions": ["xpm"] + }, + "image/x-xwindowdump": { + "source": "apache", + "extensions": ["xwd"] + }, + "message/cpim": { + "source": "iana" + }, + "message/delivery-status": { + "source": "iana" + }, + "message/disposition-notification": { + "source": "iana", + "extensions": [ + "disposition-notification" + ] + }, + "message/external-body": { + "source": "iana" + }, + "message/feedback-report": { + "source": "iana" + }, + "message/global": { + "source": "iana", + "extensions": ["u8msg"] + }, + "message/global-delivery-status": { + "source": "iana", + "extensions": ["u8dsn"] + }, + "message/global-disposition-notification": { + "source": "iana", + "extensions": ["u8mdn"] + }, + "message/global-headers": { + "source": "iana", + "extensions": ["u8hdr"] + }, + "message/http": { + "source": "iana", + "compressible": false + }, + "message/imdn+xml": { + "source": "iana", + "compressible": true + }, + "message/news": { + "source": "iana" + }, + "message/partial": { + "source": "iana", + "compressible": false + }, + "message/rfc822": { + "source": "iana", + "compressible": true, + "extensions": ["eml","mime"] + }, + "message/s-http": { + "source": "iana" + }, + "message/sip": { + "source": "iana" + }, + "message/sipfrag": { + "source": "iana" + }, + "message/tracking-status": { + "source": "iana" + }, + "message/vnd.si.simp": { + "source": "iana" + }, + "message/vnd.wfa.wsc": { + "source": "iana", + "extensions": ["wsc"] + }, + "model/3mf": { + "source": "iana" + }, + "model/gltf+json": { + "source": "iana", + "compressible": true, + "extensions": ["gltf"] + }, + "model/gltf-binary": { + "source": "iana", + "compressible": true, + "extensions": ["glb"] + }, + "model/iges": { + "source": "iana", + "compressible": false, + "extensions": ["igs","iges"] + }, + "model/mesh": { + "source": "iana", + "compressible": false, + "extensions": ["msh","mesh","silo"] + }, + "model/stl": { + "source": "iana" + }, + "model/vnd.collada+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dae"] + }, + "model/vnd.dwf": { + "source": "iana", + "extensions": ["dwf"] + }, + "model/vnd.flatland.3dml": { + "source": "iana" + }, + "model/vnd.gdl": { + "source": "iana", + "extensions": ["gdl"] + }, + "model/vnd.gs-gdl": { + "source": "apache" + }, + "model/vnd.gs.gdl": { + "source": "iana" + }, + "model/vnd.gtw": { + "source": "iana", + "extensions": ["gtw"] + }, + "model/vnd.moml+xml": { + "source": "iana", + "compressible": true + }, + "model/vnd.mts": { + "source": "iana", + "extensions": ["mts"] + }, + "model/vnd.opengex": { + "source": "iana" + }, + "model/vnd.parasolid.transmit.binary": { + "source": "iana" + }, + "model/vnd.parasolid.transmit.text": { + "source": "iana" + }, + "model/vnd.rosette.annotated-data-model": { + "source": "iana" + }, + "model/vnd.usdz+zip": { + "source": "iana", + "compressible": false + }, + "model/vnd.valve.source.compiled-map": { + "source": "iana" + }, + "model/vnd.vtu": { + "source": "iana", + "extensions": ["vtu"] + }, + "model/vrml": { + "source": "iana", + "compressible": false, + "extensions": ["wrl","vrml"] + }, + "model/x3d+binary": { + "source": "apache", + "compressible": false, + "extensions": ["x3db","x3dbz"] + }, + "model/x3d+fastinfoset": { + "source": "iana" + }, + "model/x3d+vrml": { + "source": "apache", + "compressible": false, + "extensions": ["x3dv","x3dvz"] + }, + "model/x3d+xml": { + "source": "iana", + "compressible": true, + "extensions": ["x3d","x3dz"] + }, + "model/x3d-vrml": { + "source": "iana" + }, + "multipart/alternative": { + "source": "iana", + "compressible": false + }, + "multipart/appledouble": { + "source": "iana" + }, + "multipart/byteranges": { + "source": "iana" + }, + "multipart/digest": { + "source": "iana" + }, + "multipart/encrypted": { + "source": "iana", + "compressible": false + }, + "multipart/form-data": { + "source": "iana", + "compressible": false + }, + "multipart/header-set": { + "source": "iana" + }, + "multipart/mixed": { + "source": "iana", + "compressible": false + }, + "multipart/multilingual": { + "source": "iana" + }, + "multipart/parallel": { + "source": "iana" + }, + "multipart/related": { + "source": "iana", + "compressible": false + }, + "multipart/report": { + "source": "iana" + }, + "multipart/signed": { + "source": "iana", + "compressible": false + }, + "multipart/vnd.bint.med-plus": { + "source": "iana" + }, + "multipart/voice-message": { + "source": "iana" + }, + "multipart/x-mixed-replace": { + "source": "iana" + }, + "text/1d-interleaved-parityfec": { + "source": "iana" + }, + "text/cache-manifest": { + "source": "iana", + "compressible": true, + "extensions": ["appcache","manifest"] + }, + "text/calendar": { + "source": "iana", + "extensions": ["ics","ifb"] + }, + "text/calender": { + "compressible": true + }, + "text/cmd": { + "compressible": true + }, + "text/coffeescript": { + "extensions": ["coffee","litcoffee"] + }, + "text/css": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["css"] + }, + "text/csv": { + "source": "iana", + "compressible": true, + "extensions": ["csv"] + }, + "text/csv-schema": { + "source": "iana" + }, + "text/directory": { + "source": "iana" + }, + "text/dns": { + "source": "iana" + }, + "text/ecmascript": { + "source": "iana" + }, + "text/encaprtp": { + "source": "iana" + }, + "text/enriched": { + "source": "iana" + }, + "text/fwdred": { + "source": "iana" + }, + "text/grammar-ref-list": { + "source": "iana" + }, + "text/html": { + "source": "iana", + "compressible": true, + "extensions": ["html","htm","shtml"] + }, + "text/jade": { + "extensions": ["jade"] + }, + "text/javascript": { + "source": "iana", + "compressible": true + }, + "text/jcr-cnd": { + "source": "iana" + }, + "text/jsx": { + "compressible": true, + "extensions": ["jsx"] + }, + "text/less": { + "compressible": true, + "extensions": ["less"] + }, + "text/markdown": { + "source": "iana", + "compressible": true, + "extensions": ["markdown","md"] + }, + "text/mathml": { + "source": "nginx", + "extensions": ["mml"] + }, + "text/mizar": { + "source": "iana" + }, + "text/n3": { + "source": "iana", + "compressible": true, + "extensions": ["n3"] + }, + "text/parameters": { + "source": "iana" + }, + "text/parityfec": { + "source": "iana" + }, + "text/plain": { + "source": "iana", + "compressible": true, + "extensions": ["txt","text","conf","def","list","log","in","ini"] + }, + "text/provenance-notation": { + "source": "iana" + }, + "text/prs.fallenstein.rst": { + "source": "iana" + }, + "text/prs.lines.tag": { + "source": "iana", + "extensions": ["dsc"] + }, + "text/prs.prop.logic": { + "source": "iana" + }, + "text/raptorfec": { + "source": "iana" + }, + "text/red": { + "source": "iana" + }, + "text/rfc822-headers": { + "source": "iana" + }, + "text/richtext": { + "source": "iana", + "compressible": true, + "extensions": ["rtx"] + }, + "text/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "text/rtp-enc-aescm128": { + "source": "iana" + }, + "text/rtploopback": { + "source": "iana" + }, + "text/rtx": { + "source": "iana" + }, + "text/sgml": { + "source": "iana", + "extensions": ["sgml","sgm"] + }, + "text/shex": { + "extensions": ["shex"] + }, + "text/slim": { + "extensions": ["slim","slm"] + }, + "text/strings": { + "source": "iana" + }, + "text/stylus": { + "extensions": ["stylus","styl"] + }, + "text/t140": { + "source": "iana" + }, + "text/tab-separated-values": { + "source": "iana", + "compressible": true, + "extensions": ["tsv"] + }, + "text/troff": { + "source": "iana", + "extensions": ["t","tr","roff","man","me","ms"] + }, + "text/turtle": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["ttl"] + }, + "text/ulpfec": { + "source": "iana" + }, + "text/uri-list": { + "source": "iana", + "compressible": true, + "extensions": ["uri","uris","urls"] + }, + "text/vcard": { + "source": "iana", + "compressible": true, + "extensions": ["vcard"] + }, + "text/vnd.a": { + "source": "iana" + }, + "text/vnd.abc": { + "source": "iana" + }, + "text/vnd.ascii-art": { + "source": "iana" + }, + "text/vnd.curl": { + "source": "iana", + "extensions": ["curl"] + }, + "text/vnd.curl.dcurl": { + "source": "apache", + "extensions": ["dcurl"] + }, + "text/vnd.curl.mcurl": { + "source": "apache", + "extensions": ["mcurl"] + }, + "text/vnd.curl.scurl": { + "source": "apache", + "extensions": ["scurl"] + }, + "text/vnd.debian.copyright": { + "source": "iana" + }, + "text/vnd.dmclientscript": { + "source": "iana" + }, + "text/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "text/vnd.esmertec.theme-descriptor": { + "source": "iana" + }, + "text/vnd.fly": { + "source": "iana", + "extensions": ["fly"] + }, + "text/vnd.fmi.flexstor": { + "source": "iana", + "extensions": ["flx"] + }, + "text/vnd.gml": { + "source": "iana" + }, + "text/vnd.graphviz": { + "source": "iana", + "extensions": ["gv"] + }, + "text/vnd.hgl": { + "source": "iana" + }, + "text/vnd.in3d.3dml": { + "source": "iana", + "extensions": ["3dml"] + }, + "text/vnd.in3d.spot": { + "source": "iana", + "extensions": ["spot"] + }, + "text/vnd.iptc.newsml": { + "source": "iana" + }, + "text/vnd.iptc.nitf": { + "source": "iana" + }, + "text/vnd.latex-z": { + "source": "iana" + }, + "text/vnd.motorola.reflex": { + "source": "iana" + }, + "text/vnd.ms-mediapackage": { + "source": "iana" + }, + "text/vnd.net2phone.commcenter.command": { + "source": "iana" + }, + "text/vnd.radisys.msml-basic-layout": { + "source": "iana" + }, + "text/vnd.senx.warpscript": { + "source": "iana" + }, + "text/vnd.si.uricatalogue": { + "source": "iana" + }, + "text/vnd.sun.j2me.app-descriptor": { + "source": "iana", + "extensions": ["jad"] + }, + "text/vnd.trolltech.linguist": { + "source": "iana" + }, + "text/vnd.wap.si": { + "source": "iana" + }, + "text/vnd.wap.sl": { + "source": "iana" + }, + "text/vnd.wap.wml": { + "source": "iana", + "extensions": ["wml"] + }, + "text/vnd.wap.wmlscript": { + "source": "iana", + "extensions": ["wmls"] + }, + "text/vtt": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["vtt"] + }, + "text/x-asm": { + "source": "apache", + "extensions": ["s","asm"] + }, + "text/x-c": { + "source": "apache", + "extensions": ["c","cc","cxx","cpp","h","hh","dic"] + }, + "text/x-component": { + "source": "nginx", + "extensions": ["htc"] + }, + "text/x-fortran": { + "source": "apache", + "extensions": ["f","for","f77","f90"] + }, + "text/x-gwt-rpc": { + "compressible": true + }, + "text/x-handlebars-template": { + "extensions": ["hbs"] + }, + "text/x-java-source": { + "source": "apache", + "extensions": ["java"] + }, + "text/x-jquery-tmpl": { + "compressible": true + }, + "text/x-lua": { + "extensions": ["lua"] + }, + "text/x-markdown": { + "compressible": true, + "extensions": ["mkd"] + }, + "text/x-nfo": { + "source": "apache", + "extensions": ["nfo"] + }, + "text/x-opml": { + "source": "apache", + "extensions": ["opml"] + }, + "text/x-org": { + "compressible": true, + "extensions": ["org"] + }, + "text/x-pascal": { + "source": "apache", + "extensions": ["p","pas"] + }, + "text/x-processing": { + "compressible": true, + "extensions": ["pde"] + }, + "text/x-sass": { + "extensions": ["sass"] + }, + "text/x-scss": { + "extensions": ["scss"] + }, + "text/x-setext": { + "source": "apache", + "extensions": ["etx"] + }, + "text/x-sfv": { + "source": "apache", + "extensions": ["sfv"] + }, + "text/x-suse-ymp": { + "compressible": true, + "extensions": ["ymp"] + }, + "text/x-uuencode": { + "source": "apache", + "extensions": ["uu"] + }, + "text/x-vcalendar": { + "source": "apache", + "extensions": ["vcs"] + }, + "text/x-vcard": { + "source": "apache", + "extensions": ["vcf"] + }, + "text/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml"] + }, + "text/xml-external-parsed-entity": { + "source": "iana" + }, + "text/yaml": { + "extensions": ["yaml","yml"] + }, + "video/1d-interleaved-parityfec": { + "source": "iana" + }, + "video/3gpp": { + "source": "iana", + "extensions": ["3gp","3gpp"] + }, + "video/3gpp-tt": { + "source": "iana" + }, + "video/3gpp2": { + "source": "iana", + "extensions": ["3g2"] + }, + "video/bmpeg": { + "source": "iana" + }, + "video/bt656": { + "source": "iana" + }, + "video/celb": { + "source": "iana" + }, + "video/dv": { + "source": "iana" + }, + "video/encaprtp": { + "source": "iana" + }, + "video/h261": { + "source": "iana", + "extensions": ["h261"] + }, + "video/h263": { + "source": "iana", + "extensions": ["h263"] + }, + "video/h263-1998": { + "source": "iana" + }, + "video/h263-2000": { + "source": "iana" + }, + "video/h264": { + "source": "iana", + "extensions": ["h264"] + }, + "video/h264-rcdo": { + "source": "iana" + }, + "video/h264-svc": { + "source": "iana" + }, + "video/h265": { + "source": "iana" + }, + "video/iso.segment": { + "source": "iana" + }, + "video/jpeg": { + "source": "iana", + "extensions": ["jpgv"] + }, + "video/jpeg2000": { + "source": "iana" + }, + "video/jpm": { + "source": "apache", + "extensions": ["jpm","jpgm"] + }, + "video/mj2": { + "source": "iana", + "extensions": ["mj2","mjp2"] + }, + "video/mp1s": { + "source": "iana" + }, + "video/mp2p": { + "source": "iana" + }, + "video/mp2t": { + "source": "iana", + "extensions": ["ts"] + }, + "video/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["mp4","mp4v","mpg4"] + }, + "video/mp4v-es": { + "source": "iana" + }, + "video/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpeg","mpg","mpe","m1v","m2v"] + }, + "video/mpeg4-generic": { + "source": "iana" + }, + "video/mpv": { + "source": "iana" + }, + "video/nv": { + "source": "iana" + }, + "video/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogv"] + }, + "video/parityfec": { + "source": "iana" + }, + "video/pointer": { + "source": "iana" + }, + "video/quicktime": { + "source": "iana", + "compressible": false, + "extensions": ["qt","mov"] + }, + "video/raptorfec": { + "source": "iana" + }, + "video/raw": { + "source": "iana" + }, + "video/rtp-enc-aescm128": { + "source": "iana" + }, + "video/rtploopback": { + "source": "iana" + }, + "video/rtx": { + "source": "iana" + }, + "video/smpte291": { + "source": "iana" + }, + "video/smpte292m": { + "source": "iana" + }, + "video/ulpfec": { + "source": "iana" + }, + "video/vc1": { + "source": "iana" + }, + "video/vc2": { + "source": "iana" + }, + "video/vnd.cctv": { + "source": "iana" + }, + "video/vnd.dece.hd": { + "source": "iana", + "extensions": ["uvh","uvvh"] + }, + "video/vnd.dece.mobile": { + "source": "iana", + "extensions": ["uvm","uvvm"] + }, + "video/vnd.dece.mp4": { + "source": "iana" + }, + "video/vnd.dece.pd": { + "source": "iana", + "extensions": ["uvp","uvvp"] + }, + "video/vnd.dece.sd": { + "source": "iana", + "extensions": ["uvs","uvvs"] + }, + "video/vnd.dece.video": { + "source": "iana", + "extensions": ["uvv","uvvv"] + }, + "video/vnd.directv.mpeg": { + "source": "iana" + }, + "video/vnd.directv.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dlna.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dvb.file": { + "source": "iana", + "extensions": ["dvb"] + }, + "video/vnd.fvt": { + "source": "iana", + "extensions": ["fvt"] + }, + "video/vnd.hns.video": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsavc": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsmpeg2": { + "source": "iana" + }, + "video/vnd.motorola.video": { + "source": "iana" + }, + "video/vnd.motorola.videop": { + "source": "iana" + }, + "video/vnd.mpegurl": { + "source": "iana", + "extensions": ["mxu","m4u"] + }, + "video/vnd.ms-playready.media.pyv": { + "source": "iana", + "extensions": ["pyv"] + }, + "video/vnd.nokia.interleaved-multimedia": { + "source": "iana" + }, + "video/vnd.nokia.mp4vr": { + "source": "iana" + }, + "video/vnd.nokia.videovoip": { + "source": "iana" + }, + "video/vnd.objectvideo": { + "source": "iana" + }, + "video/vnd.radgamettools.bink": { + "source": "iana" + }, + "video/vnd.radgamettools.smacker": { + "source": "iana" + }, + "video/vnd.sealed.mpeg1": { + "source": "iana" + }, + "video/vnd.sealed.mpeg4": { + "source": "iana" + }, + "video/vnd.sealed.swf": { + "source": "iana" + }, + "video/vnd.sealedmedia.softseal.mov": { + "source": "iana" + }, + "video/vnd.uvvu.mp4": { + "source": "iana", + "extensions": ["uvu","uvvu"] + }, + "video/vnd.vivo": { + "source": "iana", + "extensions": ["viv"] + }, + "video/vp8": { + "source": "iana" + }, + "video/webm": { + "source": "apache", + "compressible": false, + "extensions": ["webm"] + }, + "video/x-f4v": { + "source": "apache", + "extensions": ["f4v"] + }, + "video/x-fli": { + "source": "apache", + "extensions": ["fli"] + }, + "video/x-flv": { + "source": "apache", + "compressible": false, + "extensions": ["flv"] + }, + "video/x-m4v": { + "source": "apache", + "extensions": ["m4v"] + }, + "video/x-matroska": { + "source": "apache", + "compressible": false, + "extensions": ["mkv","mk3d","mks"] + }, + "video/x-mng": { + "source": "apache", + "extensions": ["mng"] + }, + "video/x-ms-asf": { + "source": "apache", + "extensions": ["asf","asx"] + }, + "video/x-ms-vob": { + "source": "apache", + "extensions": ["vob"] + }, + "video/x-ms-wm": { + "source": "apache", + "extensions": ["wm"] + }, + "video/x-ms-wmv": { + "source": "apache", + "compressible": false, + "extensions": ["wmv"] + }, + "video/x-ms-wmx": { + "source": "apache", + "extensions": ["wmx"] + }, + "video/x-ms-wvx": { + "source": "apache", + "extensions": ["wvx"] + }, + "video/x-msvideo": { + "source": "apache", + "extensions": ["avi"] + }, + "video/x-sgi-movie": { + "source": "apache", + "extensions": ["movie"] + }, + "video/x-smv": { + "source": "apache", + "extensions": ["smv"] + }, + "x-conference/x-cooltalk": { + "source": "apache", + "extensions": ["ice"] + }, + "x-shader/x-fragment": { + "compressible": true + }, + "x-shader/x-vertex": { + "compressible": true + } +} diff --git a/resources/app/node_modules/mime-db/index.js b/resources/app/node_modules/mime-db/index.js new file mode 100644 index 0000000..551031f --- /dev/null +++ b/resources/app/node_modules/mime-db/index.js @@ -0,0 +1,11 @@ +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = require('./db.json') diff --git a/resources/app/node_modules/modify-filename/index.js b/resources/app/node_modules/modify-filename/index.js new file mode 100644 index 0000000..1c53fba --- /dev/null +++ b/resources/app/node_modules/modify-filename/index.js @@ -0,0 +1,17 @@ +'use strict'; +var path = require('path'); + +module.exports = function modifyFilename(pth, modifier) { + if (arguments.length !== 2) { + throw new Error('`path` and `modifier` required'); + } + + if (Array.isArray(pth)) { + return pth.map(function (el) { + return modifyFilename(el, modifier); + }); + } + + var ext = path.extname(pth); + return path.join(path.dirname(pth), modifier(path.basename(pth, ext), ext)); +}; diff --git a/resources/app/node_modules/modify-filename/license b/resources/app/node_modules/modify-filename/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/resources/app/node_modules/modify-filename/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/modify-filename/readme.md b/resources/app/node_modules/modify-filename/readme.md new file mode 100644 index 0000000..1c3ec3b --- /dev/null +++ b/resources/app/node_modules/modify-filename/readme.md @@ -0,0 +1,32 @@ +# modify-filename [](https://travis-ci.org/sindresorhus/modify-filename) + +> Modify the filename in a path + + +## Install + +``` +$ npm install --save modify-filename +``` + + +## Usage + +```js +var modifyFilename = require('modify-filename'); + +modifyFilename('src/unicorn.png', function (filename, extension) { + return filename + '-rainbow' + extension; +}); +//=> 'src/unicorn-rainbow.png' + +modifyFilename(['src/unicorn.png', 'src/pony.png'], function (filename, extension) { + return filename + '-rainbow' + extension; +}); +//=> ['src/unicorn-rainbow.png', 'src/pony-rainbow.png'] +``` + + +## License + +MIT © [Sindre Sorhus](http://sindresorhus.com) diff --git a/resources/app/node_modules/ms/index.js b/resources/app/node_modules/ms/index.js new file mode 100644 index 0000000..6a522b1 --- /dev/null +++ b/resources/app/node_modules/ms/index.js @@ -0,0 +1,152 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/resources/app/node_modules/ms/license.md b/resources/app/node_modules/ms/license.md new file mode 100644 index 0000000..69b6125 --- /dev/null +++ b/resources/app/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/resources/app/node_modules/ms/readme.md b/resources/app/node_modules/ms/readme.md new file mode 100644 index 0000000..84a9974 --- /dev/null +++ b/resources/app/node_modules/ms/readme.md @@ -0,0 +1,51 @@ +# ms + +[](https://travis-ci.org/zeit/ms) +[](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/resources/app/node_modules/path-exists/index.js b/resources/app/node_modules/path-exists/index.js new file mode 100644 index 0000000..16ae60a --- /dev/null +++ b/resources/app/node_modules/path-exists/index.js @@ -0,0 +1,17 @@ +'use strict'; +const fs = require('fs'); + +module.exports = fp => new Promise(resolve => { + fs.access(fp, err => { + resolve(!err); + }); +}); + +module.exports.sync = fp => { + try { + fs.accessSync(fp); + return true; + } catch (err) { + return false; + } +}; diff --git a/resources/app/node_modules/path-exists/license b/resources/app/node_modules/path-exists/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/resources/app/node_modules/path-exists/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/path-exists/readme.md b/resources/app/node_modules/path-exists/readme.md new file mode 100644 index 0000000..1b65fa7 --- /dev/null +++ b/resources/app/node_modules/path-exists/readme.md @@ -0,0 +1,50 @@ +# path-exists [](https://travis-ci.org/sindresorhus/path-exists) + +> Check if a path exists + +Because [`fs.exists()`](https://nodejs.org/api/fs.html#fs_fs_exists_path_callback) is being [deprecated](https://github.com/iojs/io.js/issues/103), but there's still a genuine use-case of being able to check if a path exists for other purposes than doing IO with it. + +Never use this before handling a file though: + +> In particular, checking if a file exists before opening it is an anti-pattern that leaves you vulnerable to race conditions: another process may remove the file between the calls to `fs.exists()` and `fs.open()`. Just open the file and handle the error when it's not there. + + +## Install + +``` +$ npm install --save path-exists +``` + + +## Usage + +```js +// foo.js +const pathExists = require('path-exists'); + +pathExists('foo.js').then(exists => { + console.log(exists); + //=> true +}); +``` + + +## API + +### pathExists(path) + +Returns a promise for a boolean of whether the path exists. + +### pathExists.sync(path) + +Returns a boolean of whether the path exists. + + +## Related + +- [path-exists-cli](https://github.com/sindresorhus/path-exists-cli) - CLI for this module + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/resources/app/node_modules/pupa/index.js b/resources/app/node_modules/pupa/index.js new file mode 100644 index 0000000..501fca5 --- /dev/null +++ b/resources/app/node_modules/pupa/index.js @@ -0,0 +1,22 @@ +'use strict'; +module.exports = (tpl, data) => { + if (typeof tpl !== 'string') { + throw new TypeError(`Expected a string in the first argument, got ${typeof tpl}`); + } + + if (typeof data !== 'object') { + throw new TypeError(`Expected an Object/Array in the second argument, got ${typeof data}`); + } + + const re = /{(.*?)}/g; + + return tpl.replace(re, (_, key) => { + let ret = data; + + for (const prop of key.split('.')) { + ret = ret ? ret[prop] : ''; + } + + return ret || ''; + }); +}; diff --git a/resources/app/node_modules/pupa/license b/resources/app/node_modules/pupa/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/resources/app/node_modules/pupa/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/pupa/readme.md b/resources/app/node_modules/pupa/readme.md new file mode 100644 index 0000000..1255e8d --- /dev/null +++ b/resources/app/node_modules/pupa/readme.md @@ -0,0 +1,59 @@ +# pupa [](https://travis-ci.org/sindresorhus/pupa) + +> Simple micro templating + +Useful when all you need is to fill in some placeholders. + + +## Install + +``` +$ npm install --save pupa +``` + + +## Usage + +```js +const pupa = require('pupa'); + +pupa('The mobile number of {name} is {phone.mobile}', { + name: 'Sindre', + phone: { + mobile: '609 24 363' + } +}); +//=> 'The mobile number of Sindre is 609 24 363' + +pupa('I like {0} and {1}', ['🦄', '🐮']); +//=> 'I like 🦄 and 🐮' +``` + + +## API + +### pupa(template, data) + +#### template + +Type: `string` + +Text with placeholders for `data` properties. + +#### data + +Type: `Object` `Array` + +Data to interpolate into `template`. + + +## FAQ + +### What about template literals? + +Template literals expand on creation. This module expands the template on execution, which can be useful if either or both template and data are lazily created or user-supplied. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/resources/app/node_modules/sort-keys-length/LICENSE.md b/resources/app/node_modules/sort-keys-length/LICENSE.md new file mode 100644 index 0000000..3beff79 --- /dev/null +++ b/resources/app/node_modules/sort-keys-length/LICENSE.md @@ -0,0 +1,19 @@ +Copyright (c) Kevin Mårtensson + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/resources/app/node_modules/sort-keys-length/README.md b/resources/app/node_modules/sort-keys-length/README.md new file mode 100644 index 0000000..1efe188 --- /dev/null +++ b/resources/app/node_modules/sort-keys-length/README.md @@ -0,0 +1,35 @@ +# sort-keys-length [](http://travis-ci.org/kevva/sort-keys-length) + +> Sort object keys by length + +## Install + +```sh +$ npm install --save sort-keys-length +``` + +## Usage + +```js +var sortKeysLength = require('sort-keys-length'); + +sortKeysLength.asc({ ab: 'x', a: 'y', abc: 'z' }); +//=> { a: 'y', ab: 'x', abc: 'z' } + +sortKeysLength.desc({ ab: 'x', a: 'y', abc: 'z' }); +//=> { abc: 'z', ab: 'x', a: 'y' } +``` + +## API + +### .asc + +Ascending sort. + +### .desc + +Descending sort. + +## License + +MIT © [Kevin Mårtensson](https://github.com/kevva) diff --git a/resources/app/node_modules/sort-keys-length/index.js b/resources/app/node_modules/sort-keys-length/index.js new file mode 100644 index 0000000..b4af8d2 --- /dev/null +++ b/resources/app/node_modules/sort-keys-length/index.js @@ -0,0 +1,22 @@ +'use strict'; + +var sortKeys = require('sort-keys'); + +/** + * Sort object keys by length + * + * @param obj + * @api public + */ + +module.exports.desc = function (obj) { + return sortKeys(obj, function (a, b) { + return b.length - a.length; + }); +} + +module.exports.asc = function (obj) { + return sortKeys(obj, function (a, b) { + return a.length - b.length; + }); +} diff --git a/resources/app/node_modules/sort-keys/index.js b/resources/app/node_modules/sort-keys/index.js new file mode 100644 index 0000000..f75a0e0 --- /dev/null +++ b/resources/app/node_modules/sort-keys/index.js @@ -0,0 +1,44 @@ +'use strict'; +var isPlainObj = require('is-plain-obj'); + +module.exports = function (obj, opts) { + if (!isPlainObj(obj)) { + throw new TypeError('Expected a plain object'); + } + + opts = opts || {}; + + // DEPRECATED + if (typeof opts === 'function') { + opts = {compare: opts}; + } + + var deep = opts.deep; + var seenInput = []; + var seenOutput = []; + + var sortKeys = function (x) { + var seenIndex = seenInput.indexOf(x); + + if (seenIndex !== -1) { + return seenOutput[seenIndex]; + } + + var ret = {}; + var keys = Object.keys(x).sort(opts.compare); + + seenInput.push(x); + seenOutput.push(ret); + + for (var i = 0; i < keys.length; i++) { + var key = keys[i]; + var val = x[key]; + + ret[key] = deep && isPlainObj(val) ? sortKeys(val) : val; + } + + return ret; + }; + + return sortKeys(obj); +}; diff --git a/resources/app/node_modules/sort-keys/license b/resources/app/node_modules/sort-keys/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/resources/app/node_modules/sort-keys/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/sort-keys/readme.md b/resources/app/node_modules/sort-keys/readme.md new file mode 100644 index 0000000..a671ffb --- /dev/null +++ b/resources/app/node_modules/sort-keys/readme.md @@ -0,0 +1,60 @@ +# sort-keys [](https://travis-ci.org/sindresorhus/sort-keys) + +> Sort the keys of an object + +Useful to get a deterministically ordered object, as the order of keys can vary between engines. + + +## Install + +``` +$ npm install --save sort-keys +``` + + +## Usage + +```js +const sortKeys = require('sort-keys'); + +sortKeys({c: 0, a: 0, b: 0}); +//=> {a: 0, b: 0, c: 0} + +sortKeys({b: {b: 0, a: 0}, a: 0}, {deep: true}); +//=> {a: 0, b: {a: 0, b: 0}} + +sortKeys({c: 0, a: 0, b: 0}, { + compare: (a, b) => -a.localeCompare(b) +}); +//=> {c: 0, b: 0, a: 0} +``` + + +## API + +### sortKeys(input, [options]) + +Returns a new object with sorted keys. + +#### input + +Type: `Object` + +#### options + +##### deep + +Type: `boolean` + +Recursively sort keys. + +##### compare + +Type: `Function` + +[Compare function.](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Array/sort) + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/resources/app/node_modules/source-map-support/LICENSE.md b/resources/app/node_modules/source-map-support/LICENSE.md new file mode 100644 index 0000000..6247ca9 --- /dev/null +++ b/resources/app/node_modules/source-map-support/LICENSE.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Evan Wallace + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/resources/app/node_modules/source-map-support/README.md b/resources/app/node_modules/source-map-support/README.md new file mode 100644 index 0000000..40228b7 --- /dev/null +++ b/resources/app/node_modules/source-map-support/README.md @@ -0,0 +1,284 @@ +# Source Map Support +[](https://travis-ci.org/evanw/node-source-map-support) + +This module provides source map support for stack traces in node via the [V8 stack trace API](https://github.com/v8/v8/wiki/Stack-Trace-API). It uses the [source-map](https://github.com/mozilla/source-map) module to replace the paths and line numbers of source-mapped files with their original paths and line numbers. The output mimics node's stack trace format with the goal of making every compile-to-JS language more of a first-class citizen. Source maps are completely general (not specific to any one language) so you can use source maps with multiple compile-to-JS languages in the same node process. + +## Installation and Usage + +#### Node support + +``` +$ npm install source-map-support +``` + +Source maps can be generated using libraries such as [source-map-index-generator](https://github.com/twolfson/source-map-index-generator). Once you have a valid source map, place a source mapping comment somewhere in the file (usually done automatically or with an option by your transpiler): + +``` +//# sourceMappingURL=path/to/source.map +``` + +If multiple sourceMappingURL comments exist in one file, the last sourceMappingURL comment will be +respected (e.g. if a file mentions the comment in code, or went through multiple transpilers). +The path should either be absolute or relative to the compiled file. + +From here you have two options. + +##### CLI Usage + +```bash +node -r source-map-support/register compiled.js +``` + +##### Programmatic Usage + +Put the following line at the top of the compiled file. + +```js +require('source-map-support').install(); +``` + +It is also possible to install the source map support directly by +requiring the `register` module which can be handy with ES6: + +```js +import 'source-map-support/register' + +// Instead of: +import sourceMapSupport from 'source-map-support' +sourceMapSupport.install() +``` +Note: if you're using babel-register, it includes source-map-support already. + +It is also very useful with Mocha: + +``` +$ mocha --require source-map-support/register tests/ +``` + +#### Browser support + +This library also works in Chrome. While the DevTools console already supports source maps, the V8 engine doesn't and `Error.prototype.stack` will be incorrect without this library. Everything will just work if you deploy your source files using [browserify](http://browserify.org/). Just make sure to pass the `--debug` flag to the browserify command so your source maps are included in the bundled code. + +This library also works if you use another build process or just include the source files directly. In this case, include the file `browser-source-map-support.js` in your page and call `sourceMapSupport.install()`. It contains the whole library already bundled for the browser using browserify. + +```html +<script src="browser-source-map-support.js"></script> +<script>sourceMapSupport.install();</script> +``` + +This library also works if you use AMD (Asynchronous Module Definition), which is used in tools like [RequireJS](http://requirejs.org/). Just list `browser-source-map-support` as a dependency: + +```html +<script> + define(['browser-source-map-support'], function(sourceMapSupport) { + sourceMapSupport.install(); + }); +</script> +``` + +## Options + +This module installs two things: a change to the `stack` property on `Error` objects and a handler for uncaught exceptions that mimics node's default exception handler (the handler can be seen in the demos below). You may want to disable the handler if you have your own uncaught exception handler. This can be done by passing an argument to the installer: + +```js +require('source-map-support').install({ + handleUncaughtExceptions: false +}); +``` + +This module loads source maps from the filesystem by default. You can provide alternate loading behavior through a callback as shown below. For example, [Meteor](https://github.com/meteor) keeps all source maps cached in memory to avoid disk access. + +```js +require('source-map-support').install({ + retrieveSourceMap: function(source) { + if (source === 'compiled.js') { + return { + url: 'original.js', + map: fs.readFileSync('compiled.js.map', 'utf8') + }; + } + return null; + } +}); +``` + +The module will by default assume a browser environment if XMLHttpRequest and window are defined. If either of these do not exist it will instead assume a node environment. +In some rare cases, e.g. when running a browser emulation and where both variables are also set, you can explictly specify the environment to be either 'browser' or 'node'. + +```js +require('source-map-support').install({ + environment: 'node' +}); +``` + +To support files with inline source maps, the `hookRequire` options can be specified, which will monitor all source files for inline source maps. + + +```js +require('source-map-support').install({ + hookRequire: true +}); +``` + +This monkey patches the `require` module loading chain, so is not enabled by default and is not recommended for any sort of production usage. + +## Demos + +#### Basic Demo + +original.js: + +```js +throw new Error('test'); // This is the original code +``` + +compiled.js: + +```js +require('source-map-support').install(); + +throw new Error('test'); // This is the compiled code +// The next line defines the sourceMapping. +//# sourceMappingURL=compiled.js.map +``` + +compiled.js.map: + +```json +{ + "version": 3, + "file": "compiled.js", + "sources": ["original.js"], + "names": [], + "mappings": ";;AAAA,MAAM,IAAI" +} +``` + +Run compiled.js using node (notice how the stack trace uses original.js instead of compiled.js): + +``` +$ node compiled.js + +original.js:1 +throw new Error('test'); // This is the original code + ^ +Error: test + at Object.<anonymous> (original.js:1:7) + at Module._compile (module.js:456:26) + at Object.Module._extensions..js (module.js:474:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Function.Module.runMain (module.js:497:10) + at startup (node.js:119:16) + at node.js:901:3 +``` + +#### TypeScript Demo + +demo.ts: + +```typescript +declare function require(name: string); +require('source-map-support').install(); +class Foo { + constructor() { this.bar(); } + bar() { throw new Error('this is a demo'); } +} +new Foo(); +``` + +Compile and run the file using the TypeScript compiler from the terminal: + +``` +$ npm install source-map-support typescript +$ node_modules/typescript/bin/tsc -sourcemap demo.ts +$ node demo.js + +demo.ts:5 + bar() { throw new Error('this is a demo'); } + ^ +Error: this is a demo + at Foo.bar (demo.ts:5:17) + at new Foo (demo.ts:4:24) + at Object.<anonymous> (demo.ts:7:1) + at Module._compile (module.js:456:26) + at Object.Module._extensions..js (module.js:474:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Function.Module.runMain (module.js:497:10) + at startup (node.js:119:16) + at node.js:901:3 +``` + +There is also the option to use `-r source-map-support/register` with typescript, without the need add the `require('source-map-support').install()` in the code base: + +``` +$ npm install source-map-support typescript +$ node_modules/typescript/bin/tsc -sourcemap demo.ts +$ node -r source-map-support/register demo.js + +demo.ts:5 + bar() { throw new Error('this is a demo'); } + ^ +Error: this is a demo + at Foo.bar (demo.ts:5:17) + at new Foo (demo.ts:4:24) + at Object.<anonymous> (demo.ts:7:1) + at Module._compile (module.js:456:26) + at Object.Module._extensions..js (module.js:474:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Function.Module.runMain (module.js:497:10) + at startup (node.js:119:16) + at node.js:901:3 +``` + +#### CoffeeScript Demo + +demo.coffee: + +```coffee +require('source-map-support').install() +foo = -> + bar = -> throw new Error 'this is a demo' + bar() +foo() +``` + +Compile and run the file using the CoffeeScript compiler from the terminal: + +```sh +$ npm install source-map-support coffeescript +$ node_modules/.bin/coffee --map --compile demo.coffee +$ node demo.js + +demo.coffee:3 + bar = -> throw new Error 'this is a demo' + ^ +Error: this is a demo + at bar (demo.coffee:3:22) + at foo (demo.coffee:4:3) + at Object.<anonymous> (demo.coffee:5:1) + at Object.<anonymous> (demo.coffee:1:1) + at Module._compile (module.js:456:26) + at Object.Module._extensions..js (module.js:474:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Function.Module.runMain (module.js:497:10) + at startup (node.js:119:16) +``` + +## Tests + +This repo contains both automated tests for node and manual tests for the browser. The automated tests can be run using mocha (type `mocha` in the root directory). To run the manual tests: + +* Build the tests using `build.js` +* Launch the HTTP server (`npm run serve-tests`) and visit + * http://127.0.0.1:1336/amd-test + * http://127.0.0.1:1336/browser-test + * http://127.0.0.1:1336/browserify-test - **Currently not working** due to a bug with browserify (see [pull request #66](https://github.com/evanw/node-source-map-support/pull/66) for details). +* For `header-test`, run `server.js` inside that directory and visit http://127.0.0.1:1337/ + +## License + +This code is available under the [MIT license](http://opensource.org/licenses/MIT). diff --git a/resources/app/node_modules/source-map-support/browser-source-map-support.js b/resources/app/node_modules/source-map-support/browser-source-map-support.js new file mode 100644 index 0000000..65e8985 --- /dev/null +++ b/resources/app/node_modules/source-map-support/browser-source-map-support.js @@ -0,0 +1,113 @@ +/* + * Support for source maps in V8 stack traces + * https://github.com/evanw/node-source-map-support + */ +/* + The buffer module from node.js, for the browser. + + @author Feross Aboukhadijeh <[email protected]> <http://feross.org> + license MIT +*/ +(this.define||function(G,J){this.sourceMapSupport=J()})("browser-source-map-support",function(G){(function b(n,u,m){function e(d,a){if(!u[d]){if(!n[d]){var l="function"==typeof require&&require;if(!a&&l)return l(d,!0);if(g)return g(d,!0);throw Error("Cannot find module '"+d+"'");}l=u[d]={exports:{}};n[d][0].call(l.exports,function(a){var b=n[d][1][a];return e(b?b:a)},l,l.exports,b,n,u,m)}return u[d].exports}for(var g="function"==typeof require&&require,h=0;h<m.length;h++)e(m[h]);return e})({1:[function(n, +u,m){G=n("./source-map-support")},{"./source-map-support":21}],2:[function(n,u,m){(function(b){function e(b){b=b.charCodeAt(0);if(43===b)return 62;if(47===b)return 63;if(48>b)return-1;if(58>b)return b-48+52;if(91>b)return b-65;if(123>b)return b-97+26}var g="undefined"!==typeof Uint8Array?Uint8Array:Array;b.toByteArray=function(b){function d(a){r[w++]=a}if(0<b.length%4)throw Error("Invalid string. Length must be a multiple of 4");var a=b.length;var l="="===b.charAt(a-2)?2:"="===b.charAt(a-1)?1:0;var r= +new g(3*b.length/4-l);var q=0<l?b.length-4:b.length;var w=0;for(a=0;a<q;a+=4){var h=e(b.charAt(a))<<18|e(b.charAt(a+1))<<12|e(b.charAt(a+2))<<6|e(b.charAt(a+3));d((h&16711680)>>16);d((h&65280)>>8);d(h&255)}2===l?(h=e(b.charAt(a))<<2|e(b.charAt(a+1))>>4,d(h&255)):1===l&&(h=e(b.charAt(a))<<10|e(b.charAt(a+1))<<4|e(b.charAt(a+2))>>2,d(h>>8&255),d(h&255));return r};b.fromByteArray=function(b){var d=b.length%3,a="",l;var e=0;for(l=b.length-d;e<l;e+=3){var g=(b[e]<<16)+(b[e+1]<<8)+b[e+2];g="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g>> +18&63)+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g>>12&63)+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g>>6&63)+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g&63);a+=g}switch(d){case 1:g=b[b.length-1];a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g>>2);a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g<<4&63);a+="==";break;case 2:g=(b[b.length-2]<<8)+ +b[b.length-1],a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g>>10),a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g>>4&63),a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(g<<2&63),a+="="}return a}})("undefined"===typeof m?this.base64js={}:m)},{}],3:[function(n,u,m){},{}],4:[function(n,u,m){(function(b){var e=Object.prototype.toString,g="function"===typeof b.alloc&&"function"===typeof b.allocUnsafe&&"function"=== +typeof b.from;u.exports=function(h,d,a){if("number"===typeof h)throw new TypeError('"value" argument must not be a number');if("ArrayBuffer"===e.call(h).slice(8,-1)){d>>>=0;var l=h.byteLength-d;if(0>l)throw new RangeError("'offset' is out of bounds");if(void 0===a)a=l;else if(a>>>=0,a>l)throw new RangeError("'length' is out of bounds");return g?b.from(h.slice(d,d+a)):new b(new Uint8Array(h.slice(d,d+a)))}if("string"===typeof h){a=d;if("string"!==typeof a||""===a)a="utf8";if(!b.isEncoding(a))throw new TypeError('"encoding" must be a valid string encoding'); +return g?b.from(h,a):new b(h,a)}return g?b.from(h):new b(h)}}).call(this,n("buffer").Buffer)},{buffer:5}],5:[function(n,u,m){function b(f,p,a){if(!(this instanceof b))return new b(f,p,a);var c=typeof f;if("number"===c)var d=0<f?f>>>0:0;else if("string"===c){if("base64"===p)for(f=(f.trim?f.trim():f.replace(/^\s+|\s+$/g,"")).replace(H,"");0!==f.length%4;)f+="=";d=b.byteLength(f,p)}else if("object"===c&&null!==f)"Buffer"===f.type&&F(f.data)&&(f=f.data),d=0<+f.length?Math.floor(+f.length):0;else throw new TypeError("must start with number, buffer, array or string"); +if(this.length>D)throw new RangeError("Attempt to allocate Buffer larger than maximum size: 0x"+D.toString(16)+" bytes");if(b.TYPED_ARRAY_SUPPORT)var k=b._augment(new Uint8Array(d));else k=this,k.length=d,k._isBuffer=!0;if(b.TYPED_ARRAY_SUPPORT&&"number"===typeof f.byteLength)k._set(f);else{var C=f;if(F(C)||b.isBuffer(C)||C&&"object"===typeof C&&"number"===typeof C.length)if(b.isBuffer(f))for(p=0;p<d;p++)k[p]=f.readUInt8(p);else for(p=0;p<d;p++)k[p]=(f[p]%256+256)%256;else if("string"===c)k.write(f, +0,p);else if("number"===c&&!b.TYPED_ARRAY_SUPPORT&&!a)for(p=0;p<d;p++)k[p]=0}return k}function e(f,p,b){var a="";for(b=Math.min(f.length,b);p<b;p++)a+=String.fromCharCode(f[p]);return a}function g(f,p,b){if(0!==f%1||0>f)throw new RangeError("offset is not uint");if(f+p>b)throw new RangeError("Trying to access beyond buffer length");}function h(f,p,a,c,d,k){if(!b.isBuffer(f))throw new TypeError("buffer must be a Buffer instance");if(p>d||p<k)throw new TypeError("value is out of bounds");if(a+c>f.length)throw new TypeError("index out of range"); +}function d(f,p,b,a){0>p&&(p=65535+p+1);for(var c=0,d=Math.min(f.length-b,2);c<d;c++)f[b+c]=(p&255<<8*(a?c:1-c))>>>8*(a?c:1-c)}function a(f,p,b,a){0>p&&(p=4294967295+p+1);for(var c=0,d=Math.min(f.length-b,4);c<d;c++)f[b+c]=p>>>8*(a?c:3-c)&255}function l(f,p,b,a,c,d){if(p>c||p<d)throw new TypeError("value is out of bounds");if(b+a>f.length)throw new TypeError("index out of range");}function r(f,p,b,a,c){c||l(f,p,b,4,3.4028234663852886E38,-3.4028234663852886E38);z.write(f,p,b,a,23,4);return b+4}function q(f, +p,b,a,c){c||l(f,p,b,8,1.7976931348623157E308,-1.7976931348623157E308);z.write(f,p,b,a,52,8);return b+8}function w(f){for(var p=[],b=0;b<f.length;b++){var a=f.charCodeAt(b);if(127>=a)p.push(a);else{var c=b;55296<=a&&57343>=a&&b++;a=encodeURIComponent(f.slice(c,b+1)).substr(1).split("%");for(c=0;c<a.length;c++)p.push(parseInt(a[c],16))}}return p}function v(f){for(var b=[],a=0;a<f.length;a++)b.push(f.charCodeAt(a)&255);return b}function c(f,b,a,c,d){d&&(c-=c%d);for(d=0;d<c&&!(d+a>=b.length||d>=f.length);d++)b[d+ +a]=f[d];return d}function k(f){try{return decodeURIComponent(f)}catch(p){return String.fromCharCode(65533)}}var x=n("base64-js"),z=n("ieee754"),F=n("is-array");m.Buffer=b;m.SlowBuffer=b;m.INSPECT_MAX_BYTES=50;b.poolSize=8192;var D=1073741823;b.TYPED_ARRAY_SUPPORT=function(){try{var f=new ArrayBuffer(0),b=new Uint8Array(f);b.foo=function(){return 42};return 42===b.foo()&&"function"===typeof b.subarray&&0===(new Uint8Array(1)).subarray(1,1).byteLength}catch(C){return!1}}();b.isBuffer=function(f){return!(null== +f||!f._isBuffer)};b.compare=function(f,a){if(!b.isBuffer(f)||!b.isBuffer(a))throw new TypeError("Arguments must be Buffers");for(var c=f.length,p=a.length,d=0,k=Math.min(c,p);d<k&&f[d]===a[d];d++);d!==k&&(c=f[d],p=a[d]);return c<p?-1:p<c?1:0};b.isEncoding=function(f){switch(String(f).toLowerCase()){case "hex":case "utf8":case "utf-8":case "ascii":case "binary":case "base64":case "raw":case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":return!0;default:return!1}};b.concat=function(f,a){if(!F(f))throw new TypeError("Usage: Buffer.concat(list[, length])"); +if(0===f.length)return new b(0);if(1===f.length)return f[0];var c;if(void 0===a)for(c=a=0;c<f.length;c++)a+=f[c].length;var p=new b(a),d=0;for(c=0;c<f.length;c++){var k=f[c];k.copy(p,d);d+=k.length}return p};b.byteLength=function(f,a){f+="";switch(a||"utf8"){case "ascii":case "binary":case "raw":var b=f.length;break;case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":b=2*f.length;break;case "hex":b=f.length>>>1;break;case "utf8":case "utf-8":b=w(f).length;break;case "base64":b=x.toByteArray(f).length; +break;default:b=f.length}return b};b.prototype.length=void 0;b.prototype.parent=void 0;b.prototype.toString=function(f,b,a){var c=!1;b>>>=0;a=void 0===a||Infinity===a?this.length:a>>>0;f||(f="utf8");0>b&&(b=0);a>this.length&&(a=this.length);if(a<=b)return"";for(;;)switch(f){case "hex":f=b;b=a;a=this.length;if(!f||0>f)f=0;if(!b||0>b||b>a)b=a;c="";for(a=f;a<b;a++)f=c,c=this[a],c=16>c?"0"+c.toString(16):c.toString(16),c=f+c;return c;case "utf8":case "utf-8":c=f="";for(a=Math.min(this.length,a);b<a;b++)127>= +this[b]?(f+=k(c)+String.fromCharCode(this[b]),c=""):c+="%"+this[b].toString(16);return f+k(c);case "ascii":return e(this,b,a);case "binary":return e(this,b,a);case "base64":return b=0===b&&a===this.length?x.fromByteArray(this):x.fromByteArray(this.slice(b,a)),b;case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":b=this.slice(b,a);a="";for(f=0;f<b.length;f+=2)a+=String.fromCharCode(b[f]+256*b[f+1]);return a;default:if(c)throw new TypeError("Unknown encoding: "+f);f=(f+"").toLowerCase();c=!0}}; +b.prototype.equals=function(f){if(!b.isBuffer(f))throw new TypeError("Argument must be a Buffer");return 0===b.compare(this,f)};b.prototype.inspect=function(){var f="",b=m.INSPECT_MAX_BYTES;0<this.length&&(f=this.toString("hex",0,b).match(/.{2}/g).join(" "),this.length>b&&(f+=" ... "));return"<Buffer "+f+">"};b.prototype.compare=function(f){if(!b.isBuffer(f))throw new TypeError("Argument must be a Buffer");return b.compare(this,f)};b.prototype.get=function(f){console.log(".get() is deprecated. Access using array indexes instead."); +return this.readUInt8(f)};b.prototype.set=function(f,b){console.log(".set() is deprecated. Access using array indexes instead.");return this.writeUInt8(f,b)};b.prototype.write=function(f,b,a,d){if(isFinite(b))isFinite(a)||(d=a,a=void 0);else{var p=d;d=b;b=a;a=p}b=Number(b)||0;p=this.length-b;a?(a=Number(a),a>p&&(a=p)):a=p;d=String(d||"utf8").toLowerCase();switch(d){case "hex":b=Number(b)||0;d=this.length-b;a?(a=Number(a),a>d&&(a=d)):a=d;d=f.length;if(0!==d%2)throw Error("Invalid hex string");a>d/ +2&&(a=d/2);for(d=0;d<a;d++){p=parseInt(f.substr(2*d,2),16);if(isNaN(p))throw Error("Invalid hex string");this[b+d]=p}f=d;break;case "utf8":case "utf-8":f=c(w(f),this,b,a);break;case "ascii":f=c(v(f),this,b,a);break;case "binary":f=c(v(f),this,b,a);break;case "base64":f=c(x.toByteArray(f),this,b,a);break;case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":p=[];for(var k=0;k<f.length;k++){var l=f.charCodeAt(k);d=l>>8;l%=256;p.push(l);p.push(d)}f=c(p,this,b,a,2);break;default:throw new TypeError("Unknown encoding: "+ +d);}return f};b.prototype.toJSON=function(){return{type:"Buffer",data:Array.prototype.slice.call(this._arr||this,0)}};b.prototype.slice=function(f,a){var c=this.length;f=~~f;a=void 0===a?c:~~a;0>f?(f+=c,0>f&&(f=0)):f>c&&(f=c);0>a?(a+=c,0>a&&(a=0)):a>c&&(a=c);a<f&&(a=f);if(b.TYPED_ARRAY_SUPPORT)return b._augment(this.subarray(f,a));c=a-f;for(var d=new b(c,void 0,!0),p=0;p<c;p++)d[p]=this[p+f];return d};b.prototype.readUInt8=function(f,a){a||g(f,1,this.length);return this[f]};b.prototype.readUInt16LE= +function(f,a){a||g(f,2,this.length);return this[f]|this[f+1]<<8};b.prototype.readUInt16BE=function(f,a){a||g(f,2,this.length);return this[f]<<8|this[f+1]};b.prototype.readUInt32LE=function(f,a){a||g(f,4,this.length);return(this[f]|this[f+1]<<8|this[f+2]<<16)+16777216*this[f+3]};b.prototype.readUInt32BE=function(f,a){a||g(f,4,this.length);return 16777216*this[f]+(this[f+1]<<16|this[f+2]<<8|this[f+3])};b.prototype.readInt8=function(f,a){a||g(f,1,this.length);return this[f]&128?-1*(255-this[f]+1):this[f]}; +b.prototype.readInt16LE=function(f,a){a||g(f,2,this.length);var b=this[f]|this[f+1]<<8;return b&32768?b|4294901760:b};b.prototype.readInt16BE=function(f,a){a||g(f,2,this.length);var b=this[f+1]|this[f]<<8;return b&32768?b|4294901760:b};b.prototype.readInt32LE=function(f,a){a||g(f,4,this.length);return this[f]|this[f+1]<<8|this[f+2]<<16|this[f+3]<<24};b.prototype.readInt32BE=function(a,b){b||g(a,4,this.length);return this[a]<<24|this[a+1]<<16|this[a+2]<<8|this[a+3]};b.prototype.readFloatLE=function(a, +b){b||g(a,4,this.length);return z.read(this,a,!0,23,4)};b.prototype.readFloatBE=function(a,b){b||g(a,4,this.length);return z.read(this,a,!1,23,4)};b.prototype.readDoubleLE=function(a,b){b||g(a,8,this.length);return z.read(this,a,!0,52,8)};b.prototype.readDoubleBE=function(a,b){b||g(a,8,this.length);return z.read(this,a,!1,52,8)};b.prototype.writeUInt8=function(a,c,d){a=+a;c>>>=0;d||h(this,a,c,1,255,0);b.TYPED_ARRAY_SUPPORT||(a=Math.floor(a));this[c]=a;return c+1};b.prototype.writeUInt16LE=function(a, +c,k){a=+a;c>>>=0;k||h(this,a,c,2,65535,0);b.TYPED_ARRAY_SUPPORT?(this[c]=a,this[c+1]=a>>>8):d(this,a,c,!0);return c+2};b.prototype.writeUInt16BE=function(a,c,k){a=+a;c>>>=0;k||h(this,a,c,2,65535,0);b.TYPED_ARRAY_SUPPORT?(this[c]=a>>>8,this[c+1]=a):d(this,a,c,!1);return c+2};b.prototype.writeUInt32LE=function(f,c,d){f=+f;c>>>=0;d||h(this,f,c,4,4294967295,0);b.TYPED_ARRAY_SUPPORT?(this[c+3]=f>>>24,this[c+2]=f>>>16,this[c+1]=f>>>8,this[c]=f):a(this,f,c,!0);return c+4};b.prototype.writeUInt32BE=function(f, +c,d){f=+f;c>>>=0;d||h(this,f,c,4,4294967295,0);b.TYPED_ARRAY_SUPPORT?(this[c]=f>>>24,this[c+1]=f>>>16,this[c+2]=f>>>8,this[c+3]=f):a(this,f,c,!1);return c+4};b.prototype.writeInt8=function(a,c,d){a=+a;c>>>=0;d||h(this,a,c,1,127,-128);b.TYPED_ARRAY_SUPPORT||(a=Math.floor(a));0>a&&(a=255+a+1);this[c]=a;return c+1};b.prototype.writeInt16LE=function(a,c,k){a=+a;c>>>=0;k||h(this,a,c,2,32767,-32768);b.TYPED_ARRAY_SUPPORT?(this[c]=a,this[c+1]=a>>>8):d(this,a,c,!0);return c+2};b.prototype.writeInt16BE=function(a, +c,k){a=+a;c>>>=0;k||h(this,a,c,2,32767,-32768);b.TYPED_ARRAY_SUPPORT?(this[c]=a>>>8,this[c+1]=a):d(this,a,c,!1);return c+2};b.prototype.writeInt32LE=function(c,d,k){c=+c;d>>>=0;k||h(this,c,d,4,2147483647,-2147483648);b.TYPED_ARRAY_SUPPORT?(this[d]=c,this[d+1]=c>>>8,this[d+2]=c>>>16,this[d+3]=c>>>24):a(this,c,d,!0);return d+4};b.prototype.writeInt32BE=function(c,d,k){c=+c;d>>>=0;k||h(this,c,d,4,2147483647,-2147483648);0>c&&(c=4294967295+c+1);b.TYPED_ARRAY_SUPPORT?(this[d]=c>>>24,this[d+1]=c>>>16,this[d+ +2]=c>>>8,this[d+3]=c):a(this,c,d,!1);return d+4};b.prototype.writeFloatLE=function(a,c,b){return r(this,a,c,!0,b)};b.prototype.writeFloatBE=function(a,c,b){return r(this,a,c,!1,b)};b.prototype.writeDoubleLE=function(a,c,b){return q(this,a,c,!0,b)};b.prototype.writeDoubleBE=function(a,c,b){return q(this,a,c,!1,b)};b.prototype.copy=function(a,c,d,k){d||(d=0);k||0===k||(k=this.length);c||(c=0);if(k!==d&&0!==a.length&&0!==this.length){if(k<d)throw new TypeError("sourceEnd < sourceStart");if(0>c||c>=a.length)throw new TypeError("targetStart out of bounds"); +if(0>d||d>=this.length)throw new TypeError("sourceStart out of bounds");if(0>k||k>this.length)throw new TypeError("sourceEnd out of bounds");k>this.length&&(k=this.length);a.length-c<k-d&&(k=a.length-c+d);k-=d;if(1E3>k||!b.TYPED_ARRAY_SUPPORT)for(var f=0;f<k;f++)a[f+c]=this[f+d];else a._set(this.subarray(d,d+k),c)}};b.prototype.fill=function(a,c,b){a||(a=0);c||(c=0);b||(b=this.length);if(b<c)throw new TypeError("end < start");if(b!==c&&0!==this.length){if(0>c||c>=this.length)throw new TypeError("start out of bounds"); +if(0>b||b>this.length)throw new TypeError("end out of bounds");if("number"===typeof a)for(;c<b;c++)this[c]=a;else{a=w(a.toString());for(var d=a.length;c<b;c++)this[c]=a[c%d]}return this}};b.prototype.toArrayBuffer=function(){if("undefined"!==typeof Uint8Array){if(b.TYPED_ARRAY_SUPPORT)return(new b(this)).buffer;for(var a=new Uint8Array(this.length),c=0,d=a.length;c<d;c+=1)a[c]=this[c];return a.buffer}throw new TypeError("Buffer.toArrayBuffer not supported in this browser");};var t=b.prototype;b._augment= +function(a){a.constructor=b;a._isBuffer=!0;a._get=a.get;a._set=a.set;a.get=t.get;a.set=t.set;a.write=t.write;a.toString=t.toString;a.toLocaleString=t.toString;a.toJSON=t.toJSON;a.equals=t.equals;a.compare=t.compare;a.copy=t.copy;a.slice=t.slice;a.readUInt8=t.readUInt8;a.readUInt16LE=t.readUInt16LE;a.readUInt16BE=t.readUInt16BE;a.readUInt32LE=t.readUInt32LE;a.readUInt32BE=t.readUInt32BE;a.readInt8=t.readInt8;a.readInt16LE=t.readInt16LE;a.readInt16BE=t.readInt16BE;a.readInt32LE=t.readInt32LE;a.readInt32BE= +t.readInt32BE;a.readFloatLE=t.readFloatLE;a.readFloatBE=t.readFloatBE;a.readDoubleLE=t.readDoubleLE;a.readDoubleBE=t.readDoubleBE;a.writeUInt8=t.writeUInt8;a.writeUInt16LE=t.writeUInt16LE;a.writeUInt16BE=t.writeUInt16BE;a.writeUInt32LE=t.writeUInt32LE;a.writeUInt32BE=t.writeUInt32BE;a.writeInt8=t.writeInt8;a.writeInt16LE=t.writeInt16LE;a.writeInt16BE=t.writeInt16BE;a.writeInt32LE=t.writeInt32LE;a.writeInt32BE=t.writeInt32BE;a.writeFloatLE=t.writeFloatLE;a.writeFloatBE=t.writeFloatBE;a.writeDoubleLE= +t.writeDoubleLE;a.writeDoubleBE=t.writeDoubleBE;a.fill=t.fill;a.inspect=t.inspect;a.toArrayBuffer=t.toArrayBuffer;return a};var H=/[^+\/0-9A-z]/g},{"base64-js":2,ieee754:6,"is-array":7}],6:[function(n,u,m){m.read=function(b,e,g,h,d){var a=8*d-h-1;var l=(1<<a)-1,r=l>>1,q=-7;d=g?d-1:0;var w=g?-1:1,v=b[e+d];d+=w;g=v&(1<<-q)-1;v>>=-q;for(q+=a;0<q;g=256*g+b[e+d],d+=w,q-=8);a=g&(1<<-q)-1;g>>=-q;for(q+=h;0<q;a=256*a+b[e+d],d+=w,q-=8);if(0===g)g=1-r;else{if(g===l)return a?NaN:Infinity*(v?-1:1);a+=Math.pow(2, +h);g-=r}return(v?-1:1)*a*Math.pow(2,g-h)};m.write=function(b,e,g,h,d,a){var l,r=8*a-d-1,q=(1<<r)-1,w=q>>1,v=23===d?Math.pow(2,-24)-Math.pow(2,-77):0;a=h?0:a-1;var c=h?1:-1,k=0>e||0===e&&0>1/e?1:0;e=Math.abs(e);isNaN(e)||Infinity===e?(e=isNaN(e)?1:0,h=q):(h=Math.floor(Math.log(e)/Math.LN2),1>e*(l=Math.pow(2,-h))&&(h--,l*=2),e=1<=h+w?e+v/l:e+v*Math.pow(2,1-w),2<=e*l&&(h++,l/=2),h+w>=q?(e=0,h=q):1<=h+w?(e=(e*l-1)*Math.pow(2,d),h+=w):(e=e*Math.pow(2,w-1)*Math.pow(2,d),h=0));for(;8<=d;b[g+a]=e&255,a+= +c,e/=256,d-=8);h=h<<d|e;for(r+=d;0<r;b[g+a]=h&255,a+=c,h/=256,r-=8);b[g+a-c]|=128*k}},{}],7:[function(n,u,m){var b=Object.prototype.toString;u.exports=Array.isArray||function(e){return!!e&&"[object Array]"==b.call(e)}},{}],8:[function(n,u,m){(function(b){function e(a,b){for(var d=0,l=a.length-1;0<=l;l--){var w=a[l];"."===w?a.splice(l,1):".."===w?(a.splice(l,1),d++):d&&(a.splice(l,1),d--)}if(b)for(;d--;d)a.unshift("..");return a}function g(a,b){if(a.filter)return a.filter(b);for(var d=[],l=0;l<a.length;l++)b(a[l], +l,a)&&d.push(a[l]);return d}var h=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;m.resolve=function(){for(var a="",d=!1,h=arguments.length-1;-1<=h&&!d;h--){var q=0<=h?arguments[h]:b.cwd();if("string"!==typeof q)throw new TypeError("Arguments to path.resolve must be strings");q&&(a=q+"/"+a,d="/"===q.charAt(0))}a=e(g(a.split("/"),function(a){return!!a}),!d).join("/");return(d?"/":"")+a||"."};m.normalize=function(a){var b=m.isAbsolute(a),h="/"===d(a,-1);(a=e(g(a.split("/"),function(a){return!!a}), +!b).join("/"))||b||(a=".");a&&h&&(a+="/");return(b?"/":"")+a};m.isAbsolute=function(a){return"/"===a.charAt(0)};m.join=function(){var a=Array.prototype.slice.call(arguments,0);return m.normalize(g(a,function(a,b){if("string"!==typeof a)throw new TypeError("Arguments to path.join must be strings");return a}).join("/"))};m.relative=function(a,b){function d(a){for(var c=0;c<a.length&&""===a[c];c++);for(var b=a.length-1;0<=b&&""===a[b];b--);return c>b?[]:a.slice(c,b-c+1)}a=m.resolve(a).substr(1);b=m.resolve(b).substr(1); +for(var l=d(a.split("/")),w=d(b.split("/")),e=Math.min(l.length,w.length),c=e,k=0;k<e;k++)if(l[k]!==w[k]){c=k;break}e=[];for(k=c;k<l.length;k++)e.push("..");e=e.concat(w.slice(c));return e.join("/")};m.sep="/";m.delimiter=":";m.dirname=function(a){var b=h.exec(a).slice(1);a=b[0];b=b[1];if(!a&&!b)return".";b&&(b=b.substr(0,b.length-1));return a+b};m.basename=function(a,b){var d=h.exec(a).slice(1)[2];b&&d.substr(-1*b.length)===b&&(d=d.substr(0,d.length-b.length));return d};m.extname=function(a){return h.exec(a).slice(1)[3]}; +var d="b"==="ab".substr(-1)?function(a,b,d){return a.substr(b,d)}:function(a,b,d){0>b&&(b=a.length+b);return a.substr(b,d)}}).call(this,n("g5I+bs"))},{"g5I+bs":9}],9:[function(n,u,m){function b(){}n=u.exports={};n.nextTick=function(){if("undefined"!==typeof window&&window.setImmediate)return function(b){return window.setImmediate(b)};if("undefined"!==typeof window&&window.postMessage&&window.addEventListener){var b=[];window.addEventListener("message",function(e){var g=e.source;g!==window&&null!== +g||"process-tick"!==e.data||(e.stopPropagation(),0<b.length&&b.shift()())},!0);return function(e){b.push(e);window.postMessage("process-tick","*")}}return function(b){setTimeout(b,0)}}();n.title="browser";n.browser=!0;n.env={};n.argv=[];n.on=b;n.addListener=b;n.once=b;n.off=b;n.removeListener=b;n.removeAllListeners=b;n.emit=b;n.binding=function(b){throw Error("process.binding is not supported");};n.cwd=function(){return"/"};n.chdir=function(b){throw Error("process.chdir is not supported");}},{}], +10:[function(n,u,m){function b(){this._array=[];this._set=h?new Map:Object.create(null)}var e=n("./util"),g=Object.prototype.hasOwnProperty,h="undefined"!==typeof Map;b.fromArray=function(d,a){for(var e=new b,g=0,h=d.length;g<h;g++)e.add(d[g],a);return e};b.prototype.size=function(){return h?this._set.size:Object.getOwnPropertyNames(this._set).length};b.prototype.add=function(b,a){var d=h?b:e.toSetString(b),r=h?this.has(b):g.call(this._set,d),q=this._array.length;r&&!a||this._array.push(b);r||(h? +this._set.set(b,q):this._set[d]=q)};b.prototype.has=function(b){if(h)return this._set.has(b);b=e.toSetString(b);return g.call(this._set,b)};b.prototype.indexOf=function(b){if(h){var a=this._set.get(b);if(0<=a)return a}else if(a=e.toSetString(b),g.call(this._set,a))return this._set[a];throw Error('"'+b+'" is not in the set.');};b.prototype.at=function(b){if(0<=b&&b<this._array.length)return this._array[b];throw Error("No element indexed by "+b);};b.prototype.toArray=function(){return this._array.slice()}; +m.ArraySet=b},{"./util":19}],11:[function(n,u,m){var b=n("./base64");m.encode=function(e){var g="",h=0>e?(-e<<1)+1:e<<1;do e=h&31,h>>>=5,0<h&&(e|=32),g+=b.encode(e);while(0<h);return g};m.decode=function(e,g,h){var d=e.length,a=0,l=0;do{if(g>=d)throw Error("Expected more digits in base 64 VLQ value.");var r=b.decode(e.charCodeAt(g++));if(-1===r)throw Error("Invalid base64 digit: "+e.charAt(g-1));var q=!!(r&32);r&=31;a+=r<<l;l+=5}while(q);e=a>>1;h.value=1===(a&1)?-e:e;h.rest=g}},{"./base64":12}],12:[function(n, +u,m){var b="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".split("");m.encode=function(e){if(0<=e&&e<b.length)return b[e];throw new TypeError("Must be between 0 and 63: "+e);};m.decode=function(b){return 65<=b&&90>=b?b-65:97<=b&&122>=b?b-97+26:48<=b&&57>=b?b-48+52:43==b?62:47==b?63:-1}},{}],13:[function(n,u,m){function b(e,g,h,d,a,l){var r=Math.floor((g-e)/2)+e,q=a(h,d[r],!0);return 0===q?r:0<q?1<g-r?b(r,g,h,d,a,l):l==m.LEAST_UPPER_BOUND?g<d.length?g:-1:r:1<r-e?b(e,r,h,d,a,l):l== +m.LEAST_UPPER_BOUND?r:0>e?-1:e}m.GREATEST_LOWER_BOUND=1;m.LEAST_UPPER_BOUND=2;m.search=function(e,g,h,d){if(0===g.length)return-1;e=b(-1,g.length,e,g,h,d||m.GREATEST_LOWER_BOUND);if(0>e)return-1;for(;0<=e-1&&0===h(g[e],g[e-1],!0);)--e;return e}},{}],14:[function(n,u,m){function b(){this._array=[];this._sorted=!0;this._last={generatedLine:-1,generatedColumn:0}}var e=n("./util");b.prototype.unsortedForEach=function(b,e){this._array.forEach(b,e)};b.prototype.add=function(b){var g=this._last,d=g.generatedLine, +a=b.generatedLine,l=g.generatedColumn,r=b.generatedColumn;a>d||a==d&&r>=l||0>=e.compareByGeneratedPositionsInflated(g,b)?this._last=b:this._sorted=!1;this._array.push(b)};b.prototype.toArray=function(){this._sorted||(this._array.sort(e.compareByGeneratedPositionsInflated),this._sorted=!0);return this._array};m.MappingList=b},{"./util":19}],15:[function(n,u,m){function b(b,e,d){var a=b[e];b[e]=b[d];b[d]=a}function e(g,h,d,a){if(d<a){var l=d-1;b(g,Math.round(d+Math.random()*(a-d)),a);for(var r=g[a], +q=d;q<a;q++)0>=h(g[q],r)&&(l+=1,b(g,l,q));b(g,l+1,q);l+=1;e(g,h,d,l-1);e(g,h,l+1,a)}}m.quickSort=function(b,h){e(b,h,0,b.length-1)}},{}],16:[function(n,u,m){function b(a,b){var c=a;"string"===typeof a&&(c=d.parseSourceMapInput(a));return null!=c.sections?new h(c,b):new e(c,b)}function e(a,b){var c=a;"string"===typeof a&&(c=d.parseSourceMapInput(a));var k=d.getArg(c,"version"),e=d.getArg(c,"sources"),w=d.getArg(c,"names",[]),g=d.getArg(c,"sourceRoot",null),h=d.getArg(c,"sourcesContent",null),q=d.getArg(c, +"mappings");c=d.getArg(c,"file",null);if(k!=this._version)throw Error("Unsupported version: "+k);g&&(g=d.normalize(g));e=e.map(String).map(d.normalize).map(function(a){return g&&d.isAbsolute(g)&&d.isAbsolute(a)?d.relative(g,a):a});this._names=l.fromArray(w.map(String),!0);this._sources=l.fromArray(e,!0);this.sourceRoot=g;this.sourcesContent=h;this._mappings=q;this._sourceMapURL=b;this.file=c}function g(){this.generatedColumn=this.generatedLine=0;this.name=this.originalColumn=this.originalLine=this.source= +null}function h(a,e){var c=a;"string"===typeof a&&(c=d.parseSourceMapInput(a));var k=d.getArg(c,"version");c=d.getArg(c,"sections");if(k!=this._version)throw Error("Unsupported version: "+k);this._sources=new l;this._names=new l;var w={line:-1,column:0};this._sections=c.map(function(a){if(a.url)throw Error("Support for url field in sections not implemented.");var c=d.getArg(a,"offset"),k=d.getArg(c,"line"),g=d.getArg(c,"column");if(k<w.line||k===w.line&&g<w.column)throw Error("Section offsets must be ordered and non-overlapping."); +w=c;return{generatedOffset:{generatedLine:k+1,generatedColumn:g+1},consumer:new b(d.getArg(a,"map"),e)}})}var d=n("./util"),a=n("./binary-search"),l=n("./array-set").ArraySet,r=n("./base64-vlq"),q=n("./quick-sort").quickSort;b.fromSourceMap=function(a){return e.fromSourceMap(a)};b.prototype._version=3;b.prototype.__generatedMappings=null;Object.defineProperty(b.prototype,"_generatedMappings",{configurable:!0,enumerable:!0,get:function(){this.__generatedMappings||this._parseMappings(this._mappings, +this.sourceRoot);return this.__generatedMappings}});b.prototype.__originalMappings=null;Object.defineProperty(b.prototype,"_originalMappings",{configurable:!0,enumerable:!0,get:function(){this.__originalMappings||this._parseMappings(this._mappings,this.sourceRoot);return this.__originalMappings}});b.prototype._charIsMappingSeparator=function(a,b){var c=a.charAt(b);return";"===c||","===c};b.prototype._parseMappings=function(a,b){throw Error("Subclasses must implement _parseMappings");};b.GENERATED_ORDER= +1;b.ORIGINAL_ORDER=2;b.GREATEST_LOWER_BOUND=1;b.LEAST_UPPER_BOUND=2;b.prototype.eachMapping=function(a,e,c){e=e||null;switch(c||b.GENERATED_ORDER){case b.GENERATED_ORDER:c=this._generatedMappings;break;case b.ORIGINAL_ORDER:c=this._originalMappings;break;default:throw Error("Unknown order of iteration.");}var k=this.sourceRoot;c.map(function(a){var b=null===a.source?null:this._sources.at(a.source);b=d.computeSourceURL(k,b,this._sourceMapURL);return{source:b,generatedLine:a.generatedLine,generatedColumn:a.generatedColumn, +originalLine:a.originalLine,originalColumn:a.originalColumn,name:null===a.name?null:this._names.at(a.name)}},this).forEach(a,e)};b.prototype.allGeneratedPositionsFor=function(b){var e=d.getArg(b,"line"),c={source:d.getArg(b,"source"),originalLine:e,originalColumn:d.getArg(b,"column",0)};null!=this.sourceRoot&&(c.source=d.relative(this.sourceRoot,c.source));if(!this._sources.has(c.source))return[];c.source=this._sources.indexOf(c.source);var k=[];c=this._findMapping(c,this._originalMappings,"originalLine", +"originalColumn",d.compareByOriginalPositions,a.LEAST_UPPER_BOUND);if(0<=c){var g=this._originalMappings[c];if(void 0===b.column)for(e=g.originalLine;g&&g.originalLine===e;)k.push({line:d.getArg(g,"generatedLine",null),column:d.getArg(g,"generatedColumn",null),lastColumn:d.getArg(g,"lastGeneratedColumn",null)}),g=this._originalMappings[++c];else for(b=g.originalColumn;g&&g.originalLine===e&&g.originalColumn==b;)k.push({line:d.getArg(g,"generatedLine",null),column:d.getArg(g,"generatedColumn",null), +lastColumn:d.getArg(g,"lastGeneratedColumn",null)}),g=this._originalMappings[++c]}return k};m.SourceMapConsumer=b;e.prototype=Object.create(b.prototype);e.prototype.consumer=b;e.fromSourceMap=function(a,b){var c=Object.create(e.prototype),k=c._names=l.fromArray(a._names.toArray(),!0),w=c._sources=l.fromArray(a._sources.toArray(),!0);c.sourceRoot=a._sourceRoot;c.sourcesContent=a._generateSourcesContent(c._sources.toArray(),c.sourceRoot);c.file=a._file;c._sourceMapURL=b;for(var h=a._mappings.toArray().slice(), +r=c.__generatedMappings=[],m=c.__originalMappings=[],v=0,n=h.length;v<n;v++){var f=h[v],p=new g;p.generatedLine=f.generatedLine;p.generatedColumn=f.generatedColumn;f.source&&(p.source=w.indexOf(f.source),p.originalLine=f.originalLine,p.originalColumn=f.originalColumn,f.name&&(p.name=k.indexOf(f.name)),m.push(p));r.push(p)}q(c.__originalMappings,d.compareByOriginalPositions);return c};e.prototype._version=3;Object.defineProperty(e.prototype,"sources",{get:function(){return this._sources.toArray().map(function(a){return d.computeSourceURL(this.sourceRoot, +a,this._sourceMapURL)},this)}});e.prototype._parseMappings=function(a,b){for(var c=1,k=0,e=0,l=0,w=0,h=0,m=a.length,v=0,f={},p={},n=[],u=[],y,B,A,E,I;v<m;)if(";"===a.charAt(v))c++,v++,k=0;else if(","===a.charAt(v))v++;else{y=new g;y.generatedLine=c;for(E=v;E<m&&!this._charIsMappingSeparator(a,E);E++);B=a.slice(v,E);if(A=f[B])v+=B.length;else{for(A=[];v<E;)r.decode(a,v,p),I=p.value,v=p.rest,A.push(I);if(2===A.length)throw Error("Found a source, but no line and column");if(3===A.length)throw Error("Found a source and line, but no column"); +f[B]=A}y.generatedColumn=k+A[0];k=y.generatedColumn;1<A.length&&(y.source=w+A[1],w+=A[1],y.originalLine=e+A[2],e=y.originalLine,y.originalLine+=1,y.originalColumn=l+A[3],l=y.originalColumn,4<A.length&&(y.name=h+A[4],h+=A[4]));u.push(y);"number"===typeof y.originalLine&&n.push(y)}q(u,d.compareByGeneratedPositionsDeflated);this.__generatedMappings=u;q(n,d.compareByOriginalPositions);this.__originalMappings=n};e.prototype._findMapping=function(b,d,c,k,e,g){if(0>=b[c])throw new TypeError("Line must be greater than or equal to 1, got "+ +b[c]);if(0>b[k])throw new TypeError("Column must be greater than or equal to 0, got "+b[k]);return a.search(b,d,e,g)};e.prototype.computeColumnSpans=function(){for(var a=0;a<this._generatedMappings.length;++a){var b=this._generatedMappings[a];if(a+1<this._generatedMappings.length){var c=this._generatedMappings[a+1];if(b.generatedLine===c.generatedLine){b.lastGeneratedColumn=c.generatedColumn-1;continue}}b.lastGeneratedColumn=Infinity}};e.prototype.originalPositionFor=function(a){var e={generatedLine:d.getArg(a, +"line"),generatedColumn:d.getArg(a,"column")};a=this._findMapping(e,this._generatedMappings,"generatedLine","generatedColumn",d.compareByGeneratedPositionsDeflated,d.getArg(a,"bias",b.GREATEST_LOWER_BOUND));if(0<=a&&(a=this._generatedMappings[a],a.generatedLine===e.generatedLine)){e=d.getArg(a,"source",null);null!==e&&(e=this._sources.at(e),e=d.computeSourceURL(this.sourceRoot,e,this._sourceMapURL));var c=d.getArg(a,"name",null);null!==c&&(c=this._names.at(c));return{source:e,line:d.getArg(a,"originalLine", +null),column:d.getArg(a,"originalColumn",null),name:c}}return{source:null,line:null,column:null,name:null}};e.prototype.hasContentsOfAllSources=function(){return this.sourcesContent?this.sourcesContent.length>=this._sources.size()&&!this.sourcesContent.some(function(a){return null==a}):!1};e.prototype.sourceContentFor=function(a,b){if(!this.sourcesContent)return null;var c=a;null!=this.sourceRoot&&(c=d.relative(this.sourceRoot,c));if(this._sources.has(c))return this.sourcesContent[this._sources.indexOf(c)]; +var k=this.sources,e;for(e=0;e<k.length;++e)if(k[e]==a)return this.sourcesContent[e];var g;if(null!=this.sourceRoot&&(g=d.urlParse(this.sourceRoot))){k=c.replace(/^file:\/\//,"");if("file"==g.scheme&&this._sources.has(k))return this.sourcesContent[this._sources.indexOf(k)];if((!g.path||"/"==g.path)&&this._sources.has("/"+c))return this.sourcesContent[this._sources.indexOf("/"+c)]}if(b)return null;throw Error('"'+c+'" is not in the SourceMap.');};e.prototype.generatedPositionFor=function(a){var e= +d.getArg(a,"source");null!=this.sourceRoot&&(e=d.relative(this.sourceRoot,e));if(!this._sources.has(e))return{line:null,column:null,lastColumn:null};e=this._sources.indexOf(e);e={source:e,originalLine:d.getArg(a,"line"),originalColumn:d.getArg(a,"column")};a=this._findMapping(e,this._originalMappings,"originalLine","originalColumn",d.compareByOriginalPositions,d.getArg(a,"bias",b.GREATEST_LOWER_BOUND));return 0<=a&&(a=this._originalMappings[a],a.source===e.source)?{line:d.getArg(a,"generatedLine", +null),column:d.getArg(a,"generatedColumn",null),lastColumn:d.getArg(a,"lastGeneratedColumn",null)}:{line:null,column:null,lastColumn:null}};m.BasicSourceMapConsumer=e;h.prototype=Object.create(b.prototype);h.prototype.constructor=b;h.prototype._version=3;Object.defineProperty(h.prototype,"sources",{get:function(){for(var a=[],b=0;b<this._sections.length;b++)for(var c=0;c<this._sections[b].consumer.sources.length;c++)a.push(this._sections[b].consumer.sources[c]);return a}});h.prototype.originalPositionFor= +function(b){var e={generatedLine:d.getArg(b,"line"),generatedColumn:d.getArg(b,"column")},c=a.search(e,this._sections,function(a,b){var c=a.generatedLine-b.generatedOffset.generatedLine;return c?c:a.generatedColumn-b.generatedOffset.generatedColumn});return(c=this._sections[c])?c.consumer.originalPositionFor({line:e.generatedLine-(c.generatedOffset.generatedLine-1),column:e.generatedColumn-(c.generatedOffset.generatedLine===e.generatedLine?c.generatedOffset.generatedColumn-1:0),bias:b.bias}):{source:null, +line:null,column:null,name:null}};h.prototype.hasContentsOfAllSources=function(){return this._sections.every(function(a){return a.consumer.hasContentsOfAllSources()})};h.prototype.sourceContentFor=function(a,b){for(var c=0;c<this._sections.length;c++){var d=this._sections[c].consumer.sourceContentFor(a,!0);if(d)return d}if(b)return null;throw Error('"'+a+'" is not in the SourceMap.');};h.prototype.generatedPositionFor=function(a){for(var b=0;b<this._sections.length;b++){var c=this._sections[b];if(-1!== +c.consumer.sources.indexOf(d.getArg(a,"source"))){var k=c.consumer.generatedPositionFor(a);if(k)return{line:k.line+(c.generatedOffset.generatedLine-1),column:k.column+(c.generatedOffset.generatedLine===k.line?c.generatedOffset.generatedColumn-1:0)}}}return{line:null,column:null}};h.prototype._parseMappings=function(a,b){this.__generatedMappings=[];this.__originalMappings=[];for(var c=0;c<this._sections.length;c++)for(var k=this._sections[c],e=k.consumer._generatedMappings,g=0;g<e.length;g++){var l= +e[g],h=k.consumer._sources.at(l.source);h=d.computeSourceURL(k.consumer.sourceRoot,h,this._sourceMapURL);this._sources.add(h);h=this._sources.indexOf(h);var r=null;l.name&&(r=k.consumer._names.at(l.name),this._names.add(r),r=this._names.indexOf(r));l={source:h,generatedLine:l.generatedLine+(k.generatedOffset.generatedLine-1),generatedColumn:l.generatedColumn+(k.generatedOffset.generatedLine===l.generatedLine?k.generatedOffset.generatedColumn-1:0),originalLine:l.originalLine,originalColumn:l.originalColumn, +name:r};this.__generatedMappings.push(l);"number"===typeof l.originalLine&&this.__originalMappings.push(l)}q(this.__generatedMappings,d.compareByGeneratedPositionsDeflated);q(this.__originalMappings,d.compareByOriginalPositions)};m.IndexedSourceMapConsumer=h},{"./array-set":10,"./base64-vlq":11,"./binary-search":13,"./quick-sort":15,"./util":19}],17:[function(n,u,m){function b(a){a||(a={});this._file=g.getArg(a,"file",null);this._sourceRoot=g.getArg(a,"sourceRoot",null);this._skipValidation=g.getArg(a, +"skipValidation",!1);this._sources=new h;this._names=new h;this._mappings=new d;this._sourcesContents=null}var e=n("./base64-vlq"),g=n("./util"),h=n("./array-set").ArraySet,d=n("./mapping-list").MappingList;b.prototype._version=3;b.fromSourceMap=function(a){var d=a.sourceRoot,e=new b({file:a.file,sourceRoot:d});a.eachMapping(function(a){var b={generated:{line:a.generatedLine,column:a.generatedColumn}};null!=a.source&&(b.source=a.source,null!=d&&(b.source=g.relative(d,b.source)),b.original={line:a.originalLine, +column:a.originalColumn},null!=a.name&&(b.name=a.name));e.addMapping(b)});a.sources.forEach(function(b){var l=b;null!==d&&(l=g.relative(d,b));e._sources.has(l)||e._sources.add(l);l=a.sourceContentFor(b);null!=l&&e.setSourceContent(b,l)});return e};b.prototype.addMapping=function(a){var b=g.getArg(a,"generated"),d=g.getArg(a,"original",null),e=g.getArg(a,"source",null);a=g.getArg(a,"name",null);this._skipValidation||this._validateMapping(b,d,e,a);null!=e&&(e=String(e),this._sources.has(e)||this._sources.add(e)); +null!=a&&(a=String(a),this._names.has(a)||this._names.add(a));this._mappings.add({generatedLine:b.line,generatedColumn:b.column,originalLine:null!=d&&d.line,originalColumn:null!=d&&d.column,source:e,name:a})};b.prototype.setSourceContent=function(a,b){var d=a;null!=this._sourceRoot&&(d=g.relative(this._sourceRoot,d));null!=b?(this._sourcesContents||(this._sourcesContents=Object.create(null)),this._sourcesContents[g.toSetString(d)]=b):this._sourcesContents&&(delete this._sourcesContents[g.toSetString(d)], +0===Object.keys(this._sourcesContents).length&&(this._sourcesContents=null))};b.prototype.applySourceMap=function(a,b,d){var e=b;if(null==b){if(null==a.file)throw Error('SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, or the source map\'s "file" property. Both were omitted.');e=a.file}var l=this._sourceRoot;null!=l&&(e=g.relative(l,e));var m=new h,c=new h;this._mappings.unsortedForEach(function(b){if(b.source===e&&null!=b.originalLine){var k=a.originalPositionFor({line:b.originalLine, +column:b.originalColumn});null!=k.source&&(b.source=k.source,null!=d&&(b.source=g.join(d,b.source)),null!=l&&(b.source=g.relative(l,b.source)),b.originalLine=k.line,b.originalColumn=k.column,null!=k.name&&(b.name=k.name))}k=b.source;null==k||m.has(k)||m.add(k);b=b.name;null==b||c.has(b)||c.add(b)},this);this._sources=m;this._names=c;a.sources.forEach(function(b){var c=a.sourceContentFor(b);null!=c&&(null!=d&&(b=g.join(d,b)),null!=l&&(b=g.relative(l,b)),this.setSourceContent(b,c))},this)};b.prototype._validateMapping= +function(a,b,d,e){if(b&&"number"!==typeof b.line&&"number"!==typeof b.column)throw Error("original.line and original.column are not numbers -- you probably meant to omit the original mapping entirely and only map the generated position. If so, pass null for the original mapping instead of an object with empty or null values.");if(!(a&&"line"in a&&"column"in a&&0<a.line&&0<=a.column&&!b&&!d&&!e||a&&"line"in a&&"column"in a&&b&&"line"in b&&"column"in b&&0<a.line&&0<=a.column&&0<b.line&&0<=b.column&& +d))throw Error("Invalid mapping: "+JSON.stringify({generated:a,source:d,original:b,name:e}));};b.prototype._serializeMappings=function(){for(var a=0,b=1,d=0,h=0,m=0,n=0,c="",k,x,z,F=this._mappings.toArray(),D=0,t=F.length;D<t;D++){x=F[D];k="";if(x.generatedLine!==b)for(a=0;x.generatedLine!==b;)k+=";",b++;else if(0<D){if(!g.compareByGeneratedPositionsInflated(x,F[D-1]))continue;k+=","}k+=e.encode(x.generatedColumn-a);a=x.generatedColumn;null!=x.source&&(z=this._sources.indexOf(x.source),k+=e.encode(z- +n),n=z,k+=e.encode(x.originalLine-1-h),h=x.originalLine-1,k+=e.encode(x.originalColumn-d),d=x.originalColumn,null!=x.name&&(x=this._names.indexOf(x.name),k+=e.encode(x-m),m=x));c+=k}return c};b.prototype._generateSourcesContent=function(a,b){return a.map(function(a){if(!this._sourcesContents)return null;null!=b&&(a=g.relative(b,a));a=g.toSetString(a);return Object.prototype.hasOwnProperty.call(this._sourcesContents,a)?this._sourcesContents[a]:null},this)};b.prototype.toJSON=function(){var a={version:this._version, +sources:this._sources.toArray(),names:this._names.toArray(),mappings:this._serializeMappings()};null!=this._file&&(a.file=this._file);null!=this._sourceRoot&&(a.sourceRoot=this._sourceRoot);this._sourcesContents&&(a.sourcesContent=this._generateSourcesContent(a.sources,a.sourceRoot));return a};b.prototype.toString=function(){return JSON.stringify(this.toJSON())};m.SourceMapGenerator=b},{"./array-set":10,"./base64-vlq":11,"./mapping-list":14,"./util":19}],18:[function(n,u,m){function b(b,a,e,g,h){this.children= +[];this.sourceContents={};this.line=null==b?null:b;this.column=null==a?null:a;this.source=null==e?null:e;this.name=null==h?null:h;this.$$$isSourceNode$$$=!0;null!=g&&this.add(g)}var e=n("./source-map-generator").SourceMapGenerator,g=n("./util"),h=/(\r?\n)/;b.fromStringWithSourceMap=function(d,a,e){function l(a,c){if(null===a||void 0===a.source)m.add(c);else{var d=e?g.join(e,a.source):a.source;m.add(new b(a.originalLine,a.originalColumn,d,c,a.name))}}var m=new b,n=d.split(h),v=0,c=function(){var a= +v<n.length?n[v++]:void 0,b=(v<n.length?n[v++]:void 0)||"";return a+b},k=1,x=0,z=null;a.eachMapping(function(a){if(null!==z)if(k<a.generatedLine)l(z,c()),k++,x=0;else{var b=n[v]||"",d=b.substr(0,a.generatedColumn-x);n[v]=b.substr(a.generatedColumn-x);x=a.generatedColumn;l(z,d);z=a;return}for(;k<a.generatedLine;)m.add(c()),k++;x<a.generatedColumn&&(b=n[v]||"",m.add(b.substr(0,a.generatedColumn)),n[v]=b.substr(a.generatedColumn),x=a.generatedColumn);z=a},this);v<n.length&&(z&&l(z,c()),m.add(n.splice(v).join(""))); +a.sources.forEach(function(b){var c=a.sourceContentFor(b);null!=c&&(null!=e&&(b=g.join(e,b)),m.setSourceContent(b,c))});return m};b.prototype.add=function(b){if(Array.isArray(b))b.forEach(function(a){this.add(a)},this);else if(b.$$$isSourceNode$$$||"string"===typeof b)b&&this.children.push(b);else throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+b);return this};b.prototype.prepend=function(b){if(Array.isArray(b))for(var a=b.length-1;0<=a;a--)this.prepend(b[a]); +else if(b.$$$isSourceNode$$$||"string"===typeof b)this.children.unshift(b);else throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+b);return this};b.prototype.walk=function(b){for(var a,d=0,e=this.children.length;d<e;d++)a=this.children[d],a.$$$isSourceNode$$$?a.walk(b):""!==a&&b(a,{source:this.source,line:this.line,column:this.column,name:this.name})};b.prototype.join=function(b){var a,d=this.children.length;if(0<d){var e=[];for(a=0;a<d-1;a++)e.push(this.children[a]), +e.push(b);e.push(this.children[a]);this.children=e}return this};b.prototype.replaceRight=function(b,a){var d=this.children[this.children.length-1];d.$$$isSourceNode$$$?d.replaceRight(b,a):"string"===typeof d?this.children[this.children.length-1]=d.replace(b,a):this.children.push("".replace(b,a));return this};b.prototype.setSourceContent=function(b,a){this.sourceContents[g.toSetString(b)]=a};b.prototype.walkSourceContents=function(b){for(var a=0,d=this.children.length;a<d;a++)this.children[a].$$$isSourceNode$$$&& +this.children[a].walkSourceContents(b);var e=Object.keys(this.sourceContents);a=0;for(d=e.length;a<d;a++)b(g.fromSetString(e[a]),this.sourceContents[e[a]])};b.prototype.toString=function(){var b="";this.walk(function(a){b+=a});return b};b.prototype.toStringWithSourceMap=function(b){var a="",d=1,g=0,h=new e(b),m=!1,n=null,c=null,k=null,x=null;this.walk(function(b,e){a+=b;null!==e.source&&null!==e.line&&null!==e.column?(n===e.source&&c===e.line&&k===e.column&&x===e.name||h.addMapping({source:e.source, +original:{line:e.line,column:e.column},generated:{line:d,column:g},name:e.name}),n=e.source,c=e.line,k=e.column,x=e.name,m=!0):m&&(h.addMapping({generated:{line:d,column:g}}),n=null,m=!1);for(var l=0,z=b.length;l<z;l++)10===b.charCodeAt(l)?(d++,g=0,l+1===z?(n=null,m=!1):m&&h.addMapping({source:e.source,original:{line:e.line,column:e.column},generated:{line:d,column:g},name:e.name})):g++});this.walkSourceContents(function(a,b){h.setSourceContent(a,b)});return{code:a,map:h}};m.SourceNode=b},{"./source-map-generator":17, +"./util":19}],19:[function(n,u,m){function b(a){return(a=a.match(w))?{scheme:a[1],auth:a[2],host:a[3],port:a[4],path:a[5]}:null}function e(a){var b="";a.scheme&&(b+=a.scheme+":");b+="//";a.auth&&(b+=a.auth+"@");a.host&&(b+=a.host);a.port&&(b+=":"+a.port);a.path&&(b+=a.path);return b}function g(a){var c=a,d=b(a);if(d){if(!d.path)return a;c=d.path}a=m.isAbsolute(c);c=c.split(/\/+/);for(var g,h=0,l=c.length-1;0<=l;l--)g=c[l],"."===g?c.splice(l,1):".."===g?h++:0<h&&(""===g?(c.splice(l+1,h),h=0):(c.splice(l, +2),h--));c=c.join("/");""===c&&(c=a?"/":".");return d?(d.path=c,e(d)):c}function h(a,d){""===a&&(a=".");""===d&&(d=".");var c=b(d),k=b(a);k&&(a=k.path||"/");if(c&&!c.scheme)return k&&(c.scheme=k.scheme),e(c);if(c||d.match(v))return d;if(k&&!k.host&&!k.path)return k.host=d,e(k);c="/"===d.charAt(0)?d:g(a.replace(/\/+$/,"")+"/"+d);return k?(k.path=c,e(k)):c}function d(a){return a}function a(a){return r(a)?"$"+a:a}function l(a){return r(a)?a.slice(1):a}function r(a){if(!a)return!1;var b=a.length;if(9> +b||95!==a.charCodeAt(b-1)||95!==a.charCodeAt(b-2)||111!==a.charCodeAt(b-3)||116!==a.charCodeAt(b-4)||111!==a.charCodeAt(b-5)||114!==a.charCodeAt(b-6)||112!==a.charCodeAt(b-7)||95!==a.charCodeAt(b-8)||95!==a.charCodeAt(b-9))return!1;for(b-=10;0<=b;b--)if(36!==a.charCodeAt(b))return!1;return!0}function q(a,b){return a===b?0:null===a?1:null===b?-1:a>b?1:-1}m.getArg=function(a,b,d){if(b in a)return a[b];if(3===arguments.length)return d;throw Error('"'+b+'" is a required argument.');};var w=/^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/, +v=/^data:.+,.+$/;m.urlParse=b;m.urlGenerate=e;m.normalize=g;m.join=h;m.isAbsolute=function(a){return"/"===a.charAt(0)||w.test(a)};m.relative=function(a,b){""===a&&(a=".");a=a.replace(/\/$/,"");for(var c=0;0!==b.indexOf(a+"/");){var d=a.lastIndexOf("/");if(0>d)return b;a=a.slice(0,d);if(a.match(/^([^\/]+:\/)?\/*$/))return b;++c}return Array(c+1).join("../")+b.substr(a.length+1)};n=!("__proto__"in Object.create(null));m.toSetString=n?d:a;m.fromSetString=n?d:l;m.compareByOriginalPositions=function(a, +b,d){var c=q(a.source,b.source);if(0!==c)return c;c=a.originalLine-b.originalLine;if(0!==c)return c;c=a.originalColumn-b.originalColumn;if(0!==c||d)return c;c=a.generatedColumn-b.generatedColumn;if(0!==c)return c;c=a.generatedLine-b.generatedLine;return 0!==c?c:q(a.name,b.name)};m.compareByGeneratedPositionsDeflated=function(a,b,d){var c=a.generatedLine-b.generatedLine;if(0!==c)return c;c=a.generatedColumn-b.generatedColumn;if(0!==c||d)return c;c=q(a.source,b.source);if(0!==c)return c;c=a.originalLine- +b.originalLine;if(0!==c)return c;c=a.originalColumn-b.originalColumn;return 0!==c?c:q(a.name,b.name)};m.compareByGeneratedPositionsInflated=function(a,b){var c=a.generatedLine-b.generatedLine;if(0!==c)return c;c=a.generatedColumn-b.generatedColumn;if(0!==c)return c;c=q(a.source,b.source);if(0!==c)return c;c=a.originalLine-b.originalLine;if(0!==c)return c;c=a.originalColumn-b.originalColumn;return 0!==c?c:q(a.name,b.name)};m.parseSourceMapInput=function(a){return JSON.parse(a.replace(/^\)]}'[^\n]*\n/, +""))};m.computeSourceURL=function(a,d,l){d=d||"";a&&("/"!==a[a.length-1]&&"/"!==d[0]&&(a+="/"),d=a+d);if(l){a=b(l);if(!a)throw Error("sourceMapURL could not be parsed");a.path&&(l=a.path.lastIndexOf("/"),0<=l&&(a.path=a.path.substring(0,l+1)));d=h(e(a),d)}return g(d)}},{}],20:[function(n,u,m){m.SourceMapGenerator=n("./lib/source-map-generator").SourceMapGenerator;m.SourceMapConsumer=n("./lib/source-map-consumer").SourceMapConsumer;m.SourceNode=n("./lib/source-node").SourceNode},{"./lib/source-map-consumer":16, +"./lib/source-map-generator":17,"./lib/source-node":18}],21:[function(n,u,m){(function(b){function e(){return"browser"===f?!0:"node"===f?!1:"undefined"!==typeof window&&"function"===typeof XMLHttpRequest&&!(window.require&&window.module&&window.process&&"renderer"===window.process.type)}function g(a){return function(b){for(var c=0;c<a.length;c++){var d=a[c](b);if(d)return d}return null}}function h(a,b){if(!a)return b;var c=x.dirname(a),d=/^\w+:\/\/[^\/]*/.exec(c);d=d?d[0]:"";var e=c.slice(d.length); +return d&&/^\/\w:/.test(e)?(d+="/",d+x.resolve(c.slice(d.length),b).replace(/\\/g,"/")):d+x.resolve(c.slice(d.length),b)}function d(a){var b=C[a.source];if(!b){var c=E(a.source);c?(b=C[a.source]={url:c.url,map:new k(c.map)},b.map.sourcesContent&&b.map.sources.forEach(function(a,c){var d=b.map.sourcesContent[c];if(d){var e=h(b.url,a);p[e]=d}})):b=C[a.source]={url:null,map:null}}return b&&b.map&&"function"===typeof b.map.originalPositionFor&&(c=b.map.originalPositionFor(a),null!==c.source)?(c.source= +h(b.url,c.source),c):a}function a(b){var c=/^eval at ([^(]+) \((.+):(\d+):(\d+)\)$/.exec(b);return c?(b=d({source:c[2],line:+c[3],column:c[4]-1}),"eval at "+c[1]+" ("+b.source+":"+b.line+":"+(b.column+1)+")"):(c=/^eval at ([^(]+) \((.+)\)$/.exec(b))?"eval at "+c[1]+" ("+a(c[2])+")":b}function l(){var a="";if(this.isNative())a="native";else{var b=this.getScriptNameOrSourceURL();!b&&this.isEval()&&(a=this.getEvalOrigin(),a+=", ");a=b?a+b:a+"<anonymous>";b=this.getLineNumber();null!=b&&(a+=":"+b,(b= +this.getColumnNumber())&&(a+=":"+b))}b="";var c=this.getFunctionName(),d=!0,e=this.isConstructor();if(this.isToplevel()||e)e?b+="new "+(c||"<anonymous>"):c?b+=c:(b+=a,d=!1);else{e=this.getTypeName();"[object Object]"===e&&(e="null");var f=this.getMethodName();c?(e&&0!=c.indexOf(e)&&(b+=e+"."),b+=c,f&&c.indexOf("."+f)!=c.length-f.length-1&&(b+=" [as "+f+"]")):b+=e+"."+(f||"<anonymous>")}d&&(b+=" ("+a+")");return b}function r(a){var b={};Object.getOwnPropertyNames(Object.getPrototypeOf(a)).forEach(function(c){b[c]= +/^(?:is|get)/.test(c)?function(){return a[c].call(a)}:a[c]});b.toString=l;return b}function q(b){if(b.isNative())return b;var c=b.getFileName()||b.getScriptNameOrSourceURL();if(c){var f=b.getLineNumber(),g=b.getColumnNumber()-1;1===f&&62<g&&!e()&&!b.isEval()&&(g-=62);var h=d({source:c,line:f,column:g});b=r(b);var k=b.getFunctionName;b.getFunctionName=function(){return h.name||k()};b.getFileName=function(){return h.source};b.getLineNumber=function(){return h.line};b.getColumnNumber=function(){return h.column+ +1};b.getScriptNameOrSourceURL=function(){return h.source};return b}var l=b.isEval()&&b.getEvalOrigin();l&&(l=a(l),b=r(b),b.getEvalOrigin=function(){return l});return b}function w(a,b){H&&(p={},C={});return a+b.map(function(a){return"\n at "+q(a)}).join("")}function v(a){var b=/\n at [^(]+ \((.*):(\d+):(\d+)\)/.exec(a.stack);if(b){a=b[1];var c=+b[2];b=+b[3];var d=p[a];if(!d&&u&&u.existsSync(a))try{d=u.readFileSync(a,"utf8")}catch(N){d=""}if(d&&(d=d.split(/(?:\r\n|\r|\n)/)[c-1]))return a+":"+ +c+"\n"+d+"\n"+Array(b).join(" ")+"^"}return null}function c(){var a=b.emit;b.emit=function(c){if("uncaughtException"===c){var d=arguments[1]&&arguments[1].stack,e=0<this.listeners(c).length;if(d&&!e){d=arguments[1];e=v(d);b.stderr._handle&&b.stderr._handle.setBlocking&&b.stderr._handle.setBlocking(!0);e&&(console.error(),console.error(e));console.error(d.stack);b.exit(1);return}}return a.apply(this,arguments)}}var k=n("source-map").SourceMapConsumer,x=n("path");try{var u=n("fs");u.existsSync&&u.readFileSync|| +(u=null)}catch(M){}var F=n("buffer-from"),D=!1,t=!1,H=!1,f="auto",p={},C={},G=/^data:application\/json[^,]+base64,/,y=[],B=[],A=g(y);y.push(function(a){a=a.trim();/^file:/.test(a)&&(a=a.replace(/file:\/\/\/(\w:)?/,function(a,b){return b?"":"/"}));if(a in p)return p[a];var b="";try{if(u)u.existsSync(a)&&(b=u.readFileSync(a,"utf8"));else{var c=new XMLHttpRequest;c.open("GET",a,!1);c.send(null);4===c.readyState&&200===c.status&&(b=c.responseText)}}catch(K){}return p[a]=b});var E=g(B);B.push(function(a){a:{if(e())try{var b= +new XMLHttpRequest;b.open("GET",a,!1);b.send(null);var c=b.getResponseHeader("SourceMap")||b.getResponseHeader("X-SourceMap");if(c){var d=c;break a}}catch(O){}d=A(a);b=/(?:\/\/[@#][ \t]+sourceMappingURL=([^\s'"]+?)[ \t]*$)|(?:\/\*[@#][ \t]+sourceMappingURL=([^\*]+?)[ \t]*(?:\*\/)[ \t]*$)/mg;for(var f;c=b.exec(d);)f=c;d=f?f[1]:null}if(!d)return null;G.test(d)?(f=d.slice(d.indexOf(",")+1),f=F(f,"base64").toString(),d=a):(d=h(a,d),f=A(d));return f?{url:d,map:f}:null});var I=y.slice(0),L=B.slice(0);m.wrapCallSite= +q;m.getErrorSource=v;m.mapSourcePosition=d;m.retrieveSourceMap=E;m.install=function(a){a=a||{};if(a.environment&&(f=a.environment,-1===["node","browser","auto"].indexOf(f)))throw Error("environment "+f+" was unknown. Available options are {auto, browser, node}");a.retrieveFile&&(a.overrideRetrieveFile&&(y.length=0),y.unshift(a.retrieveFile));a.retrieveSourceMap&&(a.overrideRetrieveSourceMap&&(B.length=0),B.unshift(a.retrieveSourceMap));if(a.hookRequire&&!e()){try{var d=n("module")}catch(K){}var g= +d.prototype._compile;g.__sourceMapSupport||(d.prototype._compile=function(a,b){p[b]=a;C[b]=void 0;return g.call(this,a,b)},d.prototype._compile.__sourceMapSupport=!0)}H||(H="emptyCacheBetweenOperations"in a?a.emptyCacheBetweenOperations:!1);D||(D=!0,Error.prepareStackTrace=w);!t&&("handleUncaughtExceptions"in a?a.handleUncaughtExceptions:1)&&"object"===typeof b&&null!==b&&"function"===typeof b.on&&(t=!0,c())};m.resetRetrieveHandlers=function(){y.length=0;B.length=0;y=I.slice(0);B=L.slice(0);E=g(B); +A=g(y)}}).call(this,n("g5I+bs"))},{"buffer-from":4,fs:3,"g5I+bs":9,module:3,path:8,"source-map":20}]},{},[1]);return G}); diff --git a/resources/app/node_modules/source-map-support/package.json b/resources/app/node_modules/source-map-support/package.json new file mode 100644 index 0000000..f0fdb62 --- /dev/null +++ b/resources/app/node_modules/source-map-support/package.json @@ -0,0 +1,56 @@ +{ + "_from": "source-map-support@^0.5.0", + "_id": "[email protected]", + "_inBundle": false, + "_integrity": "sha512-//sajEx/fGL3iw6fltKMdPvy8kL3kJ2O3iuYlRoT3k9Kb4BjOoZ+BZzaNHeuaruSt+Kf3Zk9tnfAQg9/AJqUVQ==", + "_location": "/source-map-support", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "source-map-support@^0.5.0", + "name": "source-map-support", + "escapedName": "source-map-support", + "rawSpec": "^0.5.0", + "saveSpec": null, + "fetchSpec": "^0.5.0" + }, + "_requiredBy": [ + "/" + ], + "_resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.11.tgz", + "_shasum": "efac2ce0800355d026326a0ca23e162aeac9a4e2", + "_spec": "source-map-support@^0.5.0", + "bugs": { + "url": "https://github.com/evanw/node-source-map-support/issues" + }, + "bundleDependencies": false, + "dependencies": { + "buffer-from": "^1.0.0", + "source-map": "^0.6.0" + }, + "deprecated": false, + "description": "Fixes stack traces for files with source maps", + "devDependencies": { + "browserify": "^4.2.3", + "coffeescript": "^1.12.7", + "http-server": "^0.11.1", + "mocha": "^3.5.3", + "webpack": "^1.15.0" + }, + "homepage": "https://github.com/evanw/node-source-map-support#readme", + "license": "MIT", + "main": "./source-map-support.js", + "name": "source-map-support", + "repository": { + "type": "git", + "url": "git+https://github.com/evanw/node-source-map-support.git" + }, + "scripts": { + "build": "node build.js", + "prepublish": "npm run build", + "serve-tests": "http-server -p 1336", + "test": "mocha" + }, + "version": "0.5.11" +} diff --git a/resources/app/node_modules/source-map-support/register.js b/resources/app/node_modules/source-map-support/register.js new file mode 100644 index 0000000..4f68e67 --- /dev/null +++ b/resources/app/node_modules/source-map-support/register.js @@ -0,0 +1 @@ +require('./').install(); diff --git a/resources/app/node_modules/source-map-support/source-map-support.js b/resources/app/node_modules/source-map-support/source-map-support.js new file mode 100644 index 0000000..44e8294 --- /dev/null +++ b/resources/app/node_modules/source-map-support/source-map-support.js @@ -0,0 +1,563 @@ +var SourceMapConsumer = require('source-map').SourceMapConsumer; +var path = require('path'); + +var fs; +try { + fs = require('fs'); + if (!fs.existsSync || !fs.readFileSync) { + // fs doesn't have all methods we need + fs = null; + } +} catch (err) { + /* nop */ +} + +var bufferFrom = require('buffer-from'); + +// Only install once if called multiple times +var errorFormatterInstalled = false; +var uncaughtShimInstalled = false; + +// If true, the caches are reset before a stack trace formatting operation +var emptyCacheBetweenOperations = false; + +// Supports {browser, node, auto} +var environment = "auto"; + +// Maps a file path to a string containing the file contents +var fileContentsCache = {}; + +// Maps a file path to a source map for that file +var sourceMapCache = {}; + +// Regex for detecting source maps +var reSourceMap = /^data:application\/json[^,]+base64,/; + +// Priority list of retrieve handlers +var retrieveFileHandlers = []; +var retrieveMapHandlers = []; + +function isInBrowser() { + if (environment === "browser") + return true; + if (environment === "node") + return false; + return ((typeof window !== 'undefined') && (typeof XMLHttpRequest === 'function') && !(window.require && window.module && window.process && window.process.type === "renderer")); +} + +function hasGlobalProcessEventEmitter() { + return ((typeof process === 'object') && (process !== null) && (typeof process.on === 'function')); +} + +function handlerExec(list) { + return function(arg) { + for (var i = 0; i < list.length; i++) { + var ret = list[i](arg); + if (ret) { + return ret; + } + } + return null; + }; +} + +var retrieveFile = handlerExec(retrieveFileHandlers); + +retrieveFileHandlers.push(function(path) { + // Trim the path to make sure there is no extra whitespace. + path = path.trim(); + if (/^file:/.test(path)) { + // existsSync/readFileSync can't handle file protocol, but once stripped, it works + path = path.replace(/file:\/\/\/(\w:)?/, function(protocol, drive) { + return drive ? + '' : // file:///C:/dir/file -> C:/dir/file + '/'; // file:///root-dir/file -> /root-dir/file + }); + } + if (path in fileContentsCache) { + return fileContentsCache[path]; + } + + var contents = ''; + try { + if (!fs) { + // Use SJAX if we are in the browser + var xhr = new XMLHttpRequest(); + xhr.open('GET', path, /** async */ false); + xhr.send(null); + if (xhr.readyState === 4 && xhr.status === 200) { + contents = xhr.responseText; + } + } else if (fs.existsSync(path)) { + // Otherwise, use the filesystem + contents = fs.readFileSync(path, 'utf8'); + } + } catch (er) { + /* ignore any errors */ + } + + return fileContentsCache[path] = contents; +}); + +// Support URLs relative to a directory, but be careful about a protocol prefix +// in case we are in the browser (i.e. directories may start with "http://" or "file:///") +function supportRelativeURL(file, url) { + if (!file) return url; + var dir = path.dirname(file); + var match = /^\w+:\/\/[^\/]*/.exec(dir); + var protocol = match ? match[0] : ''; + var startPath = dir.slice(protocol.length); + if (protocol && /^\/\w\:/.test(startPath)) { + // handle file:///C:/ paths + protocol += '/'; + return protocol + path.resolve(dir.slice(protocol.length), url).replace(/\\/g, '/'); + } + return protocol + path.resolve(dir.slice(protocol.length), url); +} + +function retrieveSourceMapURL(source) { + var fileData; + + if (isInBrowser()) { + try { + var xhr = new XMLHttpRequest(); + xhr.open('GET', source, false); + xhr.send(null); + fileData = xhr.readyState === 4 ? xhr.responseText : null; + + // Support providing a sourceMappingURL via the SourceMap header + var sourceMapHeader = xhr.getResponseHeader("SourceMap") || + xhr.getResponseHeader("X-SourceMap"); + if (sourceMapHeader) { + return sourceMapHeader; + } + } catch (e) { + } + } + + // Get the URL of the source map + fileData = retrieveFile(source); + var re = /(?:\/\/[@#][ \t]+sourceMappingURL=([^\s'"]+?)[ \t]*$)|(?:\/\*[@#][ \t]+sourceMappingURL=([^\*]+?)[ \t]*(?:\*\/)[ \t]*$)/mg; + // Keep executing the search to find the *last* sourceMappingURL to avoid + // picking up sourceMappingURLs from comments, strings, etc. + var lastMatch, match; + while (match = re.exec(fileData)) lastMatch = match; + if (!lastMatch) return null; + return lastMatch[1]; +}; + +// Can be overridden by the retrieveSourceMap option to install. Takes a +// generated source filename; returns a {map, optional url} object, or null if +// there is no source map. The map field may be either a string or the parsed +// JSON object (ie, it must be a valid argument to the SourceMapConsumer +// constructor). +var retrieveSourceMap = handlerExec(retrieveMapHandlers); +retrieveMapHandlers.push(function(source) { + var sourceMappingURL = retrieveSourceMapURL(source); + if (!sourceMappingURL) return null; + + // Read the contents of the source map + var sourceMapData; + if (reSourceMap.test(sourceMappingURL)) { + // Support source map URL as a data url + var rawData = sourceMappingURL.slice(sourceMappingURL.indexOf(',') + 1); + sourceMapData = bufferFrom(rawData, "base64").toString(); + sourceMappingURL = source; + } else { + // Support source map URLs relative to the source URL + sourceMappingURL = supportRelativeURL(source, sourceMappingURL); + sourceMapData = retrieveFile(sourceMappingURL); + } + + if (!sourceMapData) { + return null; + } + + return { + url: sourceMappingURL, + map: sourceMapData + }; +}); + +function mapSourcePosition(position) { + var sourceMap = sourceMapCache[position.source]; + if (!sourceMap) { + // Call the (overrideable) retrieveSourceMap function to get the source map. + var urlAndMap = retrieveSourceMap(position.source); + if (urlAndMap) { + sourceMap = sourceMapCache[position.source] = { + url: urlAndMap.url, + map: new SourceMapConsumer(urlAndMap.map) + }; + + // Load all sources stored inline with the source map into the file cache + // to pretend like they are already loaded. They may not exist on disk. + if (sourceMap.map.sourcesContent) { + sourceMap.map.sources.forEach(function(source, i) { + var contents = sourceMap.map.sourcesContent[i]; + if (contents) { + var url = supportRelativeURL(sourceMap.url, source); + fileContentsCache[url] = contents; + } + }); + } + } else { + sourceMap = sourceMapCache[position.source] = { + url: null, + map: null + }; + } + } + + // Resolve the source URL relative to the URL of the source map + if (sourceMap && sourceMap.map && typeof sourceMap.map.originalPositionFor === 'function') { + var originalPosition = sourceMap.map.originalPositionFor(position); + + // Only return the original position if a matching line was found. If no + // matching line is found then we return position instead, which will cause + // the stack trace to print the path and line for the compiled file. It is + // better to give a precise location in the compiled file than a vague + // location in the original file. + if (originalPosition.source !== null) { + originalPosition.source = supportRelativeURL( + sourceMap.url, originalPosition.source); + return originalPosition; + } + } + + return position; +} + +// Parses code generated by FormatEvalOrigin(), a function inside V8: +// https://code.google.com/p/v8/source/browse/trunk/src/messages.js +function mapEvalOrigin(origin) { + // Most eval() calls are in this format + var match = /^eval at ([^(]+) \((.+):(\d+):(\d+)\)$/.exec(origin); + if (match) { + var position = mapSourcePosition({ + source: match[2], + line: +match[3], + column: match[4] - 1 + }); + return 'eval at ' + match[1] + ' (' + position.source + ':' + + position.line + ':' + (position.column + 1) + ')'; + } + + // Parse nested eval() calls using recursion + match = /^eval at ([^(]+) \((.+)\)$/.exec(origin); + if (match) { + return 'eval at ' + match[1] + ' (' + mapEvalOrigin(match[2]) + ')'; + } + + // Make sure we still return useful information if we didn't find anything + return origin; +} + +// This is copied almost verbatim from the V8 source code at +// https://code.google.com/p/v8/source/browse/trunk/src/messages.js. The +// implementation of wrapCallSite() used to just forward to the actual source +// code of CallSite.prototype.toString but unfortunately a new release of V8 +// did something to the prototype chain and broke the shim. The only fix I +// could find was copy/paste. +function CallSiteToString() { + var fileName; + var fileLocation = ""; + if (this.isNative()) { + fileLocation = "native"; + } else { + fileName = this.getScriptNameOrSourceURL(); + if (!fileName && this.isEval()) { + fileLocation = this.getEvalOrigin(); + fileLocation += ", "; // Expecting source position to follow. + } + + if (fileName) { + fileLocation += fileName; + } else { + // Source code does not originate from a file and is not native, but we + // can still get the source position inside the source string, e.g. in + // an eval string. + fileLocation += "<anonymous>"; + } + var lineNumber = this.getLineNumber(); + if (lineNumber != null) { + fileLocation += ":" + lineNumber; + var columnNumber = this.getColumnNumber(); + if (columnNumber) { + fileLocation += ":" + columnNumber; + } + } + } + + var line = ""; + var functionName = this.getFunctionName(); + var addSuffix = true; + var isConstructor = this.isConstructor(); + var isMethodCall = !(this.isToplevel() || isConstructor); + if (isMethodCall) { + var typeName = this.getTypeName(); + // Fixes shim to be backward compatable with Node v0 to v4 + if (typeName === "[object Object]") { + typeName = "null"; + } + var methodName = this.getMethodName(); + if (functionName) { + if (typeName && functionName.indexOf(typeName) != 0) { + line += typeName + "."; + } + line += functionName; + if (methodName && functionName.indexOf("." + methodName) != functionName.length - methodName.length - 1) { + line += " [as " + methodName + "]"; + } + } else { + line += typeName + "." + (methodName || "<anonymous>"); + } + } else if (isConstructor) { + line += "new " + (functionName || "<anonymous>"); + } else if (functionName) { + line += functionName; + } else { + line += fileLocation; + addSuffix = false; + } + if (addSuffix) { + line += " (" + fileLocation + ")"; + } + return line; +} + +function cloneCallSite(frame) { + var object = {}; + Object.getOwnPropertyNames(Object.getPrototypeOf(frame)).forEach(function(name) { + object[name] = /^(?:is|get)/.test(name) ? function() { return frame[name].call(frame); } : frame[name]; + }); + object.toString = CallSiteToString; + return object; +} + +function wrapCallSite(frame) { + if(frame.isNative()) { + return frame; + } + + // Most call sites will return the source file from getFileName(), but code + // passed to eval() ending in "//# sourceURL=..." will return the source file + // from getScriptNameOrSourceURL() instead + var source = frame.getFileName() || frame.getScriptNameOrSourceURL(); + if (source) { + var line = frame.getLineNumber(); + var column = frame.getColumnNumber() - 1; + + // Fix position in Node where some (internal) code is prepended. + // See https://github.com/evanw/node-source-map-support/issues/36 + var headerLength = 62; + if (line === 1 && column > headerLength && !isInBrowser() && !frame.isEval()) { + column -= headerLength; + } + + var position = mapSourcePosition({ + source: source, + line: line, + column: column + }); + frame = cloneCallSite(frame); + var originalFunctionName = frame.getFunctionName; + frame.getFunctionName = function() { return position.name || originalFunctionName(); }; + frame.getFileName = function() { return position.source; }; + frame.getLineNumber = function() { return position.line; }; + frame.getColumnNumber = function() { return position.column + 1; }; + frame.getScriptNameOrSourceURL = function() { return position.source; }; + return frame; + } + + // Code called using eval() needs special handling + var origin = frame.isEval() && frame.getEvalOrigin(); + if (origin) { + origin = mapEvalOrigin(origin); + frame = cloneCallSite(frame); + frame.getEvalOrigin = function() { return origin; }; + return frame; + } + + // If we get here then we were unable to change the source position + return frame; +} + +// This function is part of the V8 stack trace API, for more info see: +// http://code.google.com/p/v8/wiki/JavaScriptStackTraceApi +function prepareStackTrace(error, stack) { + if (emptyCacheBetweenOperations) { + fileContentsCache = {}; + sourceMapCache = {}; + } + + return error + stack.map(function(frame) { + return '\n at ' + wrapCallSite(frame); + }).join(''); +} + +// Generate position and snippet of original source with pointer +function getErrorSource(error) { + var match = /\n at [^(]+ \((.*):(\d+):(\d+)\)/.exec(error.stack); + if (match) { + var source = match[1]; + var line = +match[2]; + var column = +match[3]; + + // Support the inline sourceContents inside the source map + var contents = fileContentsCache[source]; + + // Support files on disk + if (!contents && fs && fs.existsSync(source)) { + try { + contents = fs.readFileSync(source, 'utf8'); + } catch (er) { + contents = ''; + } + } + + // Format the line from the original source code like node does + if (contents) { + var code = contents.split(/(?:\r\n|\r|\n)/)[line - 1]; + if (code) { + return source + ':' + line + '\n' + code + '\n' + + new Array(column).join(' ') + '^'; + } + } + } + return null; +} + +function printErrorAndExit (error) { + var source = getErrorSource(error); + + // Ensure error is printed synchronously and not truncated + if (process.stderr._handle && process.stderr._handle.setBlocking) { + process.stderr._handle.setBlocking(true); + } + + if (source) { + console.error(); + console.error(source); + } + + console.error(error.stack); + process.exit(1); +} + +function shimEmitUncaughtException () { + var origEmit = process.emit; + + process.emit = function (type) { + if (type === 'uncaughtException') { + var hasStack = (arguments[1] && arguments[1].stack); + var hasListeners = (this.listeners(type).length > 0); + + if (hasStack && !hasListeners) { + return printErrorAndExit(arguments[1]); + } + } + + return origEmit.apply(this, arguments); + }; +} + +var originalRetrieveFileHandlers = retrieveFileHandlers.slice(0); +var originalRetrieveMapHandlers = retrieveMapHandlers.slice(0); + +exports.wrapCallSite = wrapCallSite; +exports.getErrorSource = getErrorSource; +exports.mapSourcePosition = mapSourcePosition; +exports.retrieveSourceMap = retrieveSourceMap; + +exports.install = function(options) { + options = options || {}; + + if (options.environment) { + environment = options.environment; + if (["node", "browser", "auto"].indexOf(environment) === -1) { + throw new Error("environment " + environment + " was unknown. Available options are {auto, browser, node}") + } + } + + // Allow sources to be found by methods other than reading the files + // directly from disk. + if (options.retrieveFile) { + if (options.overrideRetrieveFile) { + retrieveFileHandlers.length = 0; + } + + retrieveFileHandlers.unshift(options.retrieveFile); + } + + // Allow source maps to be found by methods other than reading the files + // directly from disk. + if (options.retrieveSourceMap) { + if (options.overrideRetrieveSourceMap) { + retrieveMapHandlers.length = 0; + } + + retrieveMapHandlers.unshift(options.retrieveSourceMap); + } + + // Support runtime transpilers that include inline source maps + if (options.hookRequire && !isInBrowser()) { + var Module; + try { + Module = require('module'); + } catch (err) { + // NOP: Loading in catch block to convert webpack error to warning. + } + var $compile = Module.prototype._compile; + + if (!$compile.__sourceMapSupport) { + Module.prototype._compile = function(content, filename) { + fileContentsCache[filename] = content; + sourceMapCache[filename] = undefined; + return $compile.call(this, content, filename); + }; + + Module.prototype._compile.__sourceMapSupport = true; + } + } + + // Configure options + if (!emptyCacheBetweenOperations) { + emptyCacheBetweenOperations = 'emptyCacheBetweenOperations' in options ? + options.emptyCacheBetweenOperations : false; + } + + // Install the error reformatter + if (!errorFormatterInstalled) { + errorFormatterInstalled = true; + Error.prepareStackTrace = prepareStackTrace; + } + + if (!uncaughtShimInstalled) { + var installHandler = 'handleUncaughtExceptions' in options ? + options.handleUncaughtExceptions : true; + + // Provide the option to not install the uncaught exception handler. This is + // to support other uncaught exception handlers (in test frameworks, for + // example). If this handler is not installed and there are no other uncaught + // exception handlers, uncaught exceptions will be caught by node's built-in + // exception handler and the process will still be terminated. However, the + // generated JavaScript code will be shown above the stack trace instead of + // the original source code. + if (installHandler && hasGlobalProcessEventEmitter()) { + uncaughtShimInstalled = true; + shimEmitUncaughtException(); + } + } +}; + +exports.resetRetrieveHandlers = function() { + retrieveFileHandlers.length = 0; + retrieveMapHandlers.length = 0; + + retrieveFileHandlers = originalRetrieveFileHandlers.slice(0); + retrieveMapHandlers = originalRetrieveMapHandlers.slice(0); + + retrieveSourceMap = handlerExec(retrieveMapHandlers); + retrieveFile = handlerExec(retrieveFileHandlers); +} diff --git a/resources/app/node_modules/source-map/CHANGELOG.md b/resources/app/node_modules/source-map/CHANGELOG.md new file mode 100644 index 0000000..3a8c066 --- /dev/null +++ b/resources/app/node_modules/source-map/CHANGELOG.md @@ -0,0 +1,301 @@ +# Change Log + +## 0.5.6 + +* Fix for regression when people were using numbers as names in source maps. See + #236. + +## 0.5.5 + +* Fix "regression" of unsupported, implementation behavior that half the world + happens to have come to depend on. See #235. + +* Fix regression involving function hoisting in SpiderMonkey. See #233. + +## 0.5.4 + +* Large performance improvements to source-map serialization. See #228 and #229. + +## 0.5.3 + +* Do not include unnecessary distribution files. See + commit ef7006f8d1647e0a83fdc60f04f5a7ca54886f86. + +## 0.5.2 + +* Include browser distributions of the library in package.json's `files`. See + issue #212. + +## 0.5.1 + +* Fix latent bugs in IndexedSourceMapConsumer.prototype._parseMappings. See + ff05274becc9e6e1295ed60f3ea090d31d843379. + +## 0.5.0 + +* Node 0.8 is no longer supported. + +* Use webpack instead of dryice for bundling. + +* Big speedups serializing source maps. See pull request #203. + +* Fix a bug with `SourceMapConsumer.prototype.sourceContentFor` and sources that + explicitly start with the source root. See issue #199. + +## 0.4.4 + +* Fix an issue where using a `SourceMapGenerator` after having created a + `SourceMapConsumer` from it via `SourceMapConsumer.fromSourceMap` failed. See + issue #191. + +* Fix an issue with where `SourceMapGenerator` would mistakenly consider + different mappings as duplicates of each other and avoid generating them. See + issue #192. + +## 0.4.3 + +* A very large number of performance improvements, particularly when parsing + source maps. Collectively about 75% of time shaved off of the source map + parsing benchmark! + +* Fix a bug in `SourceMapConsumer.prototype.allGeneratedPositionsFor` and fuzzy + searching in the presence of a column option. See issue #177. + +* Fix a bug with joining a source and its source root when the source is above + the root. See issue #182. + +* Add the `SourceMapConsumer.prototype.hasContentsOfAllSources` method to + determine when all sources' contents are inlined into the source map. See + issue #190. + +## 0.4.2 + +* Add an `.npmignore` file so that the benchmarks aren't pulled down by + dependent projects. Issue #169. + +* Add an optional `column` argument to + `SourceMapConsumer.prototype.allGeneratedPositionsFor` and better handle lines + with no mappings. Issues #172 and #173. + +## 0.4.1 + +* Fix accidentally defining a global variable. #170. + +## 0.4.0 + +* The default direction for fuzzy searching was changed back to its original + direction. See #164. + +* There is now a `bias` option you can supply to `SourceMapConsumer` to control + the fuzzy searching direction. See #167. + +* About an 8% speed up in parsing source maps. See #159. + +* Added a benchmark for parsing and generating source maps. + +## 0.3.0 + +* Change the default direction that searching for positions fuzzes when there is + not an exact match. See #154. + +* Support for environments using json2.js for JSON serialization. See #156. + +## 0.2.0 + +* Support for consuming "indexed" source maps which do not have any remote + sections. See pull request #127. This introduces a minor backwards + incompatibility if you are monkey patching `SourceMapConsumer.prototype` + methods. + +## 0.1.43 + +* Performance improvements for `SourceMapGenerator` and `SourceNode`. See issue + #148 for some discussion and issues #150, #151, and #152 for implementations. + +## 0.1.42 + +* Fix an issue where `SourceNode`s from different versions of the source-map + library couldn't be used in conjunction with each other. See issue #142. + +## 0.1.41 + +* Fix a bug with getting the source content of relative sources with a "./" + prefix. See issue #145 and [Bug 1090768](bugzil.la/1090768). + +* Add the `SourceMapConsumer.prototype.computeColumnSpans` method to compute the + column span of each mapping. + +* Add the `SourceMapConsumer.prototype.allGeneratedPositionsFor` method to find + all generated positions associated with a given original source and line. + +## 0.1.40 + +* Performance improvements for parsing source maps in SourceMapConsumer. + +## 0.1.39 + +* Fix a bug where setting a source's contents to null before any source content + had been set before threw a TypeError. See issue #131. + +## 0.1.38 + +* Fix a bug where finding relative paths from an empty path were creating + absolute paths. See issue #129. + +## 0.1.37 + +* Fix a bug where if the source root was an empty string, relative source paths + would turn into absolute source paths. Issue #124. + +## 0.1.36 + +* Allow the `names` mapping property to be an empty string. Issue #121. + +## 0.1.35 + +* A third optional parameter was added to `SourceNode.fromStringWithSourceMap` + to specify a path that relative sources in the second parameter should be + relative to. Issue #105. + +* If no file property is given to a `SourceMapGenerator`, then the resulting + source map will no longer have a `null` file property. The property will + simply not exist. Issue #104. + +* Fixed a bug where consecutive newlines were ignored in `SourceNode`s. + Issue #116. + +## 0.1.34 + +* Make `SourceNode` work with windows style ("\r\n") newlines. Issue #103. + +* Fix bug involving source contents and the + `SourceMapGenerator.prototype.applySourceMap`. Issue #100. + +## 0.1.33 + +* Fix some edge cases surrounding path joining and URL resolution. + +* Add a third parameter for relative path to + `SourceMapGenerator.prototype.applySourceMap`. + +* Fix issues with mappings and EOLs. + +## 0.1.32 + +* Fixed a bug where SourceMapConsumer couldn't handle negative relative columns + (issue 92). + +* Fixed test runner to actually report number of failed tests as its process + exit code. + +* Fixed a typo when reporting bad mappings (issue 87). + +## 0.1.31 + +* Delay parsing the mappings in SourceMapConsumer until queried for a source + location. + +* Support Sass source maps (which at the time of writing deviate from the spec + in small ways) in SourceMapConsumer. + +## 0.1.30 + +* Do not join source root with a source, when the source is a data URI. + +* Extend the test runner to allow running single specific test files at a time. + +* Performance improvements in `SourceNode.prototype.walk` and + `SourceMapConsumer.prototype.eachMapping`. + +* Source map browser builds will now work inside Workers. + +* Better error messages when attempting to add an invalid mapping to a + `SourceMapGenerator`. + +## 0.1.29 + +* Allow duplicate entries in the `names` and `sources` arrays of source maps + (usually from TypeScript) we are parsing. Fixes github issue 72. + +## 0.1.28 + +* Skip duplicate mappings when creating source maps from SourceNode; github + issue 75. + +## 0.1.27 + +* Don't throw an error when the `file` property is missing in SourceMapConsumer, + we don't use it anyway. + +## 0.1.26 + +* Fix SourceNode.fromStringWithSourceMap for empty maps. Fixes github issue 70. + +## 0.1.25 + +* Make compatible with browserify + +## 0.1.24 + +* Fix issue with absolute paths and `file://` URIs. See + https://bugzilla.mozilla.org/show_bug.cgi?id=885597 + +## 0.1.23 + +* Fix issue with absolute paths and sourcesContent, github issue 64. + +## 0.1.22 + +* Ignore duplicate mappings in SourceMapGenerator. Fixes github issue 21. + +## 0.1.21 + +* Fixed handling of sources that start with a slash so that they are relative to + the source root's host. + +## 0.1.20 + +* Fixed github issue #43: absolute URLs aren't joined with the source root + anymore. + +## 0.1.19 + +* Using Travis CI to run tests. + +## 0.1.18 + +* Fixed a bug in the handling of sourceRoot. + +## 0.1.17 + +* Added SourceNode.fromStringWithSourceMap. + +## 0.1.16 + +* Added missing documentation. + +* Fixed the generating of empty mappings in SourceNode. + +## 0.1.15 + +* Added SourceMapGenerator.applySourceMap. + +## 0.1.14 + +* The sourceRoot is now handled consistently. + +## 0.1.13 + +* Added SourceMapGenerator.fromSourceMap. + +## 0.1.12 + +* SourceNode now generates empty mappings too. + +## 0.1.11 + +* Added name support to SourceNode. + +## 0.1.10 + +* Added sourcesContent support to the customer and generator. diff --git a/resources/app/node_modules/source-map/LICENSE b/resources/app/node_modules/source-map/LICENSE new file mode 100644 index 0000000..ed1b7cf --- /dev/null +++ b/resources/app/node_modules/source-map/LICENSE @@ -0,0 +1,28 @@ + +Copyright (c) 2009-2011, Mozilla Foundation and contributors +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +* Neither the names of the Mozilla Foundation nor the names of project + contributors may be used to endorse or promote products derived from this + software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/resources/app/node_modules/source-map/README.md b/resources/app/node_modules/source-map/README.md new file mode 100644 index 0000000..fea4beb --- /dev/null +++ b/resources/app/node_modules/source-map/README.md @@ -0,0 +1,742 @@ +# Source Map + +[](https://travis-ci.org/mozilla/source-map) + +[](https://www.npmjs.com/package/source-map) + +This is a library to generate and consume the source map format +[described here][format]. + +[format]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit + +## Use with Node + + $ npm install source-map + +## Use on the Web + + <script src="https://raw.githubusercontent.com/mozilla/source-map/master/dist/source-map.min.js" defer></script> + +-------------------------------------------------------------------------------- + +<!-- `npm run toc` to regenerate the Table of Contents --> + +<!-- START doctoc generated TOC please keep comment here to allow auto update --> +<!-- DON'T EDIT THIS SECTION, INSTEAD RE-RUN doctoc TO UPDATE --> +## Table of Contents + +- [Examples](#examples) + - [Consuming a source map](#consuming-a-source-map) + - [Generating a source map](#generating-a-source-map) + - [With SourceNode (high level API)](#with-sourcenode-high-level-api) + - [With SourceMapGenerator (low level API)](#with-sourcemapgenerator-low-level-api) +- [API](#api) + - [SourceMapConsumer](#sourcemapconsumer) + - [new SourceMapConsumer(rawSourceMap)](#new-sourcemapconsumerrawsourcemap) + - [SourceMapConsumer.prototype.computeColumnSpans()](#sourcemapconsumerprototypecomputecolumnspans) + - [SourceMapConsumer.prototype.originalPositionFor(generatedPosition)](#sourcemapconsumerprototypeoriginalpositionforgeneratedposition) + - [SourceMapConsumer.prototype.generatedPositionFor(originalPosition)](#sourcemapconsumerprototypegeneratedpositionfororiginalposition) + - [SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)](#sourcemapconsumerprototypeallgeneratedpositionsfororiginalposition) + - [SourceMapConsumer.prototype.hasContentsOfAllSources()](#sourcemapconsumerprototypehascontentsofallsources) + - [SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])](#sourcemapconsumerprototypesourcecontentforsource-returnnullonmissing) + - [SourceMapConsumer.prototype.eachMapping(callback, context, order)](#sourcemapconsumerprototypeeachmappingcallback-context-order) + - [SourceMapGenerator](#sourcemapgenerator) + - [new SourceMapGenerator([startOfSourceMap])](#new-sourcemapgeneratorstartofsourcemap) + - [SourceMapGenerator.fromSourceMap(sourceMapConsumer)](#sourcemapgeneratorfromsourcemapsourcemapconsumer) + - [SourceMapGenerator.prototype.addMapping(mapping)](#sourcemapgeneratorprototypeaddmappingmapping) + - [SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)](#sourcemapgeneratorprototypesetsourcecontentsourcefile-sourcecontent) + - [SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])](#sourcemapgeneratorprototypeapplysourcemapsourcemapconsumer-sourcefile-sourcemappath) + - [SourceMapGenerator.prototype.toString()](#sourcemapgeneratorprototypetostring) + - [SourceNode](#sourcenode) + - [new SourceNode([line, column, source[, chunk[, name]]])](#new-sourcenodeline-column-source-chunk-name) + - [SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])](#sourcenodefromstringwithsourcemapcode-sourcemapconsumer-relativepath) + - [SourceNode.prototype.add(chunk)](#sourcenodeprototypeaddchunk) + - [SourceNode.prototype.prepend(chunk)](#sourcenodeprototypeprependchunk) + - [SourceNode.prototype.setSourceContent(sourceFile, sourceContent)](#sourcenodeprototypesetsourcecontentsourcefile-sourcecontent) + - [SourceNode.prototype.walk(fn)](#sourcenodeprototypewalkfn) + - [SourceNode.prototype.walkSourceContents(fn)](#sourcenodeprototypewalksourcecontentsfn) + - [SourceNode.prototype.join(sep)](#sourcenodeprototypejoinsep) + - [SourceNode.prototype.replaceRight(pattern, replacement)](#sourcenodeprototypereplacerightpattern-replacement) + - [SourceNode.prototype.toString()](#sourcenodeprototypetostring) + - [SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])](#sourcenodeprototypetostringwithsourcemapstartofsourcemap) + +<!-- END doctoc generated TOC please keep comment here to allow auto update --> + +## Examples + +### Consuming a source map + +```js +var rawSourceMap = { + version: 3, + file: 'min.js', + names: ['bar', 'baz', 'n'], + sources: ['one.js', 'two.js'], + sourceRoot: 'http://example.com/www/js/', + mappings: 'CAAC,IAAI,IAAM,SAAUA,GAClB,OAAOC,IAAID;CCDb,IAAI,IAAM,SAAUE,GAClB,OAAOA' +}; + +var smc = new SourceMapConsumer(rawSourceMap); + +console.log(smc.sources); +// [ 'http://example.com/www/js/one.js', +// 'http://example.com/www/js/two.js' ] + +console.log(smc.originalPositionFor({ + line: 2, + column: 28 +})); +// { source: 'http://example.com/www/js/two.js', +// line: 2, +// column: 10, +// name: 'n' } + +console.log(smc.generatedPositionFor({ + source: 'http://example.com/www/js/two.js', + line: 2, + column: 10 +})); +// { line: 2, column: 28 } + +smc.eachMapping(function (m) { + // ... +}); +``` + +### Generating a source map + +In depth guide: +[**Compiling to JavaScript, and Debugging with Source Maps**](https://hacks.mozilla.org/2013/05/compiling-to-javascript-and-debugging-with-source-maps/) + +#### With SourceNode (high level API) + +```js +function compile(ast) { + switch (ast.type) { + case 'BinaryExpression': + return new SourceNode( + ast.location.line, + ast.location.column, + ast.location.source, + [compile(ast.left), " + ", compile(ast.right)] + ); + case 'Literal': + return new SourceNode( + ast.location.line, + ast.location.column, + ast.location.source, + String(ast.value) + ); + // ... + default: + throw new Error("Bad AST"); + } +} + +var ast = parse("40 + 2", "add.js"); +console.log(compile(ast).toStringWithSourceMap({ + file: 'add.js' +})); +// { code: '40 + 2', +// map: [object SourceMapGenerator] } +``` + +#### With SourceMapGenerator (low level API) + +```js +var map = new SourceMapGenerator({ + file: "source-mapped.js" +}); + +map.addMapping({ + generated: { + line: 10, + column: 35 + }, + source: "foo.js", + original: { + line: 33, + column: 2 + }, + name: "christopher" +}); + +console.log(map.toString()); +// '{"version":3,"file":"source-mapped.js","sources":["foo.js"],"names":["christopher"],"mappings":";;;;;;;;;mCAgCEA"}' +``` + +## API + +Get a reference to the module: + +```js +// Node.js +var sourceMap = require('source-map'); + +// Browser builds +var sourceMap = window.sourceMap; + +// Inside Firefox +const sourceMap = require("devtools/toolkit/sourcemap/source-map.js"); +``` + +### SourceMapConsumer + +A SourceMapConsumer instance represents a parsed source map which we can query +for information about the original file positions by giving it a file position +in the generated source. + +#### new SourceMapConsumer(rawSourceMap) + +The only parameter is the raw source map (either as a string which can be +`JSON.parse`'d, or an object). According to the spec, source maps have the +following attributes: + +* `version`: Which version of the source map spec this map is following. + +* `sources`: An array of URLs to the original source files. + +* `names`: An array of identifiers which can be referenced by individual + mappings. + +* `sourceRoot`: Optional. The URL root from which all sources are relative. + +* `sourcesContent`: Optional. An array of contents of the original source files. + +* `mappings`: A string of base64 VLQs which contain the actual mappings. + +* `file`: Optional. The generated filename this source map is associated with. + +```js +var consumer = new sourceMap.SourceMapConsumer(rawSourceMapJsonData); +``` + +#### SourceMapConsumer.prototype.computeColumnSpans() + +Compute the last column for each generated mapping. The last column is +inclusive. + +```js +// Before: +consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" }) +// [ { line: 2, +// column: 1 }, +// { line: 2, +// column: 10 }, +// { line: 2, +// column: 20 } ] + +consumer.computeColumnSpans(); + +// After: +consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" }) +// [ { line: 2, +// column: 1, +// lastColumn: 9 }, +// { line: 2, +// column: 10, +// lastColumn: 19 }, +// { line: 2, +// column: 20, +// lastColumn: Infinity } ] + +``` + +#### SourceMapConsumer.prototype.originalPositionFor(generatedPosition) + +Returns the original source, line, and column information for the generated +source's line and column positions provided. The only argument is an object with +the following properties: + +* `line`: The line number in the generated source. Line numbers in + this library are 1-based (note that the underlying source map + specification uses 0-based line numbers -- this library handles the + translation). + +* `column`: The column number in the generated source. Column numbers + in this library are 0-based. + +* `bias`: Either `SourceMapConsumer.GREATEST_LOWER_BOUND` or + `SourceMapConsumer.LEAST_UPPER_BOUND`. Specifies whether to return the closest + element that is smaller than or greater than the one we are searching for, + respectively, if the exact element cannot be found. Defaults to + `SourceMapConsumer.GREATEST_LOWER_BOUND`. + +and an object is returned with the following properties: + +* `source`: The original source file, or null if this information is not + available. + +* `line`: The line number in the original source, or null if this information is + not available. The line number is 1-based. + +* `column`: The column number in the original source, or null if this + information is not available. The column number is 0-based. + +* `name`: The original identifier, or null if this information is not available. + +```js +consumer.originalPositionFor({ line: 2, column: 10 }) +// { source: 'foo.coffee', +// line: 2, +// column: 2, +// name: null } + +consumer.originalPositionFor({ line: 99999999999999999, column: 999999999999999 }) +// { source: null, +// line: null, +// column: null, +// name: null } +``` + +#### SourceMapConsumer.prototype.generatedPositionFor(originalPosition) + +Returns the generated line and column information for the original source, +line, and column positions provided. The only argument is an object with +the following properties: + +* `source`: The filename of the original source. + +* `line`: The line number in the original source. The line number is + 1-based. + +* `column`: The column number in the original source. The column + number is 0-based. + +and an object is returned with the following properties: + +* `line`: The line number in the generated source, or null. The line + number is 1-based. + +* `column`: The column number in the generated source, or null. The + column number is 0-based. + +```js +consumer.generatedPositionFor({ source: "example.js", line: 2, column: 10 }) +// { line: 1, +// column: 56 } +``` + +#### SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition) + +Returns all generated line and column information for the original source, line, +and column provided. If no column is provided, returns all mappings +corresponding to a either the line we are searching for or the next closest line +that has any mappings. Otherwise, returns all mappings corresponding to the +given line and either the column we are searching for or the next closest column +that has any offsets. + +The only argument is an object with the following properties: + +* `source`: The filename of the original source. + +* `line`: The line number in the original source. The line number is + 1-based. + +* `column`: Optional. The column number in the original source. The + column number is 0-based. + +and an array of objects is returned, each with the following properties: + +* `line`: The line number in the generated source, or null. The line + number is 1-based. + +* `column`: The column number in the generated source, or null. The + column number is 0-based. + +```js +consumer.allGeneratedpositionsfor({ line: 2, source: "foo.coffee" }) +// [ { line: 2, +// column: 1 }, +// { line: 2, +// column: 10 }, +// { line: 2, +// column: 20 } ] +``` + +#### SourceMapConsumer.prototype.hasContentsOfAllSources() + +Return true if we have the embedded source content for every source listed in +the source map, false otherwise. + +In other words, if this method returns `true`, then +`consumer.sourceContentFor(s)` will succeed for every source `s` in +`consumer.sources`. + +```js +// ... +if (consumer.hasContentsOfAllSources()) { + consumerReadyCallback(consumer); +} else { + fetchSources(consumer, consumerReadyCallback); +} +// ... +``` + +#### SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing]) + +Returns the original source content for the source provided. The only +argument is the URL of the original source file. + +If the source content for the given source is not found, then an error is +thrown. Optionally, pass `true` as the second param to have `null` returned +instead. + +```js +consumer.sources +// [ "my-cool-lib.clj" ] + +consumer.sourceContentFor("my-cool-lib.clj") +// "..." + +consumer.sourceContentFor("this is not in the source map"); +// Error: "this is not in the source map" is not in the source map + +consumer.sourceContentFor("this is not in the source map", true); +// null +``` + +#### SourceMapConsumer.prototype.eachMapping(callback, context, order) + +Iterate over each mapping between an original source/line/column and a +generated line/column in this source map. + +* `callback`: The function that is called with each mapping. Mappings have the + form `{ source, generatedLine, generatedColumn, originalLine, originalColumn, + name }` + +* `context`: Optional. If specified, this object will be the value of `this` + every time that `callback` is called. + +* `order`: Either `SourceMapConsumer.GENERATED_ORDER` or + `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to iterate over + the mappings sorted by the generated file's line/column order or the + original's source/line/column order, respectively. Defaults to + `SourceMapConsumer.GENERATED_ORDER`. + +```js +consumer.eachMapping(function (m) { console.log(m); }) +// ... +// { source: 'illmatic.js', +// generatedLine: 1, +// generatedColumn: 0, +// originalLine: 1, +// originalColumn: 0, +// name: null } +// { source: 'illmatic.js', +// generatedLine: 2, +// generatedColumn: 0, +// originalLine: 2, +// originalColumn: 0, +// name: null } +// ... +``` +### SourceMapGenerator + +An instance of the SourceMapGenerator represents a source map which is being +built incrementally. + +#### new SourceMapGenerator([startOfSourceMap]) + +You may pass an object with the following properties: + +* `file`: The filename of the generated source that this source map is + associated with. + +* `sourceRoot`: A root for all relative URLs in this source map. + +* `skipValidation`: Optional. When `true`, disables validation of mappings as + they are added. This can improve performance but should be used with + discretion, as a last resort. Even then, one should avoid using this flag when + running tests, if possible. + +```js +var generator = new sourceMap.SourceMapGenerator({ + file: "my-generated-javascript-file.js", + sourceRoot: "http://example.com/app/js/" +}); +``` + +#### SourceMapGenerator.fromSourceMap(sourceMapConsumer) + +Creates a new `SourceMapGenerator` from an existing `SourceMapConsumer` instance. + +* `sourceMapConsumer` The SourceMap. + +```js +var generator = sourceMap.SourceMapGenerator.fromSourceMap(consumer); +``` + +#### SourceMapGenerator.prototype.addMapping(mapping) + +Add a single mapping from original source line and column to the generated +source's line and column for this source map being created. The mapping object +should have the following properties: + +* `generated`: An object with the generated line and column positions. + +* `original`: An object with the original line and column positions. + +* `source`: The original source file (relative to the sourceRoot). + +* `name`: An optional original token name for this mapping. + +```js +generator.addMapping({ + source: "module-one.scm", + original: { line: 128, column: 0 }, + generated: { line: 3, column: 456 } +}) +``` + +#### SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent) + +Set the source content for an original source file. + +* `sourceFile` the URL of the original source file. + +* `sourceContent` the content of the source file. + +```js +generator.setSourceContent("module-one.scm", + fs.readFileSync("path/to/module-one.scm")) +``` + +#### SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]]) + +Applies a SourceMap for a source file to the SourceMap. +Each mapping to the supplied source file is rewritten using the +supplied SourceMap. Note: The resolution for the resulting mappings +is the minimum of this map and the supplied map. + +* `sourceMapConsumer`: The SourceMap to be applied. + +* `sourceFile`: Optional. The filename of the source file. + If omitted, sourceMapConsumer.file will be used, if it exists. + Otherwise an error will be thrown. + +* `sourceMapPath`: Optional. The dirname of the path to the SourceMap + to be applied. If relative, it is relative to the SourceMap. + + This parameter is needed when the two SourceMaps aren't in the same + directory, and the SourceMap to be applied contains relative source + paths. If so, those relative source paths need to be rewritten + relative to the SourceMap. + + If omitted, it is assumed that both SourceMaps are in the same directory, + thus not needing any rewriting. (Supplying `'.'` has the same effect.) + +#### SourceMapGenerator.prototype.toString() + +Renders the source map being generated to a string. + +```js +generator.toString() +// '{"version":3,"sources":["module-one.scm"],"names":[],"mappings":"...snip...","file":"my-generated-javascript-file.js","sourceRoot":"http://example.com/app/js/"}' +``` + +### SourceNode + +SourceNodes provide a way to abstract over interpolating and/or concatenating +snippets of generated JavaScript source code, while maintaining the line and +column information associated between those snippets and the original source +code. This is useful as the final intermediate representation a compiler might +use before outputting the generated JS and source map. + +#### new SourceNode([line, column, source[, chunk[, name]]]) + +* `line`: The original line number associated with this source node, or null if + it isn't associated with an original line. The line number is 1-based. + +* `column`: The original column number associated with this source node, or null + if it isn't associated with an original column. The column number + is 0-based. + +* `source`: The original source's filename; null if no filename is provided. + +* `chunk`: Optional. Is immediately passed to `SourceNode.prototype.add`, see + below. + +* `name`: Optional. The original identifier. + +```js +var node = new SourceNode(1, 2, "a.cpp", [ + new SourceNode(3, 4, "b.cpp", "extern int status;\n"), + new SourceNode(5, 6, "c.cpp", "std::string* make_string(size_t n);\n"), + new SourceNode(7, 8, "d.cpp", "int main(int argc, char** argv) {}\n"), +]); +``` + +#### SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath]) + +Creates a SourceNode from generated code and a SourceMapConsumer. + +* `code`: The generated code + +* `sourceMapConsumer` The SourceMap for the generated code + +* `relativePath` The optional path that relative sources in `sourceMapConsumer` + should be relative to. + +```js +var consumer = new SourceMapConsumer(fs.readFileSync("path/to/my-file.js.map", "utf8")); +var node = SourceNode.fromStringWithSourceMap(fs.readFileSync("path/to/my-file.js"), + consumer); +``` + +#### SourceNode.prototype.add(chunk) + +Add a chunk of generated JS to this source node. + +* `chunk`: A string snippet of generated JS code, another instance of + `SourceNode`, or an array where each member is one of those things. + +```js +node.add(" + "); +node.add(otherNode); +node.add([leftHandOperandNode, " + ", rightHandOperandNode]); +``` + +#### SourceNode.prototype.prepend(chunk) + +Prepend a chunk of generated JS to this source node. + +* `chunk`: A string snippet of generated JS code, another instance of + `SourceNode`, or an array where each member is one of those things. + +```js +node.prepend("/** Build Id: f783haef86324gf **/\n\n"); +``` + +#### SourceNode.prototype.setSourceContent(sourceFile, sourceContent) + +Set the source content for a source file. This will be added to the +`SourceMap` in the `sourcesContent` field. + +* `sourceFile`: The filename of the source file + +* `sourceContent`: The content of the source file + +```js +node.setSourceContent("module-one.scm", + fs.readFileSync("path/to/module-one.scm")) +``` + +#### SourceNode.prototype.walk(fn) + +Walk over the tree of JS snippets in this node and its children. The walking +function is called once for each snippet of JS and is passed that snippet and +the its original associated source's line/column location. + +* `fn`: The traversal function. + +```js +var node = new SourceNode(1, 2, "a.js", [ + new SourceNode(3, 4, "b.js", "uno"), + "dos", + [ + "tres", + new SourceNode(5, 6, "c.js", "quatro") + ] +]); + +node.walk(function (code, loc) { console.log("WALK:", code, loc); }) +// WALK: uno { source: 'b.js', line: 3, column: 4, name: null } +// WALK: dos { source: 'a.js', line: 1, column: 2, name: null } +// WALK: tres { source: 'a.js', line: 1, column: 2, name: null } +// WALK: quatro { source: 'c.js', line: 5, column: 6, name: null } +``` + +#### SourceNode.prototype.walkSourceContents(fn) + +Walk over the tree of SourceNodes. The walking function is called for each +source file content and is passed the filename and source content. + +* `fn`: The traversal function. + +```js +var a = new SourceNode(1, 2, "a.js", "generated from a"); +a.setSourceContent("a.js", "original a"); +var b = new SourceNode(1, 2, "b.js", "generated from b"); +b.setSourceContent("b.js", "original b"); +var c = new SourceNode(1, 2, "c.js", "generated from c"); +c.setSourceContent("c.js", "original c"); + +var node = new SourceNode(null, null, null, [a, b, c]); +node.walkSourceContents(function (source, contents) { console.log("WALK:", source, ":", contents); }) +// WALK: a.js : original a +// WALK: b.js : original b +// WALK: c.js : original c +``` + +#### SourceNode.prototype.join(sep) + +Like `Array.prototype.join` except for SourceNodes. Inserts the separator +between each of this source node's children. + +* `sep`: The separator. + +```js +var lhs = new SourceNode(1, 2, "a.rs", "my_copy"); +var operand = new SourceNode(3, 4, "a.rs", "="); +var rhs = new SourceNode(5, 6, "a.rs", "orig.clone()"); + +var node = new SourceNode(null, null, null, [ lhs, operand, rhs ]); +var joinedNode = node.join(" "); +``` + +#### SourceNode.prototype.replaceRight(pattern, replacement) + +Call `String.prototype.replace` on the very right-most source snippet. Useful +for trimming white space from the end of a source node, etc. + +* `pattern`: The pattern to replace. + +* `replacement`: The thing to replace the pattern with. + +```js +// Trim trailing white space. +node.replaceRight(/\s*$/, ""); +``` + +#### SourceNode.prototype.toString() + +Return the string representation of this source node. Walks over the tree and +concatenates all the various snippets together to one string. + +```js +var node = new SourceNode(1, 2, "a.js", [ + new SourceNode(3, 4, "b.js", "uno"), + "dos", + [ + "tres", + new SourceNode(5, 6, "c.js", "quatro") + ] +]); + +node.toString() +// 'unodostresquatro' +``` + +#### SourceNode.prototype.toStringWithSourceMap([startOfSourceMap]) + +Returns the string representation of this tree of source nodes, plus a +SourceMapGenerator which contains all the mappings between the generated and +original sources. + +The arguments are the same as those to `new SourceMapGenerator`. + +```js +var node = new SourceNode(1, 2, "a.js", [ + new SourceNode(3, 4, "b.js", "uno"), + "dos", + [ + "tres", + new SourceNode(5, 6, "c.js", "quatro") + ] +]); + +node.toStringWithSourceMap({ file: "my-output-file.js" }) +// { code: 'unodostresquatro', +// map: [object SourceMapGenerator] } +``` diff --git a/resources/app/node_modules/source-map/dist/source-map.debug.js b/resources/app/node_modules/source-map/dist/source-map.debug.js new file mode 100644 index 0000000..aad0620 --- /dev/null +++ b/resources/app/node_modules/source-map/dist/source-map.debug.js @@ -0,0 +1,3234 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["sourceMap"] = factory(); + else + root["sourceMap"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; +/******/ +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.loaded = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + /* + * Copyright 2009-2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE.txt or: + * http://opensource.org/licenses/BSD-3-Clause + */ + exports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + exports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer; + exports.SourceNode = __webpack_require__(10).SourceNode; + + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var base64VLQ = __webpack_require__(2); + var util = __webpack_require__(4); + var ArraySet = __webpack_require__(5).ArraySet; + var MappingList = __webpack_require__(6).MappingList; + + /** + * An instance of the SourceMapGenerator represents a source map which is + * being built incrementally. You may pass an object with the following + * properties: + * + * - file: The filename of the generated source. + * - sourceRoot: A root for all relative URLs in this source map. + */ + function SourceMapGenerator(aArgs) { + if (!aArgs) { + aArgs = {}; + } + this._file = util.getArg(aArgs, 'file', null); + this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null); + this._skipValidation = util.getArg(aArgs, 'skipValidation', false); + this._sources = new ArraySet(); + this._names = new ArraySet(); + this._mappings = new MappingList(); + this._sourcesContents = null; + } + + SourceMapGenerator.prototype._version = 3; + + /** + * Creates a new SourceMapGenerator based on a SourceMapConsumer + * + * @param aSourceMapConsumer The SourceMap. + */ + SourceMapGenerator.fromSourceMap = + function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) { + var sourceRoot = aSourceMapConsumer.sourceRoot; + var generator = new SourceMapGenerator({ + file: aSourceMapConsumer.file, + sourceRoot: sourceRoot + }); + aSourceMapConsumer.eachMapping(function (mapping) { + var newMapping = { + generated: { + line: mapping.generatedLine, + column: mapping.generatedColumn + } + }; + + if (mapping.source != null) { + newMapping.source = mapping.source; + if (sourceRoot != null) { + newMapping.source = util.relative(sourceRoot, newMapping.source); + } + + newMapping.original = { + line: mapping.originalLine, + column: mapping.originalColumn + }; + + if (mapping.name != null) { + newMapping.name = mapping.name; + } + } + + generator.addMapping(newMapping); + }); + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var sourceRelative = sourceFile; + if (sourceRoot !== null) { + sourceRelative = util.relative(sourceRoot, sourceFile); + } + + if (!generator._sources.has(sourceRelative)) { + generator._sources.add(sourceRelative); + } + + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + generator.setSourceContent(sourceFile, content); + } + }); + return generator; + }; + + /** + * Add a single mapping from original source line and column to the generated + * source's line and column for this source map being created. The mapping + * object should have the following properties: + * + * - generated: An object with the generated line and column positions. + * - original: An object with the original line and column positions. + * - source: The original source file (relative to the sourceRoot). + * - name: An optional original token name for this mapping. + */ + SourceMapGenerator.prototype.addMapping = + function SourceMapGenerator_addMapping(aArgs) { + var generated = util.getArg(aArgs, 'generated'); + var original = util.getArg(aArgs, 'original', null); + var source = util.getArg(aArgs, 'source', null); + var name = util.getArg(aArgs, 'name', null); + + if (!this._skipValidation) { + this._validateMapping(generated, original, source, name); + } + + if (source != null) { + source = String(source); + if (!this._sources.has(source)) { + this._sources.add(source); + } + } + + if (name != null) { + name = String(name); + if (!this._names.has(name)) { + this._names.add(name); + } + } + + this._mappings.add({ + generatedLine: generated.line, + generatedColumn: generated.column, + originalLine: original != null && original.line, + originalColumn: original != null && original.column, + source: source, + name: name + }); + }; + + /** + * Set the source content for a source file. + */ + SourceMapGenerator.prototype.setSourceContent = + function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) { + var source = aSourceFile; + if (this._sourceRoot != null) { + source = util.relative(this._sourceRoot, source); + } + + if (aSourceContent != null) { + // Add the source content to the _sourcesContents map. + // Create a new _sourcesContents map if the property is null. + if (!this._sourcesContents) { + this._sourcesContents = Object.create(null); + } + this._sourcesContents[util.toSetString(source)] = aSourceContent; + } else if (this._sourcesContents) { + // Remove the source file from the _sourcesContents map. + // If the _sourcesContents map is empty, set the property to null. + delete this._sourcesContents[util.toSetString(source)]; + if (Object.keys(this._sourcesContents).length === 0) { + this._sourcesContents = null; + } + } + }; + + /** + * Applies the mappings of a sub-source-map for a specific source file to the + * source map being generated. Each mapping to the supplied source file is + * rewritten using the supplied source map. Note: The resolution for the + * resulting mappings is the minimium of this map and the supplied map. + * + * @param aSourceMapConsumer The source map to be applied. + * @param aSourceFile Optional. The filename of the source file. + * If omitted, SourceMapConsumer's file property will be used. + * @param aSourceMapPath Optional. The dirname of the path to the source map + * to be applied. If relative, it is relative to the SourceMapConsumer. + * This parameter is needed when the two source maps aren't in the same + * directory, and the source map to be applied contains relative source + * paths. If so, those relative source paths need to be rewritten + * relative to the SourceMapGenerator. + */ + SourceMapGenerator.prototype.applySourceMap = + function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) { + var sourceFile = aSourceFile; + // If aSourceFile is omitted, we will use the file property of the SourceMap + if (aSourceFile == null) { + if (aSourceMapConsumer.file == null) { + throw new Error( + 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' + + 'or the source map\'s "file" property. Both were omitted.' + ); + } + sourceFile = aSourceMapConsumer.file; + } + var sourceRoot = this._sourceRoot; + // Make "sourceFile" relative if an absolute Url is passed. + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + // Applying the SourceMap can add and remove items from the sources and + // the names array. + var newSources = new ArraySet(); + var newNames = new ArraySet(); + + // Find mappings for the "sourceFile" + this._mappings.unsortedForEach(function (mapping) { + if (mapping.source === sourceFile && mapping.originalLine != null) { + // Check if it can be mapped by the source map, then update the mapping. + var original = aSourceMapConsumer.originalPositionFor({ + line: mapping.originalLine, + column: mapping.originalColumn + }); + if (original.source != null) { + // Copy mapping + mapping.source = original.source; + if (aSourceMapPath != null) { + mapping.source = util.join(aSourceMapPath, mapping.source) + } + if (sourceRoot != null) { + mapping.source = util.relative(sourceRoot, mapping.source); + } + mapping.originalLine = original.line; + mapping.originalColumn = original.column; + if (original.name != null) { + mapping.name = original.name; + } + } + } + + var source = mapping.source; + if (source != null && !newSources.has(source)) { + newSources.add(source); + } + + var name = mapping.name; + if (name != null && !newNames.has(name)) { + newNames.add(name); + } + + }, this); + this._sources = newSources; + this._names = newNames; + + // Copy sourcesContents of applied map. + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aSourceMapPath != null) { + sourceFile = util.join(aSourceMapPath, sourceFile); + } + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + this.setSourceContent(sourceFile, content); + } + }, this); + }; + + /** + * A mapping can have one of the three levels of data: + * + * 1. Just the generated position. + * 2. The Generated position, original position, and original source. + * 3. Generated and original position, original source, as well as a name + * token. + * + * To maintain consistency, we validate that any new mapping being added falls + * in to one of these categories. + */ + SourceMapGenerator.prototype._validateMapping = + function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource, + aName) { + // When aOriginal is truthy but has empty values for .line and .column, + // it is most likely a programmer error. In this case we throw a very + // specific error message to try to guide them the right way. + // For example: https://github.com/Polymer/polymer-bundler/pull/519 + if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') { + throw new Error( + 'original.line and original.column are not numbers -- you probably meant to omit ' + + 'the original mapping entirely and only map the generated position. If so, pass ' + + 'null for the original mapping instead of an object with empty or null values.' + ); + } + + if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aGenerated.line > 0 && aGenerated.column >= 0 + && !aOriginal && !aSource && !aName) { + // Case 1. + return; + } + else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aOriginal && 'line' in aOriginal && 'column' in aOriginal + && aGenerated.line > 0 && aGenerated.column >= 0 + && aOriginal.line > 0 && aOriginal.column >= 0 + && aSource) { + // Cases 2 and 3. + return; + } + else { + throw new Error('Invalid mapping: ' + JSON.stringify({ + generated: aGenerated, + source: aSource, + original: aOriginal, + name: aName + })); + } + }; + + /** + * Serialize the accumulated mappings in to the stream of base 64 VLQs + * specified by the source map format. + */ + SourceMapGenerator.prototype._serializeMappings = + function SourceMapGenerator_serializeMappings() { + var previousGeneratedColumn = 0; + var previousGeneratedLine = 1; + var previousOriginalColumn = 0; + var previousOriginalLine = 0; + var previousName = 0; + var previousSource = 0; + var result = ''; + var next; + var mapping; + var nameIdx; + var sourceIdx; + + var mappings = this._mappings.toArray(); + for (var i = 0, len = mappings.length; i < len; i++) { + mapping = mappings[i]; + next = '' + + if (mapping.generatedLine !== previousGeneratedLine) { + previousGeneratedColumn = 0; + while (mapping.generatedLine !== previousGeneratedLine) { + next += ';'; + previousGeneratedLine++; + } + } + else { + if (i > 0) { + if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) { + continue; + } + next += ','; + } + } + + next += base64VLQ.encode(mapping.generatedColumn + - previousGeneratedColumn); + previousGeneratedColumn = mapping.generatedColumn; + + if (mapping.source != null) { + sourceIdx = this._sources.indexOf(mapping.source); + next += base64VLQ.encode(sourceIdx - previousSource); + previousSource = sourceIdx; + + // lines are stored 0-based in SourceMap spec version 3 + next += base64VLQ.encode(mapping.originalLine - 1 + - previousOriginalLine); + previousOriginalLine = mapping.originalLine - 1; + + next += base64VLQ.encode(mapping.originalColumn + - previousOriginalColumn); + previousOriginalColumn = mapping.originalColumn; + + if (mapping.name != null) { + nameIdx = this._names.indexOf(mapping.name); + next += base64VLQ.encode(nameIdx - previousName); + previousName = nameIdx; + } + } + + result += next; + } + + return result; + }; + + SourceMapGenerator.prototype._generateSourcesContent = + function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) { + return aSources.map(function (source) { + if (!this._sourcesContents) { + return null; + } + if (aSourceRoot != null) { + source = util.relative(aSourceRoot, source); + } + var key = util.toSetString(source); + return Object.prototype.hasOwnProperty.call(this._sourcesContents, key) + ? this._sourcesContents[key] + : null; + }, this); + }; + + /** + * Externalize the source map. + */ + SourceMapGenerator.prototype.toJSON = + function SourceMapGenerator_toJSON() { + var map = { + version: this._version, + sources: this._sources.toArray(), + names: this._names.toArray(), + mappings: this._serializeMappings() + }; + if (this._file != null) { + map.file = this._file; + } + if (this._sourceRoot != null) { + map.sourceRoot = this._sourceRoot; + } + if (this._sourcesContents) { + map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot); + } + + return map; + }; + + /** + * Render the source map being generated to a string. + */ + SourceMapGenerator.prototype.toString = + function SourceMapGenerator_toString() { + return JSON.stringify(this.toJSON()); + }; + + exports.SourceMapGenerator = SourceMapGenerator; + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + * + * Based on the Base 64 VLQ implementation in Closure Compiler: + * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java + * + * Copyright 2011 The Closure Compiler Authors. All rights reserved. + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above + * copyright notice, this list of conditions and the following + * disclaimer in the documentation and/or other materials provided + * with the distribution. + * * Neither the name of Google Inc. nor the names of its + * contributors may be used to endorse or promote products derived + * from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + + var base64 = __webpack_require__(3); + + // A single base 64 digit can contain 6 bits of data. For the base 64 variable + // length quantities we use in the source map spec, the first bit is the sign, + // the next four bits are the actual value, and the 6th bit is the + // continuation bit. The continuation bit tells us whether there are more + // digits in this value following this digit. + // + // Continuation + // | Sign + // | | + // V V + // 101011 + + var VLQ_BASE_SHIFT = 5; + + // binary: 100000 + var VLQ_BASE = 1 << VLQ_BASE_SHIFT; + + // binary: 011111 + var VLQ_BASE_MASK = VLQ_BASE - 1; + + // binary: 100000 + var VLQ_CONTINUATION_BIT = VLQ_BASE; + + /** + * Converts from a two-complement value to a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary) + * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary) + */ + function toVLQSigned(aValue) { + return aValue < 0 + ? ((-aValue) << 1) + 1 + : (aValue << 1) + 0; + } + + /** + * Converts to a two-complement value from a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1 + * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2 + */ + function fromVLQSigned(aValue) { + var isNegative = (aValue & 1) === 1; + var shifted = aValue >> 1; + return isNegative + ? -shifted + : shifted; + } + + /** + * Returns the base 64 VLQ encoded value. + */ + exports.encode = function base64VLQ_encode(aValue) { + var encoded = ""; + var digit; + + var vlq = toVLQSigned(aValue); + + do { + digit = vlq & VLQ_BASE_MASK; + vlq >>>= VLQ_BASE_SHIFT; + if (vlq > 0) { + // There are still more digits in this value, so we must make sure the + // continuation bit is marked. + digit |= VLQ_CONTINUATION_BIT; + } + encoded += base64.encode(digit); + } while (vlq > 0); + + return encoded; + }; + + /** + * Decodes the next base 64 VLQ value from the given string and returns the + * value and the rest of the string via the out parameter. + */ + exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) { + var strLen = aStr.length; + var result = 0; + var shift = 0; + var continuation, digit; + + do { + if (aIndex >= strLen) { + throw new Error("Expected more digits in base 64 VLQ value."); + } + + digit = base64.decode(aStr.charCodeAt(aIndex++)); + if (digit === -1) { + throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1)); + } + + continuation = !!(digit & VLQ_CONTINUATION_BIT); + digit &= VLQ_BASE_MASK; + result = result + (digit << shift); + shift += VLQ_BASE_SHIFT; + } while (continuation); + + aOutParam.value = fromVLQSigned(result); + aOutParam.rest = aIndex; + }; + + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split(''); + + /** + * Encode an integer in the range of 0 to 63 to a single base 64 digit. + */ + exports.encode = function (number) { + if (0 <= number && number < intToCharMap.length) { + return intToCharMap[number]; + } + throw new TypeError("Must be between 0 and 63: " + number); + }; + + /** + * Decode a single base 64 character code digit to an integer. Returns -1 on + * failure. + */ + exports.decode = function (charCode) { + var bigA = 65; // 'A' + var bigZ = 90; // 'Z' + + var littleA = 97; // 'a' + var littleZ = 122; // 'z' + + var zero = 48; // '0' + var nine = 57; // '9' + + var plus = 43; // '+' + var slash = 47; // '/' + + var littleOffset = 26; + var numberOffset = 52; + + // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ + if (bigA <= charCode && charCode <= bigZ) { + return (charCode - bigA); + } + + // 26 - 51: abcdefghijklmnopqrstuvwxyz + if (littleA <= charCode && charCode <= littleZ) { + return (charCode - littleA + littleOffset); + } + + // 52 - 61: 0123456789 + if (zero <= charCode && charCode <= nine) { + return (charCode - zero + numberOffset); + } + + // 62: + + if (charCode == plus) { + return 62; + } + + // 63: / + if (charCode == slash) { + return 63; + } + + // Invalid base64 digit. + return -1; + }; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + /** + * This is a helper function for getting values from parameter/options + * objects. + * + * @param args The object we are extracting values from + * @param name The name of the property we are getting. + * @param defaultValue An optional value to return if the property is missing + * from the object. If this is not specified and the property is missing, an + * error will be thrown. + */ + function getArg(aArgs, aName, aDefaultValue) { + if (aName in aArgs) { + return aArgs[aName]; + } else if (arguments.length === 3) { + return aDefaultValue; + } else { + throw new Error('"' + aName + '" is a required argument.'); + } + } + exports.getArg = getArg; + + var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/; + var dataUrlRegexp = /^data:.+\,.+$/; + + function urlParse(aUrl) { + var match = aUrl.match(urlRegexp); + if (!match) { + return null; + } + return { + scheme: match[1], + auth: match[2], + host: match[3], + port: match[4], + path: match[5] + }; + } + exports.urlParse = urlParse; + + function urlGenerate(aParsedUrl) { + var url = ''; + if (aParsedUrl.scheme) { + url += aParsedUrl.scheme + ':'; + } + url += '//'; + if (aParsedUrl.auth) { + url += aParsedUrl.auth + '@'; + } + if (aParsedUrl.host) { + url += aParsedUrl.host; + } + if (aParsedUrl.port) { + url += ":" + aParsedUrl.port + } + if (aParsedUrl.path) { + url += aParsedUrl.path; + } + return url; + } + exports.urlGenerate = urlGenerate; + + /** + * Normalizes a path, or the path portion of a URL: + * + * - Replaces consecutive slashes with one slash. + * - Removes unnecessary '.' parts. + * - Removes unnecessary '<dir>/..' parts. + * + * Based on code in the Node.js 'path' core module. + * + * @param aPath The path or url to normalize. + */ + function normalize(aPath) { + var path = aPath; + var url = urlParse(aPath); + if (url) { + if (!url.path) { + return aPath; + } + path = url.path; + } + var isAbsolute = exports.isAbsolute(path); + + var parts = path.split(/\/+/); + for (var part, up = 0, i = parts.length - 1; i >= 0; i--) { + part = parts[i]; + if (part === '.') { + parts.splice(i, 1); + } else if (part === '..') { + up++; + } else if (up > 0) { + if (part === '') { + // The first part is blank if the path is absolute. Trying to go + // above the root is a no-op. Therefore we can remove all '..' parts + // directly after the root. + parts.splice(i + 1, up); + up = 0; + } else { + parts.splice(i, 2); + up--; + } + } + } + path = parts.join('/'); + + if (path === '') { + path = isAbsolute ? '/' : '.'; + } + + if (url) { + url.path = path; + return urlGenerate(url); + } + return path; + } + exports.normalize = normalize; + + /** + * Joins two paths/URLs. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be joined with the root. + * + * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a + * scheme-relative URL: Then the scheme of aRoot, if any, is prepended + * first. + * - Otherwise aPath is a path. If aRoot is a URL, then its path portion + * is updated with the result and aRoot is returned. Otherwise the result + * is returned. + * - If aPath is absolute, the result is aPath. + * - Otherwise the two paths are joined with a slash. + * - Joining for example 'http://' and 'www.example.com' is also supported. + */ + function join(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + if (aPath === "") { + aPath = "."; + } + var aPathUrl = urlParse(aPath); + var aRootUrl = urlParse(aRoot); + if (aRootUrl) { + aRoot = aRootUrl.path || '/'; + } + + // `join(foo, '//www.example.org')` + if (aPathUrl && !aPathUrl.scheme) { + if (aRootUrl) { + aPathUrl.scheme = aRootUrl.scheme; + } + return urlGenerate(aPathUrl); + } + + if (aPathUrl || aPath.match(dataUrlRegexp)) { + return aPath; + } + + // `join('http://', 'www.example.com')` + if (aRootUrl && !aRootUrl.host && !aRootUrl.path) { + aRootUrl.host = aPath; + return urlGenerate(aRootUrl); + } + + var joined = aPath.charAt(0) === '/' + ? aPath + : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath); + + if (aRootUrl) { + aRootUrl.path = joined; + return urlGenerate(aRootUrl); + } + return joined; + } + exports.join = join; + + exports.isAbsolute = function (aPath) { + return aPath.charAt(0) === '/' || urlRegexp.test(aPath); + }; + + /** + * Make a path relative to a URL or another path. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be made relative to aRoot. + */ + function relative(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + + aRoot = aRoot.replace(/\/$/, ''); + + // It is possible for the path to be above the root. In this case, simply + // checking whether the root is a prefix of the path won't work. Instead, we + // need to remove components from the root one by one, until either we find + // a prefix that fits, or we run out of components to remove. + var level = 0; + while (aPath.indexOf(aRoot + '/') !== 0) { + var index = aRoot.lastIndexOf("/"); + if (index < 0) { + return aPath; + } + + // If the only part of the root that is left is the scheme (i.e. http://, + // file:///, etc.), one or more slashes (/), or simply nothing at all, we + // have exhausted all components, so the path is not relative to the root. + aRoot = aRoot.slice(0, index); + if (aRoot.match(/^([^\/]+:\/)?\/*$/)) { + return aPath; + } + + ++level; + } + + // Make sure we add a "../" for each component we removed from the root. + return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1); + } + exports.relative = relative; + + var supportsNullProto = (function () { + var obj = Object.create(null); + return !('__proto__' in obj); + }()); + + function identity (s) { + return s; + } + + /** + * Because behavior goes wacky when you set `__proto__` on objects, we + * have to prefix all the strings in our set with an arbitrary character. + * + * See https://github.com/mozilla/source-map/pull/31 and + * https://github.com/mozilla/source-map/issues/30 + * + * @param String aStr + */ + function toSetString(aStr) { + if (isProtoString(aStr)) { + return '$' + aStr; + } + + return aStr; + } + exports.toSetString = supportsNullProto ? identity : toSetString; + + function fromSetString(aStr) { + if (isProtoString(aStr)) { + return aStr.slice(1); + } + + return aStr; + } + exports.fromSetString = supportsNullProto ? identity : fromSetString; + + function isProtoString(s) { + if (!s) { + return false; + } + + var length = s.length; + + if (length < 9 /* "__proto__".length */) { + return false; + } + + if (s.charCodeAt(length - 1) !== 95 /* '_' */ || + s.charCodeAt(length - 2) !== 95 /* '_' */ || + s.charCodeAt(length - 3) !== 111 /* 'o' */ || + s.charCodeAt(length - 4) !== 116 /* 't' */ || + s.charCodeAt(length - 5) !== 111 /* 'o' */ || + s.charCodeAt(length - 6) !== 114 /* 'r' */ || + s.charCodeAt(length - 7) !== 112 /* 'p' */ || + s.charCodeAt(length - 8) !== 95 /* '_' */ || + s.charCodeAt(length - 9) !== 95 /* '_' */) { + return false; + } + + for (var i = length - 10; i >= 0; i--) { + if (s.charCodeAt(i) !== 36 /* '$' */) { + return false; + } + } + + return true; + } + + /** + * Comparator between two mappings where the original positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same original source/line/column, but different generated + * line and column the same. Useful when searching for a mapping with a + * stubbed out mapping. + */ + function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) { + var cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0 || onlyCompareOriginal) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByOriginalPositions = compareByOriginalPositions; + + /** + * Comparator between two mappings with deflated source and name indices where + * the generated positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same generated line and column, but different + * source/name/original line and column the same. Useful when searching for a + * mapping with a stubbed out mapping. + */ + function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0 || onlyCompareGenerated) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated; + + function strcmp(aStr1, aStr2) { + if (aStr1 === aStr2) { + return 0; + } + + if (aStr1 === null) { + return 1; // aStr2 !== null + } + + if (aStr2 === null) { + return -1; // aStr1 !== null + } + + if (aStr1 > aStr2) { + return 1; + } + + return -1; + } + + /** + * Comparator between two mappings with inflated source and name strings where + * the generated positions are compared. + */ + function compareByGeneratedPositionsInflated(mappingA, mappingB) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated; + + /** + * Strip any JSON XSSI avoidance prefix from the string (as documented + * in the source maps specification), and then parse the string as + * JSON. + */ + function parseSourceMapInput(str) { + return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, '')); + } + exports.parseSourceMapInput = parseSourceMapInput; + + /** + * Compute the URL of a source given the the source root, the source's + * URL, and the source map's URL. + */ + function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) { + sourceURL = sourceURL || ''; + + if (sourceRoot) { + // This follows what Chrome does. + if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') { + sourceRoot += '/'; + } + // The spec says: + // Line 4: An optional source root, useful for relocating source + // files on a server or removing repeated values in the + // “sources” entry. This value is prepended to the individual + // entries in the “source” field. + sourceURL = sourceRoot + sourceURL; + } + + // Historically, SourceMapConsumer did not take the sourceMapURL as + // a parameter. This mode is still somewhat supported, which is why + // this code block is conditional. However, it's preferable to pass + // the source map URL to SourceMapConsumer, so that this function + // can implement the source URL resolution algorithm as outlined in + // the spec. This block is basically the equivalent of: + // new URL(sourceURL, sourceMapURL).toString() + // ... except it avoids using URL, which wasn't available in the + // older releases of node still supported by this library. + // + // The spec says: + // If the sources are not absolute URLs after prepending of the + // “sourceRoot”, the sources are resolved relative to the + // SourceMap (like resolving script src in a html document). + if (sourceMapURL) { + var parsed = urlParse(sourceMapURL); + if (!parsed) { + throw new Error("sourceMapURL could not be parsed"); + } + if (parsed.path) { + // Strip the last path component, but keep the "/". + var index = parsed.path.lastIndexOf('/'); + if (index >= 0) { + parsed.path = parsed.path.substring(0, index + 1); + } + } + sourceURL = join(urlGenerate(parsed), sourceURL); + } + + return normalize(sourceURL); + } + exports.computeSourceURL = computeSourceURL; + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var has = Object.prototype.hasOwnProperty; + var hasNativeMap = typeof Map !== "undefined"; + + /** + * A data structure which is a combination of an array and a set. Adding a new + * member is O(1), testing for membership is O(1), and finding the index of an + * element is O(1). Removing elements from the set is not supported. Only + * strings are supported for membership. + */ + function ArraySet() { + this._array = []; + this._set = hasNativeMap ? new Map() : Object.create(null); + } + + /** + * Static method for creating ArraySet instances from an existing array. + */ + ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) { + var set = new ArraySet(); + for (var i = 0, len = aArray.length; i < len; i++) { + set.add(aArray[i], aAllowDuplicates); + } + return set; + }; + + /** + * Return how many unique items are in this ArraySet. If duplicates have been + * added, than those do not count towards the size. + * + * @returns Number + */ + ArraySet.prototype.size = function ArraySet_size() { + return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length; + }; + + /** + * Add the given string to this set. + * + * @param String aStr + */ + ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) { + var sStr = hasNativeMap ? aStr : util.toSetString(aStr); + var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr); + var idx = this._array.length; + if (!isDuplicate || aAllowDuplicates) { + this._array.push(aStr); + } + if (!isDuplicate) { + if (hasNativeMap) { + this._set.set(aStr, idx); + } else { + this._set[sStr] = idx; + } + } + }; + + /** + * Is the given string a member of this set? + * + * @param String aStr + */ + ArraySet.prototype.has = function ArraySet_has(aStr) { + if (hasNativeMap) { + return this._set.has(aStr); + } else { + var sStr = util.toSetString(aStr); + return has.call(this._set, sStr); + } + }; + + /** + * What is the index of the given string in the array? + * + * @param String aStr + */ + ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) { + if (hasNativeMap) { + var idx = this._set.get(aStr); + if (idx >= 0) { + return idx; + } + } else { + var sStr = util.toSetString(aStr); + if (has.call(this._set, sStr)) { + return this._set[sStr]; + } + } + + throw new Error('"' + aStr + '" is not in the set.'); + }; + + /** + * What is the element at the given index? + * + * @param Number aIdx + */ + ArraySet.prototype.at = function ArraySet_at(aIdx) { + if (aIdx >= 0 && aIdx < this._array.length) { + return this._array[aIdx]; + } + throw new Error('No element indexed by ' + aIdx); + }; + + /** + * Returns the array representation of this set (which has the proper indices + * indicated by indexOf). Note that this is a copy of the internal array used + * for storing the members so that no one can mess with internal state. + */ + ArraySet.prototype.toArray = function ArraySet_toArray() { + return this._array.slice(); + }; + + exports.ArraySet = ArraySet; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2014 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + + /** + * Determine whether mappingB is after mappingA with respect to generated + * position. + */ + function generatedPositionAfter(mappingA, mappingB) { + // Optimized for most common case + var lineA = mappingA.generatedLine; + var lineB = mappingB.generatedLine; + var columnA = mappingA.generatedColumn; + var columnB = mappingB.generatedColumn; + return lineB > lineA || lineB == lineA && columnB >= columnA || + util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0; + } + + /** + * A data structure to provide a sorted view of accumulated mappings in a + * performance conscious manner. It trades a neglibable overhead in general + * case for a large speedup in case of mappings being added in order. + */ + function MappingList() { + this._array = []; + this._sorted = true; + // Serves as infimum + this._last = {generatedLine: -1, generatedColumn: 0}; + } + + /** + * Iterate through internal items. This method takes the same arguments that + * `Array.prototype.forEach` takes. + * + * NOTE: The order of the mappings is NOT guaranteed. + */ + MappingList.prototype.unsortedForEach = + function MappingList_forEach(aCallback, aThisArg) { + this._array.forEach(aCallback, aThisArg); + }; + + /** + * Add the given source mapping. + * + * @param Object aMapping + */ + MappingList.prototype.add = function MappingList_add(aMapping) { + if (generatedPositionAfter(this._last, aMapping)) { + this._last = aMapping; + this._array.push(aMapping); + } else { + this._sorted = false; + this._array.push(aMapping); + } + }; + + /** + * Returns the flat, sorted array of mappings. The mappings are sorted by + * generated position. + * + * WARNING: This method returns internal data without copying, for + * performance. The return value must NOT be mutated, and should be treated as + * an immutable borrow. If you want to take ownership, you must make your own + * copy. + */ + MappingList.prototype.toArray = function MappingList_toArray() { + if (!this._sorted) { + this._array.sort(util.compareByGeneratedPositionsInflated); + this._sorted = true; + } + return this._array; + }; + + exports.MappingList = MappingList; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var binarySearch = __webpack_require__(8); + var ArraySet = __webpack_require__(5).ArraySet; + var base64VLQ = __webpack_require__(2); + var quickSort = __webpack_require__(9).quickSort; + + function SourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + return sourceMap.sections != null + ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL) + : new BasicSourceMapConsumer(sourceMap, aSourceMapURL); + } + + SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) { + return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL); + } + + /** + * The version of the source mapping spec that we are consuming. + */ + SourceMapConsumer.prototype._version = 3; + + // `__generatedMappings` and `__originalMappings` are arrays that hold the + // parsed mapping coordinates from the source map's "mappings" attribute. They + // are lazily instantiated, accessed via the `_generatedMappings` and + // `_originalMappings` getters respectively, and we only parse the mappings + // and create these arrays once queried for a source location. We jump through + // these hoops because there can be many thousands of mappings, and parsing + // them is expensive, so we only want to do it if we must. + // + // Each object in the arrays is of the form: + // + // { + // generatedLine: The line number in the generated code, + // generatedColumn: The column number in the generated code, + // source: The path to the original source file that generated this + // chunk of code, + // originalLine: The line number in the original source that + // corresponds to this chunk of generated code, + // originalColumn: The column number in the original source that + // corresponds to this chunk of generated code, + // name: The name of the original symbol which generated this chunk of + // code. + // } + // + // All properties except for `generatedLine` and `generatedColumn` can be + // `null`. + // + // `_generatedMappings` is ordered by the generated positions. + // + // `_originalMappings` is ordered by the original positions. + + SourceMapConsumer.prototype.__generatedMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__generatedMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__generatedMappings; + } + }); + + SourceMapConsumer.prototype.__originalMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__originalMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__originalMappings; + } + }); + + SourceMapConsumer.prototype._charIsMappingSeparator = + function SourceMapConsumer_charIsMappingSeparator(aStr, index) { + var c = aStr.charAt(index); + return c === ";" || c === ","; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + SourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + throw new Error("Subclasses must implement _parseMappings"); + }; + + SourceMapConsumer.GENERATED_ORDER = 1; + SourceMapConsumer.ORIGINAL_ORDER = 2; + + SourceMapConsumer.GREATEST_LOWER_BOUND = 1; + SourceMapConsumer.LEAST_UPPER_BOUND = 2; + + /** + * Iterate over each mapping between an original source/line/column and a + * generated line/column in this source map. + * + * @param Function aCallback + * The function that is called with each mapping. + * @param Object aContext + * Optional. If specified, this object will be the value of `this` every + * time that `aCallback` is called. + * @param aOrder + * Either `SourceMapConsumer.GENERATED_ORDER` or + * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to + * iterate over the mappings sorted by the generated file's line/column + * order or the original's source/line/column order, respectively. Defaults to + * `SourceMapConsumer.GENERATED_ORDER`. + */ + SourceMapConsumer.prototype.eachMapping = + function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) { + var context = aContext || null; + var order = aOrder || SourceMapConsumer.GENERATED_ORDER; + + var mappings; + switch (order) { + case SourceMapConsumer.GENERATED_ORDER: + mappings = this._generatedMappings; + break; + case SourceMapConsumer.ORIGINAL_ORDER: + mappings = this._originalMappings; + break; + default: + throw new Error("Unknown order of iteration."); + } + + var sourceRoot = this.sourceRoot; + mappings.map(function (mapping) { + var source = mapping.source === null ? null : this._sources.at(mapping.source); + source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL); + return { + source: source, + generatedLine: mapping.generatedLine, + generatedColumn: mapping.generatedColumn, + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: mapping.name === null ? null : this._names.at(mapping.name) + }; + }, this).forEach(aCallback, context); + }; + + /** + * Returns all generated line and column information for the original source, + * line, and column provided. If no column is provided, returns all mappings + * corresponding to a either the line we are searching for or the next + * closest line that has any mappings. Otherwise, returns all mappings + * corresponding to the given line and either the column we are searching for + * or the next closest column that has any offsets. + * + * The only argument is an object with the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number is 1-based. + * - column: Optional. the column number in the original source. + * The column number is 0-based. + * + * and an array of objects is returned, each with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + SourceMapConsumer.prototype.allGeneratedPositionsFor = + function SourceMapConsumer_allGeneratedPositionsFor(aArgs) { + var line = util.getArg(aArgs, 'line'); + + // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping + // returns the index of the closest mapping less than the needle. By + // setting needle.originalColumn to 0, we thus find the last mapping for + // the given line, provided such a mapping exists. + var needle = { + source: util.getArg(aArgs, 'source'), + originalLine: line, + originalColumn: util.getArg(aArgs, 'column', 0) + }; + + needle.source = this._findSourceIndex(needle.source); + if (needle.source < 0) { + return []; + } + + var mappings = []; + + var index = this._findMapping(needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + binarySearch.LEAST_UPPER_BOUND); + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (aArgs.column === undefined) { + var originalLine = mapping.originalLine; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we found. Since + // mappings are sorted, this is guaranteed to find all mappings for + // the line we found. + while (mapping && mapping.originalLine === originalLine) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } else { + var originalColumn = mapping.originalColumn; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we were searching for. + // Since mappings are sorted, this is guaranteed to find all mappings for + // the line we are searching for. + while (mapping && + mapping.originalLine === line && + mapping.originalColumn == originalColumn) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } + } + + return mappings; + }; + + exports.SourceMapConsumer = SourceMapConsumer; + + /** + * A BasicSourceMapConsumer instance represents a parsed source map which we can + * query for information about the original file positions by giving it a file + * position in the generated source. + * + * The first parameter is the raw source map (either as a JSON string, or + * already parsed to an object). According to the spec, source maps have the + * following attributes: + * + * - version: Which version of the source map spec this map is following. + * - sources: An array of URLs to the original source files. + * - names: An array of identifiers which can be referrenced by individual mappings. + * - sourceRoot: Optional. The URL root from which all sources are relative. + * - sourcesContent: Optional. An array of contents of the original source files. + * - mappings: A string of base64 VLQs which contain the actual mappings. + * - file: Optional. The generated file this source map is associated with. + * + * Here is an example source map, taken from the source map spec[0]: + * + * { + * version : 3, + * file: "out.js", + * sourceRoot : "", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AA,AB;;ABCDE;" + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1# + */ + function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sources = util.getArg(sourceMap, 'sources'); + // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which + // requires the array) to play nice here. + var names = util.getArg(sourceMap, 'names', []); + var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null); + var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null); + var mappings = util.getArg(sourceMap, 'mappings'); + var file = util.getArg(sourceMap, 'file', null); + + // Once again, Sass deviates from the spec and supplies the version as a + // string rather than a number, so we use loose equality checking here. + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + if (sourceRoot) { + sourceRoot = util.normalize(sourceRoot); + } + + sources = sources + .map(String) + // Some source maps produce relative source paths like "./foo.js" instead of + // "foo.js". Normalize these first so that future comparisons will succeed. + // See bugzil.la/1090768. + .map(util.normalize) + // Always ensure that absolute sources are internally stored relative to + // the source root, if the source root is absolute. Not doing this would + // be particularly problematic when the source root is a prefix of the + // source (valid, but why??). See github issue #199 and bugzil.la/1188982. + .map(function (source) { + return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source) + ? util.relative(sourceRoot, source) + : source; + }); + + // Pass `true` below to allow duplicate names and sources. While source maps + // are intended to be compressed and deduplicated, the TypeScript compiler + // sometimes generates source maps with duplicates in them. See Github issue + // #72 and bugzil.la/889492. + this._names = ArraySet.fromArray(names.map(String), true); + this._sources = ArraySet.fromArray(sources, true); + + this._absoluteSources = this._sources.toArray().map(function (s) { + return util.computeSourceURL(sourceRoot, s, aSourceMapURL); + }); + + this.sourceRoot = sourceRoot; + this.sourcesContent = sourcesContent; + this._mappings = mappings; + this._sourceMapURL = aSourceMapURL; + this.file = file; + } + + BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer; + + /** + * Utility function to find the index of a source. Returns -1 if not + * found. + */ + BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) { + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + if (this._sources.has(relativeSource)) { + return this._sources.indexOf(relativeSource); + } + + // Maybe aSource is an absolute URL as returned by |sources|. In + // this case we can't simply undo the transform. + var i; + for (i = 0; i < this._absoluteSources.length; ++i) { + if (this._absoluteSources[i] == aSource) { + return i; + } + } + + return -1; + }; + + /** + * Create a BasicSourceMapConsumer from a SourceMapGenerator. + * + * @param SourceMapGenerator aSourceMap + * The source map that will be consumed. + * @param String aSourceMapURL + * The URL at which the source map can be found (optional) + * @returns BasicSourceMapConsumer + */ + BasicSourceMapConsumer.fromSourceMap = + function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) { + var smc = Object.create(BasicSourceMapConsumer.prototype); + + var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true); + var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true); + smc.sourceRoot = aSourceMap._sourceRoot; + smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(), + smc.sourceRoot); + smc.file = aSourceMap._file; + smc._sourceMapURL = aSourceMapURL; + smc._absoluteSources = smc._sources.toArray().map(function (s) { + return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL); + }); + + // Because we are modifying the entries (by converting string sources and + // names to indices into the sources and names ArraySets), we have to make + // a copy of the entry or else bad things happen. Shared mutable state + // strikes again! See github issue #191. + + var generatedMappings = aSourceMap._mappings.toArray().slice(); + var destGeneratedMappings = smc.__generatedMappings = []; + var destOriginalMappings = smc.__originalMappings = []; + + for (var i = 0, length = generatedMappings.length; i < length; i++) { + var srcMapping = generatedMappings[i]; + var destMapping = new Mapping; + destMapping.generatedLine = srcMapping.generatedLine; + destMapping.generatedColumn = srcMapping.generatedColumn; + + if (srcMapping.source) { + destMapping.source = sources.indexOf(srcMapping.source); + destMapping.originalLine = srcMapping.originalLine; + destMapping.originalColumn = srcMapping.originalColumn; + + if (srcMapping.name) { + destMapping.name = names.indexOf(srcMapping.name); + } + + destOriginalMappings.push(destMapping); + } + + destGeneratedMappings.push(destMapping); + } + + quickSort(smc.__originalMappings, util.compareByOriginalPositions); + + return smc; + }; + + /** + * The version of the source mapping spec that we are consuming. + */ + BasicSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', { + get: function () { + return this._absoluteSources.slice(); + } + }); + + /** + * Provide the JIT with a nice shape / hidden class. + */ + function Mapping() { + this.generatedLine = 0; + this.generatedColumn = 0; + this.source = null; + this.originalLine = null; + this.originalColumn = null; + this.name = null; + } + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + BasicSourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + var generatedLine = 1; + var previousGeneratedColumn = 0; + var previousOriginalLine = 0; + var previousOriginalColumn = 0; + var previousSource = 0; + var previousName = 0; + var length = aStr.length; + var index = 0; + var cachedSegments = {}; + var temp = {}; + var originalMappings = []; + var generatedMappings = []; + var mapping, str, segment, end, value; + + while (index < length) { + if (aStr.charAt(index) === ';') { + generatedLine++; + index++; + previousGeneratedColumn = 0; + } + else if (aStr.charAt(index) === ',') { + index++; + } + else { + mapping = new Mapping(); + mapping.generatedLine = generatedLine; + + // Because each offset is encoded relative to the previous one, + // many segments often have the same encoding. We can exploit this + // fact by caching the parsed variable length fields of each segment, + // allowing us to avoid a second parse if we encounter the same + // segment again. + for (end = index; end < length; end++) { + if (this._charIsMappingSeparator(aStr, end)) { + break; + } + } + str = aStr.slice(index, end); + + segment = cachedSegments[str]; + if (segment) { + index += str.length; + } else { + segment = []; + while (index < end) { + base64VLQ.decode(aStr, index, temp); + value = temp.value; + index = temp.rest; + segment.push(value); + } + + if (segment.length === 2) { + throw new Error('Found a source, but no line and column'); + } + + if (segment.length === 3) { + throw new Error('Found a source and line, but no column'); + } + + cachedSegments[str] = segment; + } + + // Generated column. + mapping.generatedColumn = previousGeneratedColumn + segment[0]; + previousGeneratedColumn = mapping.generatedColumn; + + if (segment.length > 1) { + // Original source. + mapping.source = previousSource + segment[1]; + previousSource += segment[1]; + + // Original line. + mapping.originalLine = previousOriginalLine + segment[2]; + previousOriginalLine = mapping.originalLine; + // Lines are stored 0-based + mapping.originalLine += 1; + + // Original column. + mapping.originalColumn = previousOriginalColumn + segment[3]; + previousOriginalColumn = mapping.originalColumn; + + if (segment.length > 4) { + // Original name. + mapping.name = previousName + segment[4]; + previousName += segment[4]; + } + } + + generatedMappings.push(mapping); + if (typeof mapping.originalLine === 'number') { + originalMappings.push(mapping); + } + } + } + + quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated); + this.__generatedMappings = generatedMappings; + + quickSort(originalMappings, util.compareByOriginalPositions); + this.__originalMappings = originalMappings; + }; + + /** + * Find the mapping that best matches the hypothetical "needle" mapping that + * we are searching for in the given "haystack" of mappings. + */ + BasicSourceMapConsumer.prototype._findMapping = + function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName, + aColumnName, aComparator, aBias) { + // To return the position we are searching for, we must first find the + // mapping for the given position and then return the opposite position it + // points to. Because the mappings are sorted, we can use binary search to + // find the best mapping. + + if (aNeedle[aLineName] <= 0) { + throw new TypeError('Line must be greater than or equal to 1, got ' + + aNeedle[aLineName]); + } + if (aNeedle[aColumnName] < 0) { + throw new TypeError('Column must be greater than or equal to 0, got ' + + aNeedle[aColumnName]); + } + + return binarySearch.search(aNeedle, aMappings, aComparator, aBias); + }; + + /** + * Compute the last column for each generated mapping. The last column is + * inclusive. + */ + BasicSourceMapConsumer.prototype.computeColumnSpans = + function SourceMapConsumer_computeColumnSpans() { + for (var index = 0; index < this._generatedMappings.length; ++index) { + var mapping = this._generatedMappings[index]; + + // Mappings do not contain a field for the last generated columnt. We + // can come up with an optimistic estimate, however, by assuming that + // mappings are contiguous (i.e. given two consecutive mappings, the + // first mapping ends where the second one starts). + if (index + 1 < this._generatedMappings.length) { + var nextMapping = this._generatedMappings[index + 1]; + + if (mapping.generatedLine === nextMapping.generatedLine) { + mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1; + continue; + } + } + + // The last mapping for each line spans the entire line. + mapping.lastGeneratedColumn = Infinity; + } + }; + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + BasicSourceMapConsumer.prototype.originalPositionFor = + function SourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._generatedMappings, + "generatedLine", + "generatedColumn", + util.compareByGeneratedPositionsDeflated, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._generatedMappings[index]; + + if (mapping.generatedLine === needle.generatedLine) { + var source = util.getArg(mapping, 'source', null); + if (source !== null) { + source = this._sources.at(source); + source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL); + } + var name = util.getArg(mapping, 'name', null); + if (name !== null) { + name = this._names.at(name); + } + return { + source: source, + line: util.getArg(mapping, 'originalLine', null), + column: util.getArg(mapping, 'originalColumn', null), + name: name + }; + } + } + + return { + source: null, + line: null, + column: null, + name: null + }; + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + BasicSourceMapConsumer.prototype.hasContentsOfAllSources = + function BasicSourceMapConsumer_hasContentsOfAllSources() { + if (!this.sourcesContent) { + return false; + } + return this.sourcesContent.length >= this._sources.size() && + !this.sourcesContent.some(function (sc) { return sc == null; }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + BasicSourceMapConsumer.prototype.sourceContentFor = + function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + if (!this.sourcesContent) { + return null; + } + + var index = this._findSourceIndex(aSource); + if (index >= 0) { + return this.sourcesContent[index]; + } + + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + var url; + if (this.sourceRoot != null + && (url = util.urlParse(this.sourceRoot))) { + // XXX: file:// URIs and absolute paths lead to unexpected behavior for + // many users. We can help them out when they expect file:// URIs to + // behave like it would if they were running a local HTTP server. See + // https://bugzilla.mozilla.org/show_bug.cgi?id=885597. + var fileUriAbsPath = relativeSource.replace(/^file:\/\//, ""); + if (url.scheme == "file" + && this._sources.has(fileUriAbsPath)) { + return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)] + } + + if ((!url.path || url.path == "/") + && this._sources.has("/" + relativeSource)) { + return this.sourcesContent[this._sources.indexOf("/" + relativeSource)]; + } + } + + // This function is used recursively from + // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we + // don't want to throw if we can't find the source - we just want to + // return null, so we provide a flag to exit gracefully. + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + relativeSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + BasicSourceMapConsumer.prototype.generatedPositionFor = + function SourceMapConsumer_generatedPositionFor(aArgs) { + var source = util.getArg(aArgs, 'source'); + source = this._findSourceIndex(source); + if (source < 0) { + return { + line: null, + column: null, + lastColumn: null + }; + } + + var needle = { + source: source, + originalLine: util.getArg(aArgs, 'line'), + originalColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (mapping.source === needle.source) { + return { + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }; + } + } + + return { + line: null, + column: null, + lastColumn: null + }; + }; + + exports.BasicSourceMapConsumer = BasicSourceMapConsumer; + + /** + * An IndexedSourceMapConsumer instance represents a parsed source map which + * we can query for information. It differs from BasicSourceMapConsumer in + * that it takes "indexed" source maps (i.e. ones with a "sections" field) as + * input. + * + * The first parameter is a raw source map (either as a JSON string, or already + * parsed to an object). According to the spec for indexed source maps, they + * have the following attributes: + * + * - version: Which version of the source map spec this map is following. + * - file: Optional. The generated file this source map is associated with. + * - sections: A list of section definitions. + * + * Each value under the "sections" field has two fields: + * - offset: The offset into the original specified at which this section + * begins to apply, defined as an object with a "line" and "column" + * field. + * - map: A source map definition. This source map could also be indexed, + * but doesn't have to be. + * + * Instead of the "map" field, it's also possible to have a "url" field + * specifying a URL to retrieve a source map from, but that's currently + * unsupported. + * + * Here's an example source map, taken from the source map spec[0], but + * modified to omit a section which uses the "url" field. + * + * { + * version : 3, + * file: "app.js", + * sections: [{ + * offset: {line:100, column:10}, + * map: { + * version : 3, + * file: "section.js", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AAAA,E;;ABCDE;" + * } + * }], + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt + */ + function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sections = util.getArg(sourceMap, 'sections'); + + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + this._sources = new ArraySet(); + this._names = new ArraySet(); + + var lastOffset = { + line: -1, + column: 0 + }; + this._sections = sections.map(function (s) { + if (s.url) { + // The url field will require support for asynchronicity. + // See https://github.com/mozilla/source-map/issues/16 + throw new Error('Support for url field in sections not implemented.'); + } + var offset = util.getArg(s, 'offset'); + var offsetLine = util.getArg(offset, 'line'); + var offsetColumn = util.getArg(offset, 'column'); + + if (offsetLine < lastOffset.line || + (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) { + throw new Error('Section offsets must be ordered and non-overlapping.'); + } + lastOffset = offset; + + return { + generatedOffset: { + // The offset fields are 0-based, but we use 1-based indices when + // encoding/decoding from VLQ. + generatedLine: offsetLine + 1, + generatedColumn: offsetColumn + 1 + }, + consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL) + } + }); + } + + IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer; + + /** + * The version of the source mapping spec that we are consuming. + */ + IndexedSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', { + get: function () { + var sources = []; + for (var i = 0; i < this._sections.length; i++) { + for (var j = 0; j < this._sections[i].consumer.sources.length; j++) { + sources.push(this._sections[i].consumer.sources[j]); + } + } + return sources; + } + }); + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + IndexedSourceMapConsumer.prototype.originalPositionFor = + function IndexedSourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + // Find the section containing the generated position we're trying to map + // to an original position. + var sectionIndex = binarySearch.search(needle, this._sections, + function(needle, section) { + var cmp = needle.generatedLine - section.generatedOffset.generatedLine; + if (cmp) { + return cmp; + } + + return (needle.generatedColumn - + section.generatedOffset.generatedColumn); + }); + var section = this._sections[sectionIndex]; + + if (!section) { + return { + source: null, + line: null, + column: null, + name: null + }; + } + + return section.consumer.originalPositionFor({ + line: needle.generatedLine - + (section.generatedOffset.generatedLine - 1), + column: needle.generatedColumn - + (section.generatedOffset.generatedLine === needle.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + bias: aArgs.bias + }); + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + IndexedSourceMapConsumer.prototype.hasContentsOfAllSources = + function IndexedSourceMapConsumer_hasContentsOfAllSources() { + return this._sections.every(function (s) { + return s.consumer.hasContentsOfAllSources(); + }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + IndexedSourceMapConsumer.prototype.sourceContentFor = + function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + var content = section.consumer.sourceContentFor(aSource, true); + if (content) { + return content; + } + } + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + aSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + IndexedSourceMapConsumer.prototype.generatedPositionFor = + function IndexedSourceMapConsumer_generatedPositionFor(aArgs) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + // Only consider this section if the requested source is in the list of + // sources of the consumer. + if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) { + continue; + } + var generatedPosition = section.consumer.generatedPositionFor(aArgs); + if (generatedPosition) { + var ret = { + line: generatedPosition.line + + (section.generatedOffset.generatedLine - 1), + column: generatedPosition.column + + (section.generatedOffset.generatedLine === generatedPosition.line + ? section.generatedOffset.generatedColumn - 1 + : 0) + }; + return ret; + } + } + + return { + line: null, + column: null + }; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + IndexedSourceMapConsumer.prototype._parseMappings = + function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) { + this.__generatedMappings = []; + this.__originalMappings = []; + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + var sectionMappings = section.consumer._generatedMappings; + for (var j = 0; j < sectionMappings.length; j++) { + var mapping = sectionMappings[j]; + + var source = section.consumer._sources.at(mapping.source); + source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL); + this._sources.add(source); + source = this._sources.indexOf(source); + + var name = null; + if (mapping.name) { + name = section.consumer._names.at(mapping.name); + this._names.add(name); + name = this._names.indexOf(name); + } + + // The mappings coming from the consumer for the section have + // generated positions relative to the start of the section, so we + // need to offset them to be relative to the start of the concatenated + // generated file. + var adjustedMapping = { + source: source, + generatedLine: mapping.generatedLine + + (section.generatedOffset.generatedLine - 1), + generatedColumn: mapping.generatedColumn + + (section.generatedOffset.generatedLine === mapping.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: name + }; + + this.__generatedMappings.push(adjustedMapping); + if (typeof adjustedMapping.originalLine === 'number') { + this.__originalMappings.push(adjustedMapping); + } + } + } + + quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated); + quickSort(this.__originalMappings, util.compareByOriginalPositions); + }; + + exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + exports.GREATEST_LOWER_BOUND = 1; + exports.LEAST_UPPER_BOUND = 2; + + /** + * Recursive implementation of binary search. + * + * @param aLow Indices here and lower do not contain the needle. + * @param aHigh Indices here and higher do not contain the needle. + * @param aNeedle The element being searched for. + * @param aHaystack The non-empty array being searched. + * @param aCompare Function which takes two elements and returns -1, 0, or 1. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + */ + function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) { + // This function terminates when one of the following is true: + // + // 1. We find the exact element we are looking for. + // + // 2. We did not find the exact element, but we can return the index of + // the next-closest element. + // + // 3. We did not find the exact element, and there is no next-closest + // element than the one we are searching for, so we return -1. + var mid = Math.floor((aHigh - aLow) / 2) + aLow; + var cmp = aCompare(aNeedle, aHaystack[mid], true); + if (cmp === 0) { + // Found the element we are looking for. + return mid; + } + else if (cmp > 0) { + // Our needle is greater than aHaystack[mid]. + if (aHigh - mid > 1) { + // The element is in the upper half. + return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias); + } + + // The exact needle element was not found in this haystack. Determine if + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return aHigh < aHaystack.length ? aHigh : -1; + } else { + return mid; + } + } + else { + // Our needle is less than aHaystack[mid]. + if (mid - aLow > 1) { + // The element is in the lower half. + return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias); + } + + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return mid; + } else { + return aLow < 0 ? -1 : aLow; + } + } + } + + /** + * This is an implementation of binary search which will always try and return + * the index of the closest element if there is no exact hit. This is because + * mappings between original and generated line/col pairs are single points, + * and there is an implicit region between each of them, so a miss just means + * that you aren't on the very start of a region. + * + * @param aNeedle The element you are looking for. + * @param aHaystack The array that is being searched. + * @param aCompare A function which takes the needle and an element in the + * array and returns -1, 0, or 1 depending on whether the needle is less + * than, equal to, or greater than the element, respectively. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'. + */ + exports.search = function search(aNeedle, aHaystack, aCompare, aBias) { + if (aHaystack.length === 0) { + return -1; + } + + var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, + aCompare, aBias || exports.GREATEST_LOWER_BOUND); + if (index < 0) { + return -1; + } + + // We have found either the exact element, or the next-closest element than + // the one we are searching for. However, there may be more than one such + // element. Make sure we always return the smallest of these. + while (index - 1 >= 0) { + if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) { + break; + } + --index; + } + + return index; + }; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + // It turns out that some (most?) JavaScript engines don't self-host + // `Array.prototype.sort`. This makes sense because C++ will likely remain + // faster than JS when doing raw CPU-intensive sorting. However, when using a + // custom comparator function, calling back and forth between the VM's C++ and + // JIT'd JS is rather slow *and* loses JIT type information, resulting in + // worse generated code for the comparator function than would be optimal. In + // fact, when sorting with a comparator, these costs outweigh the benefits of + // sorting in C++. By using our own JS-implemented Quick Sort (below), we get + // a ~3500ms mean speed-up in `bench/bench.html`. + + /** + * Swap the elements indexed by `x` and `y` in the array `ary`. + * + * @param {Array} ary + * The array. + * @param {Number} x + * The index of the first item. + * @param {Number} y + * The index of the second item. + */ + function swap(ary, x, y) { + var temp = ary[x]; + ary[x] = ary[y]; + ary[y] = temp; + } + + /** + * Returns a random integer within the range `low .. high` inclusive. + * + * @param {Number} low + * The lower bound on the range. + * @param {Number} high + * The upper bound on the range. + */ + function randomIntInRange(low, high) { + return Math.round(low + (Math.random() * (high - low))); + } + + /** + * The Quick Sort algorithm. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + * @param {Number} p + * Start index of the array + * @param {Number} r + * End index of the array + */ + function doQuickSort(ary, comparator, p, r) { + // If our lower bound is less than our upper bound, we (1) partition the + // array into two pieces and (2) recurse on each half. If it is not, this is + // the empty array and our base case. + + if (p < r) { + // (1) Partitioning. + // + // The partitioning chooses a pivot between `p` and `r` and moves all + // elements that are less than or equal to the pivot to the before it, and + // all the elements that are greater than it after it. The effect is that + // once partition is done, the pivot is in the exact place it will be when + // the array is put in sorted order, and it will not need to be moved + // again. This runs in O(n) time. + + // Always choose a random pivot so that an input array which is reverse + // sorted does not cause O(n^2) running time. + var pivotIndex = randomIntInRange(p, r); + var i = p - 1; + + swap(ary, pivotIndex, r); + var pivot = ary[r]; + + // Immediately after `j` is incremented in this loop, the following hold + // true: + // + // * Every element in `ary[p .. i]` is less than or equal to the pivot. + // + // * Every element in `ary[i+1 .. j-1]` is greater than the pivot. + for (var j = p; j < r; j++) { + if (comparator(ary[j], pivot) <= 0) { + i += 1; + swap(ary, i, j); + } + } + + swap(ary, i + 1, j); + var q = i + 1; + + // (2) Recurse on each half. + + doQuickSort(ary, comparator, p, q - 1); + doQuickSort(ary, comparator, q + 1, r); + } + } + + /** + * Sort the given array in-place with the given comparator function. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + */ + exports.quickSort = function (ary, comparator) { + doQuickSort(ary, comparator, 0, ary.length - 1); + }; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + var util = __webpack_require__(4); + + // Matches a Windows-style `\r\n` newline or a `\n` newline used by all other + // operating systems these days (capturing the result). + var REGEX_NEWLINE = /(\r?\n)/; + + // Newline character code for charCodeAt() comparisons + var NEWLINE_CODE = 10; + + // Private symbol for identifying `SourceNode`s when multiple versions of + // the source-map library are loaded. This MUST NOT CHANGE across + // versions! + var isSourceNode = "$$$isSourceNode$$$"; + + /** + * SourceNodes provide a way to abstract over interpolating/concatenating + * snippets of generated JavaScript source code while maintaining the line and + * column information associated with the original source code. + * + * @param aLine The original line number. + * @param aColumn The original column number. + * @param aSource The original source's filename. + * @param aChunks Optional. An array of strings which are snippets of + * generated JS, or other SourceNodes. + * @param aName The original identifier. + */ + function SourceNode(aLine, aColumn, aSource, aChunks, aName) { + this.children = []; + this.sourceContents = {}; + this.line = aLine == null ? null : aLine; + this.column = aColumn == null ? null : aColumn; + this.source = aSource == null ? null : aSource; + this.name = aName == null ? null : aName; + this[isSourceNode] = true; + if (aChunks != null) this.add(aChunks); + } + + /** + * Creates a SourceNode from generated code and a SourceMapConsumer. + * + * @param aGeneratedCode The generated code + * @param aSourceMapConsumer The SourceMap for the generated code + * @param aRelativePath Optional. The path that relative sources in the + * SourceMapConsumer should be relative to. + */ + SourceNode.fromStringWithSourceMap = + function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) { + // The SourceNode we want to fill with the generated code + // and the SourceMap + var node = new SourceNode(); + + // All even indices of this array are one line of the generated code, + // while all odd indices are the newlines between two adjacent lines + // (since `REGEX_NEWLINE` captures its match). + // Processed fragments are accessed by calling `shiftNextLine`. + var remainingLines = aGeneratedCode.split(REGEX_NEWLINE); + var remainingLinesIndex = 0; + var shiftNextLine = function() { + var lineContents = getNextLine(); + // The last line of a file might not have a newline. + var newLine = getNextLine() || ""; + return lineContents + newLine; + + function getNextLine() { + return remainingLinesIndex < remainingLines.length ? + remainingLines[remainingLinesIndex++] : undefined; + } + }; + + // We need to remember the position of "remainingLines" + var lastGeneratedLine = 1, lastGeneratedColumn = 0; + + // The generate SourceNodes we need a code range. + // To extract it current and last mapping is used. + // Here we store the last mapping. + var lastMapping = null; + + aSourceMapConsumer.eachMapping(function (mapping) { + if (lastMapping !== null) { + // We add the code from "lastMapping" to "mapping": + // First check if there is a new line in between. + if (lastGeneratedLine < mapping.generatedLine) { + // Associate first line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + lastGeneratedLine++; + lastGeneratedColumn = 0; + // The remaining code is added without mapping + } else { + // There is no new line in between. + // Associate the code between "lastGeneratedColumn" and + // "mapping.generatedColumn" with "lastMapping" + var nextLine = remainingLines[remainingLinesIndex] || ''; + var code = nextLine.substr(0, mapping.generatedColumn - + lastGeneratedColumn); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn - + lastGeneratedColumn); + lastGeneratedColumn = mapping.generatedColumn; + addMappingWithCode(lastMapping, code); + // No more remaining code, continue + lastMapping = mapping; + return; + } + } + // We add the generated code until the first mapping + // to the SourceNode without any mapping. + // Each line is added as separate string. + while (lastGeneratedLine < mapping.generatedLine) { + node.add(shiftNextLine()); + lastGeneratedLine++; + } + if (lastGeneratedColumn < mapping.generatedColumn) { + var nextLine = remainingLines[remainingLinesIndex] || ''; + node.add(nextLine.substr(0, mapping.generatedColumn)); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn); + lastGeneratedColumn = mapping.generatedColumn; + } + lastMapping = mapping; + }, this); + // We have processed all mappings. + if (remainingLinesIndex < remainingLines.length) { + if (lastMapping) { + // Associate the remaining code in the current line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + } + // and add the remaining lines without any mapping + node.add(remainingLines.splice(remainingLinesIndex).join("")); + } + + // Copy sourcesContent into SourceNode + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aRelativePath != null) { + sourceFile = util.join(aRelativePath, sourceFile); + } + node.setSourceContent(sourceFile, content); + } + }); + + return node; + + function addMappingWithCode(mapping, code) { + if (mapping === null || mapping.source === undefined) { + node.add(code); + } else { + var source = aRelativePath + ? util.join(aRelativePath, mapping.source) + : mapping.source; + node.add(new SourceNode(mapping.originalLine, + mapping.originalColumn, + source, + code, + mapping.name)); + } + } + }; + + /** + * Add a chunk of generated JS to this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.add = function SourceNode_add(aChunk) { + if (Array.isArray(aChunk)) { + aChunk.forEach(function (chunk) { + this.add(chunk); + }, this); + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + if (aChunk) { + this.children.push(aChunk); + } + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Add a chunk of generated JS to the beginning of this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) { + if (Array.isArray(aChunk)) { + for (var i = aChunk.length-1; i >= 0; i--) { + this.prepend(aChunk[i]); + } + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + this.children.unshift(aChunk); + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Walk over the tree of JS snippets in this node and its children. The + * walking function is called once for each snippet of JS and is passed that + * snippet and the its original associated source's line/column location. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walk = function SourceNode_walk(aFn) { + var chunk; + for (var i = 0, len = this.children.length; i < len; i++) { + chunk = this.children[i]; + if (chunk[isSourceNode]) { + chunk.walk(aFn); + } + else { + if (chunk !== '') { + aFn(chunk, { source: this.source, + line: this.line, + column: this.column, + name: this.name }); + } + } + } + }; + + /** + * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between + * each of `this.children`. + * + * @param aSep The separator. + */ + SourceNode.prototype.join = function SourceNode_join(aSep) { + var newChildren; + var i; + var len = this.children.length; + if (len > 0) { + newChildren = []; + for (i = 0; i < len-1; i++) { + newChildren.push(this.children[i]); + newChildren.push(aSep); + } + newChildren.push(this.children[i]); + this.children = newChildren; + } + return this; + }; + + /** + * Call String.prototype.replace on the very right-most source snippet. Useful + * for trimming whitespace from the end of a source node, etc. + * + * @param aPattern The pattern to replace. + * @param aReplacement The thing to replace the pattern with. + */ + SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) { + var lastChild = this.children[this.children.length - 1]; + if (lastChild[isSourceNode]) { + lastChild.replaceRight(aPattern, aReplacement); + } + else if (typeof lastChild === 'string') { + this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement); + } + else { + this.children.push(''.replace(aPattern, aReplacement)); + } + return this; + }; + + /** + * Set the source content for a source file. This will be added to the SourceMapGenerator + * in the sourcesContent field. + * + * @param aSourceFile The filename of the source file + * @param aSourceContent The content of the source file + */ + SourceNode.prototype.setSourceContent = + function SourceNode_setSourceContent(aSourceFile, aSourceContent) { + this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent; + }; + + /** + * Walk over the tree of SourceNodes. The walking function is called for each + * source file content and is passed the filename and source content. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walkSourceContents = + function SourceNode_walkSourceContents(aFn) { + for (var i = 0, len = this.children.length; i < len; i++) { + if (this.children[i][isSourceNode]) { + this.children[i].walkSourceContents(aFn); + } + } + + var sources = Object.keys(this.sourceContents); + for (var i = 0, len = sources.length; i < len; i++) { + aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]); + } + }; + + /** + * Return the string representation of this source node. Walks over the tree + * and concatenates all the various snippets together to one string. + */ + SourceNode.prototype.toString = function SourceNode_toString() { + var str = ""; + this.walk(function (chunk) { + str += chunk; + }); + return str; + }; + + /** + * Returns the string representation of this source node along with a source + * map. + */ + SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) { + var generated = { + code: "", + line: 1, + column: 0 + }; + var map = new SourceMapGenerator(aArgs); + var sourceMappingActive = false; + var lastOriginalSource = null; + var lastOriginalLine = null; + var lastOriginalColumn = null; + var lastOriginalName = null; + this.walk(function (chunk, original) { + generated.code += chunk; + if (original.source !== null + && original.line !== null + && original.column !== null) { + if(lastOriginalSource !== original.source + || lastOriginalLine !== original.line + || lastOriginalColumn !== original.column + || lastOriginalName !== original.name) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + lastOriginalSource = original.source; + lastOriginalLine = original.line; + lastOriginalColumn = original.column; + lastOriginalName = original.name; + sourceMappingActive = true; + } else if (sourceMappingActive) { + map.addMapping({ + generated: { + line: generated.line, + column: generated.column + } + }); + lastOriginalSource = null; + sourceMappingActive = false; + } + for (var idx = 0, length = chunk.length; idx < length; idx++) { + if (chunk.charCodeAt(idx) === NEWLINE_CODE) { + generated.line++; + generated.column = 0; + // Mappings end at eol + if (idx + 1 === length) { + lastOriginalSource = null; + sourceMappingActive = false; + } else if (sourceMappingActive) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + } else { + generated.column++; + } + } + }); + this.walkSourceContents(function (sourceFile, sourceContent) { + map.setSourceContent(sourceFile, sourceContent); + }); + + return { code: generated.code, map: map }; + }; + + exports.SourceNode = SourceNode; + + +/***/ }) +/******/ ]) +}); +; +//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIndlYnBhY2s6Ly8vd2VicGFjay91bml2ZXJzYWxNb2R1bGVEZWZpbml0aW9uIiwid2VicGFjazovLy93ZWJwYWNrL2Jvb3RzdHJhcCAxNjI0YzcyOTliODg3ZjdiZGY2NCIsIndlYnBhY2s6Ly8vLi9zb3VyY2UtbWFwLmpzIiwid2VicGFjazovLy8uL2xpYi9zb3VyY2UtbWFwLWdlbmVyYXRvci5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmFzZTY0LXZscS5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmFzZTY0LmpzIiwid2VicGFjazovLy8uL2xpYi91dGlsLmpzIiwid2VicGFjazovLy8uL2xpYi9hcnJheS1zZXQuanMiLCJ3ZWJwYWNrOi8vLy4vbGliL21hcHBpbmctbGlzdC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvc291cmNlLW1hcC1jb25zdW1lci5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmluYXJ5LXNlYXJjaC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvcXVpY2stc29ydC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvc291cmNlLW5vZGUuanMiXSwibmFtZXMiOltdLCJtYXBwaW5ncyI6IkFBQUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsQ0FBQztBQUNELE87QUNWQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQSx1QkFBZTtBQUNmO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOzs7QUFHQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBOzs7Ozs7O0FDdENBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7Ozs7Ozs7QUNQQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsVUFBUztBQUNUO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBLE1BQUs7QUFDTDtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsUUFBTztBQUNQO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBLDJDQUEwQyxTQUFTO0FBQ25EO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EscUJBQW9CO0FBQ3BCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7Ozs7OztBQ3hhQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSw0REFBMkQ7QUFDM0QscUJBQW9CO0FBQ3BCO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRzs7QUFFSDtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7O0FBRUg7QUFDQTtBQUNBOzs7Ozs7O0FDM0lBLGlCQUFnQixvQkFBb0I7QUFDcEM7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGlCQUFnQjtBQUNoQixpQkFBZ0I7O0FBRWhCLG9CQUFtQjtBQUNuQixxQkFBb0I7O0FBRXBCLGlCQUFnQjtBQUNoQixpQkFBZ0I7O0FBRWhCLGlCQUFnQjtBQUNoQixrQkFBaUI7O0FBRWpCO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOzs7Ozs7O0FDbEVBLGlCQUFnQixvQkFBb0I7QUFDcEM7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7QUFDSDtBQUNBLElBQUc7QUFDSDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBLCtDQUE4QyxRQUFRO0FBQ3REO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsRUFBQzs7QUFFRDtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQSw0QkFBMkIsUUFBUTtBQUNuQztBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBLGNBQWE7QUFDYjs7QUFFQTtBQUNBLGVBQWM7QUFDZDs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLHVDQUFzQztBQUN0QztBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOzs7Ozs7O0FDdmVBLGlCQUFnQixvQkFBb0I7QUFDcEM7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLHVDQUFzQyxTQUFTO0FBQy9DO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7QUFDSDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRztBQUNIO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7Ozs7Ozs7QUN4SEEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGlCQUFnQjtBQUNoQjs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFHO0FBQ0g7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7Ozs7Ozs7QUM5RUEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQSxFQUFDOztBQUVEO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBLEVBQUM7O0FBRUQ7QUFDQTtBQUNBO0FBQ0Esb0JBQW1CO0FBQ25COztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFlBQVc7O0FBRVg7QUFDQTtBQUNBLFFBQU87QUFDUDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsWUFBVzs7QUFFWDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsNEJBQTJCLE1BQU07QUFDakM7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLOztBQUVMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0EsSUFBRzs7QUFFSDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBLGNBQWEsa0NBQWtDO0FBQy9DO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7O0FBRUw7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBLHVEQUFzRCxZQUFZO0FBQ2xFO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLEVBQUM7O0FBRUQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0Esb0NBQW1DO0FBQ25DO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSwwQkFBeUIsY0FBYztBQUN2QztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBLFVBQVM7QUFDVDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esd0JBQXVCLHdDQUF3QztBQUMvRDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGdEQUErQyxtQkFBbUIsRUFBRTtBQUNwRTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxrQkFBaUIsb0JBQW9CO0FBQ3JDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSw4QkFBNkIsTUFBTTtBQUNuQztBQUNBLFFBQU87QUFDUDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsUUFBTztBQUNQO0FBQ0E7QUFDQSxJQUFHO0FBQ0g7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxvQkFBbUIsMkJBQTJCO0FBQzlDLHNCQUFxQiwrQ0FBK0M7QUFDcEU7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLEVBQUM7O0FBRUQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0EsUUFBTztBQUNQOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esb0JBQW1CLDJCQUEyQjtBQUM5Qzs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLG9CQUFtQiwyQkFBMkI7QUFDOUM7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esb0JBQW1CLDJCQUEyQjtBQUM5QztBQUNBO0FBQ0Esc0JBQXFCLDRCQUE0QjtBQUNqRDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTs7Ozs7OztBQ3huQ0EsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7Ozs7Ozs7QUM5R0EsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxZQUFXLE1BQU07QUFDakI7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsWUFBVyxNQUFNO0FBQ2pCO0FBQ0EsWUFBVyxTQUFTO0FBQ3BCO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxvQkFBbUIsT0FBTztBQUMxQjtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsWUFBVyxNQUFNO0FBQ2pCO0FBQ0EsWUFBVyxTQUFTO0FBQ3BCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7Ozs7Ozs7QUNqSEEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxVQUFTO0FBQ1Q7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSzs7QUFFTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esa0NBQWlDLFFBQVE7QUFDekM7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsOENBQTZDLFNBQVM7QUFDdEQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EscUJBQW9CO0FBQ3BCO0FBQ0E7QUFDQSx1Q0FBc0M7QUFDdEM7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsZ0JBQWUsV0FBVztBQUMxQjtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsZ0RBQStDLFNBQVM7QUFDeEQ7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQSwwQ0FBeUMsU0FBUztBQUNsRDtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7QUFDSDtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFlBQVc7QUFDWDtBQUNBO0FBQ0E7QUFDQSxZQUFXO0FBQ1g7QUFDQSxVQUFTO0FBQ1Q7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0EsNkNBQTRDLGNBQWM7QUFDMUQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxVQUFTO0FBQ1Q7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGNBQWE7QUFDYjtBQUNBO0FBQ0E7QUFDQSxjQUFhO0FBQ2I7QUFDQSxZQUFXO0FBQ1g7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0EsSUFBRztBQUNIO0FBQ0E7QUFDQSxJQUFHOztBQUVILFdBQVU7QUFDVjs7QUFFQSIsImZpbGUiOiJzb3VyY2UtbWFwLmRlYnVnLmpzIiwic291cmNlc0NvbnRlbnQiOlsiKGZ1bmN0aW9uIHdlYnBhY2tVbml2ZXJzYWxNb2R1bGVEZWZpbml0aW9uKHJvb3QsIGZhY3RvcnkpIHtcblx0aWYodHlwZW9mIGV4cG9ydHMgPT09ICdvYmplY3QnICYmIHR5cGVvZiBtb2R1bGUgPT09ICdvYmplY3QnKVxuXHRcdG1vZHVsZS5leHBvcnRzID0gZmFjdG9yeSgpO1xuXHRlbHNlIGlmKHR5cGVvZiBkZWZpbmUgPT09ICdmdW5jdGlvbicgJiYgZGVmaW5lLmFtZClcblx0XHRkZWZpbmUoW10sIGZhY3RvcnkpO1xuXHRlbHNlIGlmKHR5cGVvZiBleHBvcnRzID09PSAnb2JqZWN0Jylcblx0XHRleHBvcnRzW1wic291cmNlTWFwXCJdID0gZmFjdG9yeSgpO1xuXHRlbHNlXG5cdFx0cm9vdFtcInNvdXJjZU1hcFwiXSA9IGZhY3RvcnkoKTtcbn0pKHRoaXMsIGZ1bmN0aW9uKCkge1xucmV0dXJuIFxuXG5cbi8vIFdFQlBBQ0sgRk9PVEVSIC8vXG4vLyB3ZWJwYWNrL3VuaXZlcnNhbE1vZHVsZURlZmluaXRpb24iLCIgXHQvLyBUaGUgbW9kdWxlIGNhY2hlXG4gXHR2YXIgaW5zdGFsbGVkTW9kdWxlcyA9IHt9O1xuXG4gXHQvLyBUaGUgcmVxdWlyZSBmdW5jdGlvblxuIFx0ZnVuY3Rpb24gX193ZWJwYWNrX3JlcXVpcmVfXyhtb2R1bGVJZCkge1xuXG4gXHRcdC8vIENoZWNrIGlmIG1vZHVsZSBpcyBpbiBjYWNoZVxuIFx0XHRpZihpbnN0YWxsZWRNb2R1bGVzW21vZHVsZUlkXSlcbiBcdFx0XHRyZXR1cm4gaW5zdGFsbGVkTW9kdWxlc1ttb2R1bGVJZF0uZXhwb3J0cztcblxuIFx0XHQvLyBDcmVhdGUgYSBuZXcgbW9kdWxlIChhbmQgcHV0IGl0IGludG8gdGhlIGNhY2hlKVxuIFx0XHR2YXIgbW9kdWxlID0gaW5zdGFsbGVkTW9kdWxlc1ttb2R1bGVJZF0gPSB7XG4gXHRcdFx0ZXhwb3J0czoge30sXG4gXHRcdFx0aWQ6IG1vZHVsZUlkLFxuIFx0XHRcdGxvYWRlZDogZmFsc2VcbiBcdFx0fTtcblxuIFx0XHQvLyBFeGVjdXRlIHRoZSBtb2R1bGUgZnVuY3Rpb25cbiBcdFx0bW9kdWxlc1ttb2R1bGVJZF0uY2FsbChtb2R1bGUuZXhwb3J0cywgbW9kdWxlLCBtb2R1bGUuZXhwb3J0cywgX193ZWJwYWNrX3JlcXVpcmVfXyk7XG5cbiBcdFx0Ly8gRmxhZyB0aGUgbW9kdWxlIGFzIGxvYWRlZFxuIFx0XHRtb2R1bGUubG9hZGVkID0gdHJ1ZTtcblxuIFx0XHQvLyBSZXR1cm4gdGhlIGV4cG9ydHMgb2YgdGhlIG1vZHVsZVxuIFx0XHRyZXR1cm4gbW9kdWxlLmV4cG9ydHM7XG4gXHR9XG5cblxuIFx0Ly8gZXhwb3NlIHRoZSBtb2R1bGVzIG9iamVjdCAoX193ZWJwYWNrX21vZHVsZXNfXylcbiBcdF9fd2VicGFja19yZXF1aXJlX18ubSA9IG1vZHVsZXM7XG5cbiBcdC8vIGV4cG9zZSB0aGUgbW9kdWxlIGNhY2hlXG4gXHRfX3dlYnBhY2tfcmVxdWlyZV9fLmMgPSBpbnN0YWxsZWRNb2R1bGVzO1xuXG4gXHQvLyBfX3dlYnBhY2tfcHVibGljX3BhdGhfX1xuIFx0X193ZWJwYWNrX3JlcXVpcmVfXy5wID0gXCJcIjtcblxuIFx0Ly8gTG9hZCBlbnRyeSBtb2R1bGUgYW5kIHJldHVybiBleHBvcnRzXG4gXHRyZXR1cm4gX193ZWJwYWNrX3JlcXVpcmVfXygwKTtcblxuXG5cbi8vIFdFQlBBQ0sgRk9PVEVSIC8vXG4vLyB3ZWJwYWNrL2Jvb3RzdHJhcCAxNjI0YzcyOTliODg3ZjdiZGY2NCIsIi8qXG4gKiBDb3B5cmlnaHQgMjAwOS0yMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRS50eHQgb3I6XG4gKiBodHRwOi8vb3BlbnNvdXJjZS5vcmcvbGljZW5zZXMvQlNELTMtQ2xhdXNlXG4gKi9cbmV4cG9ydHMuU291cmNlTWFwR2VuZXJhdG9yID0gcmVxdWlyZSgnLi9saWIvc291cmNlLW1hcC1nZW5lcmF0b3InKS5Tb3VyY2VNYXBHZW5lcmF0b3I7XG5leHBvcnRzLlNvdXJjZU1hcENvbnN1bWVyID0gcmVxdWlyZSgnLi9saWIvc291cmNlLW1hcC1jb25zdW1lcicpLlNvdXJjZU1hcENvbnN1bWVyO1xuZXhwb3J0cy5Tb3VyY2VOb2RlID0gcmVxdWlyZSgnLi9saWIvc291cmNlLW5vZGUnKS5Tb3VyY2VOb2RlO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9zb3VyY2UtbWFwLmpzXG4vLyBtb2R1bGUgaWQgPSAwXG4vLyBtb2R1bGUgY2h1bmtzID0gMCIsIi8qIC0qLSBNb2RlOiBqczsganMtaW5kZW50LWxldmVsOiAyOyAtKi0gKi9cbi8qXG4gKiBDb3B5cmlnaHQgMjAxMSBNb3ppbGxhIEZvdW5kYXRpb24gYW5kIGNvbnRyaWJ1dG9yc1xuICogTGljZW5zZWQgdW5kZXIgdGhlIE5ldyBCU0QgbGljZW5zZS4gU2VlIExJQ0VOU0Ugb3I6XG4gKiBodHRwOi8vb3BlbnNvdXJjZS5vcmcvbGljZW5zZXMvQlNELTMtQ2xhdXNlXG4gKi9cblxudmFyIGJhc2U2NFZMUSA9IHJlcXVpcmUoJy4vYmFzZTY0LXZscScpO1xudmFyIHV0aWwgPSByZXF1aXJlKCcuL3V0aWwnKTtcbnZhciBBcnJheVNldCA9IHJlcXVpcmUoJy4vYXJyYXktc2V0JykuQXJyYXlTZXQ7XG52YXIgTWFwcGluZ0xpc3QgPSByZXF1aXJlKCcuL21hcHBpbmctbGlzdCcpLk1hcHBpbmdMaXN0O1xuXG4vKipcbiAqIEFuIGluc3RhbmNlIG9mIHRoZSBTb3VyY2VNYXBHZW5lcmF0b3IgcmVwcmVzZW50cyBhIHNvdXJjZSBtYXAgd2hpY2ggaXNcbiAqIGJlaW5nIGJ1aWx0IGluY3JlbWVudGFsbHkuIFlvdSBtYXkgcGFzcyBhbiBvYmplY3Qgd2l0aCB0aGUgZm9sbG93aW5nXG4gKiBwcm9wZXJ0aWVzOlxuICpcbiAqICAgLSBmaWxlOiBUaGUgZmlsZW5hbWUgb2YgdGhlIGdlbmVyYXRlZCBzb3VyY2UuXG4gKiAgIC0gc291cmNlUm9vdDogQSByb290IGZvciBhbGwgcmVsYXRpdmUgVVJMcyBpbiB0aGlzIHNvdXJjZSBtYXAuXG4gKi9cbmZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcihhQXJncykge1xuICBpZiAoIWFBcmdzKSB7XG4gICAgYUFyZ3MgPSB7fTtcbiAgfVxuICB0aGlzLl9maWxlID0gdXRpbC5nZXRBcmcoYUFyZ3MsICdmaWxlJywgbnVsbCk7XG4gIHRoaXMuX3NvdXJjZVJvb3QgPSB1dGlsLmdldEFyZyhhQXJncywgJ3NvdXJjZVJvb3QnLCBudWxsKTtcbiAgdGhpcy5fc2tpcFZhbGlkYXRpb24gPSB1dGlsLmdldEFyZyhhQXJncywgJ3NraXBWYWxpZGF0aW9uJywgZmFsc2UpO1xuICB0aGlzLl9zb3VyY2VzID0gbmV3IEFycmF5U2V0KCk7XG4gIHRoaXMuX25hbWVzID0gbmV3IEFycmF5U2V0KCk7XG4gIHRoaXMuX21hcHBpbmdzID0gbmV3IE1hcHBpbmdMaXN0KCk7XG4gIHRoaXMuX3NvdXJjZXNDb250ZW50cyA9IG51bGw7XG59XG5cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuX3ZlcnNpb24gPSAzO1xuXG4vKipcbiAqIENyZWF0ZXMgYSBuZXcgU291cmNlTWFwR2VuZXJhdG9yIGJhc2VkIG9uIGEgU291cmNlTWFwQ29uc3VtZXJcbiAqXG4gKiBAcGFyYW0gYVNvdXJjZU1hcENvbnN1bWVyIFRoZSBTb3VyY2VNYXAuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5mcm9tU291cmNlTWFwID1cbiAgZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yX2Zyb21Tb3VyY2VNYXAoYVNvdXJjZU1hcENvbnN1bWVyKSB7XG4gICAgdmFyIHNvdXJjZVJvb3QgPSBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlUm9vdDtcbiAgICB2YXIgZ2VuZXJhdG9yID0gbmV3IFNvdXJjZU1hcEdlbmVyYXRvcih7XG4gICAgICBmaWxlOiBhU291cmNlTWFwQ29uc3VtZXIuZmlsZSxcbiAgICAgIHNvdXJjZVJvb3Q6IHNvdXJjZVJvb3RcbiAgICB9KTtcbiAgICBhU291cmNlTWFwQ29uc3VtZXIuZWFjaE1hcHBpbmcoZnVuY3Rpb24gKG1hcHBpbmcpIHtcbiAgICAgIHZhciBuZXdNYXBwaW5nID0ge1xuICAgICAgICBnZW5lcmF0ZWQ6IHtcbiAgICAgICAgICBsaW5lOiBtYXBwaW5nLmdlbmVyYXRlZExpbmUsXG4gICAgICAgICAgY29sdW1uOiBtYXBwaW5nLmdlbmVyYXRlZENvbHVtblxuICAgICAgICB9XG4gICAgICB9O1xuXG4gICAgICBpZiAobWFwcGluZy5zb3VyY2UgIT0gbnVsbCkge1xuICAgICAgICBuZXdNYXBwaW5nLnNvdXJjZSA9IG1hcHBpbmcuc291cmNlO1xuICAgICAgICBpZiAoc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICAgICAgbmV3TWFwcGluZy5zb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIG5ld01hcHBpbmcuc291cmNlKTtcbiAgICAgICAgfVxuXG4gICAgICAgIG5ld01hcHBpbmcub3JpZ2luYWwgPSB7XG4gICAgICAgICAgbGluZTogbWFwcGluZy5vcmlnaW5hbExpbmUsXG4gICAgICAgICAgY29sdW1uOiBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uXG4gICAgICAgIH07XG5cbiAgICAgICAgaWYgKG1hcHBpbmcubmFtZSAhPSBudWxsKSB7XG4gICAgICAgICAgbmV3TWFwcGluZy5uYW1lID0gbWFwcGluZy5uYW1lO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIGdlbmVyYXRvci5hZGRNYXBwaW5nKG5ld01hcHBpbmcpO1xuICAgIH0pO1xuICAgIGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VzLmZvckVhY2goZnVuY3Rpb24gKHNvdXJjZUZpbGUpIHtcbiAgICAgIHZhciBzb3VyY2VSZWxhdGl2ZSA9IHNvdXJjZUZpbGU7XG4gICAgICBpZiAoc291cmNlUm9vdCAhPT0gbnVsbCkge1xuICAgICAgICBzb3VyY2VSZWxhdGl2ZSA9IHV0aWwucmVsYXRpdmUoc291cmNlUm9vdCwgc291cmNlRmlsZSk7XG4gICAgICB9XG5cbiAgICAgIGlmICghZ2VuZXJhdG9yLl9zb3VyY2VzLmhhcyhzb3VyY2VSZWxhdGl2ZSkpIHtcbiAgICAgICAgZ2VuZXJhdG9yLl9zb3VyY2VzLmFkZChzb3VyY2VSZWxhdGl2ZSk7XG4gICAgICB9XG5cbiAgICAgIHZhciBjb250ZW50ID0gYVNvdXJjZU1hcENvbnN1bWVyLnNvdXJjZUNvbnRlbnRGb3Ioc291cmNlRmlsZSk7XG4gICAgICBpZiAoY29udGVudCAhPSBudWxsKSB7XG4gICAgICAgIGdlbmVyYXRvci5zZXRTb3VyY2VDb250ZW50KHNvdXJjZUZpbGUsIGNvbnRlbnQpO1xuICAgICAgfVxuICAgIH0pO1xuICAgIHJldHVybiBnZW5lcmF0b3I7XG4gIH07XG5cbi8qKlxuICogQWRkIGEgc2luZ2xlIG1hcHBpbmcgZnJvbSBvcmlnaW5hbCBzb3VyY2UgbGluZSBhbmQgY29sdW1uIHRvIHRoZSBnZW5lcmF0ZWRcbiAqIHNvdXJjZSdzIGxpbmUgYW5kIGNvbHVtbiBmb3IgdGhpcyBzb3VyY2UgbWFwIGJlaW5nIGNyZWF0ZWQuIFRoZSBtYXBwaW5nXG4gKiBvYmplY3Qgc2hvdWxkIGhhdmUgdGhlIGZvbGxvd2luZyBwcm9wZXJ0aWVzOlxuICpcbiAqICAgLSBnZW5lcmF0ZWQ6IEFuIG9iamVjdCB3aXRoIHRoZSBnZW5lcmF0ZWQgbGluZSBhbmQgY29sdW1uIHBvc2l0aW9ucy5cbiAqICAgLSBvcmlnaW5hbDogQW4gb2JqZWN0IHdpdGggdGhlIG9yaWdpbmFsIGxpbmUgYW5kIGNvbHVtbiBwb3NpdGlvbnMuXG4gKiAgIC0gc291cmNlOiBUaGUgb3JpZ2luYWwgc291cmNlIGZpbGUgKHJlbGF0aXZlIHRvIHRoZSBzb3VyY2VSb290KS5cbiAqICAgLSBuYW1lOiBBbiBvcHRpb25hbCBvcmlnaW5hbCB0b2tlbiBuYW1lIGZvciB0aGlzIG1hcHBpbmcuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuYWRkTWFwcGluZyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl9hZGRNYXBwaW5nKGFBcmdzKSB7XG4gICAgdmFyIGdlbmVyYXRlZCA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnZ2VuZXJhdGVkJyk7XG4gICAgdmFyIG9yaWdpbmFsID0gdXRpbC5nZXRBcmcoYUFyZ3MsICdvcmlnaW5hbCcsIG51bGwpO1xuICAgIHZhciBzb3VyY2UgPSB1dGlsLmdldEFyZyhhQXJncywgJ3NvdXJjZScsIG51bGwpO1xuICAgIHZhciBuYW1lID0gdXRpbC5nZXRBcmcoYUFyZ3MsICduYW1lJywgbnVsbCk7XG5cbiAgICBpZiAoIXRoaXMuX3NraXBWYWxpZGF0aW9uKSB7XG4gICAgICB0aGlzLl92YWxpZGF0ZU1hcHBpbmcoZ2VuZXJhdGVkLCBvcmlnaW5hbCwgc291cmNlLCBuYW1lKTtcbiAgICB9XG5cbiAgICBpZiAoc291cmNlICE9IG51bGwpIHtcbiAgICAgIHNvdXJjZSA9IFN0cmluZyhzb3VyY2UpO1xuICAgICAgaWYgKCF0aGlzLl9zb3VyY2VzLmhhcyhzb3VyY2UpKSB7XG4gICAgICAgIHRoaXMuX3NvdXJjZXMuYWRkKHNvdXJjZSk7XG4gICAgICB9XG4gICAgfVxuXG4gICAgaWYgKG5hbWUgIT0gbnVsbCkge1xuICAgICAgbmFtZSA9IFN0cmluZyhuYW1lKTtcbiAgICAgIGlmICghdGhpcy5fbmFtZXMuaGFzKG5hbWUpKSB7XG4gICAgICAgIHRoaXMuX25hbWVzLmFkZChuYW1lKTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICB0aGlzLl9tYXBwaW5ncy5hZGQoe1xuICAgICAgZ2VuZXJhdGVkTGluZTogZ2VuZXJhdGVkLmxpbmUsXG4gICAgICBnZW5lcmF0ZWRDb2x1bW46IGdlbmVyYXRlZC5jb2x1bW4sXG4gICAgICBvcmlnaW5hbExpbmU6IG9yaWdpbmFsICE9IG51bGwgJiYgb3JpZ2luYWwubGluZSxcbiAgICAgIG9yaWdpbmFsQ29sdW1uOiBvcmlnaW5hbCAhPSBudWxsICYmIG9yaWdpbmFsLmNvbHVtbixcbiAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgbmFtZTogbmFtZVxuICAgIH0pO1xuICB9O1xuXG4vKipcbiAqIFNldCB0aGUgc291cmNlIGNvbnRlbnQgZm9yIGEgc291cmNlIGZpbGUuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuc2V0U291cmNlQ29udGVudCA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl9zZXRTb3VyY2VDb250ZW50KGFTb3VyY2VGaWxlLCBhU291cmNlQ29udGVudCkge1xuICAgIHZhciBzb3VyY2UgPSBhU291cmNlRmlsZTtcbiAgICBpZiAodGhpcy5fc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICBzb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHRoaXMuX3NvdXJjZVJvb3QsIHNvdXJjZSk7XG4gICAgfVxuXG4gICAgaWYgKGFTb3VyY2VDb250ZW50ICE9IG51bGwpIHtcbiAgICAgIC8vIEFkZCB0aGUgc291cmNlIGNvbnRlbnQgdG8gdGhlIF9zb3VyY2VzQ29udGVudHMgbWFwLlxuICAgICAgLy8gQ3JlYXRlIGEgbmV3IF9zb3VyY2VzQ29udGVudHMgbWFwIGlmIHRoZSBwcm9wZXJ0eSBpcyBudWxsLlxuICAgICAgaWYgKCF0aGlzLl9zb3VyY2VzQ29udGVudHMpIHtcbiAgICAgICAgdGhpcy5fc291cmNlc0NvbnRlbnRzID0gT2JqZWN0LmNyZWF0ZShudWxsKTtcbiAgICAgIH1cbiAgICAgIHRoaXMuX3NvdXJjZXNDb250ZW50c1t1dGlsLnRvU2V0U3RyaW5nKHNvdXJjZSldID0gYVNvdXJjZUNvbnRlbnQ7XG4gICAgfSBlbHNlIGlmICh0aGlzLl9zb3VyY2VzQ29udGVudHMpIHtcbiAgICAgIC8vIFJlbW92ZSB0aGUgc291cmNlIGZpbGUgZnJvbSB0aGUgX3NvdXJjZXNDb250ZW50cyBtYXAuXG4gICAgICAvLyBJZiB0aGUgX3NvdXJjZXNDb250ZW50cyBtYXAgaXMgZW1wdHksIHNldCB0aGUgcHJvcGVydHkgdG8gbnVsbC5cbiAgICAgIGRlbGV0ZSB0aGlzLl9zb3VyY2VzQ29udGVudHNbdXRpbC50b1NldFN0cmluZyhzb3VyY2UpXTtcbiAgICAgIGlmIChPYmplY3Qua2V5cyh0aGlzLl9zb3VyY2VzQ29udGVudHMpLmxlbmd0aCA9PT0gMCkge1xuICAgICAgICB0aGlzLl9zb3VyY2VzQ29udGVudHMgPSBudWxsO1xuICAgICAgfVxuICAgIH1cbiAgfTtcblxuLyoqXG4gKiBBcHBsaWVzIHRoZSBtYXBwaW5ncyBvZiBhIHN1Yi1zb3VyY2UtbWFwIGZvciBhIHNwZWNpZmljIHNvdXJjZSBmaWxlIHRvIHRoZVxuICogc291cmNlIG1hcCBiZWluZyBnZW5lcmF0ZWQuIEVhY2ggbWFwcGluZyB0byB0aGUgc3VwcGxpZWQgc291cmNlIGZpbGUgaXNcbiAqIHJld3JpdHRlbiB1c2luZyB0aGUgc3VwcGxpZWQgc291cmNlIG1hcC4gTm90ZTogVGhlIHJlc29sdXRpb24gZm9yIHRoZVxuICogcmVzdWx0aW5nIG1hcHBpbmdzIGlzIHRoZSBtaW5pbWl1bSBvZiB0aGlzIG1hcCBhbmQgdGhlIHN1cHBsaWVkIG1hcC5cbiAqXG4gKiBAcGFyYW0gYVNvdXJjZU1hcENvbnN1bWVyIFRoZSBzb3VyY2UgbWFwIHRvIGJlIGFwcGxpZWQuXG4gKiBAcGFyYW0gYVNvdXJjZUZpbGUgT3B0aW9uYWwuIFRoZSBmaWxlbmFtZSBvZiB0aGUgc291cmNlIGZpbGUuXG4gKiAgICAgICAgSWYgb21pdHRlZCwgU291cmNlTWFwQ29uc3VtZXIncyBmaWxlIHByb3BlcnR5IHdpbGwgYmUgdXNlZC5cbiAqIEBwYXJhbSBhU291cmNlTWFwUGF0aCBPcHRpb25hbC4gVGhlIGRpcm5hbWUgb2YgdGhlIHBhdGggdG8gdGhlIHNvdXJjZSBtYXBcbiAqICAgICAgICB0byBiZSBhcHBsaWVkLiBJZiByZWxhdGl2ZSwgaXQgaXMgcmVsYXRpdmUgdG8gdGhlIFNvdXJjZU1hcENvbnN1bWVyLlxuICogICAgICAgIFRoaXMgcGFyYW1ldGVyIGlzIG5lZWRlZCB3aGVuIHRoZSB0d28gc291cmNlIG1hcHMgYXJlbid0IGluIHRoZSBzYW1lXG4gKiAgICAgICAgZGlyZWN0b3J5LCBhbmQgdGhlIHNvdXJjZSBtYXAgdG8gYmUgYXBwbGllZCBjb250YWlucyByZWxhdGl2ZSBzb3VyY2VcbiAqICAgICAgICBwYXRocy4gSWYgc28sIHRob3NlIHJlbGF0aXZlIHNvdXJjZSBwYXRocyBuZWVkIHRvIGJlIHJld3JpdHRlblxuICogICAgICAgIHJlbGF0aXZlIHRvIHRoZSBTb3VyY2VNYXBHZW5lcmF0b3IuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuYXBwbHlTb3VyY2VNYXAgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfYXBwbHlTb3VyY2VNYXAoYVNvdXJjZU1hcENvbnN1bWVyLCBhU291cmNlRmlsZSwgYVNvdXJjZU1hcFBhdGgpIHtcbiAgICB2YXIgc291cmNlRmlsZSA9IGFTb3VyY2VGaWxlO1xuICAgIC8vIElmIGFTb3VyY2VGaWxlIGlzIG9taXR0ZWQsIHdlIHdpbGwgdXNlIHRoZSBmaWxlIHByb3BlcnR5IG9mIHRoZSBTb3VyY2VNYXBcbiAgICBpZiAoYVNvdXJjZUZpbGUgPT0gbnVsbCkge1xuICAgICAgaWYgKGFTb3VyY2VNYXBDb25zdW1lci5maWxlID09IG51bGwpIHtcbiAgICAgICAgdGhyb3cgbmV3IEVycm9yKFxuICAgICAgICAgICdTb3VyY2VNYXBHZW5lcmF0b3IucHJvdG90eXBlLmFwcGx5U291cmNlTWFwIHJlcXVpcmVzIGVpdGhlciBhbiBleHBsaWNpdCBzb3VyY2UgZmlsZSwgJyArXG4gICAgICAgICAgJ29yIHRoZSBzb3VyY2UgbWFwXFwncyBcImZpbGVcIiBwcm9wZXJ0eS4gQm90aCB3ZXJlIG9taXR0ZWQuJ1xuICAgICAgICApO1xuICAgICAgfVxuICAgICAgc291cmNlRmlsZSA9IGFTb3VyY2VNYXBDb25zdW1lci5maWxlO1xuICAgIH1cbiAgICB2YXIgc291cmNlUm9vdCA9IHRoaXMuX3NvdXJjZVJvb3Q7XG4gICAgLy8gTWFrZSBcInNvdXJjZUZpbGVcIiByZWxhdGl2ZSBpZiBhbiBhYnNvbHV0ZSBVcmwgaXMgcGFzc2VkLlxuICAgIGlmIChzb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgIHNvdXJjZUZpbGUgPSB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIHNvdXJjZUZpbGUpO1xuICAgIH1cbiAgICAvLyBBcHBseWluZyB0aGUgU291cmNlTWFwIGNhbiBhZGQgYW5kIHJlbW92ZSBpdGVtcyBmcm9tIHRoZSBzb3VyY2VzIGFuZFxuICAgIC8vIHRoZSBuYW1lcyBhcnJheS5cbiAgICB2YXIgbmV3U291cmNlcyA9IG5ldyBBcnJheVNldCgpO1xuICAgIHZhciBuZXdOYW1lcyA9IG5ldyBBcnJheVNldCgpO1xuXG4gICAgLy8gRmluZCBtYXBwaW5ncyBmb3IgdGhlIFwic291cmNlRmlsZVwiXG4gICAgdGhpcy5fbWFwcGluZ3MudW5zb3J0ZWRGb3JFYWNoKGZ1bmN0aW9uIChtYXBwaW5nKSB7XG4gICAgICBpZiAobWFwcGluZy5zb3VyY2UgPT09IHNvdXJjZUZpbGUgJiYgbWFwcGluZy5vcmlnaW5hbExpbmUgIT0gbnVsbCkge1xuICAgICAgICAvLyBDaGVjayBpZiBpdCBjYW4gYmUgbWFwcGVkIGJ5IHRoZSBzb3VyY2UgbWFwLCB0aGVuIHVwZGF0ZSB0aGUgbWFwcGluZy5cbiAgICAgICAgdmFyIG9yaWdpbmFsID0gYVNvdXJjZU1hcENvbnN1bWVyLm9yaWdpbmFsUG9zaXRpb25Gb3Ioe1xuICAgICAgICAgIGxpbmU6IG1hcHBpbmcub3JpZ2luYWxMaW5lLFxuICAgICAgICAgIGNvbHVtbjogbWFwcGluZy5vcmlnaW5hbENvbHVtblxuICAgICAgICB9KTtcbiAgICAgICAgaWYgKG9yaWdpbmFsLnNvdXJjZSAhPSBudWxsKSB7XG4gICAgICAgICAgLy8gQ29weSBtYXBwaW5nXG4gICAgICAgICAgbWFwcGluZy5zb3VyY2UgPSBvcmlnaW5hbC5zb3VyY2U7XG4gICAgICAgICAgaWYgKGFTb3VyY2VNYXBQYXRoICE9IG51bGwpIHtcbiAgICAgICAgICAgIG1hcHBpbmcuc291cmNlID0gdXRpbC5qb2luKGFTb3VyY2VNYXBQYXRoLCBtYXBwaW5nLnNvdXJjZSlcbiAgICAgICAgICB9XG4gICAgICAgICAgaWYgKHNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgICAgICAgbWFwcGluZy5zb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIG1hcHBpbmcuc291cmNlKTtcbiAgICAgICAgICB9XG4gICAgICAgICAgbWFwcGluZy5vcmlnaW5hbExpbmUgPSBvcmlnaW5hbC5saW5lO1xuICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxDb2x1bW4gPSBvcmlnaW5hbC5jb2x1bW47XG4gICAgICAgICAgaWYgKG9yaWdpbmFsLm5hbWUgIT0gbnVsbCkge1xuICAgICAgICAgICAgbWFwcGluZy5uYW1lID0gb3JpZ2luYWwubmFtZTtcbiAgICAgICAgICB9XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgdmFyIHNvdXJjZSA9IG1hcHBpbmcuc291cmNlO1xuICAgICAgaWYgKHNvdXJjZSAhPSBudWxsICYmICFuZXdTb3VyY2VzLmhhcyhzb3VyY2UpKSB7XG4gICAgICAgIG5ld1NvdXJjZXMuYWRkKHNvdXJjZSk7XG4gICAgICB9XG5cbiAgICAgIHZhciBuYW1lID0gbWFwcGluZy5uYW1lO1xuICAgICAgaWYgKG5hbWUgIT0gbnVsbCAmJiAhbmV3TmFtZXMuaGFzKG5hbWUpKSB7XG4gICAgICAgIG5ld05hbWVzLmFkZChuYW1lKTtcbiAgICAgIH1cblxuICAgIH0sIHRoaXMpO1xuICAgIHRoaXMuX3NvdXJjZXMgPSBuZXdTb3VyY2VzO1xuICAgIHRoaXMuX25hbWVzID0gbmV3TmFtZXM7XG5cbiAgICAvLyBDb3B5IHNvdXJjZXNDb250ZW50cyBvZiBhcHBsaWVkIG1hcC5cbiAgICBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlcy5mb3JFYWNoKGZ1bmN0aW9uIChzb3VyY2VGaWxlKSB7XG4gICAgICB2YXIgY29udGVudCA9IGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VDb250ZW50Rm9yKHNvdXJjZUZpbGUpO1xuICAgICAgaWYgKGNvbnRlbnQgIT0gbnVsbCkge1xuICAgICAgICBpZiAoYVNvdXJjZU1hcFBhdGggIT0gbnVsbCkge1xuICAgICAgICAgIHNvdXJjZUZpbGUgPSB1dGlsLmpvaW4oYVNvdXJjZU1hcFBhdGgsIHNvdXJjZUZpbGUpO1xuICAgICAgICB9XG4gICAgICAgIGlmIChzb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgICAgICBzb3VyY2VGaWxlID0gdXRpbC5yZWxhdGl2ZShzb3VyY2VSb290LCBzb3VyY2VGaWxlKTtcbiAgICAgICAgfVxuICAgICAgICB0aGlzLnNldFNvdXJjZUNvbnRlbnQoc291cmNlRmlsZSwgY29udGVudCk7XG4gICAgICB9XG4gICAgfSwgdGhpcyk7XG4gIH07XG5cbi8qKlxuICogQSBtYXBwaW5nIGNhbiBoYXZlIG9uZSBvZiB0aGUgdGhyZWUgbGV2ZWxzIG9mIGRhdGE6XG4gKlxuICogICAxLiBKdXN0IHRoZSBnZW5lcmF0ZWQgcG9zaXRpb24uXG4gKiAgIDIuIFRoZSBHZW5lcmF0ZWQgcG9zaXRpb24sIG9yaWdpbmFsIHBvc2l0aW9uLCBhbmQgb3JpZ2luYWwgc291cmNlLlxuICogICAzLiBHZW5lcmF0ZWQgYW5kIG9yaWdpbmFsIHBvc2l0aW9uLCBvcmlnaW5hbCBzb3VyY2UsIGFzIHdlbGwgYXMgYSBuYW1lXG4gKiAgICAgIHRva2VuLlxuICpcbiAqIFRvIG1haW50YWluIGNvbnNpc3RlbmN5LCB3ZSB2YWxpZGF0ZSB0aGF0IGFueSBuZXcgbWFwcGluZyBiZWluZyBhZGRlZCBmYWxsc1xuICogaW4gdG8gb25lIG9mIHRoZXNlIGNhdGVnb3JpZXMuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuX3ZhbGlkYXRlTWFwcGluZyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl92YWxpZGF0ZU1hcHBpbmcoYUdlbmVyYXRlZCwgYU9yaWdpbmFsLCBhU291cmNlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGFOYW1lKSB7XG4gICAgLy8gV2hlbiBhT3JpZ2luYWwgaXMgdHJ1dGh5IGJ1dCBoYXMgZW1wdHkgdmFsdWVzIGZvciAubGluZSBhbmQgLmNvbHVtbixcbiAgICAvLyBpdCBpcyBtb3N0IGxpa2VseSBhIHByb2dyYW1tZXIgZXJyb3IuIEluIHRoaXMgY2FzZSB3ZSB0aHJvdyBhIHZlcnlcbiAgICAvLyBzcGVjaWZpYyBlcnJvciBtZXNzYWdlIHRvIHRyeSB0byBndWlkZSB0aGVtIHRoZSByaWdodCB3YXkuXG4gICAgLy8gRm9yIGV4YW1wbGU6IGh0dHBzOi8vZ2l0aHViLmNvbS9Qb2x5bWVyL3BvbHltZXItYnVuZGxlci9wdWxsLzUxOVxuICAgIGlmIChhT3JpZ2luYWwgJiYgdHlwZW9mIGFPcmlnaW5hbC5saW5lICE9PSAnbnVtYmVyJyAmJiB0eXBlb2YgYU9yaWdpbmFsLmNvbHVtbiAhPT0gJ251bWJlcicpIHtcbiAgICAgICAgdGhyb3cgbmV3IEVycm9yKFxuICAgICAgICAgICAgJ29yaWdpbmFsLmxpbmUgYW5kIG9yaWdpbmFsLmNvbHVtbiBhcmUgbm90IG51bWJlcnMgLS0geW91IHByb2JhYmx5IG1lYW50IHRvIG9taXQgJyArXG4gICAgICAgICAgICAndGhlIG9yaWdpbmFsIG1hcHBpbmcgZW50aXJlbHkgYW5kIG9ubHkgbWFwIHRoZSBnZW5lcmF0ZWQgcG9zaXRpb24uIElmIHNvLCBwYXNzICcgK1xuICAgICAgICAgICAgJ251bGwgZm9yIHRoZSBvcmlnaW5hbCBtYXBwaW5nIGluc3RlYWQgb2YgYW4gb2JqZWN0IHdpdGggZW1wdHkgb3IgbnVsbCB2YWx1ZXMuJ1xuICAgICAgICApO1xuICAgIH1cblxuICAgIGlmIChhR2VuZXJhdGVkICYmICdsaW5lJyBpbiBhR2VuZXJhdGVkICYmICdjb2x1bW4nIGluIGFHZW5lcmF0ZWRcbiAgICAgICAgJiYgYUdlbmVyYXRlZC5saW5lID4gMCAmJiBhR2VuZXJhdGVkLmNvbHVtbiA+PSAwXG4gICAgICAgICYmICFhT3JpZ2luYWwgJiYgIWFTb3VyY2UgJiYgIWFOYW1lKSB7XG4gICAgICAvLyBDYXNlIDEuXG4gICAgICByZXR1cm47XG4gICAgfVxuICAgIGVsc2UgaWYgKGFHZW5lcmF0ZWQgJiYgJ2xpbmUnIGluIGFHZW5lcmF0ZWQgJiYgJ2NvbHVtbicgaW4gYUdlbmVyYXRlZFxuICAgICAgICAgICAgICYmIGFPcmlnaW5hbCAmJiAnbGluZScgaW4gYU9yaWdpbmFsICYmICdjb2x1bW4nIGluIGFPcmlnaW5hbFxuICAgICAgICAgICAgICYmIGFHZW5lcmF0ZWQubGluZSA+IDAgJiYgYUdlbmVyYXRlZC5jb2x1bW4gPj0gMFxuICAgICAgICAgICAgICYmIGFPcmlnaW5hbC5saW5lID4gMCAmJiBhT3JpZ2luYWwuY29sdW1uID49IDBcbiAgICAgICAgICAgICAmJiBhU291cmNlKSB7XG4gICAgICAvLyBDYXNlcyAyIGFuZCAzLlxuICAgICAgcmV0dXJuO1xuICAgIH1cbiAgICBlbHNlIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignSW52YWxpZCBtYXBwaW5nOiAnICsgSlNPTi5zdHJpbmdpZnkoe1xuICAgICAgICBnZW5lcmF0ZWQ6IGFHZW5lcmF0ZWQsXG4gICAgICAgIHNvdXJjZTogYVNvdXJjZSxcbiAgICAgICAgb3JpZ2luYWw6IGFPcmlnaW5hbCxcbiAgICAgICAgbmFtZTogYU5hbWVcbiAgICAgIH0pKTtcbiAgICB9XG4gIH07XG5cbi8qKlxuICogU2VyaWFsaXplIHRoZSBhY2N1bXVsYXRlZCBtYXBwaW5ncyBpbiB0byB0aGUgc3RyZWFtIG9mIGJhc2UgNjQgVkxRc1xuICogc3BlY2lmaWVkIGJ5IHRoZSBzb3VyY2UgbWFwIGZvcm1hdC5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5fc2VyaWFsaXplTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3Jfc2VyaWFsaXplTWFwcGluZ3MoKSB7XG4gICAgdmFyIHByZXZpb3VzR2VuZXJhdGVkQ29sdW1uID0gMDtcbiAgICB2YXIgcHJldmlvdXNHZW5lcmF0ZWRMaW5lID0gMTtcbiAgICB2YXIgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gMDtcbiAgICB2YXIgcHJldmlvdXNOYW1lID0gMDtcbiAgICB2YXIgcHJldmlvdXNTb3VyY2UgPSAwO1xuICAgIHZhciByZXN1bHQgPSAnJztcbiAgICB2YXIgbmV4dDtcbiAgICB2YXIgbWFwcGluZztcbiAgICB2YXIgbmFtZUlkeDtcbiAgICB2YXIgc291cmNlSWR4O1xuXG4gICAgdmFyIG1hcHBpbmdzID0gdGhpcy5fbWFwcGluZ3MudG9BcnJheSgpO1xuICAgIGZvciAodmFyIGkgPSAwLCBsZW4gPSBtYXBwaW5ncy5sZW5ndGg7IGkgPCBsZW47IGkrKykge1xuICAgICAgbWFwcGluZyA9IG1hcHBpbmdzW2ldO1xuICAgICAgbmV4dCA9ICcnXG5cbiAgICAgIGlmIChtYXBwaW5nLmdlbmVyYXRlZExpbmUgIT09IHByZXZpb3VzR2VuZXJhdGVkTGluZSkge1xuICAgICAgICBwcmV2aW91c0dlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgICAgIHdoaWxlIChtYXBwaW5nLmdlbmVyYXRlZExpbmUgIT09IHByZXZpb3VzR2VuZXJhdGVkTGluZSkge1xuICAgICAgICAgIG5leHQgKz0gJzsnO1xuICAgICAgICAgIHByZXZpb3VzR2VuZXJhdGVkTGluZSsrO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgICBlbHNlIHtcbiAgICAgICAgaWYgKGkgPiAwKSB7XG4gICAgICAgICAgaWYgKCF1dGlsLmNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0luZmxhdGVkKG1hcHBpbmcsIG1hcHBpbmdzW2kgLSAxXSkpIHtcbiAgICAgICAgICAgIGNvbnRpbnVlO1xuICAgICAgICAgIH1cbiAgICAgICAgICBuZXh0ICs9ICcsJztcbiAgICAgICAgfVxuICAgICAgfVxuXG4gICAgICBuZXh0ICs9IGJhc2U2NFZMUS5lbmNvZGUobWFwcGluZy5nZW5lcmF0ZWRDb2x1bW5cbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIC0gcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgaWYgKG1hcHBpbmcuc291cmNlICE9IG51bGwpIHtcbiAgICAgICAgc291cmNlSWR4ID0gdGhpcy5fc291cmNlcy5pbmRleE9mKG1hcHBpbmcuc291cmNlKTtcbiAgICAgICAgbmV4dCArPSBiYXNlNjRWTFEuZW5jb2RlKHNvdXJjZUlkeCAtIHByZXZpb3VzU291cmNlKTtcbiAgICAgICAgcHJldmlvdXNTb3VyY2UgPSBzb3VyY2VJZHg7XG5cbiAgICAgICAgLy8gbGluZXMgYXJlIHN0b3JlZCAwLWJhc2VkIGluIFNvdXJjZU1hcCBzcGVjIHZlcnNpb24gM1xuICAgICAgICBuZXh0ICs9IGJhc2U2NFZMUS5lbmNvZGUobWFwcGluZy5vcmlnaW5hbExpbmUgLSAxXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIC0gcHJldmlvdXNPcmlnaW5hbExpbmUpO1xuICAgICAgICBwcmV2aW91c09yaWdpbmFsTGluZSA9IG1hcHBpbmcub3JpZ2luYWxMaW5lIC0gMTtcblxuICAgICAgICBuZXh0ICs9IGJhc2U2NFZMUS5lbmNvZGUobWFwcGluZy5vcmlnaW5hbENvbHVtblxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAtIHByZXZpb3VzT3JpZ2luYWxDb2x1bW4pO1xuICAgICAgICBwcmV2aW91c09yaWdpbmFsQ29sdW1uID0gbWFwcGluZy5vcmlnaW5hbENvbHVtbjtcblxuICAgICAgICBpZiAobWFwcGluZy5uYW1lICE9IG51bGwpIHtcbiAgICAgICAgICBuYW1lSWR4ID0gdGhpcy5fbmFtZXMuaW5kZXhPZihtYXBwaW5nLm5hbWUpO1xuICAgICAgICAgIG5leHQgKz0gYmFzZTY0VkxRLmVuY29kZShuYW1lSWR4IC0gcHJldmlvdXNOYW1lKTtcbiAgICAgICAgICBwcmV2aW91c05hbWUgPSBuYW1lSWR4O1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIHJlc3VsdCArPSBuZXh0O1xuICAgIH1cblxuICAgIHJldHVybiByZXN1bHQ7XG4gIH07XG5cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuX2dlbmVyYXRlU291cmNlc0NvbnRlbnQgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfZ2VuZXJhdGVTb3VyY2VzQ29udGVudChhU291cmNlcywgYVNvdXJjZVJvb3QpIHtcbiAgICByZXR1cm4gYVNvdXJjZXMubWFwKGZ1bmN0aW9uIChzb3VyY2UpIHtcbiAgICAgIGlmICghdGhpcy5fc291cmNlc0NvbnRlbnRzKSB7XG4gICAgICAgIHJldHVybiBudWxsO1xuICAgICAgfVxuICAgICAgaWYgKGFTb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgICAgc291cmNlID0gdXRpbC5yZWxhdGl2ZShhU291cmNlUm9vdCwgc291cmNlKTtcbiAgICAgIH1cbiAgICAgIHZhciBrZXkgPSB1dGlsLnRvU2V0U3RyaW5nKHNvdXJjZSk7XG4gICAgICByZXR1cm4gT2JqZWN0LnByb3RvdHlwZS5oYXNPd25Qcm9wZXJ0eS5jYWxsKHRoaXMuX3NvdXJjZXNDb250ZW50cywga2V5KVxuICAgICAgICA/IHRoaXMuX3NvdXJjZXNDb250ZW50c1trZXldXG4gICAgICAgIDogbnVsbDtcbiAgICB9LCB0aGlzKTtcbiAgfTtcblxuLyoqXG4gKiBFeHRlcm5hbGl6ZSB0aGUgc291cmNlIG1hcC5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS50b0pTT04gPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfdG9KU09OKCkge1xuICAgIHZhciBtYXAgPSB7XG4gICAgICB2ZXJzaW9uOiB0aGlzLl92ZXJzaW9uLFxuICAgICAgc291cmNlczogdGhpcy5fc291cmNlcy50b0FycmF5KCksXG4gICAgICBuYW1lczogdGhpcy5fbmFtZXMudG9BcnJheSgpLFxuICAgICAgbWFwcGluZ3M6IHRoaXMuX3NlcmlhbGl6ZU1hcHBpbmdzKClcbiAgICB9O1xuICAgIGlmICh0aGlzLl9maWxlICE9IG51bGwpIHtcbiAgICAgIG1hcC5maWxlID0gdGhpcy5fZmlsZTtcbiAgICB9XG4gICAgaWYgKHRoaXMuX3NvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgbWFwLnNvdXJjZVJvb3QgPSB0aGlzLl9zb3VyY2VSb290O1xuICAgIH1cbiAgICBpZiAodGhpcy5fc291cmNlc0NvbnRlbnRzKSB7XG4gICAgICBtYXAuc291cmNlc0NvbnRlbnQgPSB0aGlzLl9nZW5lcmF0ZVNvdXJjZXNDb250ZW50KG1hcC5zb3VyY2VzLCBtYXAuc291cmNlUm9vdCk7XG4gICAgfVxuXG4gICAgcmV0dXJuIG1hcDtcbiAgfTtcblxuLyoqXG4gKiBSZW5kZXIgdGhlIHNvdXJjZSBtYXAgYmVpbmcgZ2VuZXJhdGVkIHRvIGEgc3RyaW5nLlxuICovXG5Tb3VyY2VNYXBHZW5lcmF0b3IucHJvdG90eXBlLnRvU3RyaW5nID1cbiAgZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yX3RvU3RyaW5nKCkge1xuICAgIHJldHVybiBKU09OLnN0cmluZ2lmeSh0aGlzLnRvSlNPTigpKTtcbiAgfTtcblxuZXhwb3J0cy5Tb3VyY2VNYXBHZW5lcmF0b3IgPSBTb3VyY2VNYXBHZW5lcmF0b3I7XG5cblxuXG4vLy8vLy8vLy8vLy8vLy8vLy9cbi8vIFdFQlBBQ0sgRk9PVEVSXG4vLyAuL2xpYi9zb3VyY2UtbWFwLWdlbmVyYXRvci5qc1xuLy8gbW9kdWxlIGlkID0gMVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICpcbiAqIEJhc2VkIG9uIHRoZSBCYXNlIDY0IFZMUSBpbXBsZW1lbnRhdGlvbiBpbiBDbG9zdXJlIENvbXBpbGVyOlxuICogaHR0cHM6Ly9jb2RlLmdvb2dsZS5jb20vcC9jbG9zdXJlLWNvbXBpbGVyL3NvdXJjZS9icm93c2UvdHJ1bmsvc3JjL2NvbS9nb29nbGUvZGVidWdnaW5nL3NvdXJjZW1hcC9CYXNlNjRWTFEuamF2YVxuICpcbiAqIENvcHlyaWdodCAyMDExIFRoZSBDbG9zdXJlIENvbXBpbGVyIEF1dGhvcnMuIEFsbCByaWdodHMgcmVzZXJ2ZWQuXG4gKiBSZWRpc3RyaWJ1dGlvbiBhbmQgdXNlIGluIHNvdXJjZSBhbmQgYmluYXJ5IGZvcm1zLCB3aXRoIG9yIHdpdGhvdXRcbiAqIG1vZGlmaWNhdGlvbiwgYXJlIHBlcm1pdHRlZCBwcm92aWRlZCB0aGF0IHRoZSBmb2xsb3dpbmcgY29uZGl0aW9ucyBhcmVcbiAqIG1ldDpcbiAqXG4gKiAgKiBSZWRpc3RyaWJ1dGlvbnMgb2Ygc291cmNlIGNvZGUgbXVzdCByZXRhaW4gdGhlIGFib3ZlIGNvcHlyaWdodFxuICogICAgbm90aWNlLCB0aGlzIGxpc3Qgb2YgY29uZGl0aW9ucyBhbmQgdGhlIGZvbGxvd2luZyBkaXNjbGFpbWVyLlxuICogICogUmVkaXN0cmlidXRpb25zIGluIGJpbmFyeSBmb3JtIG11c3QgcmVwcm9kdWNlIHRoZSBhYm92ZVxuICogICAgY29weXJpZ2h0IG5vdGljZSwgdGhpcyBsaXN0IG9mIGNvbmRpdGlvbnMgYW5kIHRoZSBmb2xsb3dpbmdcbiAqICAgIGRpc2NsYWltZXIgaW4gdGhlIGRvY3VtZW50YXRpb24gYW5kL29yIG90aGVyIG1hdGVyaWFscyBwcm92aWRlZFxuICogICAgd2l0aCB0aGUgZGlzdHJpYnV0aW9uLlxuICogICogTmVpdGhlciB0aGUgbmFtZSBvZiBHb29nbGUgSW5jLiBub3IgdGhlIG5hbWVzIG9mIGl0c1xuICogICAgY29udHJpYnV0b3JzIG1heSBiZSB1c2VkIHRvIGVuZG9yc2Ugb3IgcHJvbW90ZSBwcm9kdWN0cyBkZXJpdmVkXG4gKiAgICBmcm9tIHRoaXMgc29mdHdhcmUgd2l0aG91dCBzcGVjaWZpYyBwcmlvciB3cml0dGVuIHBlcm1pc3Npb24uXG4gKlxuICogVEhJUyBTT0ZUV0FSRSBJUyBQUk9WSURFRCBCWSBUSEUgQ09QWVJJR0hUIEhPTERFUlMgQU5EIENPTlRSSUJVVE9SU1xuICogXCJBUyBJU1wiIEFORCBBTlkgRVhQUkVTUyBPUiBJTVBMSUVEIFdBUlJBTlRJRVMsIElOQ0xVRElORywgQlVUIE5PVFxuICogTElNSVRFRCBUTywgVEhFIElNUExJRUQgV0FSUkFOVElFUyBPRiBNRVJDSEFOVEFCSUxJVFkgQU5EIEZJVE5FU1MgRk9SXG4gKiBBIFBBUlRJQ1VMQVIgUFVSUE9TRSBBUkUgRElTQ0xBSU1FRC4gSU4gTk8gRVZFTlQgU0hBTEwgVEhFIENPUFlSSUdIVFxuICogT1dORVIgT1IgQ09OVFJJQlVUT1JTIEJFIExJQUJMRSBGT1IgQU5ZIERJUkVDVCwgSU5ESVJFQ1QsIElOQ0lERU5UQUwsXG4gKiBTUEVDSUFMLCBFWEVNUExBUlksIE9SIENPTlNFUVVFTlRJQUwgREFNQUdFUyAoSU5DTFVESU5HLCBCVVQgTk9UXG4gKiBMSU1JVEVEIFRPLCBQUk9DVVJFTUVOVCBPRiBTVUJTVElUVVRFIEdPT0RTIE9SIFNFUlZJQ0VTOyBMT1NTIE9GIFVTRSxcbiAqIERBVEEsIE9SIFBST0ZJVFM7IE9SIEJVU0lORVNTIElOVEVSUlVQVElPTikgSE9XRVZFUiBDQVVTRUQgQU5EIE9OIEFOWVxuICogVEhFT1JZIE9GIExJQUJJTElUWSwgV0hFVEhFUiBJTiBDT05UUkFDVCwgU1RSSUNUIExJQUJJTElUWSwgT1IgVE9SVFxuICogKElOQ0xVRElORyBORUdMSUdFTkNFIE9SIE9USEVSV0lTRSkgQVJJU0lORyBJTiBBTlkgV0FZIE9VVCBPRiBUSEUgVVNFXG4gKiBPRiBUSElTIFNPRlRXQVJFLCBFVkVOIElGIEFEVklTRUQgT0YgVEhFIFBPU1NJQklMSVRZIE9GIFNVQ0ggREFNQUdFLlxuICovXG5cbnZhciBiYXNlNjQgPSByZXF1aXJlKCcuL2Jhc2U2NCcpO1xuXG4vLyBBIHNpbmdsZSBiYXNlIDY0IGRpZ2l0IGNhbiBjb250YWluIDYgYml0cyBvZiBkYXRhLiBGb3IgdGhlIGJhc2UgNjQgdmFyaWFibGVcbi8vIGxlbmd0aCBxdWFudGl0aWVzIHdlIHVzZSBpbiB0aGUgc291cmNlIG1hcCBzcGVjLCB0aGUgZmlyc3QgYml0IGlzIHRoZSBzaWduLFxuLy8gdGhlIG5leHQgZm91ciBiaXRzIGFyZSB0aGUgYWN0dWFsIHZhbHVlLCBhbmQgdGhlIDZ0aCBiaXQgaXMgdGhlXG4vLyBjb250aW51YXRpb24gYml0LiBUaGUgY29udGludWF0aW9uIGJpdCB0ZWxscyB1cyB3aGV0aGVyIHRoZXJlIGFyZSBtb3JlXG4vLyBkaWdpdHMgaW4gdGhpcyB2YWx1ZSBmb2xsb3dpbmcgdGhpcyBkaWdpdC5cbi8vXG4vLyAgIENvbnRpbnVhdGlvblxuLy8gICB8ICAgIFNpZ25cbi8vICAgfCAgICB8XG4vLyAgIFYgICAgVlxuLy8gICAxMDEwMTFcblxudmFyIFZMUV9CQVNFX1NISUZUID0gNTtcblxuLy8gYmluYXJ5OiAxMDAwMDBcbnZhciBWTFFfQkFTRSA9IDEgPDwgVkxRX0JBU0VfU0hJRlQ7XG5cbi8vIGJpbmFyeTogMDExMTExXG52YXIgVkxRX0JBU0VfTUFTSyA9IFZMUV9CQVNFIC0gMTtcblxuLy8gYmluYXJ5OiAxMDAwMDBcbnZhciBWTFFfQ09OVElOVUFUSU9OX0JJVCA9IFZMUV9CQVNFO1xuXG4vKipcbiAqIENvbnZlcnRzIGZyb20gYSB0d28tY29tcGxlbWVudCB2YWx1ZSB0byBhIHZhbHVlIHdoZXJlIHRoZSBzaWduIGJpdCBpc1xuICogcGxhY2VkIGluIHRoZSBsZWFzdCBzaWduaWZpY2FudCBiaXQuICBGb3IgZXhhbXBsZSwgYXMgZGVjaW1hbHM6XG4gKiAgIDEgYmVjb21lcyAyICgxMCBiaW5hcnkpLCAtMSBiZWNvbWVzIDMgKDExIGJpbmFyeSlcbiAqICAgMiBiZWNvbWVzIDQgKDEwMCBiaW5hcnkpLCAtMiBiZWNvbWVzIDUgKDEwMSBiaW5hcnkpXG4gKi9cbmZ1bmN0aW9uIHRvVkxRU2lnbmVkKGFWYWx1ZSkge1xuICByZXR1cm4gYVZhbHVlIDwgMFxuICAgID8gKCgtYVZhbHVlKSA8PCAxKSArIDFcbiAgICA6IChhVmFsdWUgPDwgMSkgKyAwO1xufVxuXG4vKipcbiAqIENvbnZlcnRzIHRvIGEgdHdvLWNvbXBsZW1lbnQgdmFsdWUgZnJvbSBhIHZhbHVlIHdoZXJlIHRoZSBzaWduIGJpdCBpc1xuICogcGxhY2VkIGluIHRoZSBsZWFzdCBzaWduaWZpY2FudCBiaXQuICBGb3IgZXhhbXBsZSwgYXMgZGVjaW1hbHM6XG4gKiAgIDIgKDEwIGJpbmFyeSkgYmVjb21lcyAxLCAzICgxMSBiaW5hcnkpIGJlY29tZXMgLTFcbiAqICAgNCAoMTAwIGJpbmFyeSkgYmVjb21lcyAyLCA1ICgxMDEgYmluYXJ5KSBiZWNvbWVzIC0yXG4gKi9cbmZ1bmN0aW9uIGZyb21WTFFTaWduZWQoYVZhbHVlKSB7XG4gIHZhciBpc05lZ2F0aXZlID0gKGFWYWx1ZSAmIDEpID09PSAxO1xuICB2YXIgc2hpZnRlZCA9IGFWYWx1ZSA+PiAxO1xuICByZXR1cm4gaXNOZWdhdGl2ZVxuICAgID8gLXNoaWZ0ZWRcbiAgICA6IHNoaWZ0ZWQ7XG59XG5cbi8qKlxuICogUmV0dXJucyB0aGUgYmFzZSA2NCBWTFEgZW5jb2RlZCB2YWx1ZS5cbiAqL1xuZXhwb3J0cy5lbmNvZGUgPSBmdW5jdGlvbiBiYXNlNjRWTFFfZW5jb2RlKGFWYWx1ZSkge1xuICB2YXIgZW5jb2RlZCA9IFwiXCI7XG4gIHZhciBkaWdpdDtcblxuICB2YXIgdmxxID0gdG9WTFFTaWduZWQoYVZhbHVlKTtcblxuICBkbyB7XG4gICAgZGlnaXQgPSB2bHEgJiBWTFFfQkFTRV9NQVNLO1xuICAgIHZscSA+Pj49IFZMUV9CQVNFX1NISUZUO1xuICAgIGlmICh2bHEgPiAwKSB7XG4gICAgICAvLyBUaGVyZSBhcmUgc3RpbGwgbW9yZSBkaWdpdHMgaW4gdGhpcyB2YWx1ZSwgc28gd2UgbXVzdCBtYWtlIHN1cmUgdGhlXG4gICAgICAvLyBjb250aW51YXRpb24gYml0IGlzIG1hcmtlZC5cbiAgICAgIGRpZ2l0IHw9IFZMUV9DT05USU5VQVRJT05fQklUO1xuICAgIH1cbiAgICBlbmNvZGVkICs9IGJhc2U2NC5lbmNvZGUoZGlnaXQpO1xuICB9IHdoaWxlICh2bHEgPiAwKTtcblxuICByZXR1cm4gZW5jb2RlZDtcbn07XG5cbi8qKlxuICogRGVjb2RlcyB0aGUgbmV4dCBiYXNlIDY0IFZMUSB2YWx1ZSBmcm9tIHRoZSBnaXZlbiBzdHJpbmcgYW5kIHJldHVybnMgdGhlXG4gKiB2YWx1ZSBhbmQgdGhlIHJlc3Qgb2YgdGhlIHN0cmluZyB2aWEgdGhlIG91dCBwYXJhbWV0ZXIuXG4gKi9cbmV4cG9ydHMuZGVjb2RlID0gZnVuY3Rpb24gYmFzZTY0VkxRX2RlY29kZShhU3RyLCBhSW5kZXgsIGFPdXRQYXJhbSkge1xuICB2YXIgc3RyTGVuID0gYVN0ci5sZW5ndGg7XG4gIHZhciByZXN1bHQgPSAwO1xuICB2YXIgc2hpZnQgPSAwO1xuICB2YXIgY29udGludWF0aW9uLCBkaWdpdDtcblxuICBkbyB7XG4gICAgaWYgKGFJbmRleCA+PSBzdHJMZW4pIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcihcIkV4cGVjdGVkIG1vcmUgZGlnaXRzIGluIGJhc2UgNjQgVkxRIHZhbHVlLlwiKTtcbiAgICB9XG5cbiAgICBkaWdpdCA9IGJhc2U2NC5kZWNvZGUoYVN0ci5jaGFyQ29kZUF0KGFJbmRleCsrKSk7XG4gICAgaWYgKGRpZ2l0ID09PSAtMSkge1xuICAgICAgdGhyb3cgbmV3IEVycm9yKFwiSW52YWxpZCBiYXNlNjQgZGlnaXQ6IFwiICsgYVN0ci5jaGFyQXQoYUluZGV4IC0gMSkpO1xuICAgIH1cblxuICAgIGNvbnRpbnVhdGlvbiA9ICEhKGRpZ2l0ICYgVkxRX0NPTlRJTlVBVElPTl9CSVQpO1xuICAgIGRpZ2l0ICY9IFZMUV9CQVNFX01BU0s7XG4gICAgcmVzdWx0ID0gcmVzdWx0ICsgKGRpZ2l0IDw8IHNoaWZ0KTtcbiAgICBzaGlmdCArPSBWTFFfQkFTRV9TSElGVDtcbiAgfSB3aGlsZSAoY29udGludWF0aW9uKTtcblxuICBhT3V0UGFyYW0udmFsdWUgPSBmcm9tVkxRU2lnbmVkKHJlc3VsdCk7XG4gIGFPdXRQYXJhbS5yZXN0ID0gYUluZGV4O1xufTtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL2Jhc2U2NC12bHEuanNcbi8vIG1vZHVsZSBpZCA9IDJcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgaW50VG9DaGFyTWFwID0gJ0FCQ0RFRkdISUpLTE1OT1BRUlNUVVZXWFlaYWJjZGVmZ2hpamtsbW5vcHFyc3R1dnd4eXowMTIzNDU2Nzg5Ky8nLnNwbGl0KCcnKTtcblxuLyoqXG4gKiBFbmNvZGUgYW4gaW50ZWdlciBpbiB0aGUgcmFuZ2Ugb2YgMCB0byA2MyB0byBhIHNpbmdsZSBiYXNlIDY0IGRpZ2l0LlxuICovXG5leHBvcnRzLmVuY29kZSA9IGZ1bmN0aW9uIChudW1iZXIpIHtcbiAgaWYgKDAgPD0gbnVtYmVyICYmIG51bWJlciA8IGludFRvQ2hhck1hcC5sZW5ndGgpIHtcbiAgICByZXR1cm4gaW50VG9DaGFyTWFwW251bWJlcl07XG4gIH1cbiAgdGhyb3cgbmV3IFR5cGVFcnJvcihcIk11c3QgYmUgYmV0d2VlbiAwIGFuZCA2MzogXCIgKyBudW1iZXIpO1xufTtcblxuLyoqXG4gKiBEZWNvZGUgYSBzaW5nbGUgYmFzZSA2NCBjaGFyYWN0ZXIgY29kZSBkaWdpdCB0byBhbiBpbnRlZ2VyLiBSZXR1cm5zIC0xIG9uXG4gKiBmYWlsdXJlLlxuICovXG5leHBvcnRzLmRlY29kZSA9IGZ1bmN0aW9uIChjaGFyQ29kZSkge1xuICB2YXIgYmlnQSA9IDY1OyAgICAgLy8gJ0EnXG4gIHZhciBiaWdaID0gOTA7ICAgICAvLyAnWidcblxuICB2YXIgbGl0dGxlQSA9IDk3OyAgLy8gJ2EnXG4gIHZhciBsaXR0bGVaID0gMTIyOyAvLyAneidcblxuICB2YXIgemVybyA9IDQ4OyAgICAgLy8gJzAnXG4gIHZhciBuaW5lID0gNTc7ICAgICAvLyAnOSdcblxuICB2YXIgcGx1cyA9IDQzOyAgICAgLy8gJysnXG4gIHZhciBzbGFzaCA9IDQ3OyAgICAvLyAnLydcblxuICB2YXIgbGl0dGxlT2Zmc2V0ID0gMjY7XG4gIHZhciBudW1iZXJPZmZzZXQgPSA1MjtcblxuICAvLyAwIC0gMjU6IEFCQ0RFRkdISUpLTE1OT1BRUlNUVVZXWFlaXG4gIGlmIChiaWdBIDw9IGNoYXJDb2RlICYmIGNoYXJDb2RlIDw9IGJpZ1opIHtcbiAgICByZXR1cm4gKGNoYXJDb2RlIC0gYmlnQSk7XG4gIH1cblxuICAvLyAyNiAtIDUxOiBhYmNkZWZnaGlqa2xtbm9wcXJzdHV2d3h5elxuICBpZiAobGl0dGxlQSA8PSBjaGFyQ29kZSAmJiBjaGFyQ29kZSA8PSBsaXR0bGVaKSB7XG4gICAgcmV0dXJuIChjaGFyQ29kZSAtIGxpdHRsZUEgKyBsaXR0bGVPZmZzZXQpO1xuICB9XG5cbiAgLy8gNTIgLSA2MTogMDEyMzQ1Njc4OVxuICBpZiAoemVybyA8PSBjaGFyQ29kZSAmJiBjaGFyQ29kZSA8PSBuaW5lKSB7XG4gICAgcmV0dXJuIChjaGFyQ29kZSAtIHplcm8gKyBudW1iZXJPZmZzZXQpO1xuICB9XG5cbiAgLy8gNjI6ICtcbiAgaWYgKGNoYXJDb2RlID09IHBsdXMpIHtcbiAgICByZXR1cm4gNjI7XG4gIH1cblxuICAvLyA2MzogL1xuICBpZiAoY2hhckNvZGUgPT0gc2xhc2gpIHtcbiAgICByZXR1cm4gNjM7XG4gIH1cblxuICAvLyBJbnZhbGlkIGJhc2U2NCBkaWdpdC5cbiAgcmV0dXJuIC0xO1xufTtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL2Jhc2U2NC5qc1xuLy8gbW9kdWxlIGlkID0gM1xuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbi8qKlxuICogVGhpcyBpcyBhIGhlbHBlciBmdW5jdGlvbiBmb3IgZ2V0dGluZyB2YWx1ZXMgZnJvbSBwYXJhbWV0ZXIvb3B0aW9uc1xuICogb2JqZWN0cy5cbiAqXG4gKiBAcGFyYW0gYXJncyBUaGUgb2JqZWN0IHdlIGFyZSBleHRyYWN0aW5nIHZhbHVlcyBmcm9tXG4gKiBAcGFyYW0gbmFtZSBUaGUgbmFtZSBvZiB0aGUgcHJvcGVydHkgd2UgYXJlIGdldHRpbmcuXG4gKiBAcGFyYW0gZGVmYXVsdFZhbHVlIEFuIG9wdGlvbmFsIHZhbHVlIHRvIHJldHVybiBpZiB0aGUgcHJvcGVydHkgaXMgbWlzc2luZ1xuICogZnJvbSB0aGUgb2JqZWN0LiBJZiB0aGlzIGlzIG5vdCBzcGVjaWZpZWQgYW5kIHRoZSBwcm9wZXJ0eSBpcyBtaXNzaW5nLCBhblxuICogZXJyb3Igd2lsbCBiZSB0aHJvd24uXG4gKi9cbmZ1bmN0aW9uIGdldEFyZyhhQXJncywgYU5hbWUsIGFEZWZhdWx0VmFsdWUpIHtcbiAgaWYgKGFOYW1lIGluIGFBcmdzKSB7XG4gICAgcmV0dXJuIGFBcmdzW2FOYW1lXTtcbiAgfSBlbHNlIGlmIChhcmd1bWVudHMubGVuZ3RoID09PSAzKSB7XG4gICAgcmV0dXJuIGFEZWZhdWx0VmFsdWU7XG4gIH0gZWxzZSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKCdcIicgKyBhTmFtZSArICdcIiBpcyBhIHJlcXVpcmVkIGFyZ3VtZW50LicpO1xuICB9XG59XG5leHBvcnRzLmdldEFyZyA9IGdldEFyZztcblxudmFyIHVybFJlZ2V4cCA9IC9eKD86KFtcXHcrXFwtLl0rKTopP1xcL1xcLyg/OihcXHcrOlxcdyspQCk/KFtcXHcuLV0qKSg/OjooXFxkKykpPyguKikkLztcbnZhciBkYXRhVXJsUmVnZXhwID0gL15kYXRhOi4rXFwsLiskLztcblxuZnVuY3Rpb24gdXJsUGFyc2UoYVVybCkge1xuICB2YXIgbWF0Y2ggPSBhVXJsLm1hdGNoKHVybFJlZ2V4cCk7XG4gIGlmICghbWF0Y2gpIHtcbiAgICByZXR1cm4gbnVsbDtcbiAgfVxuICByZXR1cm4ge1xuICAgIHNjaGVtZTogbWF0Y2hbMV0sXG4gICAgYXV0aDogbWF0Y2hbMl0sXG4gICAgaG9zdDogbWF0Y2hbM10sXG4gICAgcG9ydDogbWF0Y2hbNF0sXG4gICAgcGF0aDogbWF0Y2hbNV1cbiAgfTtcbn1cbmV4cG9ydHMudXJsUGFyc2UgPSB1cmxQYXJzZTtcblxuZnVuY3Rpb24gdXJsR2VuZXJhdGUoYVBhcnNlZFVybCkge1xuICB2YXIgdXJsID0gJyc7XG4gIGlmIChhUGFyc2VkVXJsLnNjaGVtZSkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLnNjaGVtZSArICc6JztcbiAgfVxuICB1cmwgKz0gJy8vJztcbiAgaWYgKGFQYXJzZWRVcmwuYXV0aCkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLmF1dGggKyAnQCc7XG4gIH1cbiAgaWYgKGFQYXJzZWRVcmwuaG9zdCkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLmhvc3Q7XG4gIH1cbiAgaWYgKGFQYXJzZWRVcmwucG9ydCkge1xuICAgIHVybCArPSBcIjpcIiArIGFQYXJzZWRVcmwucG9ydFxuICB9XG4gIGlmIChhUGFyc2VkVXJsLnBhdGgpIHtcbiAgICB1cmwgKz0gYVBhcnNlZFVybC5wYXRoO1xuICB9XG4gIHJldHVybiB1cmw7XG59XG5leHBvcnRzLnVybEdlbmVyYXRlID0gdXJsR2VuZXJhdGU7XG5cbi8qKlxuICogTm9ybWFsaXplcyBhIHBhdGgsIG9yIHRoZSBwYXRoIHBvcnRpb24gb2YgYSBVUkw6XG4gKlxuICogLSBSZXBsYWNlcyBjb25zZWN1dGl2ZSBzbGFzaGVzIHdpdGggb25lIHNsYXNoLlxuICogLSBSZW1vdmVzIHVubmVjZXNzYXJ5ICcuJyBwYXJ0cy5cbiAqIC0gUmVtb3ZlcyB1bm5lY2Vzc2FyeSAnPGRpcj4vLi4nIHBhcnRzLlxuICpcbiAqIEJhc2VkIG9uIGNvZGUgaW4gdGhlIE5vZGUuanMgJ3BhdGgnIGNvcmUgbW9kdWxlLlxuICpcbiAqIEBwYXJhbSBhUGF0aCBUaGUgcGF0aCBvciB1cmwgdG8gbm9ybWFsaXplLlxuICovXG5mdW5jdGlvbiBub3JtYWxpemUoYVBhdGgpIHtcbiAgdmFyIHBhdGggPSBhUGF0aDtcbiAgdmFyIHVybCA9IHVybFBhcnNlKGFQYXRoKTtcbiAgaWYgKHVybCkge1xuICAgIGlmICghdXJsLnBhdGgpIHtcbiAgICAgIHJldHVybiBhUGF0aDtcbiAgICB9XG4gICAgcGF0aCA9IHVybC5wYXRoO1xuICB9XG4gIHZhciBpc0Fic29sdXRlID0gZXhwb3J0cy5pc0Fic29sdXRlKHBhdGgpO1xuXG4gIHZhciBwYXJ0cyA9IHBhdGguc3BsaXQoL1xcLysvKTtcbiAgZm9yICh2YXIgcGFydCwgdXAgPSAwLCBpID0gcGFydHMubGVuZ3RoIC0gMTsgaSA+PSAwOyBpLS0pIHtcbiAgICBwYXJ0ID0gcGFydHNbaV07XG4gICAgaWYgKHBhcnQgPT09ICcuJykge1xuICAgICAgcGFydHMuc3BsaWNlKGksIDEpO1xuICAgIH0gZWxzZSBpZiAocGFydCA9PT0gJy4uJykge1xuICAgICAgdXArKztcbiAgICB9IGVsc2UgaWYgKHVwID4gMCkge1xuICAgICAgaWYgKHBhcnQgPT09ICcnKSB7XG4gICAgICAgIC8vIFRoZSBmaXJzdCBwYXJ0IGlzIGJsYW5rIGlmIHRoZSBwYXRoIGlzIGFic29sdXRlLiBUcnlpbmcgdG8gZ29cbiAgICAgICAgLy8gYWJvdmUgdGhlIHJvb3QgaXMgYSBuby1vcC4gVGhlcmVmb3JlIHdlIGNhbiByZW1vdmUgYWxsICcuLicgcGFydHNcbiAgICAgICAgLy8gZGlyZWN0bHkgYWZ0ZXIgdGhlIHJvb3QuXG4gICAgICAgIHBhcnRzLnNwbGljZShpICsgMSwgdXApO1xuICAgICAgICB1cCA9IDA7XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBwYXJ0cy5zcGxpY2UoaSwgMik7XG4gICAgICAgIHVwLS07XG4gICAgICB9XG4gICAgfVxuICB9XG4gIHBhdGggPSBwYXJ0cy5qb2luKCcvJyk7XG5cbiAgaWYgKHBhdGggPT09ICcnKSB7XG4gICAgcGF0aCA9IGlzQWJzb2x1dGUgPyAnLycgOiAnLic7XG4gIH1cblxuICBpZiAodXJsKSB7XG4gICAgdXJsLnBhdGggPSBwYXRoO1xuICAgIHJldHVybiB1cmxHZW5lcmF0ZSh1cmwpO1xuICB9XG4gIHJldHVybiBwYXRoO1xufVxuZXhwb3J0cy5ub3JtYWxpemUgPSBub3JtYWxpemU7XG5cbi8qKlxuICogSm9pbnMgdHdvIHBhdGhzL1VSTHMuXG4gKlxuICogQHBhcmFtIGFSb290IFRoZSByb290IHBhdGggb3IgVVJMLlxuICogQHBhcmFtIGFQYXRoIFRoZSBwYXRoIG9yIFVSTCB0byBiZSBqb2luZWQgd2l0aCB0aGUgcm9vdC5cbiAqXG4gKiAtIElmIGFQYXRoIGlzIGEgVVJMIG9yIGEgZGF0YSBVUkksIGFQYXRoIGlzIHJldHVybmVkLCB1bmxlc3MgYVBhdGggaXMgYVxuICogICBzY2hlbWUtcmVsYXRpdmUgVVJMOiBUaGVuIHRoZSBzY2hlbWUgb2YgYVJvb3QsIGlmIGFueSwgaXMgcHJlcGVuZGVkXG4gKiAgIGZpcnN0LlxuICogLSBPdGhlcndpc2UgYVBhdGggaXMgYSBwYXRoLiBJZiBhUm9vdCBpcyBhIFVSTCwgdGhlbiBpdHMgcGF0aCBwb3J0aW9uXG4gKiAgIGlzIHVwZGF0ZWQgd2l0aCB0aGUgcmVzdWx0IGFuZCBhUm9vdCBpcyByZXR1cm5lZC4gT3RoZXJ3aXNlIHRoZSByZXN1bHRcbiAqICAgaXMgcmV0dXJuZWQuXG4gKiAgIC0gSWYgYVBhdGggaXMgYWJzb2x1dGUsIHRoZSByZXN1bHQgaXMgYVBhdGguXG4gKiAgIC0gT3RoZXJ3aXNlIHRoZSB0d28gcGF0aHMgYXJlIGpvaW5lZCB3aXRoIGEgc2xhc2guXG4gKiAtIEpvaW5pbmcgZm9yIGV4YW1wbGUgJ2h0dHA6Ly8nIGFuZCAnd3d3LmV4YW1wbGUuY29tJyBpcyBhbHNvIHN1cHBvcnRlZC5cbiAqL1xuZnVuY3Rpb24gam9pbihhUm9vdCwgYVBhdGgpIHtcbiAgaWYgKGFSb290ID09PSBcIlwiKSB7XG4gICAgYVJvb3QgPSBcIi5cIjtcbiAgfVxuICBpZiAoYVBhdGggPT09IFwiXCIpIHtcbiAgICBhUGF0aCA9IFwiLlwiO1xuICB9XG4gIHZhciBhUGF0aFVybCA9IHVybFBhcnNlKGFQYXRoKTtcbiAgdmFyIGFSb290VXJsID0gdXJsUGFyc2UoYVJvb3QpO1xuICBpZiAoYVJvb3RVcmwpIHtcbiAgICBhUm9vdCA9IGFSb290VXJsLnBhdGggfHwgJy8nO1xuICB9XG5cbiAgLy8gYGpvaW4oZm9vLCAnLy93d3cuZXhhbXBsZS5vcmcnKWBcbiAgaWYgKGFQYXRoVXJsICYmICFhUGF0aFVybC5zY2hlbWUpIHtcbiAgICBpZiAoYVJvb3RVcmwpIHtcbiAgICAgIGFQYXRoVXJsLnNjaGVtZSA9IGFSb290VXJsLnNjaGVtZTtcbiAgICB9XG4gICAgcmV0dXJuIHVybEdlbmVyYXRlKGFQYXRoVXJsKTtcbiAgfVxuXG4gIGlmIChhUGF0aFVybCB8fCBhUGF0aC5tYXRjaChkYXRhVXJsUmVnZXhwKSkge1xuICAgIHJldHVybiBhUGF0aDtcbiAgfVxuXG4gIC8vIGBqb2luKCdodHRwOi8vJywgJ3d3dy5leGFtcGxlLmNvbScpYFxuICBpZiAoYVJvb3RVcmwgJiYgIWFSb290VXJsLmhvc3QgJiYgIWFSb290VXJsLnBhdGgpIHtcbiAgICBhUm9vdFVybC5ob3N0ID0gYVBhdGg7XG4gICAgcmV0dXJuIHVybEdlbmVyYXRlKGFSb290VXJsKTtcbiAgfVxuXG4gIHZhciBqb2luZWQgPSBhUGF0aC5jaGFyQXQoMCkgPT09ICcvJ1xuICAgID8gYVBhdGhcbiAgICA6IG5vcm1hbGl6ZShhUm9vdC5yZXBsYWNlKC9cXC8rJC8sICcnKSArICcvJyArIGFQYXRoKTtcblxuICBpZiAoYVJvb3RVcmwpIHtcbiAgICBhUm9vdFVybC5wYXRoID0gam9pbmVkO1xuICAgIHJldHVybiB1cmxHZW5lcmF0ZShhUm9vdFVybCk7XG4gIH1cbiAgcmV0dXJuIGpvaW5lZDtcbn1cbmV4cG9ydHMuam9pbiA9IGpvaW47XG5cbmV4cG9ydHMuaXNBYnNvbHV0ZSA9IGZ1bmN0aW9uIChhUGF0aCkge1xuICByZXR1cm4gYVBhdGguY2hhckF0KDApID09PSAnLycgfHwgdXJsUmVnZXhwLnRlc3QoYVBhdGgpO1xufTtcblxuLyoqXG4gKiBNYWtlIGEgcGF0aCByZWxhdGl2ZSB0byBhIFVSTCBvciBhbm90aGVyIHBhdGguXG4gKlxuICogQHBhcmFtIGFSb290IFRoZSByb290IHBhdGggb3IgVVJMLlxuICogQHBhcmFtIGFQYXRoIFRoZSBwYXRoIG9yIFVSTCB0byBiZSBtYWRlIHJlbGF0aXZlIHRvIGFSb290LlxuICovXG5mdW5jdGlvbiByZWxhdGl2ZShhUm9vdCwgYVBhdGgpIHtcbiAgaWYgKGFSb290ID09PSBcIlwiKSB7XG4gICAgYVJvb3QgPSBcIi5cIjtcbiAgfVxuXG4gIGFSb290ID0gYVJvb3QucmVwbGFjZSgvXFwvJC8sICcnKTtcblxuICAvLyBJdCBpcyBwb3NzaWJsZSBmb3IgdGhlIHBhdGggdG8gYmUgYWJvdmUgdGhlIHJvb3QuIEluIHRoaXMgY2FzZSwgc2ltcGx5XG4gIC8vIGNoZWNraW5nIHdoZXRoZXIgdGhlIHJvb3QgaXMgYSBwcmVmaXggb2YgdGhlIHBhdGggd29uJ3Qgd29yay4gSW5zdGVhZCwgd2VcbiAgLy8gbmVlZCB0byByZW1vdmUgY29tcG9uZW50cyBmcm9tIHRoZSByb290IG9uZSBieSBvbmUsIHVudGlsIGVpdGhlciB3ZSBmaW5kXG4gIC8vIGEgcHJlZml4IHRoYXQgZml0cywgb3Igd2UgcnVuIG91dCBvZiBjb21wb25lbnRzIHRvIHJlbW92ZS5cbiAgdmFyIGxldmVsID0gMDtcbiAgd2hpbGUgKGFQYXRoLmluZGV4T2YoYVJvb3QgKyAnLycpICE9PSAwKSB7XG4gICAgdmFyIGluZGV4ID0gYVJvb3QubGFzdEluZGV4T2YoXCIvXCIpO1xuICAgIGlmIChpbmRleCA8IDApIHtcbiAgICAgIHJldHVybiBhUGF0aDtcbiAgICB9XG5cbiAgICAvLyBJZiB0aGUgb25seSBwYXJ0IG9mIHRoZSByb290IHRoYXQgaXMgbGVmdCBpcyB0aGUgc2NoZW1lIChpLmUuIGh0dHA6Ly8sXG4gICAgLy8gZmlsZTovLy8sIGV0Yy4pLCBvbmUgb3IgbW9yZSBzbGFzaGVzICgvKSwgb3Igc2ltcGx5IG5vdGhpbmcgYXQgYWxsLCB3ZVxuICAgIC8vIGhhdmUgZXhoYXVzdGVkIGFsbCBjb21wb25lbnRzLCBzbyB0aGUgcGF0aCBpcyBub3QgcmVsYXRpdmUgdG8gdGhlIHJvb3QuXG4gICAgYVJvb3QgPSBhUm9vdC5zbGljZSgwLCBpbmRleCk7XG4gICAgaWYgKGFSb290Lm1hdGNoKC9eKFteXFwvXSs6XFwvKT9cXC8qJC8pKSB7XG4gICAgICByZXR1cm4gYVBhdGg7XG4gICAgfVxuXG4gICAgKytsZXZlbDtcbiAgfVxuXG4gIC8vIE1ha2Ugc3VyZSB3ZSBhZGQgYSBcIi4uL1wiIGZvciBlYWNoIGNvbXBvbmVudCB3ZSByZW1vdmVkIGZyb20gdGhlIHJvb3QuXG4gIHJldHVybiBBcnJheShsZXZlbCArIDEpLmpvaW4oXCIuLi9cIikgKyBhUGF0aC5zdWJzdHIoYVJvb3QubGVuZ3RoICsgMSk7XG59XG5leHBvcnRzLnJlbGF0aXZlID0gcmVsYXRpdmU7XG5cbnZhciBzdXBwb3J0c051bGxQcm90byA9IChmdW5jdGlvbiAoKSB7XG4gIHZhciBvYmogPSBPYmplY3QuY3JlYXRlKG51bGwpO1xuICByZXR1cm4gISgnX19wcm90b19fJyBpbiBvYmopO1xufSgpKTtcblxuZnVuY3Rpb24gaWRlbnRpdHkgKHMpIHtcbiAgcmV0dXJuIHM7XG59XG5cbi8qKlxuICogQmVjYXVzZSBiZWhhdmlvciBnb2VzIHdhY2t5IHdoZW4geW91IHNldCBgX19wcm90b19fYCBvbiBvYmplY3RzLCB3ZVxuICogaGF2ZSB0byBwcmVmaXggYWxsIHRoZSBzdHJpbmdzIGluIG91ciBzZXQgd2l0aCBhbiBhcmJpdHJhcnkgY2hhcmFjdGVyLlxuICpcbiAqIFNlZSBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL3B1bGwvMzEgYW5kXG4gKiBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL2lzc3Vlcy8zMFxuICpcbiAqIEBwYXJhbSBTdHJpbmcgYVN0clxuICovXG5mdW5jdGlvbiB0b1NldFN0cmluZyhhU3RyKSB7XG4gIGlmIChpc1Byb3RvU3RyaW5nKGFTdHIpKSB7XG4gICAgcmV0dXJuICckJyArIGFTdHI7XG4gIH1cblxuICByZXR1cm4gYVN0cjtcbn1cbmV4cG9ydHMudG9TZXRTdHJpbmcgPSBzdXBwb3J0c051bGxQcm90byA/IGlkZW50aXR5IDogdG9TZXRTdHJpbmc7XG5cbmZ1bmN0aW9uIGZyb21TZXRTdHJpbmcoYVN0cikge1xuICBpZiAoaXNQcm90b1N0cmluZyhhU3RyKSkge1xuICAgIHJldHVybiBhU3RyLnNsaWNlKDEpO1xuICB9XG5cbiAgcmV0dXJuIGFTdHI7XG59XG5leHBvcnRzLmZyb21TZXRTdHJpbmcgPSBzdXBwb3J0c051bGxQcm90byA/IGlkZW50aXR5IDogZnJvbVNldFN0cmluZztcblxuZnVuY3Rpb24gaXNQcm90b1N0cmluZyhzKSB7XG4gIGlmICghcykge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIHZhciBsZW5ndGggPSBzLmxlbmd0aDtcblxuICBpZiAobGVuZ3RoIDwgOSAvKiBcIl9fcHJvdG9fX1wiLmxlbmd0aCAqLykge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIGlmIChzLmNoYXJDb2RlQXQobGVuZ3RoIC0gMSkgIT09IDk1ICAvKiAnXycgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSAyKSAhPT0gOTUgIC8qICdfJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDMpICE9PSAxMTEgLyogJ28nICovIHx8XG4gICAgICBzLmNoYXJDb2RlQXQobGVuZ3RoIC0gNCkgIT09IDExNiAvKiAndCcgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSA1KSAhPT0gMTExIC8qICdvJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDYpICE9PSAxMTQgLyogJ3InICovIHx8XG4gICAgICBzLmNoYXJDb2RlQXQobGVuZ3RoIC0gNykgIT09IDExMiAvKiAncCcgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSA4KSAhPT0gOTUgIC8qICdfJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDkpICE9PSA5NSAgLyogJ18nICovKSB7XG4gICAgcmV0dXJuIGZhbHNlO1xuICB9XG5cbiAgZm9yICh2YXIgaSA9IGxlbmd0aCAtIDEwOyBpID49IDA7IGktLSkge1xuICAgIGlmIChzLmNoYXJDb2RlQXQoaSkgIT09IDM2IC8qICckJyAqLykge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgfVxuXG4gIHJldHVybiB0cnVlO1xufVxuXG4vKipcbiAqIENvbXBhcmF0b3IgYmV0d2VlbiB0d28gbWFwcGluZ3Mgd2hlcmUgdGhlIG9yaWdpbmFsIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKlxuICogT3B0aW9uYWxseSBwYXNzIGluIGB0cnVlYCBhcyBgb25seUNvbXBhcmVHZW5lcmF0ZWRgIHRvIGNvbnNpZGVyIHR3b1xuICogbWFwcGluZ3Mgd2l0aCB0aGUgc2FtZSBvcmlnaW5hbCBzb3VyY2UvbGluZS9jb2x1bW4sIGJ1dCBkaWZmZXJlbnQgZ2VuZXJhdGVkXG4gKiBsaW5lIGFuZCBjb2x1bW4gdGhlIHNhbWUuIFVzZWZ1bCB3aGVuIHNlYXJjaGluZyBmb3IgYSBtYXBwaW5nIHdpdGggYVxuICogc3R1YmJlZCBvdXQgbWFwcGluZy5cbiAqL1xuZnVuY3Rpb24gY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnMobWFwcGluZ0EsIG1hcHBpbmdCLCBvbmx5Q29tcGFyZU9yaWdpbmFsKSB7XG4gIHZhciBjbXAgPSBzdHJjbXAobWFwcGluZ0Euc291cmNlLCBtYXBwaW5nQi5zb3VyY2UpO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsTGluZSAtIG1hcHBpbmdCLm9yaWdpbmFsTGluZTtcbiAgaWYgKGNtcCAhPT0gMCkge1xuICAgIHJldHVybiBjbXA7XG4gIH1cblxuICBjbXAgPSBtYXBwaW5nQS5vcmlnaW5hbENvbHVtbiAtIG1hcHBpbmdCLm9yaWdpbmFsQ29sdW1uO1xuICBpZiAoY21wICE9PSAwIHx8IG9ubHlDb21wYXJlT3JpZ2luYWwpIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkQ29sdW1uIC0gbWFwcGluZ0IuZ2VuZXJhdGVkQ29sdW1uO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLmdlbmVyYXRlZExpbmUgLSBtYXBwaW5nQi5nZW5lcmF0ZWRMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIHJldHVybiBzdHJjbXAobWFwcGluZ0EubmFtZSwgbWFwcGluZ0IubmFtZSk7XG59XG5leHBvcnRzLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zID0gY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnM7XG5cbi8qKlxuICogQ29tcGFyYXRvciBiZXR3ZWVuIHR3byBtYXBwaW5ncyB3aXRoIGRlZmxhdGVkIHNvdXJjZSBhbmQgbmFtZSBpbmRpY2VzIHdoZXJlXG4gKiB0aGUgZ2VuZXJhdGVkIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKlxuICogT3B0aW9uYWxseSBwYXNzIGluIGB0cnVlYCBhcyBgb25seUNvbXBhcmVHZW5lcmF0ZWRgIHRvIGNvbnNpZGVyIHR3b1xuICogbWFwcGluZ3Mgd2l0aCB0aGUgc2FtZSBnZW5lcmF0ZWQgbGluZSBhbmQgY29sdW1uLCBidXQgZGlmZmVyZW50XG4gKiBzb3VyY2UvbmFtZS9vcmlnaW5hbCBsaW5lIGFuZCBjb2x1bW4gdGhlIHNhbWUuIFVzZWZ1bCB3aGVuIHNlYXJjaGluZyBmb3IgYVxuICogbWFwcGluZyB3aXRoIGEgc3R1YmJlZCBvdXQgbWFwcGluZy5cbiAqL1xuZnVuY3Rpb24gY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zRGVmbGF0ZWQobWFwcGluZ0EsIG1hcHBpbmdCLCBvbmx5Q29tcGFyZUdlbmVyYXRlZCkge1xuICB2YXIgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkTGluZSAtIG1hcHBpbmdCLmdlbmVyYXRlZExpbmU7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkQ29sdW1uIC0gbWFwcGluZ0IuZ2VuZXJhdGVkQ29sdW1uO1xuICBpZiAoY21wICE9PSAwIHx8IG9ubHlDb21wYXJlR2VuZXJhdGVkKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IHN0cmNtcChtYXBwaW5nQS5zb3VyY2UsIG1hcHBpbmdCLnNvdXJjZSk7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0Eub3JpZ2luYWxMaW5lIC0gbWFwcGluZ0Iub3JpZ2luYWxMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsQ29sdW1uIC0gbWFwcGluZ0Iub3JpZ2luYWxDb2x1bW47XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgcmV0dXJuIHN0cmNtcChtYXBwaW5nQS5uYW1lLCBtYXBwaW5nQi5uYW1lKTtcbn1cbmV4cG9ydHMuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zRGVmbGF0ZWQgPSBjb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNEZWZsYXRlZDtcblxuZnVuY3Rpb24gc3RyY21wKGFTdHIxLCBhU3RyMikge1xuICBpZiAoYVN0cjEgPT09IGFTdHIyKSB7XG4gICAgcmV0dXJuIDA7XG4gIH1cblxuICBpZiAoYVN0cjEgPT09IG51bGwpIHtcbiAgICByZXR1cm4gMTsgLy8gYVN0cjIgIT09IG51bGxcbiAgfVxuXG4gIGlmIChhU3RyMiA9PT0gbnVsbCkge1xuICAgIHJldHVybiAtMTsgLy8gYVN0cjEgIT09IG51bGxcbiAgfVxuXG4gIGlmIChhU3RyMSA+IGFTdHIyKSB7XG4gICAgcmV0dXJuIDE7XG4gIH1cblxuICByZXR1cm4gLTE7XG59XG5cbi8qKlxuICogQ29tcGFyYXRvciBiZXR3ZWVuIHR3byBtYXBwaW5ncyB3aXRoIGluZmxhdGVkIHNvdXJjZSBhbmQgbmFtZSBzdHJpbmdzIHdoZXJlXG4gKiB0aGUgZ2VuZXJhdGVkIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKi9cbmZ1bmN0aW9uIGNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0luZmxhdGVkKG1hcHBpbmdBLCBtYXBwaW5nQikge1xuICB2YXIgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkTGluZSAtIG1hcHBpbmdCLmdlbmVyYXRlZExpbmU7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkQ29sdW1uIC0gbWFwcGluZ0IuZ2VuZXJhdGVkQ29sdW1uO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IHN0cmNtcChtYXBwaW5nQS5zb3VyY2UsIG1hcHBpbmdCLnNvdXJjZSk7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0Eub3JpZ2luYWxMaW5lIC0gbWFwcGluZ0Iub3JpZ2luYWxMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsQ29sdW1uIC0gbWFwcGluZ0Iub3JpZ2luYWxDb2x1bW47XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgcmV0dXJuIHN0cmNtcChtYXBwaW5nQS5uYW1lLCBtYXBwaW5nQi5uYW1lKTtcbn1cbmV4cG9ydHMuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zSW5mbGF0ZWQgPSBjb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZDtcblxuLyoqXG4gKiBTdHJpcCBhbnkgSlNPTiBYU1NJIGF2b2lkYW5jZSBwcmVmaXggZnJvbSB0aGUgc3RyaW5nIChhcyBkb2N1bWVudGVkXG4gKiBpbiB0aGUgc291cmNlIG1hcHMgc3BlY2lmaWNhdGlvbiksIGFuZCB0aGVuIHBhcnNlIHRoZSBzdHJpbmcgYXNcbiAqIEpTT04uXG4gKi9cbmZ1bmN0aW9uIHBhcnNlU291cmNlTWFwSW5wdXQoc3RyKSB7XG4gIHJldHVybiBKU09OLnBhcnNlKHN0ci5yZXBsYWNlKC9eXFwpXX0nW15cXG5dKlxcbi8sICcnKSk7XG59XG5leHBvcnRzLnBhcnNlU291cmNlTWFwSW5wdXQgPSBwYXJzZVNvdXJjZU1hcElucHV0O1xuXG4vKipcbiAqIENvbXB1dGUgdGhlIFVSTCBvZiBhIHNvdXJjZSBnaXZlbiB0aGUgdGhlIHNvdXJjZSByb290LCB0aGUgc291cmNlJ3NcbiAqIFVSTCwgYW5kIHRoZSBzb3VyY2UgbWFwJ3MgVVJMLlxuICovXG5mdW5jdGlvbiBjb21wdXRlU291cmNlVVJMKHNvdXJjZVJvb3QsIHNvdXJjZVVSTCwgc291cmNlTWFwVVJMKSB7XG4gIHNvdXJjZVVSTCA9IHNvdXJjZVVSTCB8fCAnJztcblxuICBpZiAoc291cmNlUm9vdCkge1xuICAgIC8vIFRoaXMgZm9sbG93cyB3aGF0IENocm9tZSBkb2VzLlxuICAgIGlmIChzb3VyY2VSb290W3NvdXJjZVJvb3QubGVuZ3RoIC0gMV0gIT09ICcvJyAmJiBzb3VyY2VVUkxbMF0gIT09ICcvJykge1xuICAgICAgc291cmNlUm9vdCArPSAnLyc7XG4gICAgfVxuICAgIC8vIFRoZSBzcGVjIHNheXM6XG4gICAgLy8gICBMaW5lIDQ6IEFuIG9wdGlvbmFsIHNvdXJjZSByb290LCB1c2VmdWwgZm9yIHJlbG9jYXRpbmcgc291cmNlXG4gICAgLy8gICBmaWxlcyBvbiBhIHNlcnZlciBvciByZW1vdmluZyByZXBlYXRlZCB2YWx1ZXMgaW4gdGhlXG4gICAgLy8gICDigJxzb3VyY2Vz4oCdIGVudHJ5LiAgVGhpcyB2YWx1ZSBpcyBwcmVwZW5kZWQgdG8gdGhlIGluZGl2aWR1YWxcbiAgICAvLyAgIGVudHJpZXMgaW4gdGhlIOKAnHNvdXJjZeKAnSBmaWVsZC5cbiAgICBzb3VyY2VVUkwgPSBzb3VyY2VSb290ICsgc291cmNlVVJMO1xuICB9XG5cbiAgLy8gSGlzdG9yaWNhbGx5LCBTb3VyY2VNYXBDb25zdW1lciBkaWQgbm90IHRha2UgdGhlIHNvdXJjZU1hcFVSTCBhc1xuICAvLyBhIHBhcmFtZXRlci4gIFRoaXMgbW9kZSBpcyBzdGlsbCBzb21ld2hhdCBzdXBwb3J0ZWQsIHdoaWNoIGlzIHdoeVxuICAvLyB0aGlzIGNvZGUgYmxvY2sgaXMgY29uZGl0aW9uYWwuICBIb3dldmVyLCBpdCdzIHByZWZlcmFibGUgdG8gcGFzc1xuICAvLyB0aGUgc291cmNlIG1hcCBVUkwgdG8gU291cmNlTWFwQ29uc3VtZXIsIHNvIHRoYXQgdGhpcyBmdW5jdGlvblxuICAvLyBjYW4gaW1wbGVtZW50IHRoZSBzb3VyY2UgVVJMIHJlc29sdXRpb24gYWxnb3JpdGhtIGFzIG91dGxpbmVkIGluXG4gIC8vIHRoZSBzcGVjLiAgVGhpcyBibG9jayBpcyBiYXNpY2FsbHkgdGhlIGVxdWl2YWxlbnQgb2Y6XG4gIC8vICAgIG5ldyBVUkwoc291cmNlVVJMLCBzb3VyY2VNYXBVUkwpLnRvU3RyaW5nKClcbiAgLy8gLi4uIGV4Y2VwdCBpdCBhdm9pZHMgdXNpbmcgVVJMLCB3aGljaCB3YXNuJ3QgYXZhaWxhYmxlIGluIHRoZVxuICAvLyBvbGRlciByZWxlYXNlcyBvZiBub2RlIHN0aWxsIHN1cHBvcnRlZCBieSB0aGlzIGxpYnJhcnkuXG4gIC8vXG4gIC8vIFRoZSBzcGVjIHNheXM6XG4gIC8vICAgSWYgdGhlIHNvdXJjZXMgYXJlIG5vdCBhYnNvbHV0ZSBVUkxzIGFmdGVyIHByZXBlbmRpbmcgb2YgdGhlXG4gIC8vICAg4oCcc291cmNlUm9vdOKAnSwgdGhlIHNvdXJjZXMgYXJlIHJlc29sdmVkIHJlbGF0aXZlIHRvIHRoZVxuICAvLyAgIFNvdXJjZU1hcCAobGlrZSByZXNvbHZpbmcgc2NyaXB0IHNyYyBpbiBhIGh0bWwgZG9jdW1lbnQpLlxuICBpZiAoc291cmNlTWFwVVJMKSB7XG4gICAgdmFyIHBhcnNlZCA9IHVybFBhcnNlKHNvdXJjZU1hcFVSTCk7XG4gICAgaWYgKCFwYXJzZWQpIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcihcInNvdXJjZU1hcFVSTCBjb3VsZCBub3QgYmUgcGFyc2VkXCIpO1xuICAgIH1cbiAgICBpZiAocGFyc2VkLnBhdGgpIHtcbiAgICAgIC8vIFN0cmlwIHRoZSBsYXN0IHBhdGggY29tcG9uZW50LCBidXQga2VlcCB0aGUgXCIvXCIuXG4gICAgICB2YXIgaW5kZXggPSBwYXJzZWQucGF0aC5sYXN0SW5kZXhPZignLycpO1xuICAgICAgaWYgKGluZGV4ID49IDApIHtcbiAgICAgICAgcGFyc2VkLnBhdGggPSBwYXJzZWQucGF0aC5zdWJzdHJpbmcoMCwgaW5kZXggKyAxKTtcbiAgICAgIH1cbiAgICB9XG4gICAgc291cmNlVVJMID0gam9pbih1cmxHZW5lcmF0ZShwYXJzZWQpLCBzb3VyY2VVUkwpO1xuICB9XG5cbiAgcmV0dXJuIG5vcm1hbGl6ZShzb3VyY2VVUkwpO1xufVxuZXhwb3J0cy5jb21wdXRlU291cmNlVVJMID0gY29tcHV0ZVNvdXJjZVVSTDtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL3V0aWwuanNcbi8vIG1vZHVsZSBpZCA9IDRcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgdXRpbCA9IHJlcXVpcmUoJy4vdXRpbCcpO1xudmFyIGhhcyA9IE9iamVjdC5wcm90b3R5cGUuaGFzT3duUHJvcGVydHk7XG52YXIgaGFzTmF0aXZlTWFwID0gdHlwZW9mIE1hcCAhPT0gXCJ1bmRlZmluZWRcIjtcblxuLyoqXG4gKiBBIGRhdGEgc3RydWN0dXJlIHdoaWNoIGlzIGEgY29tYmluYXRpb24gb2YgYW4gYXJyYXkgYW5kIGEgc2V0LiBBZGRpbmcgYSBuZXdcbiAqIG1lbWJlciBpcyBPKDEpLCB0ZXN0aW5nIGZvciBtZW1iZXJzaGlwIGlzIE8oMSksIGFuZCBmaW5kaW5nIHRoZSBpbmRleCBvZiBhblxuICogZWxlbWVudCBpcyBPKDEpLiBSZW1vdmluZyBlbGVtZW50cyBmcm9tIHRoZSBzZXQgaXMgbm90IHN1cHBvcnRlZC4gT25seVxuICogc3RyaW5ncyBhcmUgc3VwcG9ydGVkIGZvciBtZW1iZXJzaGlwLlxuICovXG5mdW5jdGlvbiBBcnJheVNldCgpIHtcbiAgdGhpcy5fYXJyYXkgPSBbXTtcbiAgdGhpcy5fc2V0ID0gaGFzTmF0aXZlTWFwID8gbmV3IE1hcCgpIDogT2JqZWN0LmNyZWF0ZShudWxsKTtcbn1cblxuLyoqXG4gKiBTdGF0aWMgbWV0aG9kIGZvciBjcmVhdGluZyBBcnJheVNldCBpbnN0YW5jZXMgZnJvbSBhbiBleGlzdGluZyBhcnJheS5cbiAqL1xuQXJyYXlTZXQuZnJvbUFycmF5ID0gZnVuY3Rpb24gQXJyYXlTZXRfZnJvbUFycmF5KGFBcnJheSwgYUFsbG93RHVwbGljYXRlcykge1xuICB2YXIgc2V0ID0gbmV3IEFycmF5U2V0KCk7XG4gIGZvciAodmFyIGkgPSAwLCBsZW4gPSBhQXJyYXkubGVuZ3RoOyBpIDwgbGVuOyBpKyspIHtcbiAgICBzZXQuYWRkKGFBcnJheVtpXSwgYUFsbG93RHVwbGljYXRlcyk7XG4gIH1cbiAgcmV0dXJuIHNldDtcbn07XG5cbi8qKlxuICogUmV0dXJuIGhvdyBtYW55IHVuaXF1ZSBpdGVtcyBhcmUgaW4gdGhpcyBBcnJheVNldC4gSWYgZHVwbGljYXRlcyBoYXZlIGJlZW5cbiAqIGFkZGVkLCB0aGFuIHRob3NlIGRvIG5vdCBjb3VudCB0b3dhcmRzIHRoZSBzaXplLlxuICpcbiAqIEByZXR1cm5zIE51bWJlclxuICovXG5BcnJheVNldC5wcm90b3R5cGUuc2l6ZSA9IGZ1bmN0aW9uIEFycmF5U2V0X3NpemUoKSB7XG4gIHJldHVybiBoYXNOYXRpdmVNYXAgPyB0aGlzLl9zZXQuc2l6ZSA6IE9iamVjdC5nZXRPd25Qcm9wZXJ0eU5hbWVzKHRoaXMuX3NldCkubGVuZ3RoO1xufTtcblxuLyoqXG4gKiBBZGQgdGhlIGdpdmVuIHN0cmluZyB0byB0aGlzIHNldC5cbiAqXG4gKiBAcGFyYW0gU3RyaW5nIGFTdHJcbiAqL1xuQXJyYXlTZXQucHJvdG90eXBlLmFkZCA9IGZ1bmN0aW9uIEFycmF5U2V0X2FkZChhU3RyLCBhQWxsb3dEdXBsaWNhdGVzKSB7XG4gIHZhciBzU3RyID0gaGFzTmF0aXZlTWFwID8gYVN0ciA6IHV0aWwudG9TZXRTdHJpbmcoYVN0cik7XG4gIHZhciBpc0R1cGxpY2F0ZSA9IGhhc05hdGl2ZU1hcCA/IHRoaXMuaGFzKGFTdHIpIDogaGFzLmNhbGwodGhpcy5fc2V0LCBzU3RyKTtcbiAgdmFyIGlkeCA9IHRoaXMuX2FycmF5Lmxlbmd0aDtcbiAgaWYgKCFpc0R1cGxpY2F0ZSB8fCBhQWxsb3dEdXBsaWNhdGVzKSB7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhU3RyKTtcbiAgfVxuICBpZiAoIWlzRHVwbGljYXRlKSB7XG4gICAgaWYgKGhhc05hdGl2ZU1hcCkge1xuICAgICAgdGhpcy5fc2V0LnNldChhU3RyLCBpZHgpO1xuICAgIH0gZWxzZSB7XG4gICAgICB0aGlzLl9zZXRbc1N0cl0gPSBpZHg7XG4gICAgfVxuICB9XG59O1xuXG4vKipcbiAqIElzIHRoZSBnaXZlbiBzdHJpbmcgYSBtZW1iZXIgb2YgdGhpcyBzZXQ/XG4gKlxuICogQHBhcmFtIFN0cmluZyBhU3RyXG4gKi9cbkFycmF5U2V0LnByb3RvdHlwZS5oYXMgPSBmdW5jdGlvbiBBcnJheVNldF9oYXMoYVN0cikge1xuICBpZiAoaGFzTmF0aXZlTWFwKSB7XG4gICAgcmV0dXJuIHRoaXMuX3NldC5oYXMoYVN0cik7XG4gIH0gZWxzZSB7XG4gICAgdmFyIHNTdHIgPSB1dGlsLnRvU2V0U3RyaW5nKGFTdHIpO1xuICAgIHJldHVybiBoYXMuY2FsbCh0aGlzLl9zZXQsIHNTdHIpO1xuICB9XG59O1xuXG4vKipcbiAqIFdoYXQgaXMgdGhlIGluZGV4IG9mIHRoZSBnaXZlbiBzdHJpbmcgaW4gdGhlIGFycmF5P1xuICpcbiAqIEBwYXJhbSBTdHJpbmcgYVN0clxuICovXG5BcnJheVNldC5wcm90b3R5cGUuaW5kZXhPZiA9IGZ1bmN0aW9uIEFycmF5U2V0X2luZGV4T2YoYVN0cikge1xuICBpZiAoaGFzTmF0aXZlTWFwKSB7XG4gICAgdmFyIGlkeCA9IHRoaXMuX3NldC5nZXQoYVN0cik7XG4gICAgaWYgKGlkeCA+PSAwKSB7XG4gICAgICAgIHJldHVybiBpZHg7XG4gICAgfVxuICB9IGVsc2Uge1xuICAgIHZhciBzU3RyID0gdXRpbC50b1NldFN0cmluZyhhU3RyKTtcbiAgICBpZiAoaGFzLmNhbGwodGhpcy5fc2V0LCBzU3RyKSkge1xuICAgICAgcmV0dXJuIHRoaXMuX3NldFtzU3RyXTtcbiAgICB9XG4gIH1cblxuICB0aHJvdyBuZXcgRXJyb3IoJ1wiJyArIGFTdHIgKyAnXCIgaXMgbm90IGluIHRoZSBzZXQuJyk7XG59O1xuXG4vKipcbiAqIFdoYXQgaXMgdGhlIGVsZW1lbnQgYXQgdGhlIGdpdmVuIGluZGV4P1xuICpcbiAqIEBwYXJhbSBOdW1iZXIgYUlkeFxuICovXG5BcnJheVNldC5wcm90b3R5cGUuYXQgPSBmdW5jdGlvbiBBcnJheVNldF9hdChhSWR4KSB7XG4gIGlmIChhSWR4ID49IDAgJiYgYUlkeCA8IHRoaXMuX2FycmF5Lmxlbmd0aCkge1xuICAgIHJldHVybiB0aGlzLl9hcnJheVthSWR4XTtcbiAgfVxuICB0aHJvdyBuZXcgRXJyb3IoJ05vIGVsZW1lbnQgaW5kZXhlZCBieSAnICsgYUlkeCk7XG59O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIGFycmF5IHJlcHJlc2VudGF0aW9uIG9mIHRoaXMgc2V0ICh3aGljaCBoYXMgdGhlIHByb3BlciBpbmRpY2VzXG4gKiBpbmRpY2F0ZWQgYnkgaW5kZXhPZikuIE5vdGUgdGhhdCB0aGlzIGlzIGEgY29weSBvZiB0aGUgaW50ZXJuYWwgYXJyYXkgdXNlZFxuICogZm9yIHN0b3JpbmcgdGhlIG1lbWJlcnMgc28gdGhhdCBubyBvbmUgY2FuIG1lc3Mgd2l0aCBpbnRlcm5hbCBzdGF0ZS5cbiAqL1xuQXJyYXlTZXQucHJvdG90eXBlLnRvQXJyYXkgPSBmdW5jdGlvbiBBcnJheVNldF90b0FycmF5KCkge1xuICByZXR1cm4gdGhpcy5fYXJyYXkuc2xpY2UoKTtcbn07XG5cbmV4cG9ydHMuQXJyYXlTZXQgPSBBcnJheVNldDtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL2FycmF5LXNldC5qc1xuLy8gbW9kdWxlIGlkID0gNVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTQgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbnZhciB1dGlsID0gcmVxdWlyZSgnLi91dGlsJyk7XG5cbi8qKlxuICogRGV0ZXJtaW5lIHdoZXRoZXIgbWFwcGluZ0IgaXMgYWZ0ZXIgbWFwcGluZ0Egd2l0aCByZXNwZWN0IHRvIGdlbmVyYXRlZFxuICogcG9zaXRpb24uXG4gKi9cbmZ1bmN0aW9uIGdlbmVyYXRlZFBvc2l0aW9uQWZ0ZXIobWFwcGluZ0EsIG1hcHBpbmdCKSB7XG4gIC8vIE9wdGltaXplZCBmb3IgbW9zdCBjb21tb24gY2FzZVxuICB2YXIgbGluZUEgPSBtYXBwaW5nQS5nZW5lcmF0ZWRMaW5lO1xuICB2YXIgbGluZUIgPSBtYXBwaW5nQi5nZW5lcmF0ZWRMaW5lO1xuICB2YXIgY29sdW1uQSA9IG1hcHBpbmdBLmdlbmVyYXRlZENvbHVtbjtcbiAgdmFyIGNvbHVtbkIgPSBtYXBwaW5nQi5nZW5lcmF0ZWRDb2x1bW47XG4gIHJldHVybiBsaW5lQiA+IGxpbmVBIHx8IGxpbmVCID09IGxpbmVBICYmIGNvbHVtbkIgPj0gY29sdW1uQSB8fFxuICAgICAgICAgdXRpbC5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZChtYXBwaW5nQSwgbWFwcGluZ0IpIDw9IDA7XG59XG5cbi8qKlxuICogQSBkYXRhIHN0cnVjdHVyZSB0byBwcm92aWRlIGEgc29ydGVkIHZpZXcgb2YgYWNjdW11bGF0ZWQgbWFwcGluZ3MgaW4gYVxuICogcGVyZm9ybWFuY2UgY29uc2Npb3VzIG1hbm5lci4gSXQgdHJhZGVzIGEgbmVnbGliYWJsZSBvdmVyaGVhZCBpbiBnZW5lcmFsXG4gKiBjYXNlIGZvciBhIGxhcmdlIHNwZWVkdXAgaW4gY2FzZSBvZiBtYXBwaW5ncyBiZWluZyBhZGRlZCBpbiBvcmRlci5cbiAqL1xuZnVuY3Rpb24gTWFwcGluZ0xpc3QoKSB7XG4gIHRoaXMuX2FycmF5ID0gW107XG4gIHRoaXMuX3NvcnRlZCA9IHRydWU7XG4gIC8vIFNlcnZlcyBhcyBpbmZpbXVtXG4gIHRoaXMuX2xhc3QgPSB7Z2VuZXJhdGVkTGluZTogLTEsIGdlbmVyYXRlZENvbHVtbjogMH07XG59XG5cbi8qKlxuICogSXRlcmF0ZSB0aHJvdWdoIGludGVybmFsIGl0ZW1zLiBUaGlzIG1ldGhvZCB0YWtlcyB0aGUgc2FtZSBhcmd1bWVudHMgdGhhdFxuICogYEFycmF5LnByb3RvdHlwZS5mb3JFYWNoYCB0YWtlcy5cbiAqXG4gKiBOT1RFOiBUaGUgb3JkZXIgb2YgdGhlIG1hcHBpbmdzIGlzIE5PVCBndWFyYW50ZWVkLlxuICovXG5NYXBwaW5nTGlzdC5wcm90b3R5cGUudW5zb3J0ZWRGb3JFYWNoID1cbiAgZnVuY3Rpb24gTWFwcGluZ0xpc3RfZm9yRWFjaChhQ2FsbGJhY2ssIGFUaGlzQXJnKSB7XG4gICAgdGhpcy5fYXJyYXkuZm9yRWFjaChhQ2FsbGJhY2ssIGFUaGlzQXJnKTtcbiAgfTtcblxuLyoqXG4gKiBBZGQgdGhlIGdpdmVuIHNvdXJjZSBtYXBwaW5nLlxuICpcbiAqIEBwYXJhbSBPYmplY3QgYU1hcHBpbmdcbiAqL1xuTWFwcGluZ0xpc3QucHJvdG90eXBlLmFkZCA9IGZ1bmN0aW9uIE1hcHBpbmdMaXN0X2FkZChhTWFwcGluZykge1xuICBpZiAoZ2VuZXJhdGVkUG9zaXRpb25BZnRlcih0aGlzLl9sYXN0LCBhTWFwcGluZykpIHtcbiAgICB0aGlzLl9sYXN0ID0gYU1hcHBpbmc7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhTWFwcGluZyk7XG4gIH0gZWxzZSB7XG4gICAgdGhpcy5fc29ydGVkID0gZmFsc2U7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhTWFwcGluZyk7XG4gIH1cbn07XG5cbi8qKlxuICogUmV0dXJucyB0aGUgZmxhdCwgc29ydGVkIGFycmF5IG9mIG1hcHBpbmdzLiBUaGUgbWFwcGluZ3MgYXJlIHNvcnRlZCBieVxuICogZ2VuZXJhdGVkIHBvc2l0aW9uLlxuICpcbiAqIFdBUk5JTkc6IFRoaXMgbWV0aG9kIHJldHVybnMgaW50ZXJuYWwgZGF0YSB3aXRob3V0IGNvcHlpbmcsIGZvclxuICogcGVyZm9ybWFuY2UuIFRoZSByZXR1cm4gdmFsdWUgbXVzdCBOT1QgYmUgbXV0YXRlZCwgYW5kIHNob3VsZCBiZSB0cmVhdGVkIGFzXG4gKiBhbiBpbW11dGFibGUgYm9ycm93LiBJZiB5b3Ugd2FudCB0byB0YWtlIG93bmVyc2hpcCwgeW91IG11c3QgbWFrZSB5b3VyIG93blxuICogY29weS5cbiAqL1xuTWFwcGluZ0xpc3QucHJvdG90eXBlLnRvQXJyYXkgPSBmdW5jdGlvbiBNYXBwaW5nTGlzdF90b0FycmF5KCkge1xuICBpZiAoIXRoaXMuX3NvcnRlZCkge1xuICAgIHRoaXMuX2FycmF5LnNvcnQodXRpbC5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZCk7XG4gICAgdGhpcy5fc29ydGVkID0gdHJ1ZTtcbiAgfVxuICByZXR1cm4gdGhpcy5fYXJyYXk7XG59O1xuXG5leHBvcnRzLk1hcHBpbmdMaXN0ID0gTWFwcGluZ0xpc3Q7XG5cblxuXG4vLy8vLy8vLy8vLy8vLy8vLy9cbi8vIFdFQlBBQ0sgRk9PVEVSXG4vLyAuL2xpYi9tYXBwaW5nLWxpc3QuanNcbi8vIG1vZHVsZSBpZCA9IDZcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgdXRpbCA9IHJlcXVpcmUoJy4vdXRpbCcpO1xudmFyIGJpbmFyeVNlYXJjaCA9IHJlcXVpcmUoJy4vYmluYXJ5LXNlYXJjaCcpO1xudmFyIEFycmF5U2V0ID0gcmVxdWlyZSgnLi9hcnJheS1zZXQnKS5BcnJheVNldDtcbnZhciBiYXNlNjRWTFEgPSByZXF1aXJlKCcuL2Jhc2U2NC12bHEnKTtcbnZhciBxdWlja1NvcnQgPSByZXF1aXJlKCcuL3F1aWNrLXNvcnQnKS5xdWlja1NvcnQ7XG5cbmZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgdmFyIHNvdXJjZU1hcCA9IGFTb3VyY2VNYXA7XG4gIGlmICh0eXBlb2YgYVNvdXJjZU1hcCA9PT0gJ3N0cmluZycpIHtcbiAgICBzb3VyY2VNYXAgPSB1dGlsLnBhcnNlU291cmNlTWFwSW5wdXQoYVNvdXJjZU1hcCk7XG4gIH1cblxuICByZXR1cm4gc291cmNlTWFwLnNlY3Rpb25zICE9IG51bGxcbiAgICA/IG5ldyBJbmRleGVkU291cmNlTWFwQ29uc3VtZXIoc291cmNlTWFwLCBhU291cmNlTWFwVVJMKVxuICAgIDogbmV3IEJhc2ljU291cmNlTWFwQ29uc3VtZXIoc291cmNlTWFwLCBhU291cmNlTWFwVVJMKTtcbn1cblxuU291cmNlTWFwQ29uc3VtZXIuZnJvbVNvdXJjZU1hcCA9IGZ1bmN0aW9uKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgcmV0dXJuIEJhc2ljU291cmNlTWFwQ29uc3VtZXIuZnJvbVNvdXJjZU1hcChhU291cmNlTWFwLCBhU291cmNlTWFwVVJMKTtcbn1cblxuLyoqXG4gKiBUaGUgdmVyc2lvbiBvZiB0aGUgc291cmNlIG1hcHBpbmcgc3BlYyB0aGF0IHdlIGFyZSBjb25zdW1pbmcuXG4gKi9cblNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8vIGBfX2dlbmVyYXRlZE1hcHBpbmdzYCBhbmQgYF9fb3JpZ2luYWxNYXBwaW5nc2AgYXJlIGFycmF5cyB0aGF0IGhvbGQgdGhlXG4vLyBwYXJzZWQgbWFwcGluZyBjb29yZGluYXRlcyBmcm9tIHRoZSBzb3VyY2UgbWFwJ3MgXCJtYXBwaW5nc1wiIGF0dHJpYnV0ZS4gVGhleVxuLy8gYXJlIGxhemlseSBpbnN0YW50aWF0ZWQsIGFjY2Vzc2VkIHZpYSB0aGUgYF9nZW5lcmF0ZWRNYXBwaW5nc2AgYW5kXG4vLyBgX29yaWdpbmFsTWFwcGluZ3NgIGdldHRlcnMgcmVzcGVjdGl2ZWx5LCBhbmQgd2Ugb25seSBwYXJzZSB0aGUgbWFwcGluZ3Ncbi8vIGFuZCBjcmVhdGUgdGhlc2UgYXJyYXlzIG9uY2UgcXVlcmllZCBmb3IgYSBzb3VyY2UgbG9jYXRpb24uIFdlIGp1bXAgdGhyb3VnaFxuLy8gdGhlc2UgaG9vcHMgYmVjYXVzZSB0aGVyZSBjYW4gYmUgbWFueSB0aG91c2FuZHMgb2YgbWFwcGluZ3MsIGFuZCBwYXJzaW5nXG4vLyB0aGVtIGlzIGV4cGVuc2l2ZSwgc28gd2Ugb25seSB3YW50IHRvIGRvIGl0IGlmIHdlIG11c3QuXG4vL1xuLy8gRWFjaCBvYmplY3QgaW4gdGhlIGFycmF5cyBpcyBvZiB0aGUgZm9ybTpcbi8vXG4vLyAgICAge1xuLy8gICAgICAgZ2VuZXJhdGVkTGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgY29kZSxcbi8vICAgICAgIGdlbmVyYXRlZENvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBjb2RlLFxuLy8gICAgICAgc291cmNlOiBUaGUgcGF0aCB0byB0aGUgb3JpZ2luYWwgc291cmNlIGZpbGUgdGhhdCBnZW5lcmF0ZWQgdGhpc1xuLy8gICAgICAgICAgICAgICBjaHVuayBvZiBjb2RlLFxuLy8gICAgICAgb3JpZ2luYWxMaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZSB0aGF0XG4vLyAgICAgICAgICAgICAgICAgICAgIGNvcnJlc3BvbmRzIHRvIHRoaXMgY2h1bmsgb2YgZ2VuZXJhdGVkIGNvZGUsXG4vLyAgICAgICBvcmlnaW5hbENvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZSB0aGF0XG4vLyAgICAgICAgICAgICAgICAgICAgICAgY29ycmVzcG9uZHMgdG8gdGhpcyBjaHVuayBvZiBnZW5lcmF0ZWQgY29kZSxcbi8vICAgICAgIG5hbWU6IFRoZSBuYW1lIG9mIHRoZSBvcmlnaW5hbCBzeW1ib2wgd2hpY2ggZ2VuZXJhdGVkIHRoaXMgY2h1bmsgb2Zcbi8vICAgICAgICAgICAgIGNvZGUuXG4vLyAgICAgfVxuLy9cbi8vIEFsbCBwcm9wZXJ0aWVzIGV4Y2VwdCBmb3IgYGdlbmVyYXRlZExpbmVgIGFuZCBgZ2VuZXJhdGVkQ29sdW1uYCBjYW4gYmVcbi8vIGBudWxsYC5cbi8vXG4vLyBgX2dlbmVyYXRlZE1hcHBpbmdzYCBpcyBvcmRlcmVkIGJ5IHRoZSBnZW5lcmF0ZWQgcG9zaXRpb25zLlxuLy9cbi8vIGBfb3JpZ2luYWxNYXBwaW5nc2AgaXMgb3JkZXJlZCBieSB0aGUgb3JpZ2luYWwgcG9zaXRpb25zLlxuXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX19nZW5lcmF0ZWRNYXBwaW5ncyA9IG51bGw7XG5PYmplY3QuZGVmaW5lUHJvcGVydHkoU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLCAnX2dlbmVyYXRlZE1hcHBpbmdzJywge1xuICBjb25maWd1cmFibGU6IHRydWUsXG4gIGVudW1lcmFibGU6IHRydWUsXG4gIGdldDogZnVuY3Rpb24gKCkge1xuICAgIGlmICghdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzKSB7XG4gICAgICB0aGlzLl9wYXJzZU1hcHBpbmdzKHRoaXMuX21hcHBpbmdzLCB0aGlzLnNvdXJjZVJvb3QpO1xuICAgIH1cblxuICAgIHJldHVybiB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3M7XG4gIH1cbn0pO1xuXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX19vcmlnaW5hbE1hcHBpbmdzID0gbnVsbDtcbk9iamVjdC5kZWZpbmVQcm9wZXJ0eShTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUsICdfb3JpZ2luYWxNYXBwaW5ncycsIHtcbiAgY29uZmlndXJhYmxlOiB0cnVlLFxuICBlbnVtZXJhYmxlOiB0cnVlLFxuICBnZXQ6IGZ1bmN0aW9uICgpIHtcbiAgICBpZiAoIXRoaXMuX19vcmlnaW5hbE1hcHBpbmdzKSB7XG4gICAgICB0aGlzLl9wYXJzZU1hcHBpbmdzKHRoaXMuX21hcHBpbmdzLCB0aGlzLnNvdXJjZVJvb3QpO1xuICAgIH1cblxuICAgIHJldHVybiB0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncztcbiAgfVxufSk7XG5cblNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fY2hhcklzTWFwcGluZ1NlcGFyYXRvciA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2NoYXJJc01hcHBpbmdTZXBhcmF0b3IoYVN0ciwgaW5kZXgpIHtcbiAgICB2YXIgYyA9IGFTdHIuY2hhckF0KGluZGV4KTtcbiAgICByZXR1cm4gYyA9PT0gXCI7XCIgfHwgYyA9PT0gXCIsXCI7XG4gIH07XG5cbi8qKlxuICogUGFyc2UgdGhlIG1hcHBpbmdzIGluIGEgc3RyaW5nIGluIHRvIGEgZGF0YSBzdHJ1Y3R1cmUgd2hpY2ggd2UgY2FuIGVhc2lseVxuICogcXVlcnkgKHRoZSBvcmRlcmVkIGFycmF5cyBpbiB0aGUgYHRoaXMuX19nZW5lcmF0ZWRNYXBwaW5nc2AgYW5kXG4gKiBgdGhpcy5fX29yaWdpbmFsTWFwcGluZ3NgIHByb3BlcnRpZXMpLlxuICovXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3BhcnNlTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKFwiU3ViY2xhc3NlcyBtdXN0IGltcGxlbWVudCBfcGFyc2VNYXBwaW5nc1wiKTtcbiAgfTtcblxuU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSID0gMTtcblNvdXJjZU1hcENvbnN1bWVyLk9SSUdJTkFMX09SREVSID0gMjtcblxuU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQgPSAxO1xuU291cmNlTWFwQ29uc3VtZXIuTEVBU1RfVVBQRVJfQk9VTkQgPSAyO1xuXG4vKipcbiAqIEl0ZXJhdGUgb3ZlciBlYWNoIG1hcHBpbmcgYmV0d2VlbiBhbiBvcmlnaW5hbCBzb3VyY2UvbGluZS9jb2x1bW4gYW5kIGFcbiAqIGdlbmVyYXRlZCBsaW5lL2NvbHVtbiBpbiB0aGlzIHNvdXJjZSBtYXAuXG4gKlxuICogQHBhcmFtIEZ1bmN0aW9uIGFDYWxsYmFja1xuICogICAgICAgIFRoZSBmdW5jdGlvbiB0aGF0IGlzIGNhbGxlZCB3aXRoIGVhY2ggbWFwcGluZy5cbiAqIEBwYXJhbSBPYmplY3QgYUNvbnRleHRcbiAqICAgICAgICBPcHRpb25hbC4gSWYgc3BlY2lmaWVkLCB0aGlzIG9iamVjdCB3aWxsIGJlIHRoZSB2YWx1ZSBvZiBgdGhpc2AgZXZlcnlcbiAqICAgICAgICB0aW1lIHRoYXQgYGFDYWxsYmFja2AgaXMgY2FsbGVkLlxuICogQHBhcmFtIGFPcmRlclxuICogICAgICAgIEVpdGhlciBgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSYCBvclxuICogICAgICAgIGBTb3VyY2VNYXBDb25zdW1lci5PUklHSU5BTF9PUkRFUmAuIFNwZWNpZmllcyB3aGV0aGVyIHlvdSB3YW50IHRvXG4gKiAgICAgICAgaXRlcmF0ZSBvdmVyIHRoZSBtYXBwaW5ncyBzb3J0ZWQgYnkgdGhlIGdlbmVyYXRlZCBmaWxlJ3MgbGluZS9jb2x1bW5cbiAqICAgICAgICBvcmRlciBvciB0aGUgb3JpZ2luYWwncyBzb3VyY2UvbGluZS9jb2x1bW4gb3JkZXIsIHJlc3BlY3RpdmVseS4gRGVmYXVsdHMgdG9cbiAqICAgICAgICBgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSYC5cbiAqL1xuU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmVhY2hNYXBwaW5nID1cbiAgZnVuY3Rpb24gU291cmNlTWFwQ29uc3VtZXJfZWFjaE1hcHBpbmcoYUNhbGxiYWNrLCBhQ29udGV4dCwgYU9yZGVyKSB7XG4gICAgdmFyIGNvbnRleHQgPSBhQ29udGV4dCB8fCBudWxsO1xuICAgIHZhciBvcmRlciA9IGFPcmRlciB8fCBTb3VyY2VNYXBDb25zdW1lci5HRU5FUkFURURfT1JERVI7XG5cbiAgICB2YXIgbWFwcGluZ3M7XG4gICAgc3dpdGNoIChvcmRlcikge1xuICAgIGNhc2UgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSOlxuICAgICAgbWFwcGluZ3MgPSB0aGlzLl9nZW5lcmF0ZWRNYXBwaW5ncztcbiAgICAgIGJyZWFrO1xuICAgIGNhc2UgU291cmNlTWFwQ29uc3VtZXIuT1JJR0lOQUxfT1JERVI6XG4gICAgICBtYXBwaW5ncyA9IHRoaXMuX29yaWdpbmFsTWFwcGluZ3M7XG4gICAgICBicmVhaztcbiAgICBkZWZhdWx0OlxuICAgICAgdGhyb3cgbmV3IEVycm9yKFwiVW5rbm93biBvcmRlciBvZiBpdGVyYXRpb24uXCIpO1xuICAgIH1cblxuICAgIHZhciBzb3VyY2VSb290ID0gdGhpcy5zb3VyY2VSb290O1xuICAgIG1hcHBpbmdzLm1hcChmdW5jdGlvbiAobWFwcGluZykge1xuICAgICAgdmFyIHNvdXJjZSA9IG1hcHBpbmcuc291cmNlID09PSBudWxsID8gbnVsbCA6IHRoaXMuX3NvdXJjZXMuYXQobWFwcGluZy5zb3VyY2UpO1xuICAgICAgc291cmNlID0gdXRpbC5jb21wdXRlU291cmNlVVJMKHNvdXJjZVJvb3QsIHNvdXJjZSwgdGhpcy5fc291cmNlTWFwVVJMKTtcbiAgICAgIHJldHVybiB7XG4gICAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgICBnZW5lcmF0ZWRMaW5lOiBtYXBwaW5nLmdlbmVyYXRlZExpbmUsXG4gICAgICAgIGdlbmVyYXRlZENvbHVtbjogbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4sXG4gICAgICAgIG9yaWdpbmFsTGluZTogbWFwcGluZy5vcmlnaW5hbExpbmUsXG4gICAgICAgIG9yaWdpbmFsQ29sdW1uOiBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uLFxuICAgICAgICBuYW1lOiBtYXBwaW5nLm5hbWUgPT09IG51bGwgPyBudWxsIDogdGhpcy5fbmFtZXMuYXQobWFwcGluZy5uYW1lKVxuICAgICAgfTtcbiAgICB9LCB0aGlzKS5mb3JFYWNoKGFDYWxsYmFjaywgY29udGV4dCk7XG4gIH07XG5cbi8qKlxuICogUmV0dXJucyBhbGwgZ2VuZXJhdGVkIGxpbmUgYW5kIGNvbHVtbiBpbmZvcm1hdGlvbiBmb3IgdGhlIG9yaWdpbmFsIHNvdXJjZSxcbiAqIGxpbmUsIGFuZCBjb2x1bW4gcHJvdmlkZWQuIElmIG5vIGNvbHVtbiBpcyBwcm92aWRlZCwgcmV0dXJucyBhbGwgbWFwcGluZ3NcbiAqIGNvcnJlc3BvbmRpbmcgdG8gYSBlaXRoZXIgdGhlIGxpbmUgd2UgYXJlIHNlYXJjaGluZyBmb3Igb3IgdGhlIG5leHRcbiAqIGNsb3Nlc3QgbGluZSB0aGF0IGhhcyBhbnkgbWFwcGluZ3MuIE90aGVyd2lzZSwgcmV0dXJucyBhbGwgbWFwcGluZ3NcbiAqIGNvcnJlc3BvbmRpbmcgdG8gdGhlIGdpdmVuIGxpbmUgYW5kIGVpdGhlciB0aGUgY29sdW1uIHdlIGFyZSBzZWFyY2hpbmcgZm9yXG4gKiBvciB0aGUgbmV4dCBjbG9zZXN0IGNvbHVtbiB0aGF0IGhhcyBhbnkgb2Zmc2V0cy5cbiAqXG4gKiBUaGUgb25seSBhcmd1bWVudCBpcyBhbiBvYmplY3Qgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIGZpbGVuYW1lIG9mIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UuICBUaGUgbGluZSBudW1iZXIgaXMgMS1iYXNlZC5cbiAqICAgLSBjb2x1bW46IE9wdGlvbmFsLiB0aGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLlxuICogICAgVGhlIGNvbHVtbiBudW1iZXIgaXMgMC1iYXNlZC5cbiAqXG4gKiBhbmQgYW4gYXJyYXkgb2Ygb2JqZWN0cyBpcyByZXR1cm5lZCwgZWFjaCB3aXRoIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLCBvciBudWxsLiAgVGhlXG4gKiAgICBsaW5lIG51bWJlciBpcyAxLWJhc2VkLlxuICogICAtIGNvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBzb3VyY2UsIG9yIG51bGwuXG4gKiAgICBUaGUgY29sdW1uIG51bWJlciBpcyAwLWJhc2VkLlxuICovXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuYWxsR2VuZXJhdGVkUG9zaXRpb25zRm9yID1cbiAgZnVuY3Rpb24gU291cmNlTWFwQ29uc3VtZXJfYWxsR2VuZXJhdGVkUG9zaXRpb25zRm9yKGFBcmdzKSB7XG4gICAgdmFyIGxpbmUgPSB1dGlsLmdldEFyZyhhQXJncywgJ2xpbmUnKTtcblxuICAgIC8vIFdoZW4gdGhlcmUgaXMgbm8gZXhhY3QgbWF0Y2gsIEJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLl9maW5kTWFwcGluZ1xuICAgIC8vIHJldHVybnMgdGhlIGluZGV4IG9mIHRoZSBjbG9zZXN0IG1hcHBpbmcgbGVzcyB0aGFuIHRoZSBuZWVkbGUuIEJ5XG4gICAgLy8gc2V0dGluZyBuZWVkbGUub3JpZ2luYWxDb2x1bW4gdG8gMCwgd2UgdGh1cyBmaW5kIHRoZSBsYXN0IG1hcHBpbmcgZm9yXG4gICAgLy8gdGhlIGdpdmVuIGxpbmUsIHByb3ZpZGVkIHN1Y2ggYSBtYXBwaW5nIGV4aXN0cy5cbiAgICB2YXIgbmVlZGxlID0ge1xuICAgICAgc291cmNlOiB1dGlsLmdldEFyZyhhQXJncywgJ3NvdXJjZScpLFxuICAgICAgb3JpZ2luYWxMaW5lOiBsaW5lLFxuICAgICAgb3JpZ2luYWxDb2x1bW46IHV0aWwuZ2V0QXJnKGFBcmdzLCAnY29sdW1uJywgMClcbiAgICB9O1xuXG4gICAgbmVlZGxlLnNvdXJjZSA9IHRoaXMuX2ZpbmRTb3VyY2VJbmRleChuZWVkbGUuc291cmNlKTtcbiAgICBpZiAobmVlZGxlLnNvdXJjZSA8IDApIHtcbiAgICAgIHJldHVybiBbXTtcbiAgICB9XG5cbiAgICB2YXIgbWFwcGluZ3MgPSBbXTtcblxuICAgIHZhciBpbmRleCA9IHRoaXMuX2ZpbmRNYXBwaW5nKG5lZWRsZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIFwib3JpZ2luYWxMaW5lXCIsXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgXCJvcmlnaW5hbENvbHVtblwiLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIHV0aWwuY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnMsXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgYmluYXJ5U2VhcmNoLkxFQVNUX1VQUEVSX0JPVU5EKTtcbiAgICBpZiAoaW5kZXggPj0gMCkge1xuICAgICAgdmFyIG1hcHBpbmcgPSB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzW2luZGV4XTtcblxuICAgICAgaWYgKGFBcmdzLmNvbHVtbiA9PT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIHZhciBvcmlnaW5hbExpbmUgPSBtYXBwaW5nLm9yaWdpbmFsTGluZTtcblxuICAgICAgICAvLyBJdGVyYXRlIHVudGlsIGVpdGhlciB3ZSBydW4gb3V0IG9mIG1hcHBpbmdzLCBvciB3ZSBydW4gaW50b1xuICAgICAgICAvLyBhIG1hcHBpbmcgZm9yIGEgZGlmZmVyZW50IGxpbmUgdGhhbiB0aGUgb25lIHdlIGZvdW5kLiBTaW5jZVxuICAgICAgICAvLyBtYXBwaW5ncyBhcmUgc29ydGVkLCB0aGlzIGlzIGd1YXJhbnRlZWQgdG8gZmluZCBhbGwgbWFwcGluZ3MgZm9yXG4gICAgICAgIC8vIHRoZSBsaW5lIHdlIGZvdW5kLlxuICAgICAgICB3aGlsZSAobWFwcGluZyAmJiBtYXBwaW5nLm9yaWdpbmFsTGluZSA9PT0gb3JpZ2luYWxMaW5lKSB7XG4gICAgICAgICAgbWFwcGluZ3MucHVzaCh7XG4gICAgICAgICAgICBsaW5lOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkTGluZScsIG51bGwpLFxuICAgICAgICAgICAgY29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkQ29sdW1uJywgbnVsbCksXG4gICAgICAgICAgICBsYXN0Q29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnbGFzdEdlbmVyYXRlZENvbHVtbicsIG51bGwpXG4gICAgICAgICAgfSk7XG5cbiAgICAgICAgICBtYXBwaW5nID0gdGhpcy5fb3JpZ2luYWxNYXBwaW5nc1srK2luZGV4XTtcbiAgICAgICAgfVxuICAgICAgfSBlbHNlIHtcbiAgICAgICAgdmFyIG9yaWdpbmFsQ29sdW1uID0gbWFwcGluZy5vcmlnaW5hbENvbHVtbjtcblxuICAgICAgICAvLyBJdGVyYXRlIHVudGlsIGVpdGhlciB3ZSBydW4gb3V0IG9mIG1hcHBpbmdzLCBvciB3ZSBydW4gaW50b1xuICAgICAgICAvLyBhIG1hcHBpbmcgZm9yIGEgZGlmZmVyZW50IGxpbmUgdGhhbiB0aGUgb25lIHdlIHdlcmUgc2VhcmNoaW5nIGZvci5cbiAgICAgICAgLy8gU2luY2UgbWFwcGluZ3MgYXJlIHNvcnRlZCwgdGhpcyBpcyBndWFyYW50ZWVkIHRvIGZpbmQgYWxsIG1hcHBpbmdzIGZvclxuICAgICAgICAvLyB0aGUgbGluZSB3ZSBhcmUgc2VhcmNoaW5nIGZvci5cbiAgICAgICAgd2hpbGUgKG1hcHBpbmcgJiZcbiAgICAgICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxMaW5lID09PSBsaW5lICYmXG4gICAgICAgICAgICAgICBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uID09IG9yaWdpbmFsQ29sdW1uKSB7XG4gICAgICAgICAgbWFwcGluZ3MucHVzaCh7XG4gICAgICAgICAgICBsaW5lOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkTGluZScsIG51bGwpLFxuICAgICAgICAgICAgY29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkQ29sdW1uJywgbnVsbCksXG4gICAgICAgICAgICBsYXN0Q29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnbGFzdEdlbmVyYXRlZENvbHVtbicsIG51bGwpXG4gICAgICAgICAgfSk7XG5cbiAgICAgICAgICBtYXBwaW5nID0gdGhpcy5fb3JpZ2luYWxNYXBwaW5nc1srK2luZGV4XTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiBtYXBwaW5ncztcbiAgfTtcblxuZXhwb3J0cy5Tb3VyY2VNYXBDb25zdW1lciA9IFNvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIEEgQmFzaWNTb3VyY2VNYXBDb25zdW1lciBpbnN0YW5jZSByZXByZXNlbnRzIGEgcGFyc2VkIHNvdXJjZSBtYXAgd2hpY2ggd2UgY2FuXG4gKiBxdWVyeSBmb3IgaW5mb3JtYXRpb24gYWJvdXQgdGhlIG9yaWdpbmFsIGZpbGUgcG9zaXRpb25zIGJ5IGdpdmluZyBpdCBhIGZpbGVcbiAqIHBvc2l0aW9uIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLlxuICpcbiAqIFRoZSBmaXJzdCBwYXJhbWV0ZXIgaXMgdGhlIHJhdyBzb3VyY2UgbWFwIChlaXRoZXIgYXMgYSBKU09OIHN0cmluZywgb3JcbiAqIGFscmVhZHkgcGFyc2VkIHRvIGFuIG9iamVjdCkuIEFjY29yZGluZyB0byB0aGUgc3BlYywgc291cmNlIG1hcHMgaGF2ZSB0aGVcbiAqIGZvbGxvd2luZyBhdHRyaWJ1dGVzOlxuICpcbiAqICAgLSB2ZXJzaW9uOiBXaGljaCB2ZXJzaW9uIG9mIHRoZSBzb3VyY2UgbWFwIHNwZWMgdGhpcyBtYXAgaXMgZm9sbG93aW5nLlxuICogICAtIHNvdXJjZXM6IEFuIGFycmF5IG9mIFVSTHMgdG8gdGhlIG9yaWdpbmFsIHNvdXJjZSBmaWxlcy5cbiAqICAgLSBuYW1lczogQW4gYXJyYXkgb2YgaWRlbnRpZmllcnMgd2hpY2ggY2FuIGJlIHJlZmVycmVuY2VkIGJ5IGluZGl2aWR1YWwgbWFwcGluZ3MuXG4gKiAgIC0gc291cmNlUm9vdDogT3B0aW9uYWwuIFRoZSBVUkwgcm9vdCBmcm9tIHdoaWNoIGFsbCBzb3VyY2VzIGFyZSByZWxhdGl2ZS5cbiAqICAgLSBzb3VyY2VzQ29udGVudDogT3B0aW9uYWwuIEFuIGFycmF5IG9mIGNvbnRlbnRzIG9mIHRoZSBvcmlnaW5hbCBzb3VyY2UgZmlsZXMuXG4gKiAgIC0gbWFwcGluZ3M6IEEgc3RyaW5nIG9mIGJhc2U2NCBWTFFzIHdoaWNoIGNvbnRhaW4gdGhlIGFjdHVhbCBtYXBwaW5ncy5cbiAqICAgLSBmaWxlOiBPcHRpb25hbC4gVGhlIGdlbmVyYXRlZCBmaWxlIHRoaXMgc291cmNlIG1hcCBpcyBhc3NvY2lhdGVkIHdpdGguXG4gKlxuICogSGVyZSBpcyBhbiBleGFtcGxlIHNvdXJjZSBtYXAsIHRha2VuIGZyb20gdGhlIHNvdXJjZSBtYXAgc3BlY1swXTpcbiAqXG4gKiAgICAge1xuICogICAgICAgdmVyc2lvbiA6IDMsXG4gKiAgICAgICBmaWxlOiBcIm91dC5qc1wiLFxuICogICAgICAgc291cmNlUm9vdCA6IFwiXCIsXG4gKiAgICAgICBzb3VyY2VzOiBbXCJmb28uanNcIiwgXCJiYXIuanNcIl0sXG4gKiAgICAgICBuYW1lczogW1wic3JjXCIsIFwibWFwc1wiLCBcImFyZVwiLCBcImZ1blwiXSxcbiAqICAgICAgIG1hcHBpbmdzOiBcIkFBLEFCOztBQkNERTtcIlxuICogICAgIH1cbiAqXG4gKiBUaGUgc2Vjb25kIHBhcmFtZXRlciwgaWYgZ2l2ZW4sIGlzIGEgc3RyaW5nIHdob3NlIHZhbHVlIGlzIHRoZSBVUkxcbiAqIGF0IHdoaWNoIHRoZSBzb3VyY2UgbWFwIHdhcyBmb3VuZC4gIFRoaXMgVVJMIGlzIHVzZWQgdG8gY29tcHV0ZSB0aGVcbiAqIHNvdXJjZXMgYXJyYXkuXG4gKlxuICogWzBdOiBodHRwczovL2RvY3MuZ29vZ2xlLmNvbS9kb2N1bWVudC9kLzFVMVJHQWVoUXdSeXBVVG92RjFLUmxwaU9GemUwYi1fMmdjNmZBSDBLWTBrL2VkaXQ/cGxpPTEjXG4gKi9cbmZ1bmN0aW9uIEJhc2ljU291cmNlTWFwQ29uc3VtZXIoYVNvdXJjZU1hcCwgYVNvdXJjZU1hcFVSTCkge1xuICB2YXIgc291cmNlTWFwID0gYVNvdXJjZU1hcDtcbiAgaWYgKHR5cGVvZiBhU291cmNlTWFwID09PSAnc3RyaW5nJykge1xuICAgIHNvdXJjZU1hcCA9IHV0aWwucGFyc2VTb3VyY2VNYXBJbnB1dChhU291cmNlTWFwKTtcbiAgfVxuXG4gIHZhciB2ZXJzaW9uID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAndmVyc2lvbicpO1xuICB2YXIgc291cmNlcyA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3NvdXJjZXMnKTtcbiAgLy8gU2FzcyAzLjMgbGVhdmVzIG91dCB0aGUgJ25hbWVzJyBhcnJheSwgc28gd2UgZGV2aWF0ZSBmcm9tIHRoZSBzcGVjICh3aGljaFxuICAvLyByZXF1aXJlcyB0aGUgYXJyYXkpIHRvIHBsYXkgbmljZSBoZXJlLlxuICB2YXIgbmFtZXMgPSB1dGlsLmdldEFyZyhzb3VyY2VNYXAsICduYW1lcycsIFtdKTtcbiAgdmFyIHNvdXJjZVJvb3QgPSB1dGlsLmdldEFyZyhzb3VyY2VNYXAsICdzb3VyY2VSb290JywgbnVsbCk7XG4gIHZhciBzb3VyY2VzQ29udGVudCA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3NvdXJjZXNDb250ZW50JywgbnVsbCk7XG4gIHZhciBtYXBwaW5ncyA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ21hcHBpbmdzJyk7XG4gIHZhciBmaWxlID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAnZmlsZScsIG51bGwpO1xuXG4gIC8vIE9uY2UgYWdhaW4sIFNhc3MgZGV2aWF0ZXMgZnJvbSB0aGUgc3BlYyBhbmQgc3VwcGxpZXMgdGhlIHZlcnNpb24gYXMgYVxuICAvLyBzdHJpbmcgcmF0aGVyIHRoYW4gYSBudW1iZXIsIHNvIHdlIHVzZSBsb29zZSBlcXVhbGl0eSBjaGVja2luZyBoZXJlLlxuICBpZiAodmVyc2lvbiAhPSB0aGlzLl92ZXJzaW9uKSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKCdVbnN1cHBvcnRlZCB2ZXJzaW9uOiAnICsgdmVyc2lvbik7XG4gIH1cblxuICBpZiAoc291cmNlUm9vdCkge1xuICAgIHNvdXJjZVJvb3QgPSB1dGlsLm5vcm1hbGl6ZShzb3VyY2VSb290KTtcbiAgfVxuXG4gIHNvdXJjZXMgPSBzb3VyY2VzXG4gICAgLm1hcChTdHJpbmcpXG4gICAgLy8gU29tZSBzb3VyY2UgbWFwcyBwcm9kdWNlIHJlbGF0aXZlIHNvdXJjZSBwYXRocyBsaWtlIFwiLi9mb28uanNcIiBpbnN0ZWFkIG9mXG4gICAgLy8gXCJmb28uanNcIi4gIE5vcm1hbGl6ZSB0aGVzZSBmaXJzdCBzbyB0aGF0IGZ1dHVyZSBjb21wYXJpc29ucyB3aWxsIHN1Y2NlZWQuXG4gICAgLy8gU2VlIGJ1Z3ppbC5sYS8xMDkwNzY4LlxuICAgIC5tYXAodXRpbC5ub3JtYWxpemUpXG4gICAgLy8gQWx3YXlzIGVuc3VyZSB0aGF0IGFic29sdXRlIHNvdXJjZXMgYXJlIGludGVybmFsbHkgc3RvcmVkIHJlbGF0aXZlIHRvXG4gICAgLy8gdGhlIHNvdXJjZSByb290LCBpZiB0aGUgc291cmNlIHJvb3QgaXMgYWJzb2x1dGUuIE5vdCBkb2luZyB0aGlzIHdvdWxkXG4gICAgLy8gYmUgcGFydGljdWxhcmx5IHByb2JsZW1hdGljIHdoZW4gdGhlIHNvdXJjZSByb290IGlzIGEgcHJlZml4IG9mIHRoZVxuICAgIC8vIHNvdXJjZSAodmFsaWQsIGJ1dCB3aHk/PykuIFNlZSBnaXRodWIgaXNzdWUgIzE5OSBhbmQgYnVnemlsLmxhLzExODg5ODIuXG4gICAgLm1hcChmdW5jdGlvbiAoc291cmNlKSB7XG4gICAgICByZXR1cm4gc291cmNlUm9vdCAmJiB1dGlsLmlzQWJzb2x1dGUoc291cmNlUm9vdCkgJiYgdXRpbC5pc0Fic29sdXRlKHNvdXJjZSlcbiAgICAgICAgPyB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIHNvdXJjZSlcbiAgICAgICAgOiBzb3VyY2U7XG4gICAgfSk7XG5cbiAgLy8gUGFzcyBgdHJ1ZWAgYmVsb3cgdG8gYWxsb3cgZHVwbGljYXRlIG5hbWVzIGFuZCBzb3VyY2VzLiBXaGlsZSBzb3VyY2UgbWFwc1xuICAvLyBhcmUgaW50ZW5kZWQgdG8gYmUgY29tcHJlc3NlZCBhbmQgZGVkdXBsaWNhdGVkLCB0aGUgVHlwZVNjcmlwdCBjb21waWxlclxuICAvLyBzb21ldGltZXMgZ2VuZXJhdGVzIHNvdXJjZSBtYXBzIHdpdGggZHVwbGljYXRlcyBpbiB0aGVtLiBTZWUgR2l0aHViIGlzc3VlXG4gIC8vICM3MiBhbmQgYnVnemlsLmxhLzg4OTQ5Mi5cbiAgdGhpcy5fbmFtZXMgPSBBcnJheVNldC5mcm9tQXJyYXkobmFtZXMubWFwKFN0cmluZyksIHRydWUpO1xuICB0aGlzLl9zb3VyY2VzID0gQXJyYXlTZXQuZnJvbUFycmF5KHNvdXJjZXMsIHRydWUpO1xuXG4gIHRoaXMuX2Fic29sdXRlU291cmNlcyA9IHRoaXMuX3NvdXJjZXMudG9BcnJheSgpLm1hcChmdW5jdGlvbiAocykge1xuICAgIHJldHVybiB1dGlsLmNvbXB1dGVTb3VyY2VVUkwoc291cmNlUm9vdCwgcywgYVNvdXJjZU1hcFVSTCk7XG4gIH0pO1xuXG4gIHRoaXMuc291cmNlUm9vdCA9IHNvdXJjZVJvb3Q7XG4gIHRoaXMuc291cmNlc0NvbnRlbnQgPSBzb3VyY2VzQ29udGVudDtcbiAgdGhpcy5fbWFwcGluZ3MgPSBtYXBwaW5ncztcbiAgdGhpcy5fc291cmNlTWFwVVJMID0gYVNvdXJjZU1hcFVSTDtcbiAgdGhpcy5maWxlID0gZmlsZTtcbn1cblxuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUgPSBPYmplY3QuY3JlYXRlKFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZSk7XG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5jb25zdW1lciA9IFNvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIFV0aWxpdHkgZnVuY3Rpb24gdG8gZmluZCB0aGUgaW5kZXggb2YgYSBzb3VyY2UuICBSZXR1cm5zIC0xIGlmIG5vdFxuICogZm91bmQuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLl9maW5kU291cmNlSW5kZXggPSBmdW5jdGlvbihhU291cmNlKSB7XG4gIHZhciByZWxhdGl2ZVNvdXJjZSA9IGFTb3VyY2U7XG4gIGlmICh0aGlzLnNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgIHJlbGF0aXZlU291cmNlID0gdXRpbC5yZWxhdGl2ZSh0aGlzLnNvdXJjZVJvb3QsIHJlbGF0aXZlU291cmNlKTtcbiAgfVxuXG4gIGlmICh0aGlzLl9zb3VyY2VzLmhhcyhyZWxhdGl2ZVNvdXJjZSkpIHtcbiAgICByZXR1cm4gdGhpcy5fc291cmNlcy5pbmRleE9mKHJlbGF0aXZlU291cmNlKTtcbiAgfVxuXG4gIC8vIE1heWJlIGFTb3VyY2UgaXMgYW4gYWJzb2x1dGUgVVJMIGFzIHJldHVybmVkIGJ5IHxzb3VyY2VzfC4gIEluXG4gIC8vIHRoaXMgY2FzZSB3ZSBjYW4ndCBzaW1wbHkgdW5kbyB0aGUgdHJhbnNmb3JtLlxuICB2YXIgaTtcbiAgZm9yIChpID0gMDsgaSA8IHRoaXMuX2Fic29sdXRlU291cmNlcy5sZW5ndGg7ICsraSkge1xuICAgIGlmICh0aGlzLl9hYnNvbHV0ZVNvdXJjZXNbaV0gPT0gYVNvdXJjZSkge1xuICAgICAgcmV0dXJuIGk7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIC0xO1xufTtcblxuLyoqXG4gKiBDcmVhdGUgYSBCYXNpY1NvdXJjZU1hcENvbnN1bWVyIGZyb20gYSBTb3VyY2VNYXBHZW5lcmF0b3IuXG4gKlxuICogQHBhcmFtIFNvdXJjZU1hcEdlbmVyYXRvciBhU291cmNlTWFwXG4gKiAgICAgICAgVGhlIHNvdXJjZSBtYXAgdGhhdCB3aWxsIGJlIGNvbnN1bWVkLlxuICogQHBhcmFtIFN0cmluZyBhU291cmNlTWFwVVJMXG4gKiAgICAgICAgVGhlIFVSTCBhdCB3aGljaCB0aGUgc291cmNlIG1hcCBjYW4gYmUgZm91bmQgKG9wdGlvbmFsKVxuICogQHJldHVybnMgQmFzaWNTb3VyY2VNYXBDb25zdW1lclxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLmZyb21Tb3VyY2VNYXAgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9mcm9tU291cmNlTWFwKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgICB2YXIgc21jID0gT2JqZWN0LmNyZWF0ZShCYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZSk7XG5cbiAgICB2YXIgbmFtZXMgPSBzbWMuX25hbWVzID0gQXJyYXlTZXQuZnJvbUFycmF5KGFTb3VyY2VNYXAuX25hbWVzLnRvQXJyYXkoKSwgdHJ1ZSk7XG4gICAgdmFyIHNvdXJjZXMgPSBzbWMuX3NvdXJjZXMgPSBBcnJheVNldC5mcm9tQXJyYXkoYVNvdXJjZU1hcC5fc291cmNlcy50b0FycmF5KCksIHRydWUpO1xuICAgIHNtYy5zb3VyY2VSb290ID0gYVNvdXJjZU1hcC5fc291cmNlUm9vdDtcbiAgICBzbWMuc291cmNlc0NvbnRlbnQgPSBhU291cmNlTWFwLl9nZW5lcmF0ZVNvdXJjZXNDb250ZW50KHNtYy5fc291cmNlcy50b0FycmF5KCksXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBzbWMuc291cmNlUm9vdCk7XG4gICAgc21jLmZpbGUgPSBhU291cmNlTWFwLl9maWxlO1xuICAgIHNtYy5fc291cmNlTWFwVVJMID0gYVNvdXJjZU1hcFVSTDtcbiAgICBzbWMuX2Fic29sdXRlU291cmNlcyA9IHNtYy5fc291cmNlcy50b0FycmF5KCkubWFwKGZ1bmN0aW9uIChzKSB7XG4gICAgICByZXR1cm4gdXRpbC5jb21wdXRlU291cmNlVVJMKHNtYy5zb3VyY2VSb290LCBzLCBhU291cmNlTWFwVVJMKTtcbiAgICB9KTtcblxuICAgIC8vIEJlY2F1c2Ugd2UgYXJlIG1vZGlmeWluZyB0aGUgZW50cmllcyAoYnkgY29udmVydGluZyBzdHJpbmcgc291cmNlcyBhbmRcbiAgICAvLyBuYW1lcyB0byBpbmRpY2VzIGludG8gdGhlIHNvdXJjZXMgYW5kIG5hbWVzIEFycmF5U2V0cyksIHdlIGhhdmUgdG8gbWFrZVxuICAgIC8vIGEgY29weSBvZiB0aGUgZW50cnkgb3IgZWxzZSBiYWQgdGhpbmdzIGhhcHBlbi4gU2hhcmVkIG11dGFibGUgc3RhdGVcbiAgICAvLyBzdHJpa2VzIGFnYWluISBTZWUgZ2l0aHViIGlzc3VlICMxOTEuXG5cbiAgICB2YXIgZ2VuZXJhdGVkTWFwcGluZ3MgPSBhU291cmNlTWFwLl9tYXBwaW5ncy50b0FycmF5KCkuc2xpY2UoKTtcbiAgICB2YXIgZGVzdEdlbmVyYXRlZE1hcHBpbmdzID0gc21jLl9fZ2VuZXJhdGVkTWFwcGluZ3MgPSBbXTtcbiAgICB2YXIgZGVzdE9yaWdpbmFsTWFwcGluZ3MgPSBzbWMuX19vcmlnaW5hbE1hcHBpbmdzID0gW107XG5cbiAgICBmb3IgKHZhciBpID0gMCwgbGVuZ3RoID0gZ2VuZXJhdGVkTWFwcGluZ3MubGVuZ3RoOyBpIDwgbGVuZ3RoOyBpKyspIHtcbiAgICAgIHZhciBzcmNNYXBwaW5nID0gZ2VuZXJhdGVkTWFwcGluZ3NbaV07XG4gICAgICB2YXIgZGVzdE1hcHBpbmcgPSBuZXcgTWFwcGluZztcbiAgICAgIGRlc3RNYXBwaW5nLmdlbmVyYXRlZExpbmUgPSBzcmNNYXBwaW5nLmdlbmVyYXRlZExpbmU7XG4gICAgICBkZXN0TWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4gPSBzcmNNYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgaWYgKHNyY01hcHBpbmcuc291cmNlKSB7XG4gICAgICAgIGRlc3RNYXBwaW5nLnNvdXJjZSA9IHNvdXJjZXMuaW5kZXhPZihzcmNNYXBwaW5nLnNvdXJjZSk7XG4gICAgICAgIGRlc3RNYXBwaW5nLm9yaWdpbmFsTGluZSA9IHNyY01hcHBpbmcub3JpZ2luYWxMaW5lO1xuICAgICAgICBkZXN0TWFwcGluZy5vcmlnaW5hbENvbHVtbiA9IHNyY01hcHBpbmcub3JpZ2luYWxDb2x1bW47XG5cbiAgICAgICAgaWYgKHNyY01hcHBpbmcubmFtZSkge1xuICAgICAgICAgIGRlc3RNYXBwaW5nLm5hbWUgPSBuYW1lcy5pbmRleE9mKHNyY01hcHBpbmcubmFtZSk7XG4gICAgICAgIH1cblxuICAgICAgICBkZXN0T3JpZ2luYWxNYXBwaW5ncy5wdXNoKGRlc3RNYXBwaW5nKTtcbiAgICAgIH1cblxuICAgICAgZGVzdEdlbmVyYXRlZE1hcHBpbmdzLnB1c2goZGVzdE1hcHBpbmcpO1xuICAgIH1cblxuICAgIHF1aWNrU29ydChzbWMuX19vcmlnaW5hbE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zKTtcblxuICAgIHJldHVybiBzbWM7XG4gIH07XG5cbi8qKlxuICogVGhlIHZlcnNpb24gb2YgdGhlIHNvdXJjZSBtYXBwaW5nIHNwZWMgdGhhdCB3ZSBhcmUgY29uc3VtaW5nLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8qKlxuICogVGhlIGxpc3Qgb2Ygb3JpZ2luYWwgc291cmNlcy5cbiAqL1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KEJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLCAnc291cmNlcycsIHtcbiAgZ2V0OiBmdW5jdGlvbiAoKSB7XG4gICAgcmV0dXJuIHRoaXMuX2Fic29sdXRlU291cmNlcy5zbGljZSgpO1xuICB9XG59KTtcblxuLyoqXG4gKiBQcm92aWRlIHRoZSBKSVQgd2l0aCBhIG5pY2Ugc2hhcGUgLyBoaWRkZW4gY2xhc3MuXG4gKi9cbmZ1bmN0aW9uIE1hcHBpbmcoKSB7XG4gIHRoaXMuZ2VuZXJhdGVkTGluZSA9IDA7XG4gIHRoaXMuZ2VuZXJhdGVkQ29sdW1uID0gMDtcbiAgdGhpcy5zb3VyY2UgPSBudWxsO1xuICB0aGlzLm9yaWdpbmFsTGluZSA9IG51bGw7XG4gIHRoaXMub3JpZ2luYWxDb2x1bW4gPSBudWxsO1xuICB0aGlzLm5hbWUgPSBudWxsO1xufVxuXG4vKipcbiAqIFBhcnNlIHRoZSBtYXBwaW5ncyBpbiBhIHN0cmluZyBpbiB0byBhIGRhdGEgc3RydWN0dXJlIHdoaWNoIHdlIGNhbiBlYXNpbHlcbiAqIHF1ZXJ5ICh0aGUgb3JkZXJlZCBhcnJheXMgaW4gdGhlIGB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3NgIGFuZFxuICogYHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzYCBwcm9wZXJ0aWVzKS5cbiAqL1xuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3BhcnNlTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdmFyIGdlbmVyYXRlZExpbmUgPSAxO1xuICAgIHZhciBwcmV2aW91c0dlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gMDtcbiAgICB2YXIgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzU291cmNlID0gMDtcbiAgICB2YXIgcHJldmlvdXNOYW1lID0gMDtcbiAgICB2YXIgbGVuZ3RoID0gYVN0ci5sZW5ndGg7XG4gICAgdmFyIGluZGV4ID0gMDtcbiAgICB2YXIgY2FjaGVkU2VnbWVudHMgPSB7fTtcbiAgICB2YXIgdGVtcCA9IHt9O1xuICAgIHZhciBvcmlnaW5hbE1hcHBpbmdzID0gW107XG4gICAgdmFyIGdlbmVyYXRlZE1hcHBpbmdzID0gW107XG4gICAgdmFyIG1hcHBpbmcsIHN0ciwgc2VnbWVudCwgZW5kLCB2YWx1ZTtcblxuICAgIHdoaWxlIChpbmRleCA8IGxlbmd0aCkge1xuICAgICAgaWYgKGFTdHIuY2hhckF0KGluZGV4KSA9PT0gJzsnKSB7XG4gICAgICAgIGdlbmVyYXRlZExpbmUrKztcbiAgICAgICAgaW5kZXgrKztcbiAgICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSAwO1xuICAgICAgfVxuICAgICAgZWxzZSBpZiAoYVN0ci5jaGFyQXQoaW5kZXgpID09PSAnLCcpIHtcbiAgICAgICAgaW5kZXgrKztcbiAgICAgIH1cbiAgICAgIGVsc2Uge1xuICAgICAgICBtYXBwaW5nID0gbmV3IE1hcHBpbmcoKTtcbiAgICAgICAgbWFwcGluZy5nZW5lcmF0ZWRMaW5lID0gZ2VuZXJhdGVkTGluZTtcblxuICAgICAgICAvLyBCZWNhdXNlIGVhY2ggb2Zmc2V0IGlzIGVuY29kZWQgcmVsYXRpdmUgdG8gdGhlIHByZXZpb3VzIG9uZSxcbiAgICAgICAgLy8gbWFueSBzZWdtZW50cyBvZnRlbiBoYXZlIHRoZSBzYW1lIGVuY29kaW5nLiBXZSBjYW4gZXhwbG9pdCB0aGlzXG4gICAgICAgIC8vIGZhY3QgYnkgY2FjaGluZyB0aGUgcGFyc2VkIHZhcmlhYmxlIGxlbmd0aCBmaWVsZHMgb2YgZWFjaCBzZWdtZW50LFxuICAgICAgICAvLyBhbGxvd2luZyB1cyB0byBhdm9pZCBhIHNlY29uZCBwYXJzZSBpZiB3ZSBlbmNvdW50ZXIgdGhlIHNhbWVcbiAgICAgICAgLy8gc2VnbWVudCBhZ2Fpbi5cbiAgICAgICAgZm9yIChlbmQgPSBpbmRleDsgZW5kIDwgbGVuZ3RoOyBlbmQrKykge1xuICAgICAgICAgIGlmICh0aGlzLl9jaGFySXNNYXBwaW5nU2VwYXJhdG9yKGFTdHIsIGVuZCkpIHtcbiAgICAgICAgICAgIGJyZWFrO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICBzdHIgPSBhU3RyLnNsaWNlKGluZGV4LCBlbmQpO1xuXG4gICAgICAgIHNlZ21lbnQgPSBjYWNoZWRTZWdtZW50c1tzdHJdO1xuICAgICAgICBpZiAoc2VnbWVudCkge1xuICAgICAgICAgIGluZGV4ICs9IHN0ci5sZW5ndGg7XG4gICAgICAgIH0gZWxzZSB7XG4gICAgICAgICAgc2VnbWVudCA9IFtdO1xuICAgICAgICAgIHdoaWxlIChpbmRleCA8IGVuZCkge1xuICAgICAgICAgICAgYmFzZTY0VkxRLmRlY29kZShhU3RyLCBpbmRleCwgdGVtcCk7XG4gICAgICAgICAgICB2YWx1ZSA9IHRlbXAudmFsdWU7XG4gICAgICAgICAgICBpbmRleCA9IHRlbXAucmVzdDtcbiAgICAgICAgICAgIHNlZ21lbnQucHVzaCh2YWx1ZSk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKHNlZ21lbnQubGVuZ3RoID09PSAyKSB7XG4gICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0ZvdW5kIGEgc291cmNlLCBidXQgbm8gbGluZSBhbmQgY29sdW1uJyk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKHNlZ21lbnQubGVuZ3RoID09PSAzKSB7XG4gICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0ZvdW5kIGEgc291cmNlIGFuZCBsaW5lLCBidXQgbm8gY29sdW1uJyk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgY2FjaGVkU2VnbWVudHNbc3RyXSA9IHNlZ21lbnQ7XG4gICAgICAgIH1cblxuICAgICAgICAvLyBHZW5lcmF0ZWQgY29sdW1uLlxuICAgICAgICBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbiA9IHByZXZpb3VzR2VuZXJhdGVkQ29sdW1uICsgc2VnbWVudFswXTtcbiAgICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgICBpZiAoc2VnbWVudC5sZW5ndGggPiAxKSB7XG4gICAgICAgICAgLy8gT3JpZ2luYWwgc291cmNlLlxuICAgICAgICAgIG1hcHBpbmcuc291cmNlID0gcHJldmlvdXNTb3VyY2UgKyBzZWdtZW50WzFdO1xuICAgICAgICAgIHByZXZpb3VzU291cmNlICs9IHNlZ21lbnRbMV07XG5cbiAgICAgICAgICAvLyBPcmlnaW5hbCBsaW5lLlxuICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxMaW5lID0gcHJldmlvdXNPcmlnaW5hbExpbmUgKyBzZWdtZW50WzJdO1xuICAgICAgICAgIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gbWFwcGluZy5vcmlnaW5hbExpbmU7XG4gICAgICAgICAgLy8gTGluZXMgYXJlIHN0b3JlZCAwLWJhc2VkXG4gICAgICAgICAgbWFwcGluZy5vcmlnaW5hbExpbmUgKz0gMTtcblxuICAgICAgICAgIC8vIE9yaWdpbmFsIGNvbHVtbi5cbiAgICAgICAgICBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uID0gcHJldmlvdXNPcmlnaW5hbENvbHVtbiArIHNlZ21lbnRbM107XG4gICAgICAgICAgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IG1hcHBpbmcub3JpZ2luYWxDb2x1bW47XG5cbiAgICAgICAgICBpZiAoc2VnbWVudC5sZW5ndGggPiA0KSB7XG4gICAgICAgICAgICAvLyBPcmlnaW5hbCBuYW1lLlxuICAgICAgICAgICAgbWFwcGluZy5uYW1lID0gcHJldmlvdXNOYW1lICsgc2VnbWVudFs0XTtcbiAgICAgICAgICAgIHByZXZpb3VzTmFtZSArPSBzZWdtZW50WzRdO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuXG4gICAgICAgIGdlbmVyYXRlZE1hcHBpbmdzLnB1c2gobWFwcGluZyk7XG4gICAgICAgIGlmICh0eXBlb2YgbWFwcGluZy5vcmlnaW5hbExpbmUgPT09ICdudW1iZXInKSB7XG4gICAgICAgICAgb3JpZ2luYWxNYXBwaW5ncy5wdXNoKG1hcHBpbmcpO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuXG4gICAgcXVpY2tTb3J0KGdlbmVyYXRlZE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0RlZmxhdGVkKTtcbiAgICB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3MgPSBnZW5lcmF0ZWRNYXBwaW5ncztcblxuICAgIHF1aWNrU29ydChvcmlnaW5hbE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zKTtcbiAgICB0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncyA9IG9yaWdpbmFsTWFwcGluZ3M7XG4gIH07XG5cbi8qKlxuICogRmluZCB0aGUgbWFwcGluZyB0aGF0IGJlc3QgbWF0Y2hlcyB0aGUgaHlwb3RoZXRpY2FsIFwibmVlZGxlXCIgbWFwcGluZyB0aGF0XG4gKiB3ZSBhcmUgc2VhcmNoaW5nIGZvciBpbiB0aGUgZ2l2ZW4gXCJoYXlzdGFja1wiIG9mIG1hcHBpbmdzLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fZmluZE1hcHBpbmcgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9maW5kTWFwcGluZyhhTmVlZGxlLCBhTWFwcGluZ3MsIGFMaW5lTmFtZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgYUNvbHVtbk5hbWUsIGFDb21wYXJhdG9yLCBhQmlhcykge1xuICAgIC8vIFRvIHJldHVybiB0aGUgcG9zaXRpb24gd2UgYXJlIHNlYXJjaGluZyBmb3IsIHdlIG11c3QgZmlyc3QgZmluZCB0aGVcbiAgICAvLyBtYXBwaW5nIGZvciB0aGUgZ2l2ZW4gcG9zaXRpb24gYW5kIHRoZW4gcmV0dXJuIHRoZSBvcHBvc2l0ZSBwb3NpdGlvbiBpdFxuICAgIC8vIHBvaW50cyB0by4gQmVjYXVzZSB0aGUgbWFwcGluZ3MgYXJlIHNvcnRlZCwgd2UgY2FuIHVzZSBiaW5hcnkgc2VhcmNoIHRvXG4gICAgLy8gZmluZCB0aGUgYmVzdCBtYXBwaW5nLlxuXG4gICAgaWYgKGFOZWVkbGVbYUxpbmVOYW1lXSA8PSAwKSB7XG4gICAgICB0aHJvdyBuZXcgVHlwZUVycm9yKCdMaW5lIG11c3QgYmUgZ3JlYXRlciB0aGFuIG9yIGVxdWFsIHRvIDEsIGdvdCAnXG4gICAgICAgICAgICAgICAgICAgICAgICAgICsgYU5lZWRsZVthTGluZU5hbWVdKTtcbiAgICB9XG4gICAgaWYgKGFOZWVkbGVbYUNvbHVtbk5hbWVdIDwgMCkge1xuICAgICAgdGhyb3cgbmV3IFR5cGVFcnJvcignQ29sdW1uIG11c3QgYmUgZ3JlYXRlciB0aGFuIG9yIGVxdWFsIHRvIDAsIGdvdCAnXG4gICAgICAgICAgICAgICAgICAgICAgICAgICsgYU5lZWRsZVthQ29sdW1uTmFtZV0pO1xuICAgIH1cblxuICAgIHJldHVybiBiaW5hcnlTZWFyY2guc2VhcmNoKGFOZWVkbGUsIGFNYXBwaW5ncywgYUNvbXBhcmF0b3IsIGFCaWFzKTtcbiAgfTtcblxuLyoqXG4gKiBDb21wdXRlIHRoZSBsYXN0IGNvbHVtbiBmb3IgZWFjaCBnZW5lcmF0ZWQgbWFwcGluZy4gVGhlIGxhc3QgY29sdW1uIGlzXG4gKiBpbmNsdXNpdmUuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmNvbXB1dGVDb2x1bW5TcGFucyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2NvbXB1dGVDb2x1bW5TcGFucygpIHtcbiAgICBmb3IgKHZhciBpbmRleCA9IDA7IGluZGV4IDwgdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3MubGVuZ3RoOyArK2luZGV4KSB7XG4gICAgICB2YXIgbWFwcGluZyA9IHRoaXMuX2dlbmVyYXRlZE1hcHBpbmdzW2luZGV4XTtcblxuICAgICAgLy8gTWFwcGluZ3MgZG8gbm90IGNvbnRhaW4gYSBmaWVsZCBmb3IgdGhlIGxhc3QgZ2VuZXJhdGVkIGNvbHVtbnQuIFdlXG4gICAgICAvLyBjYW4gY29tZSB1cCB3aXRoIGFuIG9wdGltaXN0aWMgZXN0aW1hdGUsIGhvd2V2ZXIsIGJ5IGFzc3VtaW5nIHRoYXRcbiAgICAgIC8vIG1hcHBpbmdzIGFyZSBjb250aWd1b3VzIChpLmUuIGdpdmVuIHR3byBjb25zZWN1dGl2ZSBtYXBwaW5ncywgdGhlXG4gICAgICAvLyBmaXJzdCBtYXBwaW5nIGVuZHMgd2hlcmUgdGhlIHNlY29uZCBvbmUgc3RhcnRzKS5cbiAgICAgIGlmIChpbmRleCArIDEgPCB0aGlzLl9nZW5lcmF0ZWRNYXBwaW5ncy5sZW5ndGgpIHtcbiAgICAgICAgdmFyIG5leHRNYXBwaW5nID0gdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3NbaW5kZXggKyAxXTtcblxuICAgICAgICBpZiAobWFwcGluZy5nZW5lcmF0ZWRMaW5lID09PSBuZXh0TWFwcGluZy5nZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgICAgbWFwcGluZy5sYXN0R2VuZXJhdGVkQ29sdW1uID0gbmV4dE1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uIC0gMTtcbiAgICAgICAgICBjb250aW51ZTtcbiAgICAgICAgfVxuICAgICAgfVxuXG4gICAgICAvLyBUaGUgbGFzdCBtYXBwaW5nIGZvciBlYWNoIGxpbmUgc3BhbnMgdGhlIGVudGlyZSBsaW5lLlxuICAgICAgbWFwcGluZy5sYXN0R2VuZXJhdGVkQ29sdW1uID0gSW5maW5pdHk7XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIG9yaWdpbmFsIHNvdXJjZSwgbGluZSwgYW5kIGNvbHVtbiBpbmZvcm1hdGlvbiBmb3IgdGhlIGdlbmVyYXRlZFxuICogc291cmNlJ3MgbGluZSBhbmQgY29sdW1uIHBvc2l0aW9ucyBwcm92aWRlZC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgYW4gb2JqZWN0XG4gKiB3aXRoIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLiAgVGhlIGxpbmUgbnVtYmVyXG4gKiAgICAgaXMgMS1iYXNlZC5cbiAqICAgLSBjb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLiAgVGhlIGNvbHVtblxuICogICAgIG51bWJlciBpcyAwLWJhc2VkLlxuICogICAtIGJpYXM6IEVpdGhlciAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnIG9yXG4gKiAgICAgJ1NvdXJjZU1hcENvbnN1bWVyLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIG9yaWdpbmFsIHNvdXJjZSBmaWxlLCBvciBudWxsLlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLCBvciBudWxsLiAgVGhlXG4gKiAgICAgbGluZSBudW1iZXIgaXMgMS1iYXNlZC5cbiAqICAgLSBjb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UsIG9yIG51bGwuICBUaGVcbiAqICAgICBjb2x1bW4gbnVtYmVyIGlzIDAtYmFzZWQuXG4gKiAgIC0gbmFtZTogVGhlIG9yaWdpbmFsIGlkZW50aWZpZXIsIG9yIG51bGwuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLm9yaWdpbmFsUG9zaXRpb25Gb3IgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9vcmlnaW5hbFBvc2l0aW9uRm9yKGFBcmdzKSB7XG4gICAgdmFyIG5lZWRsZSA9IHtcbiAgICAgIGdlbmVyYXRlZExpbmU6IHV0aWwuZ2V0QXJnKGFBcmdzLCAnbGluZScpLFxuICAgICAgZ2VuZXJhdGVkQ29sdW1uOiB1dGlsLmdldEFyZyhhQXJncywgJ2NvbHVtbicpXG4gICAgfTtcblxuICAgIHZhciBpbmRleCA9IHRoaXMuX2ZpbmRNYXBwaW5nKFxuICAgICAgbmVlZGxlLFxuICAgICAgdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3MsXG4gICAgICBcImdlbmVyYXRlZExpbmVcIixcbiAgICAgIFwiZ2VuZXJhdGVkQ29sdW1uXCIsXG4gICAgICB1dGlsLmNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0RlZmxhdGVkLFxuICAgICAgdXRpbC5nZXRBcmcoYUFyZ3MsICdiaWFzJywgU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQpXG4gICAgKTtcblxuICAgIGlmIChpbmRleCA+PSAwKSB7XG4gICAgICB2YXIgbWFwcGluZyA9IHRoaXMuX2dlbmVyYXRlZE1hcHBpbmdzW2luZGV4XTtcblxuICAgICAgaWYgKG1hcHBpbmcuZ2VuZXJhdGVkTGluZSA9PT0gbmVlZGxlLmdlbmVyYXRlZExpbmUpIHtcbiAgICAgICAgdmFyIHNvdXJjZSA9IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdzb3VyY2UnLCBudWxsKTtcbiAgICAgICAgaWYgKHNvdXJjZSAhPT0gbnVsbCkge1xuICAgICAgICAgIHNvdXJjZSA9IHRoaXMuX3NvdXJjZXMuYXQoc291cmNlKTtcbiAgICAgICAgICBzb3VyY2UgPSB1dGlsLmNvbXB1dGVTb3VyY2VVUkwodGhpcy5zb3VyY2VSb290LCBzb3VyY2UsIHRoaXMuX3NvdXJjZU1hcFVSTCk7XG4gICAgICAgIH1cbiAgICAgICAgdmFyIG5hbWUgPSB1dGlsLmdldEFyZyhtYXBwaW5nLCAnbmFtZScsIG51bGwpO1xuICAgICAgICBpZiAobmFtZSAhPT0gbnVsbCkge1xuICAgICAgICAgIG5hbWUgPSB0aGlzLl9uYW1lcy5hdChuYW1lKTtcbiAgICAgICAgfVxuICAgICAgICByZXR1cm4ge1xuICAgICAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgICAgIGxpbmU6IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdvcmlnaW5hbExpbmUnLCBudWxsKSxcbiAgICAgICAgICBjb2x1bW46IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdvcmlnaW5hbENvbHVtbicsIG51bGwpLFxuICAgICAgICAgIG5hbWU6IG5hbWVcbiAgICAgICAgfTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICByZXR1cm4ge1xuICAgICAgc291cmNlOiBudWxsLFxuICAgICAgbGluZTogbnVsbCxcbiAgICAgIGNvbHVtbjogbnVsbCxcbiAgICAgIG5hbWU6IG51bGxcbiAgICB9O1xuICB9O1xuXG4vKipcbiAqIFJldHVybiB0cnVlIGlmIHdlIGhhdmUgdGhlIHNvdXJjZSBjb250ZW50IGZvciBldmVyeSBzb3VyY2UgaW4gdGhlIHNvdXJjZVxuICogbWFwLCBmYWxzZSBvdGhlcndpc2UuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmhhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzID1cbiAgZnVuY3Rpb24gQmFzaWNTb3VyY2VNYXBDb25zdW1lcl9oYXNDb250ZW50c09mQWxsU291cmNlcygpIHtcbiAgICBpZiAoIXRoaXMuc291cmNlc0NvbnRlbnQpIHtcbiAgICAgIHJldHVybiBmYWxzZTtcbiAgICB9XG4gICAgcmV0dXJuIHRoaXMuc291cmNlc0NvbnRlbnQubGVuZ3RoID49IHRoaXMuX3NvdXJjZXMuc2l6ZSgpICYmXG4gICAgICAhdGhpcy5zb3VyY2VzQ29udGVudC5zb21lKGZ1bmN0aW9uIChzYykgeyByZXR1cm4gc2MgPT0gbnVsbDsgfSk7XG4gIH07XG5cbi8qKlxuICogUmV0dXJucyB0aGUgb3JpZ2luYWwgc291cmNlIGNvbnRlbnQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIHRoZSB1cmwgb2YgdGhlXG4gKiBvcmlnaW5hbCBzb3VyY2UgZmlsZS4gUmV0dXJucyBudWxsIGlmIG5vIG9yaWdpbmFsIHNvdXJjZSBjb250ZW50IGlzXG4gKiBhdmFpbGFibGUuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLnNvdXJjZUNvbnRlbnRGb3IgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9zb3VyY2VDb250ZW50Rm9yKGFTb3VyY2UsIG51bGxPbk1pc3NpbmcpIHtcbiAgICBpZiAoIXRoaXMuc291cmNlc0NvbnRlbnQpIHtcbiAgICAgIHJldHVybiBudWxsO1xuICAgIH1cblxuICAgIHZhciBpbmRleCA9IHRoaXMuX2ZpbmRTb3VyY2VJbmRleChhU291cmNlKTtcbiAgICBpZiAoaW5kZXggPj0gMCkge1xuICAgICAgcmV0dXJuIHRoaXMuc291cmNlc0NvbnRlbnRbaW5kZXhdO1xuICAgIH1cblxuICAgIHZhciByZWxhdGl2ZVNvdXJjZSA9IGFTb3VyY2U7XG4gICAgaWYgKHRoaXMuc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICByZWxhdGl2ZVNvdXJjZSA9IHV0aWwucmVsYXRpdmUodGhpcy5zb3VyY2VSb290LCByZWxhdGl2ZVNvdXJjZSk7XG4gICAgfVxuXG4gICAgdmFyIHVybDtcbiAgICBpZiAodGhpcy5zb3VyY2VSb290ICE9IG51bGxcbiAgICAgICAgJiYgKHVybCA9IHV0aWwudXJsUGFyc2UodGhpcy5zb3VyY2VSb290KSkpIHtcbiAgICAgIC8vIFhYWDogZmlsZTovLyBVUklzIGFuZCBhYnNvbHV0ZSBwYXRocyBsZWFkIHRvIHVuZXhwZWN0ZWQgYmVoYXZpb3IgZm9yXG4gICAgICAvLyBtYW55IHVzZXJzLiBXZSBjYW4gaGVscCB0aGVtIG91dCB3aGVuIHRoZXkgZXhwZWN0IGZpbGU6Ly8gVVJJcyB0b1xuICAgICAgLy8gYmVoYXZlIGxpa2UgaXQgd291bGQgaWYgdGhleSB3ZXJlIHJ1bm5pbmcgYSBsb2NhbCBIVFRQIHNlcnZlci4gU2VlXG4gICAgICAvLyBodHRwczovL2J1Z3ppbGxhLm1vemlsbGEub3JnL3Nob3dfYnVnLmNnaT9pZD04ODU1OTcuXG4gICAgICB2YXIgZmlsZVVyaUFic1BhdGggPSByZWxhdGl2ZVNvdXJjZS5yZXBsYWNlKC9eZmlsZTpcXC9cXC8vLCBcIlwiKTtcbiAgICAgIGlmICh1cmwuc2NoZW1lID09IFwiZmlsZVwiXG4gICAgICAgICAgJiYgdGhpcy5fc291cmNlcy5oYXMoZmlsZVVyaUFic1BhdGgpKSB7XG4gICAgICAgIHJldHVybiB0aGlzLnNvdXJjZXNDb250ZW50W3RoaXMuX3NvdXJjZXMuaW5kZXhPZihmaWxlVXJpQWJzUGF0aCldXG4gICAgICB9XG5cbiAgICAgIGlmICgoIXVybC5wYXRoIHx8IHVybC5wYXRoID09IFwiL1wiKVxuICAgICAgICAgICYmIHRoaXMuX3NvdXJjZXMuaGFzKFwiL1wiICsgcmVsYXRpdmVTb3VyY2UpKSB7XG4gICAgICAgIHJldHVybiB0aGlzLnNvdXJjZXNDb250ZW50W3RoaXMuX3NvdXJjZXMuaW5kZXhPZihcIi9cIiArIHJlbGF0aXZlU291cmNlKV07XG4gICAgICB9XG4gICAgfVxuXG4gICAgLy8gVGhpcyBmdW5jdGlvbiBpcyB1c2VkIHJlY3Vyc2l2ZWx5IGZyb21cbiAgICAvLyBJbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLnNvdXJjZUNvbnRlbnRGb3IuIEluIHRoYXQgY2FzZSwgd2VcbiAgICAvLyBkb24ndCB3YW50IHRvIHRocm93IGlmIHdlIGNhbid0IGZpbmQgdGhlIHNvdXJjZSAtIHdlIGp1c3Qgd2FudCB0b1xuICAgIC8vIHJldHVybiBudWxsLCBzbyB3ZSBwcm92aWRlIGEgZmxhZyB0byBleGl0IGdyYWNlZnVsbHkuXG4gICAgaWYgKG51bGxPbk1pc3NpbmcpIHtcbiAgICAgIHJldHVybiBudWxsO1xuICAgIH1cbiAgICBlbHNlIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignXCInICsgcmVsYXRpdmVTb3VyY2UgKyAnXCIgaXMgbm90IGluIHRoZSBTb3VyY2VNYXAuJyk7XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIGdlbmVyYXRlZCBsaW5lIGFuZCBjb2x1bW4gaW5mb3JtYXRpb24gZm9yIHRoZSBvcmlnaW5hbCBzb3VyY2UsXG4gKiBsaW5lLCBhbmQgY29sdW1uIHBvc2l0aW9ucyBwcm92aWRlZC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgYW4gb2JqZWN0IHdpdGhcbiAqIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gc291cmNlOiBUaGUgZmlsZW5hbWUgb2YgdGhlIG9yaWdpbmFsIHNvdXJjZS5cbiAqICAgLSBsaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZS4gIFRoZSBsaW5lIG51bWJlclxuICogICAgIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLiAgVGhlIGNvbHVtblxuICogICAgIG51bWJlciBpcyAwLWJhc2VkLlxuICogICAtIGJpYXM6IEVpdGhlciAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnIG9yXG4gKiAgICAgJ1NvdXJjZU1hcENvbnN1bWVyLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC4gIFRoZVxuICogICAgIGxpbmUgbnVtYmVyIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC5cbiAqICAgICBUaGUgY29sdW1uIG51bWJlciBpcyAwLWJhc2VkLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5nZW5lcmF0ZWRQb3NpdGlvbkZvciA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2dlbmVyYXRlZFBvc2l0aW9uRm9yKGFBcmdzKSB7XG4gICAgdmFyIHNvdXJjZSA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnc291cmNlJyk7XG4gICAgc291cmNlID0gdGhpcy5fZmluZFNvdXJjZUluZGV4KHNvdXJjZSk7XG4gICAgaWYgKHNvdXJjZSA8IDApIHtcbiAgICAgIHJldHVybiB7XG4gICAgICAgIGxpbmU6IG51bGwsXG4gICAgICAgIGNvbHVtbjogbnVsbCxcbiAgICAgICAgbGFzdENvbHVtbjogbnVsbFxuICAgICAgfTtcbiAgICB9XG5cbiAgICB2YXIgbmVlZGxlID0ge1xuICAgICAgc291cmNlOiBzb3VyY2UsXG4gICAgICBvcmlnaW5hbExpbmU6IHV0aWwuZ2V0QXJnKGFBcmdzLCAnbGluZScpLFxuICAgICAgb3JpZ2luYWxDb2x1bW46IHV0aWwuZ2V0QXJnKGFBcmdzLCAnY29sdW1uJylcbiAgICB9O1xuXG4gICAgdmFyIGluZGV4ID0gdGhpcy5fZmluZE1hcHBpbmcoXG4gICAgICBuZWVkbGUsXG4gICAgICB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzLFxuICAgICAgXCJvcmlnaW5hbExpbmVcIixcbiAgICAgIFwib3JpZ2luYWxDb2x1bW5cIixcbiAgICAgIHV0aWwuY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnMsXG4gICAgICB1dGlsLmdldEFyZyhhQXJncywgJ2JpYXMnLCBTb3VyY2VNYXBDb25zdW1lci5HUkVBVEVTVF9MT1dFUl9CT1VORClcbiAgICApO1xuXG4gICAgaWYgKGluZGV4ID49IDApIHtcbiAgICAgIHZhciBtYXBwaW5nID0gdGhpcy5fb3JpZ2luYWxNYXBwaW5nc1tpbmRleF07XG5cbiAgICAgIGlmIChtYXBwaW5nLnNvdXJjZSA9PT0gbmVlZGxlLnNvdXJjZSkge1xuICAgICAgICByZXR1cm4ge1xuICAgICAgICAgIGxpbmU6IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdnZW5lcmF0ZWRMaW5lJywgbnVsbCksXG4gICAgICAgICAgY29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkQ29sdW1uJywgbnVsbCksXG4gICAgICAgICAgbGFzdENvbHVtbjogdXRpbC5nZXRBcmcobWFwcGluZywgJ2xhc3RHZW5lcmF0ZWRDb2x1bW4nLCBudWxsKVxuICAgICAgICB9O1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB7XG4gICAgICBsaW5lOiBudWxsLFxuICAgICAgY29sdW1uOiBudWxsLFxuICAgICAgbGFzdENvbHVtbjogbnVsbFxuICAgIH07XG4gIH07XG5cbmV4cG9ydHMuQmFzaWNTb3VyY2VNYXBDb25zdW1lciA9IEJhc2ljU291cmNlTWFwQ29uc3VtZXI7XG5cbi8qKlxuICogQW4gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyIGluc3RhbmNlIHJlcHJlc2VudHMgYSBwYXJzZWQgc291cmNlIG1hcCB3aGljaFxuICogd2UgY2FuIHF1ZXJ5IGZvciBpbmZvcm1hdGlvbi4gSXQgZGlmZmVycyBmcm9tIEJhc2ljU291cmNlTWFwQ29uc3VtZXIgaW5cbiAqIHRoYXQgaXQgdGFrZXMgXCJpbmRleGVkXCIgc291cmNlIG1hcHMgKGkuZS4gb25lcyB3aXRoIGEgXCJzZWN0aW9uc1wiIGZpZWxkKSBhc1xuICogaW5wdXQuXG4gKlxuICogVGhlIGZpcnN0IHBhcmFtZXRlciBpcyBhIHJhdyBzb3VyY2UgbWFwIChlaXRoZXIgYXMgYSBKU09OIHN0cmluZywgb3IgYWxyZWFkeVxuICogcGFyc2VkIHRvIGFuIG9iamVjdCkuIEFjY29yZGluZyB0byB0aGUgc3BlYyBmb3IgaW5kZXhlZCBzb3VyY2UgbWFwcywgdGhleVxuICogaGF2ZSB0aGUgZm9sbG93aW5nIGF0dHJpYnV0ZXM6XG4gKlxuICogICAtIHZlcnNpb246IFdoaWNoIHZlcnNpb24gb2YgdGhlIHNvdXJjZSBtYXAgc3BlYyB0aGlzIG1hcCBpcyBmb2xsb3dpbmcuXG4gKiAgIC0gZmlsZTogT3B0aW9uYWwuIFRoZSBnZW5lcmF0ZWQgZmlsZSB0aGlzIHNvdXJjZSBtYXAgaXMgYXNzb2NpYXRlZCB3aXRoLlxuICogICAtIHNlY3Rpb25zOiBBIGxpc3Qgb2Ygc2VjdGlvbiBkZWZpbml0aW9ucy5cbiAqXG4gKiBFYWNoIHZhbHVlIHVuZGVyIHRoZSBcInNlY3Rpb25zXCIgZmllbGQgaGFzIHR3byBmaWVsZHM6XG4gKiAgIC0gb2Zmc2V0OiBUaGUgb2Zmc2V0IGludG8gdGhlIG9yaWdpbmFsIHNwZWNpZmllZCBhdCB3aGljaCB0aGlzIHNlY3Rpb25cbiAqICAgICAgIGJlZ2lucyB0byBhcHBseSwgZGVmaW5lZCBhcyBhbiBvYmplY3Qgd2l0aCBhIFwibGluZVwiIGFuZCBcImNvbHVtblwiXG4gKiAgICAgICBmaWVsZC5cbiAqICAgLSBtYXA6IEEgc291cmNlIG1hcCBkZWZpbml0aW9uLiBUaGlzIHNvdXJjZSBtYXAgY291bGQgYWxzbyBiZSBpbmRleGVkLFxuICogICAgICAgYnV0IGRvZXNuJ3QgaGF2ZSB0byBiZS5cbiAqXG4gKiBJbnN0ZWFkIG9mIHRoZSBcIm1hcFwiIGZpZWxkLCBpdCdzIGFsc28gcG9zc2libGUgdG8gaGF2ZSBhIFwidXJsXCIgZmllbGRcbiAqIHNwZWNpZnlpbmcgYSBVUkwgdG8gcmV0cmlldmUgYSBzb3VyY2UgbWFwIGZyb20sIGJ1dCB0aGF0J3MgY3VycmVudGx5XG4gKiB1bnN1cHBvcnRlZC5cbiAqXG4gKiBIZXJlJ3MgYW4gZXhhbXBsZSBzb3VyY2UgbWFwLCB0YWtlbiBmcm9tIHRoZSBzb3VyY2UgbWFwIHNwZWNbMF0sIGJ1dFxuICogbW9kaWZpZWQgdG8gb21pdCBhIHNlY3Rpb24gd2hpY2ggdXNlcyB0aGUgXCJ1cmxcIiBmaWVsZC5cbiAqXG4gKiAge1xuICogICAgdmVyc2lvbiA6IDMsXG4gKiAgICBmaWxlOiBcImFwcC5qc1wiLFxuICogICAgc2VjdGlvbnM6IFt7XG4gKiAgICAgIG9mZnNldDoge2xpbmU6MTAwLCBjb2x1bW46MTB9LFxuICogICAgICBtYXA6IHtcbiAqICAgICAgICB2ZXJzaW9uIDogMyxcbiAqICAgICAgICBmaWxlOiBcInNlY3Rpb24uanNcIixcbiAqICAgICAgICBzb3VyY2VzOiBbXCJmb28uanNcIiwgXCJiYXIuanNcIl0sXG4gKiAgICAgICAgbmFtZXM6IFtcInNyY1wiLCBcIm1hcHNcIiwgXCJhcmVcIiwgXCJmdW5cIl0sXG4gKiAgICAgICAgbWFwcGluZ3M6IFwiQUFBQSxFOztBQkNERTtcIlxuICogICAgICB9XG4gKiAgICB9XSxcbiAqICB9XG4gKlxuICogVGhlIHNlY29uZCBwYXJhbWV0ZXIsIGlmIGdpdmVuLCBpcyBhIHN0cmluZyB3aG9zZSB2YWx1ZSBpcyB0aGUgVVJMXG4gKiBhdCB3aGljaCB0aGUgc291cmNlIG1hcCB3YXMgZm91bmQuICBUaGlzIFVSTCBpcyB1c2VkIHRvIGNvbXB1dGUgdGhlXG4gKiBzb3VyY2VzIGFycmF5LlxuICpcbiAqIFswXTogaHR0cHM6Ly9kb2NzLmdvb2dsZS5jb20vZG9jdW1lbnQvZC8xVTFSR0FlaFF3UnlwVVRvdkYxS1JscGlPRnplMGItXzJnYzZmQUgwS1kway9lZGl0I2hlYWRpbmc9aC41MzVlczN4ZXByZ3RcbiAqL1xuZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgdmFyIHNvdXJjZU1hcCA9IGFTb3VyY2VNYXA7XG4gIGlmICh0eXBlb2YgYVNvdXJjZU1hcCA9PT0gJ3N0cmluZycpIHtcbiAgICBzb3VyY2VNYXAgPSB1dGlsLnBhcnNlU291cmNlTWFwSW5wdXQoYVNvdXJjZU1hcCk7XG4gIH1cblxuICB2YXIgdmVyc2lvbiA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3ZlcnNpb24nKTtcbiAgdmFyIHNlY3Rpb25zID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAnc2VjdGlvbnMnKTtcblxuICBpZiAodmVyc2lvbiAhPSB0aGlzLl92ZXJzaW9uKSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKCdVbnN1cHBvcnRlZCB2ZXJzaW9uOiAnICsgdmVyc2lvbik7XG4gIH1cblxuICB0aGlzLl9zb3VyY2VzID0gbmV3IEFycmF5U2V0KCk7XG4gIHRoaXMuX25hbWVzID0gbmV3IEFycmF5U2V0KCk7XG5cbiAgdmFyIGxhc3RPZmZzZXQgPSB7XG4gICAgbGluZTogLTEsXG4gICAgY29sdW1uOiAwXG4gIH07XG4gIHRoaXMuX3NlY3Rpb25zID0gc2VjdGlvbnMubWFwKGZ1bmN0aW9uIChzKSB7XG4gICAgaWYgKHMudXJsKSB7XG4gICAgICAvLyBUaGUgdXJsIGZpZWxkIHdpbGwgcmVxdWlyZSBzdXBwb3J0IGZvciBhc3luY2hyb25pY2l0eS5cbiAgICAgIC8vIFNlZSBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL2lzc3Vlcy8xNlxuICAgICAgdGhyb3cgbmV3IEVycm9yKCdTdXBwb3J0IGZvciB1cmwgZmllbGQgaW4gc2VjdGlvbnMgbm90IGltcGxlbWVudGVkLicpO1xuICAgIH1cbiAgICB2YXIgb2Zmc2V0ID0gdXRpbC5nZXRBcmcocywgJ29mZnNldCcpO1xuICAgIHZhciBvZmZzZXRMaW5lID0gdXRpbC5nZXRBcmcob2Zmc2V0LCAnbGluZScpO1xuICAgIHZhciBvZmZzZXRDb2x1bW4gPSB1dGlsLmdldEFyZyhvZmZzZXQsICdjb2x1bW4nKTtcblxuICAgIGlmIChvZmZzZXRMaW5lIDwgbGFzdE9mZnNldC5saW5lIHx8XG4gICAgICAgIChvZmZzZXRMaW5lID09PSBsYXN0T2Zmc2V0LmxpbmUgJiYgb2Zmc2V0Q29sdW1uIDwgbGFzdE9mZnNldC5jb2x1bW4pKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ1NlY3Rpb24gb2Zmc2V0cyBtdXN0IGJlIG9yZGVyZWQgYW5kIG5vbi1vdmVybGFwcGluZy4nKTtcbiAgICB9XG4gICAgbGFzdE9mZnNldCA9IG9mZnNldDtcblxuICAgIHJldHVybiB7XG4gICAgICBnZW5lcmF0ZWRPZmZzZXQ6IHtcbiAgICAgICAgLy8gVGhlIG9mZnNldCBmaWVsZHMgYXJlIDAtYmFzZWQsIGJ1dCB3ZSB1c2UgMS1iYXNlZCBpbmRpY2VzIHdoZW5cbiAgICAgICAgLy8gZW5jb2RpbmcvZGVjb2RpbmcgZnJvbSBWTFEuXG4gICAgICAgIGdlbmVyYXRlZExpbmU6IG9mZnNldExpbmUgKyAxLFxuICAgICAgICBnZW5lcmF0ZWRDb2x1bW46IG9mZnNldENvbHVtbiArIDFcbiAgICAgIH0sXG4gICAgICBjb25zdW1lcjogbmV3IFNvdXJjZU1hcENvbnN1bWVyKHV0aWwuZ2V0QXJnKHMsICdtYXAnKSwgYVNvdXJjZU1hcFVSTClcbiAgICB9XG4gIH0pO1xufVxuXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlID0gT2JqZWN0LmNyZWF0ZShTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUpO1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5jb25zdHJ1Y3RvciA9IFNvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIFRoZSB2ZXJzaW9uIG9mIHRoZSBzb3VyY2UgbWFwcGluZyBzcGVjIHRoYXQgd2UgYXJlIGNvbnN1bWluZy5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8qKlxuICogVGhlIGxpc3Qgb2Ygb3JpZ2luYWwgc291cmNlcy5cbiAqL1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUsICdzb3VyY2VzJywge1xuICBnZXQ6IGZ1bmN0aW9uICgpIHtcbiAgICB2YXIgc291cmNlcyA9IFtdO1xuICAgIGZvciAodmFyIGkgPSAwOyBpIDwgdGhpcy5fc2VjdGlvbnMubGVuZ3RoOyBpKyspIHtcbiAgICAgIGZvciAodmFyIGogPSAwOyBqIDwgdGhpcy5fc2VjdGlvbnNbaV0uY29uc3VtZXIuc291cmNlcy5sZW5ndGg7IGorKykge1xuICAgICAgICBzb3VyY2VzLnB1c2godGhpcy5fc2VjdGlvbnNbaV0uY29uc3VtZXIuc291cmNlc1tqXSk7XG4gICAgICB9XG4gICAgfVxuICAgIHJldHVybiBzb3VyY2VzO1xuICB9XG59KTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBvcmlnaW5hbCBzb3VyY2UsIGxpbmUsIGFuZCBjb2x1bW4gaW5mb3JtYXRpb24gZm9yIHRoZSBnZW5lcmF0ZWRcbiAqIHNvdXJjZSdzIGxpbmUgYW5kIGNvbHVtbiBwb3NpdGlvbnMgcHJvdmlkZWQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIGFuIG9iamVjdFxuICogd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZS4gIFRoZSBsaW5lIG51bWJlclxuICogICAgIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZS4gIFRoZSBjb2x1bW5cbiAqICAgICBudW1iZXIgaXMgMC1iYXNlZC5cbiAqXG4gKiBhbmQgYW4gb2JqZWN0IGlzIHJldHVybmVkIHdpdGggdGhlIGZvbGxvd2luZyBwcm9wZXJ0aWVzOlxuICpcbiAqICAgLSBzb3VyY2U6IFRoZSBvcmlnaW5hbCBzb3VyY2UgZmlsZSwgb3IgbnVsbC5cbiAqICAgLSBsaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZSwgb3IgbnVsbC4gIFRoZVxuICogICAgIGxpbmUgbnVtYmVyIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLCBvciBudWxsLiAgVGhlXG4gKiAgICAgY29sdW1uIG51bWJlciBpcyAwLWJhc2VkLlxuICogICAtIG5hbWU6IFRoZSBvcmlnaW5hbCBpZGVudGlmaWVyLCBvciBudWxsLlxuICovXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLm9yaWdpbmFsUG9zaXRpb25Gb3IgPVxuICBmdW5jdGlvbiBJbmRleGVkU291cmNlTWFwQ29uc3VtZXJfb3JpZ2luYWxQb3NpdGlvbkZvcihhQXJncykge1xuICAgIHZhciBuZWVkbGUgPSB7XG4gICAgICBnZW5lcmF0ZWRMaW5lOiB1dGlsLmdldEFyZyhhQXJncywgJ2xpbmUnKSxcbiAgICAgIGdlbmVyYXRlZENvbHVtbjogdXRpbC5nZXRBcmcoYUFyZ3MsICdjb2x1bW4nKVxuICAgIH07XG5cbiAgICAvLyBGaW5kIHRoZSBzZWN0aW9uIGNvbnRhaW5pbmcgdGhlIGdlbmVyYXRlZCBwb3NpdGlvbiB3ZSdyZSB0cnlpbmcgdG8gbWFwXG4gICAgLy8gdG8gYW4gb3JpZ2luYWwgcG9zaXRpb24uXG4gICAgdmFyIHNlY3Rpb25JbmRleCA9IGJpbmFyeVNlYXJjaC5zZWFyY2gobmVlZGxlLCB0aGlzLl9zZWN0aW9ucyxcbiAgICAgIGZ1bmN0aW9uKG5lZWRsZSwgc2VjdGlvbikge1xuICAgICAgICB2YXIgY21wID0gbmVlZGxlLmdlbmVyYXRlZExpbmUgLSBzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lO1xuICAgICAgICBpZiAoY21wKSB7XG4gICAgICAgICAgcmV0dXJuIGNtcDtcbiAgICAgICAgfVxuXG4gICAgICAgIHJldHVybiAobmVlZGxlLmdlbmVyYXRlZENvbHVtbiAtXG4gICAgICAgICAgICAgICAgc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkQ29sdW1uKTtcbiAgICAgIH0pO1xuICAgIHZhciBzZWN0aW9uID0gdGhpcy5fc2VjdGlvbnNbc2VjdGlvbkluZGV4XTtcblxuICAgIGlmICghc2VjdGlvbikge1xuICAgICAgcmV0dXJuIHtcbiAgICAgICAgc291cmNlOiBudWxsLFxuICAgICAgICBsaW5lOiBudWxsLFxuICAgICAgICBjb2x1bW46IG51bGwsXG4gICAgICAgIG5hbWU6IG51bGxcbiAgICAgIH07XG4gICAgfVxuXG4gICAgcmV0dXJuIHNlY3Rpb24uY29uc3VtZXIub3JpZ2luYWxQb3NpdGlvbkZvcih7XG4gICAgICBsaW5lOiBuZWVkbGUuZ2VuZXJhdGVkTGluZSAtXG4gICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lIC0gMSksXG4gICAgICBjb2x1bW46IG5lZWRsZS5nZW5lcmF0ZWRDb2x1bW4gLVxuICAgICAgICAoc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZSA9PT0gbmVlZGxlLmdlbmVyYXRlZExpbmVcbiAgICAgICAgID8gc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkQ29sdW1uIC0gMVxuICAgICAgICAgOiAwKSxcbiAgICAgIGJpYXM6IGFBcmdzLmJpYXNcbiAgICB9KTtcbiAgfTtcblxuLyoqXG4gKiBSZXR1cm4gdHJ1ZSBpZiB3ZSBoYXZlIHRoZSBzb3VyY2UgY29udGVudCBmb3IgZXZlcnkgc291cmNlIGluIHRoZSBzb3VyY2VcbiAqIG1hcCwgZmFsc2Ugb3RoZXJ3aXNlLlxuICovXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmhhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzID1cbiAgZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyX2hhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzKCkge1xuICAgIHJldHVybiB0aGlzLl9zZWN0aW9ucy5ldmVyeShmdW5jdGlvbiAocykge1xuICAgICAgcmV0dXJuIHMuY29uc3VtZXIuaGFzQ29udGVudHNPZkFsbFNvdXJjZXMoKTtcbiAgICB9KTtcbiAgfTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBvcmlnaW5hbCBzb3VyY2UgY29udGVudC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgdGhlIHVybCBvZiB0aGVcbiAqIG9yaWdpbmFsIHNvdXJjZSBmaWxlLiBSZXR1cm5zIG51bGwgaWYgbm8gb3JpZ2luYWwgc291cmNlIGNvbnRlbnQgaXNcbiAqIGF2YWlsYWJsZS5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5zb3VyY2VDb250ZW50Rm9yID1cbiAgZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyX3NvdXJjZUNvbnRlbnRGb3IoYVNvdXJjZSwgbnVsbE9uTWlzc2luZykge1xuICAgIGZvciAodmFyIGkgPSAwOyBpIDwgdGhpcy5fc2VjdGlvbnMubGVuZ3RoOyBpKyspIHtcbiAgICAgIHZhciBzZWN0aW9uID0gdGhpcy5fc2VjdGlvbnNbaV07XG5cbiAgICAgIHZhciBjb250ZW50ID0gc2VjdGlvbi5jb25zdW1lci5zb3VyY2VDb250ZW50Rm9yKGFTb3VyY2UsIHRydWUpO1xuICAgICAgaWYgKGNvbnRlbnQpIHtcbiAgICAgICAgcmV0dXJuIGNvbnRlbnQ7XG4gICAgICB9XG4gICAgfVxuICAgIGlmIChudWxsT25NaXNzaW5nKSB7XG4gICAgICByZXR1cm4gbnVsbDtcbiAgICB9XG4gICAgZWxzZSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ1wiJyArIGFTb3VyY2UgKyAnXCIgaXMgbm90IGluIHRoZSBTb3VyY2VNYXAuJyk7XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIGdlbmVyYXRlZCBsaW5lIGFuZCBjb2x1bW4gaW5mb3JtYXRpb24gZm9yIHRoZSBvcmlnaW5hbCBzb3VyY2UsXG4gKiBsaW5lLCBhbmQgY29sdW1uIHBvc2l0aW9ucyBwcm92aWRlZC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgYW4gb2JqZWN0IHdpdGhcbiAqIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gc291cmNlOiBUaGUgZmlsZW5hbWUgb2YgdGhlIG9yaWdpbmFsIHNvdXJjZS5cbiAqICAgLSBsaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZS4gIFRoZSBsaW5lIG51bWJlclxuICogICAgIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLiAgVGhlIGNvbHVtblxuICogICAgIG51bWJlciBpcyAwLWJhc2VkLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC4gIFRoZVxuICogICAgIGxpbmUgbnVtYmVyIGlzIDEtYmFzZWQuIFxuICogICAtIGNvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBzb3VyY2UsIG9yIG51bGwuXG4gKiAgICAgVGhlIGNvbHVtbiBudW1iZXIgaXMgMC1iYXNlZC5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5nZW5lcmF0ZWRQb3NpdGlvbkZvciA9XG4gIGZ1bmN0aW9uIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lcl9nZW5lcmF0ZWRQb3NpdGlvbkZvcihhQXJncykge1xuICAgIGZvciAodmFyIGkgPSAwOyBpIDwgdGhpcy5fc2VjdGlvbnMubGVuZ3RoOyBpKyspIHtcbiAgICAgIHZhciBzZWN0aW9uID0gdGhpcy5fc2VjdGlvbnNbaV07XG5cbiAgICAgIC8vIE9ubHkgY29uc2lkZXIgdGhpcyBzZWN0aW9uIGlmIHRoZSByZXF1ZXN0ZWQgc291cmNlIGlzIGluIHRoZSBsaXN0IG9mXG4gICAgICAvLyBzb3VyY2VzIG9mIHRoZSBjb25zdW1lci5cbiAgICAgIGlmIChzZWN0aW9uLmNvbnN1bWVyLl9maW5kU291cmNlSW5kZXgodXRpbC5nZXRBcmcoYUFyZ3MsICdzb3VyY2UnKSkgPT09IC0xKSB7XG4gICAgICAgIGNvbnRpbnVlO1xuICAgICAgfVxuICAgICAgdmFyIGdlbmVyYXRlZFBvc2l0aW9uID0gc2VjdGlvbi5jb25zdW1lci5nZW5lcmF0ZWRQb3NpdGlvbkZvcihhQXJncyk7XG4gICAgICBpZiAoZ2VuZXJhdGVkUG9zaXRpb24pIHtcbiAgICAgICAgdmFyIHJldCA9IHtcbiAgICAgICAgICBsaW5lOiBnZW5lcmF0ZWRQb3NpdGlvbi5saW5lICtcbiAgICAgICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lIC0gMSksXG4gICAgICAgICAgY29sdW1uOiBnZW5lcmF0ZWRQb3NpdGlvbi5jb2x1bW4gK1xuICAgICAgICAgICAgKHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZExpbmUgPT09IGdlbmVyYXRlZFBvc2l0aW9uLmxpbmVcbiAgICAgICAgICAgICA/IHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZENvbHVtbiAtIDFcbiAgICAgICAgICAgICA6IDApXG4gICAgICAgIH07XG4gICAgICAgIHJldHVybiByZXQ7XG4gICAgICB9XG4gICAgfVxuXG4gICAgcmV0dXJuIHtcbiAgICAgIGxpbmU6IG51bGwsXG4gICAgICBjb2x1bW46IG51bGxcbiAgICB9O1xuICB9O1xuXG4vKipcbiAqIFBhcnNlIHRoZSBtYXBwaW5ncyBpbiBhIHN0cmluZyBpbiB0byBhIGRhdGEgc3RydWN0dXJlIHdoaWNoIHdlIGNhbiBlYXNpbHlcbiAqIHF1ZXJ5ICh0aGUgb3JkZXJlZCBhcnJheXMgaW4gdGhlIGB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3NgIGFuZFxuICogYHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzYCBwcm9wZXJ0aWVzKS5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fcGFyc2VNYXBwaW5ncyA9XG4gIGZ1bmN0aW9uIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzID0gW107XG4gICAgdGhpcy5fX29yaWdpbmFsTWFwcGluZ3MgPSBbXTtcbiAgICBmb3IgKHZhciBpID0gMDsgaSA8IHRoaXMuX3NlY3Rpb25zLmxlbmd0aDsgaSsrKSB7XG4gICAgICB2YXIgc2VjdGlvbiA9IHRoaXMuX3NlY3Rpb25zW2ldO1xuICAgICAgdmFyIHNlY3Rpb25NYXBwaW5ncyA9IHNlY3Rpb24uY29uc3VtZXIuX2dlbmVyYXRlZE1hcHBpbmdzO1xuICAgICAgZm9yICh2YXIgaiA9IDA7IGogPCBzZWN0aW9uTWFwcGluZ3MubGVuZ3RoOyBqKyspIHtcbiAgICAgICAgdmFyIG1hcHBpbmcgPSBzZWN0aW9uTWFwcGluZ3Nbal07XG5cbiAgICAgICAgdmFyIHNvdXJjZSA9IHNlY3Rpb24uY29uc3VtZXIuX3NvdXJjZXMuYXQobWFwcGluZy5zb3VyY2UpO1xuICAgICAgICBzb3VyY2UgPSB1dGlsLmNvbXB1dGVTb3VyY2VVUkwoc2VjdGlvbi5jb25zdW1lci5zb3VyY2VSb290LCBzb3VyY2UsIHRoaXMuX3NvdXJjZU1hcFVSTCk7XG4gICAgICAgIHRoaXMuX3NvdXJjZXMuYWRkKHNvdXJjZSk7XG4gICAgICAgIHNvdXJjZSA9IHRoaXMuX3NvdXJjZXMuaW5kZXhPZihzb3VyY2UpO1xuXG4gICAgICAgIHZhciBuYW1lID0gbnVsbDtcbiAgICAgICAgaWYgKG1hcHBpbmcubmFtZSkge1xuICAgICAgICAgIG5hbWUgPSBzZWN0aW9uLmNvbnN1bWVyLl9uYW1lcy5hdChtYXBwaW5nLm5hbWUpO1xuICAgICAgICAgIHRoaXMuX25hbWVzLmFkZChuYW1lKTtcbiAgICAgICAgICBuYW1lID0gdGhpcy5fbmFtZXMuaW5kZXhPZihuYW1lKTtcbiAgICAgICAgfVxuXG4gICAgICAgIC8vIFRoZSBtYXBwaW5ncyBjb21pbmcgZnJvbSB0aGUgY29uc3VtZXIgZm9yIHRoZSBzZWN0aW9uIGhhdmVcbiAgICAgICAgLy8gZ2VuZXJhdGVkIHBvc2l0aW9ucyByZWxhdGl2ZSB0byB0aGUgc3RhcnQgb2YgdGhlIHNlY3Rpb24sIHNvIHdlXG4gICAgICAgIC8vIG5lZWQgdG8gb2Zmc2V0IHRoZW0gdG8gYmUgcmVsYXRpdmUgdG8gdGhlIHN0YXJ0IG9mIHRoZSBjb25jYXRlbmF0ZWRcbiAgICAgICAgLy8gZ2VuZXJhdGVkIGZpbGUuXG4gICAgICAgIHZhciBhZGp1c3RlZE1hcHBpbmcgPSB7XG4gICAgICAgICAgc291cmNlOiBzb3VyY2UsXG4gICAgICAgICAgZ2VuZXJhdGVkTGluZTogbWFwcGluZy5nZW5lcmF0ZWRMaW5lICtcbiAgICAgICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lIC0gMSksXG4gICAgICAgICAgZ2VuZXJhdGVkQ29sdW1uOiBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbiArXG4gICAgICAgICAgICAoc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZSA9PT0gbWFwcGluZy5nZW5lcmF0ZWRMaW5lXG4gICAgICAgICAgICA/IHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZENvbHVtbiAtIDFcbiAgICAgICAgICAgIDogMCksXG4gICAgICAgICAgb3JpZ2luYWxMaW5lOiBtYXBwaW5nLm9yaWdpbmFsTGluZSxcbiAgICAgICAgICBvcmlnaW5hbENvbHVtbjogbWFwcGluZy5vcmlnaW5hbENvbHVtbixcbiAgICAgICAgICBuYW1lOiBuYW1lXG4gICAgICAgIH07XG5cbiAgICAgICAgdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzLnB1c2goYWRqdXN0ZWRNYXBwaW5nKTtcbiAgICAgICAgaWYgKHR5cGVvZiBhZGp1c3RlZE1hcHBpbmcub3JpZ2luYWxMaW5lID09PSAnbnVtYmVyJykge1xuICAgICAgICAgIHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzLnB1c2goYWRqdXN0ZWRNYXBwaW5nKTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cblxuICAgIHF1aWNrU29ydCh0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3MsIHV0aWwuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zRGVmbGF0ZWQpO1xuICAgIHF1aWNrU29ydCh0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncywgdXRpbC5jb21wYXJlQnlPcmlnaW5hbFBvc2l0aW9ucyk7XG4gIH07XG5cbmV4cG9ydHMuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyID0gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvc291cmNlLW1hcC1jb25zdW1lci5qc1xuLy8gbW9kdWxlIGlkID0gN1xuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbmV4cG9ydHMuR1JFQVRFU1RfTE9XRVJfQk9VTkQgPSAxO1xuZXhwb3J0cy5MRUFTVF9VUFBFUl9CT1VORCA9IDI7XG5cbi8qKlxuICogUmVjdXJzaXZlIGltcGxlbWVudGF0aW9uIG9mIGJpbmFyeSBzZWFyY2guXG4gKlxuICogQHBhcmFtIGFMb3cgSW5kaWNlcyBoZXJlIGFuZCBsb3dlciBkbyBub3QgY29udGFpbiB0aGUgbmVlZGxlLlxuICogQHBhcmFtIGFIaWdoIEluZGljZXMgaGVyZSBhbmQgaGlnaGVyIGRvIG5vdCBjb250YWluIHRoZSBuZWVkbGUuXG4gKiBAcGFyYW0gYU5lZWRsZSBUaGUgZWxlbWVudCBiZWluZyBzZWFyY2hlZCBmb3IuXG4gKiBAcGFyYW0gYUhheXN0YWNrIFRoZSBub24tZW1wdHkgYXJyYXkgYmVpbmcgc2VhcmNoZWQuXG4gKiBAcGFyYW0gYUNvbXBhcmUgRnVuY3Rpb24gd2hpY2ggdGFrZXMgdHdvIGVsZW1lbnRzIGFuZCByZXR1cm5zIC0xLCAwLCBvciAxLlxuICogQHBhcmFtIGFCaWFzIEVpdGhlciAnYmluYXJ5U2VhcmNoLkdSRUFURVNUX0xPV0VSX0JPVU5EJyBvclxuICogICAgICdiaW5hcnlTZWFyY2guTEVBU1RfVVBQRVJfQk9VTkQnLiBTcGVjaWZpZXMgd2hldGhlciB0byByZXR1cm4gdGhlXG4gKiAgICAgY2xvc2VzdCBlbGVtZW50IHRoYXQgaXMgc21hbGxlciB0aGFuIG9yIGdyZWF0ZXIgdGhhbiB0aGUgb25lIHdlIGFyZVxuICogICAgIHNlYXJjaGluZyBmb3IsIHJlc3BlY3RpdmVseSwgaWYgdGhlIGV4YWN0IGVsZW1lbnQgY2Fubm90IGJlIGZvdW5kLlxuICovXG5mdW5jdGlvbiByZWN1cnNpdmVTZWFyY2goYUxvdywgYUhpZ2gsIGFOZWVkbGUsIGFIYXlzdGFjaywgYUNvbXBhcmUsIGFCaWFzKSB7XG4gIC8vIFRoaXMgZnVuY3Rpb24gdGVybWluYXRlcyB3aGVuIG9uZSBvZiB0aGUgZm9sbG93aW5nIGlzIHRydWU6XG4gIC8vXG4gIC8vICAgMS4gV2UgZmluZCB0aGUgZXhhY3QgZWxlbWVudCB3ZSBhcmUgbG9va2luZyBmb3IuXG4gIC8vXG4gIC8vICAgMi4gV2UgZGlkIG5vdCBmaW5kIHRoZSBleGFjdCBlbGVtZW50LCBidXQgd2UgY2FuIHJldHVybiB0aGUgaW5kZXggb2ZcbiAgLy8gICAgICB0aGUgbmV4dC1jbG9zZXN0IGVsZW1lbnQuXG4gIC8vXG4gIC8vICAgMy4gV2UgZGlkIG5vdCBmaW5kIHRoZSBleGFjdCBlbGVtZW50LCBhbmQgdGhlcmUgaXMgbm8gbmV4dC1jbG9zZXN0XG4gIC8vICAgICAgZWxlbWVudCB0aGFuIHRoZSBvbmUgd2UgYXJlIHNlYXJjaGluZyBmb3IsIHNvIHdlIHJldHVybiAtMS5cbiAgdmFyIG1pZCA9IE1hdGguZmxvb3IoKGFIaWdoIC0gYUxvdykgLyAyKSArIGFMb3c7XG4gIHZhciBjbXAgPSBhQ29tcGFyZShhTmVlZGxlLCBhSGF5c3RhY2tbbWlkXSwgdHJ1ZSk7XG4gIGlmIChjbXAgPT09IDApIHtcbiAgICAvLyBGb3VuZCB0aGUgZWxlbWVudCB3ZSBhcmUgbG9va2luZyBmb3IuXG4gICAgcmV0dXJuIG1pZDtcbiAgfVxuICBlbHNlIGlmIChjbXAgPiAwKSB7XG4gICAgLy8gT3VyIG5lZWRsZSBpcyBncmVhdGVyIHRoYW4gYUhheXN0YWNrW21pZF0uXG4gICAgaWYgKGFIaWdoIC0gbWlkID4gMSkge1xuICAgICAgLy8gVGhlIGVsZW1lbnQgaXMgaW4gdGhlIHVwcGVyIGhhbGYuXG4gICAgICByZXR1cm4gcmVjdXJzaXZlU2VhcmNoKG1pZCwgYUhpZ2gsIGFOZWVkbGUsIGFIYXlzdGFjaywgYUNvbXBhcmUsIGFCaWFzKTtcbiAgICB9XG5cbiAgICAvLyBUaGUgZXhhY3QgbmVlZGxlIGVsZW1lbnQgd2FzIG5vdCBmb3VuZCBpbiB0aGlzIGhheXN0YWNrLiBEZXRlcm1pbmUgaWZcbiAgICAvLyB3ZSBhcmUgaW4gdGVybWluYXRpb24gY2FzZSAoMykgb3IgKDIpIGFuZCByZXR1cm4gdGhlIGFwcHJvcHJpYXRlIHRoaW5nLlxuICAgIGlmIChhQmlhcyA9PSBleHBvcnRzLkxFQVNUX1VQUEVSX0JPVU5EKSB7XG4gICAgICByZXR1cm4gYUhpZ2ggPCBhSGF5c3RhY2subGVuZ3RoID8gYUhpZ2ggOiAtMTtcbiAgICB9IGVsc2Uge1xuICAgICAgcmV0dXJuIG1pZDtcbiAgICB9XG4gIH1cbiAgZWxzZSB7XG4gICAgLy8gT3VyIG5lZWRsZSBpcyBsZXNzIHRoYW4gYUhheXN0YWNrW21pZF0uXG4gICAgaWYgKG1pZCAtIGFMb3cgPiAxKSB7XG4gICAgICAvLyBUaGUgZWxlbWVudCBpcyBpbiB0aGUgbG93ZXIgaGFsZi5cbiAgICAgIHJldHVybiByZWN1cnNpdmVTZWFyY2goYUxvdywgbWlkLCBhTmVlZGxlLCBhSGF5c3RhY2ssIGFDb21wYXJlLCBhQmlhcyk7XG4gICAgfVxuXG4gICAgLy8gd2UgYXJlIGluIHRlcm1pbmF0aW9uIGNhc2UgKDMpIG9yICgyKSBhbmQgcmV0dXJuIHRoZSBhcHByb3ByaWF0ZSB0aGluZy5cbiAgICBpZiAoYUJpYXMgPT0gZXhwb3J0cy5MRUFTVF9VUFBFUl9CT1VORCkge1xuICAgICAgcmV0dXJuIG1pZDtcbiAgICB9IGVsc2Uge1xuICAgICAgcmV0dXJuIGFMb3cgPCAwID8gLTEgOiBhTG93O1xuICAgIH1cbiAgfVxufVxuXG4vKipcbiAqIFRoaXMgaXMgYW4gaW1wbGVtZW50YXRpb24gb2YgYmluYXJ5IHNlYXJjaCB3aGljaCB3aWxsIGFsd2F5cyB0cnkgYW5kIHJldHVyblxuICogdGhlIGluZGV4IG9mIHRoZSBjbG9zZXN0IGVsZW1lbnQgaWYgdGhlcmUgaXMgbm8gZXhhY3QgaGl0LiBUaGlzIGlzIGJlY2F1c2VcbiAqIG1hcHBpbmdzIGJldHdlZW4gb3JpZ2luYWwgYW5kIGdlbmVyYXRlZCBsaW5lL2NvbCBwYWlycyBhcmUgc2luZ2xlIHBvaW50cyxcbiAqIGFuZCB0aGVyZSBpcyBhbiBpbXBsaWNpdCByZWdpb24gYmV0d2VlbiBlYWNoIG9mIHRoZW0sIHNvIGEgbWlzcyBqdXN0IG1lYW5zXG4gKiB0aGF0IHlvdSBhcmVuJ3Qgb24gdGhlIHZlcnkgc3RhcnQgb2YgYSByZWdpb24uXG4gKlxuICogQHBhcmFtIGFOZWVkbGUgVGhlIGVsZW1lbnQgeW91IGFyZSBsb29raW5nIGZvci5cbiAqIEBwYXJhbSBhSGF5c3RhY2sgVGhlIGFycmF5IHRoYXQgaXMgYmVpbmcgc2VhcmNoZWQuXG4gKiBAcGFyYW0gYUNvbXBhcmUgQSBmdW5jdGlvbiB3aGljaCB0YWtlcyB0aGUgbmVlZGxlIGFuZCBhbiBlbGVtZW50IGluIHRoZVxuICogICAgIGFycmF5IGFuZCByZXR1cm5zIC0xLCAwLCBvciAxIGRlcGVuZGluZyBvbiB3aGV0aGVyIHRoZSBuZWVkbGUgaXMgbGVzc1xuICogICAgIHRoYW4sIGVxdWFsIHRvLCBvciBncmVhdGVyIHRoYW4gdGhlIGVsZW1lbnQsIHJlc3BlY3RpdmVseS5cbiAqIEBwYXJhbSBhQmlhcyBFaXRoZXIgJ2JpbmFyeVNlYXJjaC5HUkVBVEVTVF9MT1dFUl9CT1VORCcgb3JcbiAqICAgICAnYmluYXJ5U2VhcmNoLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnYmluYXJ5U2VhcmNoLkdSRUFURVNUX0xPV0VSX0JPVU5EJy5cbiAqL1xuZXhwb3J0cy5zZWFyY2ggPSBmdW5jdGlvbiBzZWFyY2goYU5lZWRsZSwgYUhheXN0YWNrLCBhQ29tcGFyZSwgYUJpYXMpIHtcbiAgaWYgKGFIYXlzdGFjay5sZW5ndGggPT09IDApIHtcbiAgICByZXR1cm4gLTE7XG4gIH1cblxuICB2YXIgaW5kZXggPSByZWN1cnNpdmVTZWFyY2goLTEsIGFIYXlzdGFjay5sZW5ndGgsIGFOZWVkbGUsIGFIYXlzdGFjayxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGFDb21wYXJlLCBhQmlhcyB8fCBleHBvcnRzLkdSRUFURVNUX0xPV0VSX0JPVU5EKTtcbiAgaWYgKGluZGV4IDwgMCkge1xuICAgIHJldHVybiAtMTtcbiAgfVxuXG4gIC8vIFdlIGhhdmUgZm91bmQgZWl0aGVyIHRoZSBleGFjdCBlbGVtZW50LCBvciB0aGUgbmV4dC1jbG9zZXN0IGVsZW1lbnQgdGhhblxuICAvLyB0aGUgb25lIHdlIGFyZSBzZWFyY2hpbmcgZm9yLiBIb3dldmVyLCB0aGVyZSBtYXkgYmUgbW9yZSB0aGFuIG9uZSBzdWNoXG4gIC8vIGVsZW1lbnQuIE1ha2Ugc3VyZSB3ZSBhbHdheXMgcmV0dXJuIHRoZSBzbWFsbGVzdCBvZiB0aGVzZS5cbiAgd2hpbGUgKGluZGV4IC0gMSA+PSAwKSB7XG4gICAgaWYgKGFDb21wYXJlKGFIYXlzdGFja1tpbmRleF0sIGFIYXlzdGFja1tpbmRleCAtIDFdLCB0cnVlKSAhPT0gMCkge1xuICAgICAgYnJlYWs7XG4gICAgfVxuICAgIC0taW5kZXg7XG4gIH1cblxuICByZXR1cm4gaW5kZXg7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvYmluYXJ5LXNlYXJjaC5qc1xuLy8gbW9kdWxlIGlkID0gOFxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbi8vIEl0IHR1cm5zIG91dCB0aGF0IHNvbWUgKG1vc3Q/KSBKYXZhU2NyaXB0IGVuZ2luZXMgZG9uJ3Qgc2VsZi1ob3N0XG4vLyBgQXJyYXkucHJvdG90eXBlLnNvcnRgLiBUaGlzIG1ha2VzIHNlbnNlIGJlY2F1c2UgQysrIHdpbGwgbGlrZWx5IHJlbWFpblxuLy8gZmFzdGVyIHRoYW4gSlMgd2hlbiBkb2luZyByYXcgQ1BVLWludGVuc2l2ZSBzb3J0aW5nLiBIb3dldmVyLCB3aGVuIHVzaW5nIGFcbi8vIGN1c3RvbSBjb21wYXJhdG9yIGZ1bmN0aW9uLCBjYWxsaW5nIGJhY2sgYW5kIGZvcnRoIGJldHdlZW4gdGhlIFZNJ3MgQysrIGFuZFxuLy8gSklUJ2QgSlMgaXMgcmF0aGVyIHNsb3cgKmFuZCogbG9zZXMgSklUIHR5cGUgaW5mb3JtYXRpb24sIHJlc3VsdGluZyBpblxuLy8gd29yc2UgZ2VuZXJhdGVkIGNvZGUgZm9yIHRoZSBjb21wYXJhdG9yIGZ1bmN0aW9uIHRoYW4gd291bGQgYmUgb3B0aW1hbC4gSW5cbi8vIGZhY3QsIHdoZW4gc29ydGluZyB3aXRoIGEgY29tcGFyYXRvciwgdGhlc2UgY29zdHMgb3V0d2VpZ2ggdGhlIGJlbmVmaXRzIG9mXG4vLyBzb3J0aW5nIGluIEMrKy4gQnkgdXNpbmcgb3VyIG93biBKUy1pbXBsZW1lbnRlZCBRdWljayBTb3J0IChiZWxvdyksIHdlIGdldFxuLy8gYSB+MzUwMG1zIG1lYW4gc3BlZWQtdXAgaW4gYGJlbmNoL2JlbmNoLmh0bWxgLlxuXG4vKipcbiAqIFN3YXAgdGhlIGVsZW1lbnRzIGluZGV4ZWQgYnkgYHhgIGFuZCBgeWAgaW4gdGhlIGFycmF5IGBhcnlgLlxuICpcbiAqIEBwYXJhbSB7QXJyYXl9IGFyeVxuICogICAgICAgIFRoZSBhcnJheS5cbiAqIEBwYXJhbSB7TnVtYmVyfSB4XG4gKiAgICAgICAgVGhlIGluZGV4IG9mIHRoZSBmaXJzdCBpdGVtLlxuICogQHBhcmFtIHtOdW1iZXJ9IHlcbiAqICAgICAgICBUaGUgaW5kZXggb2YgdGhlIHNlY29uZCBpdGVtLlxuICovXG5mdW5jdGlvbiBzd2FwKGFyeSwgeCwgeSkge1xuICB2YXIgdGVtcCA9IGFyeVt4XTtcbiAgYXJ5W3hdID0gYXJ5W3ldO1xuICBhcnlbeV0gPSB0ZW1wO1xufVxuXG4vKipcbiAqIFJldHVybnMgYSByYW5kb20gaW50ZWdlciB3aXRoaW4gdGhlIHJhbmdlIGBsb3cgLi4gaGlnaGAgaW5jbHVzaXZlLlxuICpcbiAqIEBwYXJhbSB7TnVtYmVyfSBsb3dcbiAqICAgICAgICBUaGUgbG93ZXIgYm91bmQgb24gdGhlIHJhbmdlLlxuICogQHBhcmFtIHtOdW1iZXJ9IGhpZ2hcbiAqICAgICAgICBUaGUgdXBwZXIgYm91bmQgb24gdGhlIHJhbmdlLlxuICovXG5mdW5jdGlvbiByYW5kb21JbnRJblJhbmdlKGxvdywgaGlnaCkge1xuICByZXR1cm4gTWF0aC5yb3VuZChsb3cgKyAoTWF0aC5yYW5kb20oKSAqIChoaWdoIC0gbG93KSkpO1xufVxuXG4vKipcbiAqIFRoZSBRdWljayBTb3J0IGFsZ29yaXRobS5cbiAqXG4gKiBAcGFyYW0ge0FycmF5fSBhcnlcbiAqICAgICAgICBBbiBhcnJheSB0byBzb3J0LlxuICogQHBhcmFtIHtmdW5jdGlvbn0gY29tcGFyYXRvclxuICogICAgICAgIEZ1bmN0aW9uIHRvIHVzZSB0byBjb21wYXJlIHR3byBpdGVtcy5cbiAqIEBwYXJhbSB7TnVtYmVyfSBwXG4gKiAgICAgICAgU3RhcnQgaW5kZXggb2YgdGhlIGFycmF5XG4gKiBAcGFyYW0ge051bWJlcn0gclxuICogICAgICAgIEVuZCBpbmRleCBvZiB0aGUgYXJyYXlcbiAqL1xuZnVuY3Rpb24gZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBwLCByKSB7XG4gIC8vIElmIG91ciBsb3dlciBib3VuZCBpcyBsZXNzIHRoYW4gb3VyIHVwcGVyIGJvdW5kLCB3ZSAoMSkgcGFydGl0aW9uIHRoZVxuICAvLyBhcnJheSBpbnRvIHR3byBwaWVjZXMgYW5kICgyKSByZWN1cnNlIG9uIGVhY2ggaGFsZi4gSWYgaXQgaXMgbm90LCB0aGlzIGlzXG4gIC8vIHRoZSBlbXB0eSBhcnJheSBhbmQgb3VyIGJhc2UgY2FzZS5cblxuICBpZiAocCA8IHIpIHtcbiAgICAvLyAoMSkgUGFydGl0aW9uaW5nLlxuICAgIC8vXG4gICAgLy8gVGhlIHBhcnRpdGlvbmluZyBjaG9vc2VzIGEgcGl2b3QgYmV0d2VlbiBgcGAgYW5kIGByYCBhbmQgbW92ZXMgYWxsXG4gICAgLy8gZWxlbWVudHMgdGhhdCBhcmUgbGVzcyB0aGFuIG9yIGVxdWFsIHRvIHRoZSBwaXZvdCB0byB0aGUgYmVmb3JlIGl0LCBhbmRcbiAgICAvLyBhbGwgdGhlIGVsZW1lbnRzIHRoYXQgYXJlIGdyZWF0ZXIgdGhhbiBpdCBhZnRlciBpdC4gVGhlIGVmZmVjdCBpcyB0aGF0XG4gICAgLy8gb25jZSBwYXJ0aXRpb24gaXMgZG9uZSwgdGhlIHBpdm90IGlzIGluIHRoZSBleGFjdCBwbGFjZSBpdCB3aWxsIGJlIHdoZW5cbiAgICAvLyB0aGUgYXJyYXkgaXMgcHV0IGluIHNvcnRlZCBvcmRlciwgYW5kIGl0IHdpbGwgbm90IG5lZWQgdG8gYmUgbW92ZWRcbiAgICAvLyBhZ2Fpbi4gVGhpcyBydW5zIGluIE8obikgdGltZS5cblxuICAgIC8vIEFsd2F5cyBjaG9vc2UgYSByYW5kb20gcGl2b3Qgc28gdGhhdCBhbiBpbnB1dCBhcnJheSB3aGljaCBpcyByZXZlcnNlXG4gICAgLy8gc29ydGVkIGRvZXMgbm90IGNhdXNlIE8obl4yKSBydW5uaW5nIHRpbWUuXG4gICAgdmFyIHBpdm90SW5kZXggPSByYW5kb21JbnRJblJhbmdlKHAsIHIpO1xuICAgIHZhciBpID0gcCAtIDE7XG5cbiAgICBzd2FwKGFyeSwgcGl2b3RJbmRleCwgcik7XG4gICAgdmFyIHBpdm90ID0gYXJ5W3JdO1xuXG4gICAgLy8gSW1tZWRpYXRlbHkgYWZ0ZXIgYGpgIGlzIGluY3JlbWVudGVkIGluIHRoaXMgbG9vcCwgdGhlIGZvbGxvd2luZyBob2xkXG4gICAgLy8gdHJ1ZTpcbiAgICAvL1xuICAgIC8vICAgKiBFdmVyeSBlbGVtZW50IGluIGBhcnlbcCAuLiBpXWAgaXMgbGVzcyB0aGFuIG9yIGVxdWFsIHRvIHRoZSBwaXZvdC5cbiAgICAvL1xuICAgIC8vICAgKiBFdmVyeSBlbGVtZW50IGluIGBhcnlbaSsxIC4uIGotMV1gIGlzIGdyZWF0ZXIgdGhhbiB0aGUgcGl2b3QuXG4gICAgZm9yICh2YXIgaiA9IHA7IGogPCByOyBqKyspIHtcbiAgICAgIGlmIChjb21wYXJhdG9yKGFyeVtqXSwgcGl2b3QpIDw9IDApIHtcbiAgICAgICAgaSArPSAxO1xuICAgICAgICBzd2FwKGFyeSwgaSwgaik7XG4gICAgICB9XG4gICAgfVxuXG4gICAgc3dhcChhcnksIGkgKyAxLCBqKTtcbiAgICB2YXIgcSA9IGkgKyAxO1xuXG4gICAgLy8gKDIpIFJlY3Vyc2Ugb24gZWFjaCBoYWxmLlxuXG4gICAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBwLCBxIC0gMSk7XG4gICAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBxICsgMSwgcik7XG4gIH1cbn1cblxuLyoqXG4gKiBTb3J0IHRoZSBnaXZlbiBhcnJheSBpbi1wbGFjZSB3aXRoIHRoZSBnaXZlbiBjb21wYXJhdG9yIGZ1bmN0aW9uLlxuICpcbiAqIEBwYXJhbSB7QXJyYXl9IGFyeVxuICogICAgICAgIEFuIGFycmF5IHRvIHNvcnQuXG4gKiBAcGFyYW0ge2Z1bmN0aW9ufSBjb21wYXJhdG9yXG4gKiAgICAgICAgRnVuY3Rpb24gdG8gdXNlIHRvIGNvbXBhcmUgdHdvIGl0ZW1zLlxuICovXG5leHBvcnRzLnF1aWNrU29ydCA9IGZ1bmN0aW9uIChhcnksIGNvbXBhcmF0b3IpIHtcbiAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCAwLCBhcnkubGVuZ3RoIC0gMSk7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvcXVpY2stc29ydC5qc1xuLy8gbW9kdWxlIGlkID0gOVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbnZhciBTb3VyY2VNYXBHZW5lcmF0b3IgPSByZXF1aXJlKCcuL3NvdXJjZS1tYXAtZ2VuZXJhdG9yJykuU291cmNlTWFwR2VuZXJhdG9yO1xudmFyIHV0aWwgPSByZXF1aXJlKCcuL3V0aWwnKTtcblxuLy8gTWF0Y2hlcyBhIFdpbmRvd3Mtc3R5bGUgYFxcclxcbmAgbmV3bGluZSBvciBhIGBcXG5gIG5ld2xpbmUgdXNlZCBieSBhbGwgb3RoZXJcbi8vIG9wZXJhdGluZyBzeXN0ZW1zIHRoZXNlIGRheXMgKGNhcHR1cmluZyB0aGUgcmVzdWx0KS5cbnZhciBSRUdFWF9ORVdMSU5FID0gLyhcXHI/XFxuKS87XG5cbi8vIE5ld2xpbmUgY2hhcmFjdGVyIGNvZGUgZm9yIGNoYXJDb2RlQXQoKSBjb21wYXJpc29uc1xudmFyIE5FV0xJTkVfQ09ERSA9IDEwO1xuXG4vLyBQcml2YXRlIHN5bWJvbCBmb3IgaWRlbnRpZnlpbmcgYFNvdXJjZU5vZGVgcyB3aGVuIG11bHRpcGxlIHZlcnNpb25zIG9mXG4vLyB0aGUgc291cmNlLW1hcCBsaWJyYXJ5IGFyZSBsb2FkZWQuIFRoaXMgTVVTVCBOT1QgQ0hBTkdFIGFjcm9zc1xuLy8gdmVyc2lvbnMhXG52YXIgaXNTb3VyY2VOb2RlID0gXCIkJCRpc1NvdXJjZU5vZGUkJCRcIjtcblxuLyoqXG4gKiBTb3VyY2VOb2RlcyBwcm92aWRlIGEgd2F5IHRvIGFic3RyYWN0IG92ZXIgaW50ZXJwb2xhdGluZy9jb25jYXRlbmF0aW5nXG4gKiBzbmlwcGV0cyBvZiBnZW5lcmF0ZWQgSmF2YVNjcmlwdCBzb3VyY2UgY29kZSB3aGlsZSBtYWludGFpbmluZyB0aGUgbGluZSBhbmRcbiAqIGNvbHVtbiBpbmZvcm1hdGlvbiBhc3NvY2lhdGVkIHdpdGggdGhlIG9yaWdpbmFsIHNvdXJjZSBjb2RlLlxuICpcbiAqIEBwYXJhbSBhTGluZSBUaGUgb3JpZ2luYWwgbGluZSBudW1iZXIuXG4gKiBAcGFyYW0gYUNvbHVtbiBUaGUgb3JpZ2luYWwgY29sdW1uIG51bWJlci5cbiAqIEBwYXJhbSBhU291cmNlIFRoZSBvcmlnaW5hbCBzb3VyY2UncyBmaWxlbmFtZS5cbiAqIEBwYXJhbSBhQ2h1bmtzIE9wdGlvbmFsLiBBbiBhcnJheSBvZiBzdHJpbmdzIHdoaWNoIGFyZSBzbmlwcGV0cyBvZlxuICogICAgICAgIGdlbmVyYXRlZCBKUywgb3Igb3RoZXIgU291cmNlTm9kZXMuXG4gKiBAcGFyYW0gYU5hbWUgVGhlIG9yaWdpbmFsIGlkZW50aWZpZXIuXG4gKi9cbmZ1bmN0aW9uIFNvdXJjZU5vZGUoYUxpbmUsIGFDb2x1bW4sIGFTb3VyY2UsIGFDaHVua3MsIGFOYW1lKSB7XG4gIHRoaXMuY2hpbGRyZW4gPSBbXTtcbiAgdGhpcy5zb3VyY2VDb250ZW50cyA9IHt9O1xuICB0aGlzLmxpbmUgPSBhTGluZSA9PSBudWxsID8gbnVsbCA6IGFMaW5lO1xuICB0aGlzLmNvbHVtbiA9IGFDb2x1bW4gPT0gbnVsbCA/IG51bGwgOiBhQ29sdW1uO1xuICB0aGlzLnNvdXJjZSA9IGFTb3VyY2UgPT0gbnVsbCA/IG51bGwgOiBhU291cmNlO1xuICB0aGlzLm5hbWUgPSBhTmFtZSA9PSBudWxsID8gbnVsbCA6IGFOYW1lO1xuICB0aGlzW2lzU291cmNlTm9kZV0gPSB0cnVlO1xuICBpZiAoYUNodW5rcyAhPSBudWxsKSB0aGlzLmFkZChhQ2h1bmtzKTtcbn1cblxuLyoqXG4gKiBDcmVhdGVzIGEgU291cmNlTm9kZSBmcm9tIGdlbmVyYXRlZCBjb2RlIGFuZCBhIFNvdXJjZU1hcENvbnN1bWVyLlxuICpcbiAqIEBwYXJhbSBhR2VuZXJhdGVkQ29kZSBUaGUgZ2VuZXJhdGVkIGNvZGVcbiAqIEBwYXJhbSBhU291cmNlTWFwQ29uc3VtZXIgVGhlIFNvdXJjZU1hcCBmb3IgdGhlIGdlbmVyYXRlZCBjb2RlXG4gKiBAcGFyYW0gYVJlbGF0aXZlUGF0aCBPcHRpb25hbC4gVGhlIHBhdGggdGhhdCByZWxhdGl2ZSBzb3VyY2VzIGluIHRoZVxuICogICAgICAgIFNvdXJjZU1hcENvbnN1bWVyIHNob3VsZCBiZSByZWxhdGl2ZSB0by5cbiAqL1xuU291cmNlTm9kZS5mcm9tU3RyaW5nV2l0aFNvdXJjZU1hcCA9XG4gIGZ1bmN0aW9uIFNvdXJjZU5vZGVfZnJvbVN0cmluZ1dpdGhTb3VyY2VNYXAoYUdlbmVyYXRlZENvZGUsIGFTb3VyY2VNYXBDb25zdW1lciwgYVJlbGF0aXZlUGF0aCkge1xuICAgIC8vIFRoZSBTb3VyY2VOb2RlIHdlIHdhbnQgdG8gZmlsbCB3aXRoIHRoZSBnZW5lcmF0ZWQgY29kZVxuICAgIC8vIGFuZCB0aGUgU291cmNlTWFwXG4gICAgdmFyIG5vZGUgPSBuZXcgU291cmNlTm9kZSgpO1xuXG4gICAgLy8gQWxsIGV2ZW4gaW5kaWNlcyBvZiB0aGlzIGFycmF5IGFyZSBvbmUgbGluZSBvZiB0aGUgZ2VuZXJhdGVkIGNvZGUsXG4gICAgLy8gd2hpbGUgYWxsIG9kZCBpbmRpY2VzIGFyZSB0aGUgbmV3bGluZXMgYmV0d2VlbiB0d28gYWRqYWNlbnQgbGluZXNcbiAgICAvLyAoc2luY2UgYFJFR0VYX05FV0xJTkVgIGNhcHR1cmVzIGl0cyBtYXRjaCkuXG4gICAgLy8gUHJvY2Vzc2VkIGZyYWdtZW50cyBhcmUgYWNjZXNzZWQgYnkgY2FsbGluZyBgc2hpZnROZXh0TGluZWAuXG4gICAgdmFyIHJlbWFpbmluZ0xpbmVzID0gYUdlbmVyYXRlZENvZGUuc3BsaXQoUkVHRVhfTkVXTElORSk7XG4gICAgdmFyIHJlbWFpbmluZ0xpbmVzSW5kZXggPSAwO1xuICAgIHZhciBzaGlmdE5leHRMaW5lID0gZnVuY3Rpb24oKSB7XG4gICAgICB2YXIgbGluZUNvbnRlbnRzID0gZ2V0TmV4dExpbmUoKTtcbiAgICAgIC8vIFRoZSBsYXN0IGxpbmUgb2YgYSBmaWxlIG1pZ2h0IG5vdCBoYXZlIGEgbmV3bGluZS5cbiAgICAgIHZhciBuZXdMaW5lID0gZ2V0TmV4dExpbmUoKSB8fCBcIlwiO1xuICAgICAgcmV0dXJuIGxpbmVDb250ZW50cyArIG5ld0xpbmU7XG5cbiAgICAgIGZ1bmN0aW9uIGdldE5leHRMaW5lKCkge1xuICAgICAgICByZXR1cm4gcmVtYWluaW5nTGluZXNJbmRleCA8IHJlbWFpbmluZ0xpbmVzLmxlbmd0aCA/XG4gICAgICAgICAgICByZW1haW5pbmdMaW5lc1tyZW1haW5pbmdMaW5lc0luZGV4KytdIDogdW5kZWZpbmVkO1xuICAgICAgfVxuICAgIH07XG5cbiAgICAvLyBXZSBuZWVkIHRvIHJlbWVtYmVyIHRoZSBwb3NpdGlvbiBvZiBcInJlbWFpbmluZ0xpbmVzXCJcbiAgICB2YXIgbGFzdEdlbmVyYXRlZExpbmUgPSAxLCBsYXN0R2VuZXJhdGVkQ29sdW1uID0gMDtcblxuICAgIC8vIFRoZSBnZW5lcmF0ZSBTb3VyY2VOb2RlcyB3ZSBuZWVkIGEgY29kZSByYW5nZS5cbiAgICAvLyBUbyBleHRyYWN0IGl0IGN1cnJlbnQgYW5kIGxhc3QgbWFwcGluZyBpcyB1c2VkLlxuICAgIC8vIEhlcmUgd2Ugc3RvcmUgdGhlIGxhc3QgbWFwcGluZy5cbiAgICB2YXIgbGFzdE1hcHBpbmcgPSBudWxsO1xuXG4gICAgYVNvdXJjZU1hcENvbnN1bWVyLmVhY2hNYXBwaW5nKGZ1bmN0aW9uIChtYXBwaW5nKSB7XG4gICAgICBpZiAobGFzdE1hcHBpbmcgIT09IG51bGwpIHtcbiAgICAgICAgLy8gV2UgYWRkIHRoZSBjb2RlIGZyb20gXCJsYXN0TWFwcGluZ1wiIHRvIFwibWFwcGluZ1wiOlxuICAgICAgICAvLyBGaXJzdCBjaGVjayBpZiB0aGVyZSBpcyBhIG5ldyBsaW5lIGluIGJldHdlZW4uXG4gICAgICAgIGlmIChsYXN0R2VuZXJhdGVkTGluZSA8IG1hcHBpbmcuZ2VuZXJhdGVkTGluZSkge1xuICAgICAgICAgIC8vIEFzc29jaWF0ZSBmaXJzdCBsaW5lIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgICAgYWRkTWFwcGluZ1dpdGhDb2RlKGxhc3RNYXBwaW5nLCBzaGlmdE5leHRMaW5lKCkpO1xuICAgICAgICAgIGxhc3RHZW5lcmF0ZWRMaW5lKys7XG4gICAgICAgICAgbGFzdEdlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgICAgICAgLy8gVGhlIHJlbWFpbmluZyBjb2RlIGlzIGFkZGVkIHdpdGhvdXQgbWFwcGluZ1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIFRoZXJlIGlzIG5vIG5ldyBsaW5lIGluIGJldHdlZW4uXG4gICAgICAgICAgLy8gQXNzb2NpYXRlIHRoZSBjb2RlIGJldHdlZW4gXCJsYXN0R2VuZXJhdGVkQ29sdW1uXCIgYW5kXG4gICAgICAgICAgLy8gXCJtYXBwaW5nLmdlbmVyYXRlZENvbHVtblwiIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgICAgdmFyIG5leHRMaW5lID0gcmVtYWluaW5nTGluZXNbcmVtYWluaW5nTGluZXNJbmRleF0gfHwgJyc7XG4gICAgICAgICAgdmFyIGNvZGUgPSBuZXh0TGluZS5zdWJzdHIoMCwgbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4gLVxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGxhc3RHZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgICAgIHJlbWFpbmluZ0xpbmVzW3JlbWFpbmluZ0xpbmVzSW5kZXhdID0gbmV4dExpbmUuc3Vic3RyKG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uIC1cbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uKTtcbiAgICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uID0gbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW47XG4gICAgICAgICAgYWRkTWFwcGluZ1dpdGhDb2RlKGxhc3RNYXBwaW5nLCBjb2RlKTtcbiAgICAgICAgICAvLyBObyBtb3JlIHJlbWFpbmluZyBjb2RlLCBjb250aW51ZVxuICAgICAgICAgIGxhc3RNYXBwaW5nID0gbWFwcGluZztcbiAgICAgICAgICByZXR1cm47XG4gICAgICAgIH1cbiAgICAgIH1cbiAgICAgIC8vIFdlIGFkZCB0aGUgZ2VuZXJhdGVkIGNvZGUgdW50aWwgdGhlIGZpcnN0IG1hcHBpbmdcbiAgICAgIC8vIHRvIHRoZSBTb3VyY2VOb2RlIHdpdGhvdXQgYW55IG1hcHBpbmcuXG4gICAgICAvLyBFYWNoIGxpbmUgaXMgYWRkZWQgYXMgc2VwYXJhdGUgc3RyaW5nLlxuICAgICAgd2hpbGUgKGxhc3RHZW5lcmF0ZWRMaW5lIDwgbWFwcGluZy5nZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgIG5vZGUuYWRkKHNoaWZ0TmV4dExpbmUoKSk7XG4gICAgICAgIGxhc3RHZW5lcmF0ZWRMaW5lKys7XG4gICAgICB9XG4gICAgICBpZiAobGFzdEdlbmVyYXRlZENvbHVtbiA8IG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uKSB7XG4gICAgICAgIHZhciBuZXh0TGluZSA9IHJlbWFpbmluZ0xpbmVzW3JlbWFpbmluZ0xpbmVzSW5kZXhdIHx8ICcnO1xuICAgICAgICBub2RlLmFkZChuZXh0TGluZS5zdWJzdHIoMCwgbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4pKTtcbiAgICAgICAgcmVtYWluaW5nTGluZXNbcmVtYWluaW5nTGluZXNJbmRleF0gPSBuZXh0TGluZS5zdWJzdHIobWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uID0gbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW47XG4gICAgICB9XG4gICAgICBsYXN0TWFwcGluZyA9IG1hcHBpbmc7XG4gICAgfSwgdGhpcyk7XG4gICAgLy8gV2UgaGF2ZSBwcm9jZXNzZWQgYWxsIG1hcHBpbmdzLlxuICAgIGlmIChyZW1haW5pbmdMaW5lc0luZGV4IDwgcmVtYWluaW5nTGluZXMubGVuZ3RoKSB7XG4gICAgICBpZiAobGFzdE1hcHBpbmcpIHtcbiAgICAgICAgLy8gQXNzb2NpYXRlIHRoZSByZW1haW5pbmcgY29kZSBpbiB0aGUgY3VycmVudCBsaW5lIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgIGFkZE1hcHBpbmdXaXRoQ29kZShsYXN0TWFwcGluZywgc2hpZnROZXh0TGluZSgpKTtcbiAgICAgIH1cbiAgICAgIC8vIGFuZCBhZGQgdGhlIHJlbWFpbmluZyBsaW5lcyB3aXRob3V0IGFueSBtYXBwaW5nXG4gICAgICBub2RlLmFkZChyZW1haW5pbmdMaW5lcy5zcGxpY2UocmVtYWluaW5nTGluZXNJbmRleCkuam9pbihcIlwiKSk7XG4gICAgfVxuXG4gICAgLy8gQ29weSBzb3VyY2VzQ29udGVudCBpbnRvIFNvdXJjZU5vZGVcbiAgICBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlcy5mb3JFYWNoKGZ1bmN0aW9uIChzb3VyY2VGaWxlKSB7XG4gICAgICB2YXIgY29udGVudCA9IGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VDb250ZW50Rm9yKHNvdXJjZUZpbGUpO1xuICAgICAgaWYgKGNvbnRlbnQgIT0gbnVsbCkge1xuICAgICAgICBpZiAoYVJlbGF0aXZlUGF0aCAhPSBudWxsKSB7XG4gICAgICAgICAgc291cmNlRmlsZSA9IHV0aWwuam9pbihhUmVsYXRpdmVQYXRoLCBzb3VyY2VGaWxlKTtcbiAgICAgICAgfVxuICAgICAgICBub2RlLnNldFNvdXJjZUNvbnRlbnQoc291cmNlRmlsZSwgY29udGVudCk7XG4gICAgICB9XG4gICAgfSk7XG5cbiAgICByZXR1cm4gbm9kZTtcblxuICAgIGZ1bmN0aW9uIGFkZE1hcHBpbmdXaXRoQ29kZShtYXBwaW5nLCBjb2RlKSB7XG4gICAgICBpZiAobWFwcGluZyA9PT0gbnVsbCB8fCBtYXBwaW5nLnNvdXJjZSA9PT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIG5vZGUuYWRkKGNvZGUpO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgdmFyIHNvdXJjZSA9IGFSZWxhdGl2ZVBhdGhcbiAgICAgICAgICA/IHV0aWwuam9pbihhUmVsYXRpdmVQYXRoLCBtYXBwaW5nLnNvdXJjZSlcbiAgICAgICAgICA6IG1hcHBpbmcuc291cmNlO1xuICAgICAgICBub2RlLmFkZChuZXcgU291cmNlTm9kZShtYXBwaW5nLm9yaWdpbmFsTGluZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgbWFwcGluZy5vcmlnaW5hbENvbHVtbixcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgc291cmNlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBjb2RlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBtYXBwaW5nLm5hbWUpKTtcbiAgICAgIH1cbiAgICB9XG4gIH07XG5cbi8qKlxuICogQWRkIGEgY2h1bmsgb2YgZ2VuZXJhdGVkIEpTIHRvIHRoaXMgc291cmNlIG5vZGUuXG4gKlxuICogQHBhcmFtIGFDaHVuayBBIHN0cmluZyBzbmlwcGV0IG9mIGdlbmVyYXRlZCBKUyBjb2RlLCBhbm90aGVyIGluc3RhbmNlIG9mXG4gKiAgICAgICAgU291cmNlTm9kZSwgb3IgYW4gYXJyYXkgd2hlcmUgZWFjaCBtZW1iZXIgaXMgb25lIG9mIHRob3NlIHRoaW5ncy5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUuYWRkID0gZnVuY3Rpb24gU291cmNlTm9kZV9hZGQoYUNodW5rKSB7XG4gIGlmIChBcnJheS5pc0FycmF5KGFDaHVuaykpIHtcbiAgICBhQ2h1bmsuZm9yRWFjaChmdW5jdGlvbiAoY2h1bmspIHtcbiAgICAgIHRoaXMuYWRkKGNodW5rKTtcbiAgICB9LCB0aGlzKTtcbiAgfVxuICBlbHNlIGlmIChhQ2h1bmtbaXNTb3VyY2VOb2RlXSB8fCB0eXBlb2YgYUNodW5rID09PSBcInN0cmluZ1wiKSB7XG4gICAgaWYgKGFDaHVuaykge1xuICAgICAgdGhpcy5jaGlsZHJlbi5wdXNoKGFDaHVuayk7XG4gICAgfVxuICB9XG4gIGVsc2Uge1xuICAgIHRocm93IG5ldyBUeXBlRXJyb3IoXG4gICAgICBcIkV4cGVjdGVkIGEgU291cmNlTm9kZSwgc3RyaW5nLCBvciBhbiBhcnJheSBvZiBTb3VyY2VOb2RlcyBhbmQgc3RyaW5ncy4gR290IFwiICsgYUNodW5rXG4gICAgKTtcbiAgfVxuICByZXR1cm4gdGhpcztcbn07XG5cbi8qKlxuICogQWRkIGEgY2h1bmsgb2YgZ2VuZXJhdGVkIEpTIHRvIHRoZSBiZWdpbm5pbmcgb2YgdGhpcyBzb3VyY2Ugbm9kZS5cbiAqXG4gKiBAcGFyYW0gYUNodW5rIEEgc3RyaW5nIHNuaXBwZXQgb2YgZ2VuZXJhdGVkIEpTIGNvZGUsIGFub3RoZXIgaW5zdGFuY2Ugb2ZcbiAqICAgICAgICBTb3VyY2VOb2RlLCBvciBhbiBhcnJheSB3aGVyZSBlYWNoIG1lbWJlciBpcyBvbmUgb2YgdGhvc2UgdGhpbmdzLlxuICovXG5Tb3VyY2VOb2RlLnByb3RvdHlwZS5wcmVwZW5kID0gZnVuY3Rpb24gU291cmNlTm9kZV9wcmVwZW5kKGFDaHVuaykge1xuICBpZiAoQXJyYXkuaXNBcnJheShhQ2h1bmspKSB7XG4gICAgZm9yICh2YXIgaSA9IGFDaHVuay5sZW5ndGgtMTsgaSA+PSAwOyBpLS0pIHtcbiAgICAgIHRoaXMucHJlcGVuZChhQ2h1bmtbaV0pO1xuICAgIH1cbiAgfVxuICBlbHNlIGlmIChhQ2h1bmtbaXNTb3VyY2VOb2RlXSB8fCB0eXBlb2YgYUNodW5rID09PSBcInN0cmluZ1wiKSB7XG4gICAgdGhpcy5jaGlsZHJlbi51bnNoaWZ0KGFDaHVuayk7XG4gIH1cbiAgZWxzZSB7XG4gICAgdGhyb3cgbmV3IFR5cGVFcnJvcihcbiAgICAgIFwiRXhwZWN0ZWQgYSBTb3VyY2VOb2RlLCBzdHJpbmcsIG9yIGFuIGFycmF5IG9mIFNvdXJjZU5vZGVzIGFuZCBzdHJpbmdzLiBHb3QgXCIgKyBhQ2h1bmtcbiAgICApO1xuICB9XG4gIHJldHVybiB0aGlzO1xufTtcblxuLyoqXG4gKiBXYWxrIG92ZXIgdGhlIHRyZWUgb2YgSlMgc25pcHBldHMgaW4gdGhpcyBub2RlIGFuZCBpdHMgY2hpbGRyZW4uIFRoZVxuICogd2Fsa2luZyBmdW5jdGlvbiBpcyBjYWxsZWQgb25jZSBmb3IgZWFjaCBzbmlwcGV0IG9mIEpTIGFuZCBpcyBwYXNzZWQgdGhhdFxuICogc25pcHBldCBhbmQgdGhlIGl0cyBvcmlnaW5hbCBhc3NvY2lhdGVkIHNvdXJjZSdzIGxpbmUvY29sdW1uIGxvY2F0aW9uLlxuICpcbiAqIEBwYXJhbSBhRm4gVGhlIHRyYXZlcnNhbCBmdW5jdGlvbi5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUud2FsayA9IGZ1bmN0aW9uIFNvdXJjZU5vZGVfd2FsayhhRm4pIHtcbiAgdmFyIGNodW5rO1xuICBmb3IgKHZhciBpID0gMCwgbGVuID0gdGhpcy5jaGlsZHJlbi5sZW5ndGg7IGkgPCBsZW47IGkrKykge1xuICAgIGNodW5rID0gdGhpcy5jaGlsZHJlbltpXTtcbiAgICBpZiAoY2h1bmtbaXNTb3VyY2VOb2RlXSkge1xuICAgICAgY2h1bmsud2FsayhhRm4pO1xuICAgIH1cbiAgICBlbHNlIHtcbiAgICAgIGlmIChjaHVuayAhPT0gJycpIHtcbiAgICAgICAgYUZuKGNodW5rLCB7IHNvdXJjZTogdGhpcy5zb3VyY2UsXG4gICAgICAgICAgICAgICAgICAgICBsaW5lOiB0aGlzLmxpbmUsXG4gICAgICAgICAgICAgICAgICAgICBjb2x1bW46IHRoaXMuY29sdW1uLFxuICAgICAgICAgICAgICAgICAgICAgbmFtZTogdGhpcy5uYW1lIH0pO1xuICAgICAgfVxuICAgIH1cbiAgfVxufTtcblxuLyoqXG4gKiBMaWtlIGBTdHJpbmcucHJvdG90eXBlLmpvaW5gIGV4Y2VwdCBmb3IgU291cmNlTm9kZXMuIEluc2VydHMgYGFTdHJgIGJldHdlZW5cbiAqIGVhY2ggb2YgYHRoaXMuY2hpbGRyZW5gLlxuICpcbiAqIEBwYXJhbSBhU2VwIFRoZSBzZXBhcmF0b3IuXG4gKi9cblNvdXJjZU5vZGUucHJvdG90eXBlLmpvaW4gPSBmdW5jdGlvbiBTb3VyY2VOb2RlX2pvaW4oYVNlcCkge1xuICB2YXIgbmV3Q2hpbGRyZW47XG4gIHZhciBpO1xuICB2YXIgbGVuID0gdGhpcy5jaGlsZHJlbi5sZW5ndGg7XG4gIGlmIChsZW4gPiAwKSB7XG4gICAgbmV3Q2hpbGRyZW4gPSBbXTtcbiAgICBmb3IgKGkgPSAwOyBpIDwgbGVuLTE7IGkrKykge1xuICAgICAgbmV3Q2hpbGRyZW4ucHVzaCh0aGlzLmNoaWxkcmVuW2ldKTtcbiAgICAgIG5ld0NoaWxkcmVuLnB1c2goYVNlcCk7XG4gICAgfVxuICAgIG5ld0NoaWxkcmVuLnB1c2godGhpcy5jaGlsZHJlbltpXSk7XG4gICAgdGhpcy5jaGlsZHJlbiA9IG5ld0NoaWxkcmVuO1xuICB9XG4gIHJldHVybiB0aGlzO1xufTtcblxuLyoqXG4gKiBDYWxsIFN0cmluZy5wcm90b3R5cGUucmVwbGFjZSBvbiB0aGUgdmVyeSByaWdodC1tb3N0IHNvdXJjZSBzbmlwcGV0LiBVc2VmdWxcbiAqIGZvciB0cmltbWluZyB3aGl0ZXNwYWNlIGZyb20gdGhlIGVuZCBvZiBhIHNvdXJjZSBub2RlLCBldGMuXG4gKlxuICogQHBhcmFtIGFQYXR0ZXJuIFRoZSBwYXR0ZXJuIHRvIHJlcGxhY2UuXG4gKiBAcGFyYW0gYVJlcGxhY2VtZW50IFRoZSB0aGluZyB0byByZXBsYWNlIHRoZSBwYXR0ZXJuIHdpdGguXG4gKi9cblNvdXJjZU5vZGUucHJvdG90eXBlLnJlcGxhY2VSaWdodCA9IGZ1bmN0aW9uIFNvdXJjZU5vZGVfcmVwbGFjZVJpZ2h0KGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpIHtcbiAgdmFyIGxhc3RDaGlsZCA9IHRoaXMuY2hpbGRyZW5bdGhpcy5jaGlsZHJlbi5sZW5ndGggLSAxXTtcbiAgaWYgKGxhc3RDaGlsZFtpc1NvdXJjZU5vZGVdKSB7XG4gICAgbGFzdENoaWxkLnJlcGxhY2VSaWdodChhUGF0dGVybiwgYVJlcGxhY2VtZW50KTtcbiAgfVxuICBlbHNlIGlmICh0eXBlb2YgbGFzdENoaWxkID09PSAnc3RyaW5nJykge1xuICAgIHRoaXMuY2hpbGRyZW5bdGhpcy5jaGlsZHJlbi5sZW5ndGggLSAxXSA9IGxhc3RDaGlsZC5yZXBsYWNlKGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpO1xuICB9XG4gIGVsc2Uge1xuICAgIHRoaXMuY2hpbGRyZW4ucHVzaCgnJy5yZXBsYWNlKGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpKTtcbiAgfVxuICByZXR1cm4gdGhpcztcbn07XG5cbi8qKlxuICogU2V0IHRoZSBzb3VyY2UgY29udGVudCBmb3IgYSBzb3VyY2UgZmlsZS4gVGhpcyB3aWxsIGJlIGFkZGVkIHRvIHRoZSBTb3VyY2VNYXBHZW5lcmF0b3JcbiAqIGluIHRoZSBzb3VyY2VzQ29udGVudCBmaWVsZC5cbiAqXG4gKiBAcGFyYW0gYVNvdXJjZUZpbGUgVGhlIGZpbGVuYW1lIG9mIHRoZSBzb3VyY2UgZmlsZVxuICogQHBhcmFtIGFTb3VyY2VDb250ZW50IFRoZSBjb250ZW50IG9mIHRoZSBzb3VyY2UgZmlsZVxuICovXG5Tb3VyY2VOb2RlLnByb3RvdHlwZS5zZXRTb3VyY2VDb250ZW50ID1cbiAgZnVuY3Rpb24gU291cmNlTm9kZV9zZXRTb3VyY2VDb250ZW50KGFTb3VyY2VGaWxlLCBhU291cmNlQ29udGVudCkge1xuICAgIHRoaXMuc291cmNlQ29udGVudHNbdXRpbC50b1NldFN0cmluZyhhU291cmNlRmlsZSldID0gYVNvdXJjZUNvbnRlbnQ7XG4gIH07XG5cbi8qKlxuICogV2FsayBvdmVyIHRoZSB0cmVlIG9mIFNvdXJjZU5vZGVzLiBUaGUgd2Fsa2luZyBmdW5jdGlvbiBpcyBjYWxsZWQgZm9yIGVhY2hcbiAqIHNvdXJjZSBmaWxlIGNvbnRlbnQgYW5kIGlzIHBhc3NlZCB0aGUgZmlsZW5hbWUgYW5kIHNvdXJjZSBjb250ZW50LlxuICpcbiAqIEBwYXJhbSBhRm4gVGhlIHRyYXZlcnNhbCBmdW5jdGlvbi5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUud2Fsa1NvdXJjZUNvbnRlbnRzID1cbiAgZnVuY3Rpb24gU291cmNlTm9kZV93YWxrU291cmNlQ29udGVudHMoYUZuKSB7XG4gICAgZm9yICh2YXIgaSA9IDAsIGxlbiA9IHRoaXMuY2hpbGRyZW4ubGVuZ3RoOyBpIDwgbGVuOyBpKyspIHtcbiAgICAgIGlmICh0aGlzLmNoaWxkcmVuW2ldW2lzU291cmNlTm9kZV0pIHtcbiAgICAgICAgdGhpcy5jaGlsZHJlbltpXS53YWxrU291cmNlQ29udGVudHMoYUZuKTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICB2YXIgc291cmNlcyA9IE9iamVjdC5rZXlzKHRoaXMuc291cmNlQ29udGVudHMpO1xuICAgIGZvciAodmFyIGkgPSAwLCBsZW4gPSBzb3VyY2VzLmxlbmd0aDsgaSA8IGxlbjsgaSsrKSB7XG4gICAgICBhRm4odXRpbC5mcm9tU2V0U3RyaW5nKHNvdXJjZXNbaV0pLCB0aGlzLnNvdXJjZUNvbnRlbnRzW3NvdXJjZXNbaV1dKTtcbiAgICB9XG4gIH07XG5cbi8qKlxuICogUmV0dXJuIHRoZSBzdHJpbmcgcmVwcmVzZW50YXRpb24gb2YgdGhpcyBzb3VyY2Ugbm9kZS4gV2Fsa3Mgb3ZlciB0aGUgdHJlZVxuICogYW5kIGNvbmNhdGVuYXRlcyBhbGwgdGhlIHZhcmlvdXMgc25pcHBldHMgdG9nZXRoZXIgdG8gb25lIHN0cmluZy5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUudG9TdHJpbmcgPSBmdW5jdGlvbiBTb3VyY2VOb2RlX3RvU3RyaW5nKCkge1xuICB2YXIgc3RyID0gXCJcIjtcbiAgdGhpcy53YWxrKGZ1bmN0aW9uIChjaHVuaykge1xuICAgIHN0ciArPSBjaHVuaztcbiAgfSk7XG4gIHJldHVybiBzdHI7XG59O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIHN0cmluZyByZXByZXNlbnRhdGlvbiBvZiB0aGlzIHNvdXJjZSBub2RlIGFsb25nIHdpdGggYSBzb3VyY2VcbiAqIG1hcC5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUudG9TdHJpbmdXaXRoU291cmNlTWFwID0gZnVuY3Rpb24gU291cmNlTm9kZV90b1N0cmluZ1dpdGhTb3VyY2VNYXAoYUFyZ3MpIHtcbiAgdmFyIGdlbmVyYXRlZCA9IHtcbiAgICBjb2RlOiBcIlwiLFxuICAgIGxpbmU6IDEsXG4gICAgY29sdW1uOiAwXG4gIH07XG4gIHZhciBtYXAgPSBuZXcgU291cmNlTWFwR2VuZXJhdG9yKGFBcmdzKTtcbiAgdmFyIHNvdXJjZU1hcHBpbmdBY3RpdmUgPSBmYWxzZTtcbiAgdmFyIGxhc3RPcmlnaW5hbFNvdXJjZSA9IG51bGw7XG4gIHZhciBsYXN0T3JpZ2luYWxMaW5lID0gbnVsbDtcbiAgdmFyIGxhc3RPcmlnaW5hbENvbHVtbiA9IG51bGw7XG4gIHZhciBsYXN0T3JpZ2luYWxOYW1lID0gbnVsbDtcbiAgdGhpcy53YWxrKGZ1bmN0aW9uIChjaHVuaywgb3JpZ2luYWwpIHtcbiAgICBnZW5lcmF0ZWQuY29kZSArPSBjaHVuaztcbiAgICBpZiAob3JpZ2luYWwuc291cmNlICE9PSBudWxsXG4gICAgICAgICYmIG9yaWdpbmFsLmxpbmUgIT09IG51bGxcbiAgICAgICAgJiYgb3JpZ2luYWwuY29sdW1uICE9PSBudWxsKSB7XG4gICAgICBpZihsYXN0T3JpZ2luYWxTb3VyY2UgIT09IG9yaWdpbmFsLnNvdXJjZVxuICAgICAgICAgfHwgbGFzdE9yaWdpbmFsTGluZSAhPT0gb3JpZ2luYWwubGluZVxuICAgICAgICAgfHwgbGFzdE9yaWdpbmFsQ29sdW1uICE9PSBvcmlnaW5hbC5jb2x1bW5cbiAgICAgICAgIHx8IGxhc3RPcmlnaW5hbE5hbWUgIT09IG9yaWdpbmFsLm5hbWUpIHtcbiAgICAgICAgbWFwLmFkZE1hcHBpbmcoe1xuICAgICAgICAgIHNvdXJjZTogb3JpZ2luYWwuc291cmNlLFxuICAgICAgICAgIG9yaWdpbmFsOiB7XG4gICAgICAgICAgICBsaW5lOiBvcmlnaW5hbC5saW5lLFxuICAgICAgICAgICAgY29sdW1uOiBvcmlnaW5hbC5jb2x1bW5cbiAgICAgICAgICB9LFxuICAgICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgICAgbGluZTogZ2VuZXJhdGVkLmxpbmUsXG4gICAgICAgICAgICBjb2x1bW46IGdlbmVyYXRlZC5jb2x1bW5cbiAgICAgICAgICB9LFxuICAgICAgICAgIG5hbWU6IG9yaWdpbmFsLm5hbWVcbiAgICAgICAgfSk7XG4gICAgICB9XG4gICAgICBsYXN0T3JpZ2luYWxTb3VyY2UgPSBvcmlnaW5hbC5zb3VyY2U7XG4gICAgICBsYXN0T3JpZ2luYWxMaW5lID0gb3JpZ2luYWwubGluZTtcbiAgICAgIGxhc3RPcmlnaW5hbENvbHVtbiA9IG9yaWdpbmFsLmNvbHVtbjtcbiAgICAgIGxhc3RPcmlnaW5hbE5hbWUgPSBvcmlnaW5hbC5uYW1lO1xuICAgICAgc291cmNlTWFwcGluZ0FjdGl2ZSA9IHRydWU7XG4gICAgfSBlbHNlIGlmIChzb3VyY2VNYXBwaW5nQWN0aXZlKSB7XG4gICAgICBtYXAuYWRkTWFwcGluZyh7XG4gICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgIGxpbmU6IGdlbmVyYXRlZC5saW5lLFxuICAgICAgICAgIGNvbHVtbjogZ2VuZXJhdGVkLmNvbHVtblxuICAgICAgICB9XG4gICAgICB9KTtcbiAgICAgIGxhc3RPcmlnaW5hbFNvdXJjZSA9IG51bGw7XG4gICAgICBzb3VyY2VNYXBwaW5nQWN0aXZlID0gZmFsc2U7XG4gICAgfVxuICAgIGZvciAodmFyIGlkeCA9IDAsIGxlbmd0aCA9IGNodW5rLmxlbmd0aDsgaWR4IDwgbGVuZ3RoOyBpZHgrKykge1xuICAgICAgaWYgKGNodW5rLmNoYXJDb2RlQXQoaWR4KSA9PT0gTkVXTElORV9DT0RFKSB7XG4gICAgICAgIGdlbmVyYXRlZC5saW5lKys7XG4gICAgICAgIGdlbmVyYXRlZC5jb2x1bW4gPSAwO1xuICAgICAgICAvLyBNYXBwaW5ncyBlbmQgYXQgZW9sXG4gICAgICAgIGlmIChpZHggKyAxID09PSBsZW5ndGgpIHtcbiAgICAgICAgICBsYXN0T3JpZ2luYWxTb3VyY2UgPSBudWxsO1xuICAgICAgICAgIHNvdXJjZU1hcHBpbmdBY3RpdmUgPSBmYWxzZTtcbiAgICAgICAgfSBlbHNlIGlmIChzb3VyY2VNYXBwaW5nQWN0aXZlKSB7XG4gICAgICAgICAgbWFwLmFkZE1hcHBpbmcoe1xuICAgICAgICAgICAgc291cmNlOiBvcmlnaW5hbC5zb3VyY2UsXG4gICAgICAgICAgICBvcmlnaW5hbDoge1xuICAgICAgICAgICAgICBsaW5lOiBvcmlnaW5hbC5saW5lLFxuICAgICAgICAgICAgICBjb2x1bW46IG9yaWdpbmFsLmNvbHVtblxuICAgICAgICAgICAgfSxcbiAgICAgICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgICAgICBsaW5lOiBnZW5lcmF0ZWQubGluZSxcbiAgICAgICAgICAgICAgY29sdW1uOiBnZW5lcmF0ZWQuY29sdW1uXG4gICAgICAgICAgICB9LFxuICAgICAgICAgICAgbmFtZTogb3JpZ2luYWwubmFtZVxuICAgICAgICAgIH0pO1xuICAgICAgICB9XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBnZW5lcmF0ZWQuY29sdW1uKys7XG4gICAgICB9XG4gICAgfVxuICB9KTtcbiAgdGhpcy53YWxrU291cmNlQ29udGVudHMoZnVuY3Rpb24gKHNvdXJjZUZpbGUsIHNvdXJjZUNvbnRlbnQpIHtcbiAgICBtYXAuc2V0U291cmNlQ29udGVudChzb3VyY2VGaWxlLCBzb3VyY2VDb250ZW50KTtcbiAgfSk7XG5cbiAgcmV0dXJuIHsgY29kZTogZ2VuZXJhdGVkLmNvZGUsIG1hcDogbWFwIH07XG59O1xuXG5leHBvcnRzLlNvdXJjZU5vZGUgPSBTb3VyY2VOb2RlO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvc291cmNlLW5vZGUuanNcbi8vIG1vZHVsZSBpZCA9IDEwXG4vLyBtb2R1bGUgY2h1bmtzID0gMCJdLCJzb3VyY2VSb290IjoiIn0= \ No newline at end of file diff --git a/resources/app/node_modules/source-map/dist/source-map.js b/resources/app/node_modules/source-map/dist/source-map.js new file mode 100644 index 0000000..b4eb087 --- /dev/null +++ b/resources/app/node_modules/source-map/dist/source-map.js @@ -0,0 +1,3233 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["sourceMap"] = factory(); + else + root["sourceMap"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; + +/******/ // The require function +/******/ function __webpack_require__(moduleId) { + +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; + +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; + +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); + +/******/ // Flag the module as loaded +/******/ module.loaded = true; + +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } + + +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; + +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; + +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; + +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + /* + * Copyright 2009-2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE.txt or: + * http://opensource.org/licenses/BSD-3-Clause + */ + exports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + exports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer; + exports.SourceNode = __webpack_require__(10).SourceNode; + + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var base64VLQ = __webpack_require__(2); + var util = __webpack_require__(4); + var ArraySet = __webpack_require__(5).ArraySet; + var MappingList = __webpack_require__(6).MappingList; + + /** + * An instance of the SourceMapGenerator represents a source map which is + * being built incrementally. You may pass an object with the following + * properties: + * + * - file: The filename of the generated source. + * - sourceRoot: A root for all relative URLs in this source map. + */ + function SourceMapGenerator(aArgs) { + if (!aArgs) { + aArgs = {}; + } + this._file = util.getArg(aArgs, 'file', null); + this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null); + this._skipValidation = util.getArg(aArgs, 'skipValidation', false); + this._sources = new ArraySet(); + this._names = new ArraySet(); + this._mappings = new MappingList(); + this._sourcesContents = null; + } + + SourceMapGenerator.prototype._version = 3; + + /** + * Creates a new SourceMapGenerator based on a SourceMapConsumer + * + * @param aSourceMapConsumer The SourceMap. + */ + SourceMapGenerator.fromSourceMap = + function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) { + var sourceRoot = aSourceMapConsumer.sourceRoot; + var generator = new SourceMapGenerator({ + file: aSourceMapConsumer.file, + sourceRoot: sourceRoot + }); + aSourceMapConsumer.eachMapping(function (mapping) { + var newMapping = { + generated: { + line: mapping.generatedLine, + column: mapping.generatedColumn + } + }; + + if (mapping.source != null) { + newMapping.source = mapping.source; + if (sourceRoot != null) { + newMapping.source = util.relative(sourceRoot, newMapping.source); + } + + newMapping.original = { + line: mapping.originalLine, + column: mapping.originalColumn + }; + + if (mapping.name != null) { + newMapping.name = mapping.name; + } + } + + generator.addMapping(newMapping); + }); + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var sourceRelative = sourceFile; + if (sourceRoot !== null) { + sourceRelative = util.relative(sourceRoot, sourceFile); + } + + if (!generator._sources.has(sourceRelative)) { + generator._sources.add(sourceRelative); + } + + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + generator.setSourceContent(sourceFile, content); + } + }); + return generator; + }; + + /** + * Add a single mapping from original source line and column to the generated + * source's line and column for this source map being created. The mapping + * object should have the following properties: + * + * - generated: An object with the generated line and column positions. + * - original: An object with the original line and column positions. + * - source: The original source file (relative to the sourceRoot). + * - name: An optional original token name for this mapping. + */ + SourceMapGenerator.prototype.addMapping = + function SourceMapGenerator_addMapping(aArgs) { + var generated = util.getArg(aArgs, 'generated'); + var original = util.getArg(aArgs, 'original', null); + var source = util.getArg(aArgs, 'source', null); + var name = util.getArg(aArgs, 'name', null); + + if (!this._skipValidation) { + this._validateMapping(generated, original, source, name); + } + + if (source != null) { + source = String(source); + if (!this._sources.has(source)) { + this._sources.add(source); + } + } + + if (name != null) { + name = String(name); + if (!this._names.has(name)) { + this._names.add(name); + } + } + + this._mappings.add({ + generatedLine: generated.line, + generatedColumn: generated.column, + originalLine: original != null && original.line, + originalColumn: original != null && original.column, + source: source, + name: name + }); + }; + + /** + * Set the source content for a source file. + */ + SourceMapGenerator.prototype.setSourceContent = + function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) { + var source = aSourceFile; + if (this._sourceRoot != null) { + source = util.relative(this._sourceRoot, source); + } + + if (aSourceContent != null) { + // Add the source content to the _sourcesContents map. + // Create a new _sourcesContents map if the property is null. + if (!this._sourcesContents) { + this._sourcesContents = Object.create(null); + } + this._sourcesContents[util.toSetString(source)] = aSourceContent; + } else if (this._sourcesContents) { + // Remove the source file from the _sourcesContents map. + // If the _sourcesContents map is empty, set the property to null. + delete this._sourcesContents[util.toSetString(source)]; + if (Object.keys(this._sourcesContents).length === 0) { + this._sourcesContents = null; + } + } + }; + + /** + * Applies the mappings of a sub-source-map for a specific source file to the + * source map being generated. Each mapping to the supplied source file is + * rewritten using the supplied source map. Note: The resolution for the + * resulting mappings is the minimium of this map and the supplied map. + * + * @param aSourceMapConsumer The source map to be applied. + * @param aSourceFile Optional. The filename of the source file. + * If omitted, SourceMapConsumer's file property will be used. + * @param aSourceMapPath Optional. The dirname of the path to the source map + * to be applied. If relative, it is relative to the SourceMapConsumer. + * This parameter is needed when the two source maps aren't in the same + * directory, and the source map to be applied contains relative source + * paths. If so, those relative source paths need to be rewritten + * relative to the SourceMapGenerator. + */ + SourceMapGenerator.prototype.applySourceMap = + function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) { + var sourceFile = aSourceFile; + // If aSourceFile is omitted, we will use the file property of the SourceMap + if (aSourceFile == null) { + if (aSourceMapConsumer.file == null) { + throw new Error( + 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' + + 'or the source map\'s "file" property. Both were omitted.' + ); + } + sourceFile = aSourceMapConsumer.file; + } + var sourceRoot = this._sourceRoot; + // Make "sourceFile" relative if an absolute Url is passed. + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + // Applying the SourceMap can add and remove items from the sources and + // the names array. + var newSources = new ArraySet(); + var newNames = new ArraySet(); + + // Find mappings for the "sourceFile" + this._mappings.unsortedForEach(function (mapping) { + if (mapping.source === sourceFile && mapping.originalLine != null) { + // Check if it can be mapped by the source map, then update the mapping. + var original = aSourceMapConsumer.originalPositionFor({ + line: mapping.originalLine, + column: mapping.originalColumn + }); + if (original.source != null) { + // Copy mapping + mapping.source = original.source; + if (aSourceMapPath != null) { + mapping.source = util.join(aSourceMapPath, mapping.source) + } + if (sourceRoot != null) { + mapping.source = util.relative(sourceRoot, mapping.source); + } + mapping.originalLine = original.line; + mapping.originalColumn = original.column; + if (original.name != null) { + mapping.name = original.name; + } + } + } + + var source = mapping.source; + if (source != null && !newSources.has(source)) { + newSources.add(source); + } + + var name = mapping.name; + if (name != null && !newNames.has(name)) { + newNames.add(name); + } + + }, this); + this._sources = newSources; + this._names = newNames; + + // Copy sourcesContents of applied map. + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aSourceMapPath != null) { + sourceFile = util.join(aSourceMapPath, sourceFile); + } + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + this.setSourceContent(sourceFile, content); + } + }, this); + }; + + /** + * A mapping can have one of the three levels of data: + * + * 1. Just the generated position. + * 2. The Generated position, original position, and original source. + * 3. Generated and original position, original source, as well as a name + * token. + * + * To maintain consistency, we validate that any new mapping being added falls + * in to one of these categories. + */ + SourceMapGenerator.prototype._validateMapping = + function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource, + aName) { + // When aOriginal is truthy but has empty values for .line and .column, + // it is most likely a programmer error. In this case we throw a very + // specific error message to try to guide them the right way. + // For example: https://github.com/Polymer/polymer-bundler/pull/519 + if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') { + throw new Error( + 'original.line and original.column are not numbers -- you probably meant to omit ' + + 'the original mapping entirely and only map the generated position. If so, pass ' + + 'null for the original mapping instead of an object with empty or null values.' + ); + } + + if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aGenerated.line > 0 && aGenerated.column >= 0 + && !aOriginal && !aSource && !aName) { + // Case 1. + return; + } + else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aOriginal && 'line' in aOriginal && 'column' in aOriginal + && aGenerated.line > 0 && aGenerated.column >= 0 + && aOriginal.line > 0 && aOriginal.column >= 0 + && aSource) { + // Cases 2 and 3. + return; + } + else { + throw new Error('Invalid mapping: ' + JSON.stringify({ + generated: aGenerated, + source: aSource, + original: aOriginal, + name: aName + })); + } + }; + + /** + * Serialize the accumulated mappings in to the stream of base 64 VLQs + * specified by the source map format. + */ + SourceMapGenerator.prototype._serializeMappings = + function SourceMapGenerator_serializeMappings() { + var previousGeneratedColumn = 0; + var previousGeneratedLine = 1; + var previousOriginalColumn = 0; + var previousOriginalLine = 0; + var previousName = 0; + var previousSource = 0; + var result = ''; + var next; + var mapping; + var nameIdx; + var sourceIdx; + + var mappings = this._mappings.toArray(); + for (var i = 0, len = mappings.length; i < len; i++) { + mapping = mappings[i]; + next = '' + + if (mapping.generatedLine !== previousGeneratedLine) { + previousGeneratedColumn = 0; + while (mapping.generatedLine !== previousGeneratedLine) { + next += ';'; + previousGeneratedLine++; + } + } + else { + if (i > 0) { + if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) { + continue; + } + next += ','; + } + } + + next += base64VLQ.encode(mapping.generatedColumn + - previousGeneratedColumn); + previousGeneratedColumn = mapping.generatedColumn; + + if (mapping.source != null) { + sourceIdx = this._sources.indexOf(mapping.source); + next += base64VLQ.encode(sourceIdx - previousSource); + previousSource = sourceIdx; + + // lines are stored 0-based in SourceMap spec version 3 + next += base64VLQ.encode(mapping.originalLine - 1 + - previousOriginalLine); + previousOriginalLine = mapping.originalLine - 1; + + next += base64VLQ.encode(mapping.originalColumn + - previousOriginalColumn); + previousOriginalColumn = mapping.originalColumn; + + if (mapping.name != null) { + nameIdx = this._names.indexOf(mapping.name); + next += base64VLQ.encode(nameIdx - previousName); + previousName = nameIdx; + } + } + + result += next; + } + + return result; + }; + + SourceMapGenerator.prototype._generateSourcesContent = + function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) { + return aSources.map(function (source) { + if (!this._sourcesContents) { + return null; + } + if (aSourceRoot != null) { + source = util.relative(aSourceRoot, source); + } + var key = util.toSetString(source); + return Object.prototype.hasOwnProperty.call(this._sourcesContents, key) + ? this._sourcesContents[key] + : null; + }, this); + }; + + /** + * Externalize the source map. + */ + SourceMapGenerator.prototype.toJSON = + function SourceMapGenerator_toJSON() { + var map = { + version: this._version, + sources: this._sources.toArray(), + names: this._names.toArray(), + mappings: this._serializeMappings() + }; + if (this._file != null) { + map.file = this._file; + } + if (this._sourceRoot != null) { + map.sourceRoot = this._sourceRoot; + } + if (this._sourcesContents) { + map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot); + } + + return map; + }; + + /** + * Render the source map being generated to a string. + */ + SourceMapGenerator.prototype.toString = + function SourceMapGenerator_toString() { + return JSON.stringify(this.toJSON()); + }; + + exports.SourceMapGenerator = SourceMapGenerator; + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + * + * Based on the Base 64 VLQ implementation in Closure Compiler: + * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java + * + * Copyright 2011 The Closure Compiler Authors. All rights reserved. + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above + * copyright notice, this list of conditions and the following + * disclaimer in the documentation and/or other materials provided + * with the distribution. + * * Neither the name of Google Inc. nor the names of its + * contributors may be used to endorse or promote products derived + * from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + + var base64 = __webpack_require__(3); + + // A single base 64 digit can contain 6 bits of data. For the base 64 variable + // length quantities we use in the source map spec, the first bit is the sign, + // the next four bits are the actual value, and the 6th bit is the + // continuation bit. The continuation bit tells us whether there are more + // digits in this value following this digit. + // + // Continuation + // | Sign + // | | + // V V + // 101011 + + var VLQ_BASE_SHIFT = 5; + + // binary: 100000 + var VLQ_BASE = 1 << VLQ_BASE_SHIFT; + + // binary: 011111 + var VLQ_BASE_MASK = VLQ_BASE - 1; + + // binary: 100000 + var VLQ_CONTINUATION_BIT = VLQ_BASE; + + /** + * Converts from a two-complement value to a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary) + * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary) + */ + function toVLQSigned(aValue) { + return aValue < 0 + ? ((-aValue) << 1) + 1 + : (aValue << 1) + 0; + } + + /** + * Converts to a two-complement value from a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1 + * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2 + */ + function fromVLQSigned(aValue) { + var isNegative = (aValue & 1) === 1; + var shifted = aValue >> 1; + return isNegative + ? -shifted + : shifted; + } + + /** + * Returns the base 64 VLQ encoded value. + */ + exports.encode = function base64VLQ_encode(aValue) { + var encoded = ""; + var digit; + + var vlq = toVLQSigned(aValue); + + do { + digit = vlq & VLQ_BASE_MASK; + vlq >>>= VLQ_BASE_SHIFT; + if (vlq > 0) { + // There are still more digits in this value, so we must make sure the + // continuation bit is marked. + digit |= VLQ_CONTINUATION_BIT; + } + encoded += base64.encode(digit); + } while (vlq > 0); + + return encoded; + }; + + /** + * Decodes the next base 64 VLQ value from the given string and returns the + * value and the rest of the string via the out parameter. + */ + exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) { + var strLen = aStr.length; + var result = 0; + var shift = 0; + var continuation, digit; + + do { + if (aIndex >= strLen) { + throw new Error("Expected more digits in base 64 VLQ value."); + } + + digit = base64.decode(aStr.charCodeAt(aIndex++)); + if (digit === -1) { + throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1)); + } + + continuation = !!(digit & VLQ_CONTINUATION_BIT); + digit &= VLQ_BASE_MASK; + result = result + (digit << shift); + shift += VLQ_BASE_SHIFT; + } while (continuation); + + aOutParam.value = fromVLQSigned(result); + aOutParam.rest = aIndex; + }; + + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split(''); + + /** + * Encode an integer in the range of 0 to 63 to a single base 64 digit. + */ + exports.encode = function (number) { + if (0 <= number && number < intToCharMap.length) { + return intToCharMap[number]; + } + throw new TypeError("Must be between 0 and 63: " + number); + }; + + /** + * Decode a single base 64 character code digit to an integer. Returns -1 on + * failure. + */ + exports.decode = function (charCode) { + var bigA = 65; // 'A' + var bigZ = 90; // 'Z' + + var littleA = 97; // 'a' + var littleZ = 122; // 'z' + + var zero = 48; // '0' + var nine = 57; // '9' + + var plus = 43; // '+' + var slash = 47; // '/' + + var littleOffset = 26; + var numberOffset = 52; + + // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ + if (bigA <= charCode && charCode <= bigZ) { + return (charCode - bigA); + } + + // 26 - 51: abcdefghijklmnopqrstuvwxyz + if (littleA <= charCode && charCode <= littleZ) { + return (charCode - littleA + littleOffset); + } + + // 52 - 61: 0123456789 + if (zero <= charCode && charCode <= nine) { + return (charCode - zero + numberOffset); + } + + // 62: + + if (charCode == plus) { + return 62; + } + + // 63: / + if (charCode == slash) { + return 63; + } + + // Invalid base64 digit. + return -1; + }; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + /** + * This is a helper function for getting values from parameter/options + * objects. + * + * @param args The object we are extracting values from + * @param name The name of the property we are getting. + * @param defaultValue An optional value to return if the property is missing + * from the object. If this is not specified and the property is missing, an + * error will be thrown. + */ + function getArg(aArgs, aName, aDefaultValue) { + if (aName in aArgs) { + return aArgs[aName]; + } else if (arguments.length === 3) { + return aDefaultValue; + } else { + throw new Error('"' + aName + '" is a required argument.'); + } + } + exports.getArg = getArg; + + var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/; + var dataUrlRegexp = /^data:.+\,.+$/; + + function urlParse(aUrl) { + var match = aUrl.match(urlRegexp); + if (!match) { + return null; + } + return { + scheme: match[1], + auth: match[2], + host: match[3], + port: match[4], + path: match[5] + }; + } + exports.urlParse = urlParse; + + function urlGenerate(aParsedUrl) { + var url = ''; + if (aParsedUrl.scheme) { + url += aParsedUrl.scheme + ':'; + } + url += '//'; + if (aParsedUrl.auth) { + url += aParsedUrl.auth + '@'; + } + if (aParsedUrl.host) { + url += aParsedUrl.host; + } + if (aParsedUrl.port) { + url += ":" + aParsedUrl.port + } + if (aParsedUrl.path) { + url += aParsedUrl.path; + } + return url; + } + exports.urlGenerate = urlGenerate; + + /** + * Normalizes a path, or the path portion of a URL: + * + * - Replaces consecutive slashes with one slash. + * - Removes unnecessary '.' parts. + * - Removes unnecessary '<dir>/..' parts. + * + * Based on code in the Node.js 'path' core module. + * + * @param aPath The path or url to normalize. + */ + function normalize(aPath) { + var path = aPath; + var url = urlParse(aPath); + if (url) { + if (!url.path) { + return aPath; + } + path = url.path; + } + var isAbsolute = exports.isAbsolute(path); + + var parts = path.split(/\/+/); + for (var part, up = 0, i = parts.length - 1; i >= 0; i--) { + part = parts[i]; + if (part === '.') { + parts.splice(i, 1); + } else if (part === '..') { + up++; + } else if (up > 0) { + if (part === '') { + // The first part is blank if the path is absolute. Trying to go + // above the root is a no-op. Therefore we can remove all '..' parts + // directly after the root. + parts.splice(i + 1, up); + up = 0; + } else { + parts.splice(i, 2); + up--; + } + } + } + path = parts.join('/'); + + if (path === '') { + path = isAbsolute ? '/' : '.'; + } + + if (url) { + url.path = path; + return urlGenerate(url); + } + return path; + } + exports.normalize = normalize; + + /** + * Joins two paths/URLs. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be joined with the root. + * + * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a + * scheme-relative URL: Then the scheme of aRoot, if any, is prepended + * first. + * - Otherwise aPath is a path. If aRoot is a URL, then its path portion + * is updated with the result and aRoot is returned. Otherwise the result + * is returned. + * - If aPath is absolute, the result is aPath. + * - Otherwise the two paths are joined with a slash. + * - Joining for example 'http://' and 'www.example.com' is also supported. + */ + function join(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + if (aPath === "") { + aPath = "."; + } + var aPathUrl = urlParse(aPath); + var aRootUrl = urlParse(aRoot); + if (aRootUrl) { + aRoot = aRootUrl.path || '/'; + } + + // `join(foo, '//www.example.org')` + if (aPathUrl && !aPathUrl.scheme) { + if (aRootUrl) { + aPathUrl.scheme = aRootUrl.scheme; + } + return urlGenerate(aPathUrl); + } + + if (aPathUrl || aPath.match(dataUrlRegexp)) { + return aPath; + } + + // `join('http://', 'www.example.com')` + if (aRootUrl && !aRootUrl.host && !aRootUrl.path) { + aRootUrl.host = aPath; + return urlGenerate(aRootUrl); + } + + var joined = aPath.charAt(0) === '/' + ? aPath + : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath); + + if (aRootUrl) { + aRootUrl.path = joined; + return urlGenerate(aRootUrl); + } + return joined; + } + exports.join = join; + + exports.isAbsolute = function (aPath) { + return aPath.charAt(0) === '/' || urlRegexp.test(aPath); + }; + + /** + * Make a path relative to a URL or another path. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be made relative to aRoot. + */ + function relative(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + + aRoot = aRoot.replace(/\/$/, ''); + + // It is possible for the path to be above the root. In this case, simply + // checking whether the root is a prefix of the path won't work. Instead, we + // need to remove components from the root one by one, until either we find + // a prefix that fits, or we run out of components to remove. + var level = 0; + while (aPath.indexOf(aRoot + '/') !== 0) { + var index = aRoot.lastIndexOf("/"); + if (index < 0) { + return aPath; + } + + // If the only part of the root that is left is the scheme (i.e. http://, + // file:///, etc.), one or more slashes (/), or simply nothing at all, we + // have exhausted all components, so the path is not relative to the root. + aRoot = aRoot.slice(0, index); + if (aRoot.match(/^([^\/]+:\/)?\/*$/)) { + return aPath; + } + + ++level; + } + + // Make sure we add a "../" for each component we removed from the root. + return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1); + } + exports.relative = relative; + + var supportsNullProto = (function () { + var obj = Object.create(null); + return !('__proto__' in obj); + }()); + + function identity (s) { + return s; + } + + /** + * Because behavior goes wacky when you set `__proto__` on objects, we + * have to prefix all the strings in our set with an arbitrary character. + * + * See https://github.com/mozilla/source-map/pull/31 and + * https://github.com/mozilla/source-map/issues/30 + * + * @param String aStr + */ + function toSetString(aStr) { + if (isProtoString(aStr)) { + return '$' + aStr; + } + + return aStr; + } + exports.toSetString = supportsNullProto ? identity : toSetString; + + function fromSetString(aStr) { + if (isProtoString(aStr)) { + return aStr.slice(1); + } + + return aStr; + } + exports.fromSetString = supportsNullProto ? identity : fromSetString; + + function isProtoString(s) { + if (!s) { + return false; + } + + var length = s.length; + + if (length < 9 /* "__proto__".length */) { + return false; + } + + if (s.charCodeAt(length - 1) !== 95 /* '_' */ || + s.charCodeAt(length - 2) !== 95 /* '_' */ || + s.charCodeAt(length - 3) !== 111 /* 'o' */ || + s.charCodeAt(length - 4) !== 116 /* 't' */ || + s.charCodeAt(length - 5) !== 111 /* 'o' */ || + s.charCodeAt(length - 6) !== 114 /* 'r' */ || + s.charCodeAt(length - 7) !== 112 /* 'p' */ || + s.charCodeAt(length - 8) !== 95 /* '_' */ || + s.charCodeAt(length - 9) !== 95 /* '_' */) { + return false; + } + + for (var i = length - 10; i >= 0; i--) { + if (s.charCodeAt(i) !== 36 /* '$' */) { + return false; + } + } + + return true; + } + + /** + * Comparator between two mappings where the original positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same original source/line/column, but different generated + * line and column the same. Useful when searching for a mapping with a + * stubbed out mapping. + */ + function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) { + var cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0 || onlyCompareOriginal) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByOriginalPositions = compareByOriginalPositions; + + /** + * Comparator between two mappings with deflated source and name indices where + * the generated positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same generated line and column, but different + * source/name/original line and column the same. Useful when searching for a + * mapping with a stubbed out mapping. + */ + function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0 || onlyCompareGenerated) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated; + + function strcmp(aStr1, aStr2) { + if (aStr1 === aStr2) { + return 0; + } + + if (aStr1 === null) { + return 1; // aStr2 !== null + } + + if (aStr2 === null) { + return -1; // aStr1 !== null + } + + if (aStr1 > aStr2) { + return 1; + } + + return -1; + } + + /** + * Comparator between two mappings with inflated source and name strings where + * the generated positions are compared. + */ + function compareByGeneratedPositionsInflated(mappingA, mappingB) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated; + + /** + * Strip any JSON XSSI avoidance prefix from the string (as documented + * in the source maps specification), and then parse the string as + * JSON. + */ + function parseSourceMapInput(str) { + return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, '')); + } + exports.parseSourceMapInput = parseSourceMapInput; + + /** + * Compute the URL of a source given the the source root, the source's + * URL, and the source map's URL. + */ + function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) { + sourceURL = sourceURL || ''; + + if (sourceRoot) { + // This follows what Chrome does. + if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') { + sourceRoot += '/'; + } + // The spec says: + // Line 4: An optional source root, useful for relocating source + // files on a server or removing repeated values in the + // “sources” entry. This value is prepended to the individual + // entries in the “source” field. + sourceURL = sourceRoot + sourceURL; + } + + // Historically, SourceMapConsumer did not take the sourceMapURL as + // a parameter. This mode is still somewhat supported, which is why + // this code block is conditional. However, it's preferable to pass + // the source map URL to SourceMapConsumer, so that this function + // can implement the source URL resolution algorithm as outlined in + // the spec. This block is basically the equivalent of: + // new URL(sourceURL, sourceMapURL).toString() + // ... except it avoids using URL, which wasn't available in the + // older releases of node still supported by this library. + // + // The spec says: + // If the sources are not absolute URLs after prepending of the + // “sourceRoot”, the sources are resolved relative to the + // SourceMap (like resolving script src in a html document). + if (sourceMapURL) { + var parsed = urlParse(sourceMapURL); + if (!parsed) { + throw new Error("sourceMapURL could not be parsed"); + } + if (parsed.path) { + // Strip the last path component, but keep the "/". + var index = parsed.path.lastIndexOf('/'); + if (index >= 0) { + parsed.path = parsed.path.substring(0, index + 1); + } + } + sourceURL = join(urlGenerate(parsed), sourceURL); + } + + return normalize(sourceURL); + } + exports.computeSourceURL = computeSourceURL; + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var has = Object.prototype.hasOwnProperty; + var hasNativeMap = typeof Map !== "undefined"; + + /** + * A data structure which is a combination of an array and a set. Adding a new + * member is O(1), testing for membership is O(1), and finding the index of an + * element is O(1). Removing elements from the set is not supported. Only + * strings are supported for membership. + */ + function ArraySet() { + this._array = []; + this._set = hasNativeMap ? new Map() : Object.create(null); + } + + /** + * Static method for creating ArraySet instances from an existing array. + */ + ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) { + var set = new ArraySet(); + for (var i = 0, len = aArray.length; i < len; i++) { + set.add(aArray[i], aAllowDuplicates); + } + return set; + }; + + /** + * Return how many unique items are in this ArraySet. If duplicates have been + * added, than those do not count towards the size. + * + * @returns Number + */ + ArraySet.prototype.size = function ArraySet_size() { + return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length; + }; + + /** + * Add the given string to this set. + * + * @param String aStr + */ + ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) { + var sStr = hasNativeMap ? aStr : util.toSetString(aStr); + var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr); + var idx = this._array.length; + if (!isDuplicate || aAllowDuplicates) { + this._array.push(aStr); + } + if (!isDuplicate) { + if (hasNativeMap) { + this._set.set(aStr, idx); + } else { + this._set[sStr] = idx; + } + } + }; + + /** + * Is the given string a member of this set? + * + * @param String aStr + */ + ArraySet.prototype.has = function ArraySet_has(aStr) { + if (hasNativeMap) { + return this._set.has(aStr); + } else { + var sStr = util.toSetString(aStr); + return has.call(this._set, sStr); + } + }; + + /** + * What is the index of the given string in the array? + * + * @param String aStr + */ + ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) { + if (hasNativeMap) { + var idx = this._set.get(aStr); + if (idx >= 0) { + return idx; + } + } else { + var sStr = util.toSetString(aStr); + if (has.call(this._set, sStr)) { + return this._set[sStr]; + } + } + + throw new Error('"' + aStr + '" is not in the set.'); + }; + + /** + * What is the element at the given index? + * + * @param Number aIdx + */ + ArraySet.prototype.at = function ArraySet_at(aIdx) { + if (aIdx >= 0 && aIdx < this._array.length) { + return this._array[aIdx]; + } + throw new Error('No element indexed by ' + aIdx); + }; + + /** + * Returns the array representation of this set (which has the proper indices + * indicated by indexOf). Note that this is a copy of the internal array used + * for storing the members so that no one can mess with internal state. + */ + ArraySet.prototype.toArray = function ArraySet_toArray() { + return this._array.slice(); + }; + + exports.ArraySet = ArraySet; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2014 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + + /** + * Determine whether mappingB is after mappingA with respect to generated + * position. + */ + function generatedPositionAfter(mappingA, mappingB) { + // Optimized for most common case + var lineA = mappingA.generatedLine; + var lineB = mappingB.generatedLine; + var columnA = mappingA.generatedColumn; + var columnB = mappingB.generatedColumn; + return lineB > lineA || lineB == lineA && columnB >= columnA || + util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0; + } + + /** + * A data structure to provide a sorted view of accumulated mappings in a + * performance conscious manner. It trades a neglibable overhead in general + * case for a large speedup in case of mappings being added in order. + */ + function MappingList() { + this._array = []; + this._sorted = true; + // Serves as infimum + this._last = {generatedLine: -1, generatedColumn: 0}; + } + + /** + * Iterate through internal items. This method takes the same arguments that + * `Array.prototype.forEach` takes. + * + * NOTE: The order of the mappings is NOT guaranteed. + */ + MappingList.prototype.unsortedForEach = + function MappingList_forEach(aCallback, aThisArg) { + this._array.forEach(aCallback, aThisArg); + }; + + /** + * Add the given source mapping. + * + * @param Object aMapping + */ + MappingList.prototype.add = function MappingList_add(aMapping) { + if (generatedPositionAfter(this._last, aMapping)) { + this._last = aMapping; + this._array.push(aMapping); + } else { + this._sorted = false; + this._array.push(aMapping); + } + }; + + /** + * Returns the flat, sorted array of mappings. The mappings are sorted by + * generated position. + * + * WARNING: This method returns internal data without copying, for + * performance. The return value must NOT be mutated, and should be treated as + * an immutable borrow. If you want to take ownership, you must make your own + * copy. + */ + MappingList.prototype.toArray = function MappingList_toArray() { + if (!this._sorted) { + this._array.sort(util.compareByGeneratedPositionsInflated); + this._sorted = true; + } + return this._array; + }; + + exports.MappingList = MappingList; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var binarySearch = __webpack_require__(8); + var ArraySet = __webpack_require__(5).ArraySet; + var base64VLQ = __webpack_require__(2); + var quickSort = __webpack_require__(9).quickSort; + + function SourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + return sourceMap.sections != null + ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL) + : new BasicSourceMapConsumer(sourceMap, aSourceMapURL); + } + + SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) { + return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL); + } + + /** + * The version of the source mapping spec that we are consuming. + */ + SourceMapConsumer.prototype._version = 3; + + // `__generatedMappings` and `__originalMappings` are arrays that hold the + // parsed mapping coordinates from the source map's "mappings" attribute. They + // are lazily instantiated, accessed via the `_generatedMappings` and + // `_originalMappings` getters respectively, and we only parse the mappings + // and create these arrays once queried for a source location. We jump through + // these hoops because there can be many thousands of mappings, and parsing + // them is expensive, so we only want to do it if we must. + // + // Each object in the arrays is of the form: + // + // { + // generatedLine: The line number in the generated code, + // generatedColumn: The column number in the generated code, + // source: The path to the original source file that generated this + // chunk of code, + // originalLine: The line number in the original source that + // corresponds to this chunk of generated code, + // originalColumn: The column number in the original source that + // corresponds to this chunk of generated code, + // name: The name of the original symbol which generated this chunk of + // code. + // } + // + // All properties except for `generatedLine` and `generatedColumn` can be + // `null`. + // + // `_generatedMappings` is ordered by the generated positions. + // + // `_originalMappings` is ordered by the original positions. + + SourceMapConsumer.prototype.__generatedMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__generatedMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__generatedMappings; + } + }); + + SourceMapConsumer.prototype.__originalMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__originalMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__originalMappings; + } + }); + + SourceMapConsumer.prototype._charIsMappingSeparator = + function SourceMapConsumer_charIsMappingSeparator(aStr, index) { + var c = aStr.charAt(index); + return c === ";" || c === ","; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + SourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + throw new Error("Subclasses must implement _parseMappings"); + }; + + SourceMapConsumer.GENERATED_ORDER = 1; + SourceMapConsumer.ORIGINAL_ORDER = 2; + + SourceMapConsumer.GREATEST_LOWER_BOUND = 1; + SourceMapConsumer.LEAST_UPPER_BOUND = 2; + + /** + * Iterate over each mapping between an original source/line/column and a + * generated line/column in this source map. + * + * @param Function aCallback + * The function that is called with each mapping. + * @param Object aContext + * Optional. If specified, this object will be the value of `this` every + * time that `aCallback` is called. + * @param aOrder + * Either `SourceMapConsumer.GENERATED_ORDER` or + * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to + * iterate over the mappings sorted by the generated file's line/column + * order or the original's source/line/column order, respectively. Defaults to + * `SourceMapConsumer.GENERATED_ORDER`. + */ + SourceMapConsumer.prototype.eachMapping = + function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) { + var context = aContext || null; + var order = aOrder || SourceMapConsumer.GENERATED_ORDER; + + var mappings; + switch (order) { + case SourceMapConsumer.GENERATED_ORDER: + mappings = this._generatedMappings; + break; + case SourceMapConsumer.ORIGINAL_ORDER: + mappings = this._originalMappings; + break; + default: + throw new Error("Unknown order of iteration."); + } + + var sourceRoot = this.sourceRoot; + mappings.map(function (mapping) { + var source = mapping.source === null ? null : this._sources.at(mapping.source); + source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL); + return { + source: source, + generatedLine: mapping.generatedLine, + generatedColumn: mapping.generatedColumn, + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: mapping.name === null ? null : this._names.at(mapping.name) + }; + }, this).forEach(aCallback, context); + }; + + /** + * Returns all generated line and column information for the original source, + * line, and column provided. If no column is provided, returns all mappings + * corresponding to a either the line we are searching for or the next + * closest line that has any mappings. Otherwise, returns all mappings + * corresponding to the given line and either the column we are searching for + * or the next closest column that has any offsets. + * + * The only argument is an object with the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number is 1-based. + * - column: Optional. the column number in the original source. + * The column number is 0-based. + * + * and an array of objects is returned, each with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + SourceMapConsumer.prototype.allGeneratedPositionsFor = + function SourceMapConsumer_allGeneratedPositionsFor(aArgs) { + var line = util.getArg(aArgs, 'line'); + + // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping + // returns the index of the closest mapping less than the needle. By + // setting needle.originalColumn to 0, we thus find the last mapping for + // the given line, provided such a mapping exists. + var needle = { + source: util.getArg(aArgs, 'source'), + originalLine: line, + originalColumn: util.getArg(aArgs, 'column', 0) + }; + + needle.source = this._findSourceIndex(needle.source); + if (needle.source < 0) { + return []; + } + + var mappings = []; + + var index = this._findMapping(needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + binarySearch.LEAST_UPPER_BOUND); + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (aArgs.column === undefined) { + var originalLine = mapping.originalLine; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we found. Since + // mappings are sorted, this is guaranteed to find all mappings for + // the line we found. + while (mapping && mapping.originalLine === originalLine) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } else { + var originalColumn = mapping.originalColumn; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we were searching for. + // Since mappings are sorted, this is guaranteed to find all mappings for + // the line we are searching for. + while (mapping && + mapping.originalLine === line && + mapping.originalColumn == originalColumn) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } + } + + return mappings; + }; + + exports.SourceMapConsumer = SourceMapConsumer; + + /** + * A BasicSourceMapConsumer instance represents a parsed source map which we can + * query for information about the original file positions by giving it a file + * position in the generated source. + * + * The first parameter is the raw source map (either as a JSON string, or + * already parsed to an object). According to the spec, source maps have the + * following attributes: + * + * - version: Which version of the source map spec this map is following. + * - sources: An array of URLs to the original source files. + * - names: An array of identifiers which can be referrenced by individual mappings. + * - sourceRoot: Optional. The URL root from which all sources are relative. + * - sourcesContent: Optional. An array of contents of the original source files. + * - mappings: A string of base64 VLQs which contain the actual mappings. + * - file: Optional. The generated file this source map is associated with. + * + * Here is an example source map, taken from the source map spec[0]: + * + * { + * version : 3, + * file: "out.js", + * sourceRoot : "", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AA,AB;;ABCDE;" + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1# + */ + function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sources = util.getArg(sourceMap, 'sources'); + // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which + // requires the array) to play nice here. + var names = util.getArg(sourceMap, 'names', []); + var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null); + var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null); + var mappings = util.getArg(sourceMap, 'mappings'); + var file = util.getArg(sourceMap, 'file', null); + + // Once again, Sass deviates from the spec and supplies the version as a + // string rather than a number, so we use loose equality checking here. + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + if (sourceRoot) { + sourceRoot = util.normalize(sourceRoot); + } + + sources = sources + .map(String) + // Some source maps produce relative source paths like "./foo.js" instead of + // "foo.js". Normalize these first so that future comparisons will succeed. + // See bugzil.la/1090768. + .map(util.normalize) + // Always ensure that absolute sources are internally stored relative to + // the source root, if the source root is absolute. Not doing this would + // be particularly problematic when the source root is a prefix of the + // source (valid, but why??). See github issue #199 and bugzil.la/1188982. + .map(function (source) { + return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source) + ? util.relative(sourceRoot, source) + : source; + }); + + // Pass `true` below to allow duplicate names and sources. While source maps + // are intended to be compressed and deduplicated, the TypeScript compiler + // sometimes generates source maps with duplicates in them. See Github issue + // #72 and bugzil.la/889492. + this._names = ArraySet.fromArray(names.map(String), true); + this._sources = ArraySet.fromArray(sources, true); + + this._absoluteSources = this._sources.toArray().map(function (s) { + return util.computeSourceURL(sourceRoot, s, aSourceMapURL); + }); + + this.sourceRoot = sourceRoot; + this.sourcesContent = sourcesContent; + this._mappings = mappings; + this._sourceMapURL = aSourceMapURL; + this.file = file; + } + + BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer; + + /** + * Utility function to find the index of a source. Returns -1 if not + * found. + */ + BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) { + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + if (this._sources.has(relativeSource)) { + return this._sources.indexOf(relativeSource); + } + + // Maybe aSource is an absolute URL as returned by |sources|. In + // this case we can't simply undo the transform. + var i; + for (i = 0; i < this._absoluteSources.length; ++i) { + if (this._absoluteSources[i] == aSource) { + return i; + } + } + + return -1; + }; + + /** + * Create a BasicSourceMapConsumer from a SourceMapGenerator. + * + * @param SourceMapGenerator aSourceMap + * The source map that will be consumed. + * @param String aSourceMapURL + * The URL at which the source map can be found (optional) + * @returns BasicSourceMapConsumer + */ + BasicSourceMapConsumer.fromSourceMap = + function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) { + var smc = Object.create(BasicSourceMapConsumer.prototype); + + var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true); + var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true); + smc.sourceRoot = aSourceMap._sourceRoot; + smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(), + smc.sourceRoot); + smc.file = aSourceMap._file; + smc._sourceMapURL = aSourceMapURL; + smc._absoluteSources = smc._sources.toArray().map(function (s) { + return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL); + }); + + // Because we are modifying the entries (by converting string sources and + // names to indices into the sources and names ArraySets), we have to make + // a copy of the entry or else bad things happen. Shared mutable state + // strikes again! See github issue #191. + + var generatedMappings = aSourceMap._mappings.toArray().slice(); + var destGeneratedMappings = smc.__generatedMappings = []; + var destOriginalMappings = smc.__originalMappings = []; + + for (var i = 0, length = generatedMappings.length; i < length; i++) { + var srcMapping = generatedMappings[i]; + var destMapping = new Mapping; + destMapping.generatedLine = srcMapping.generatedLine; + destMapping.generatedColumn = srcMapping.generatedColumn; + + if (srcMapping.source) { + destMapping.source = sources.indexOf(srcMapping.source); + destMapping.originalLine = srcMapping.originalLine; + destMapping.originalColumn = srcMapping.originalColumn; + + if (srcMapping.name) { + destMapping.name = names.indexOf(srcMapping.name); + } + + destOriginalMappings.push(destMapping); + } + + destGeneratedMappings.push(destMapping); + } + + quickSort(smc.__originalMappings, util.compareByOriginalPositions); + + return smc; + }; + + /** + * The version of the source mapping spec that we are consuming. + */ + BasicSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', { + get: function () { + return this._absoluteSources.slice(); + } + }); + + /** + * Provide the JIT with a nice shape / hidden class. + */ + function Mapping() { + this.generatedLine = 0; + this.generatedColumn = 0; + this.source = null; + this.originalLine = null; + this.originalColumn = null; + this.name = null; + } + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + BasicSourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + var generatedLine = 1; + var previousGeneratedColumn = 0; + var previousOriginalLine = 0; + var previousOriginalColumn = 0; + var previousSource = 0; + var previousName = 0; + var length = aStr.length; + var index = 0; + var cachedSegments = {}; + var temp = {}; + var originalMappings = []; + var generatedMappings = []; + var mapping, str, segment, end, value; + + while (index < length) { + if (aStr.charAt(index) === ';') { + generatedLine++; + index++; + previousGeneratedColumn = 0; + } + else if (aStr.charAt(index) === ',') { + index++; + } + else { + mapping = new Mapping(); + mapping.generatedLine = generatedLine; + + // Because each offset is encoded relative to the previous one, + // many segments often have the same encoding. We can exploit this + // fact by caching the parsed variable length fields of each segment, + // allowing us to avoid a second parse if we encounter the same + // segment again. + for (end = index; end < length; end++) { + if (this._charIsMappingSeparator(aStr, end)) { + break; + } + } + str = aStr.slice(index, end); + + segment = cachedSegments[str]; + if (segment) { + index += str.length; + } else { + segment = []; + while (index < end) { + base64VLQ.decode(aStr, index, temp); + value = temp.value; + index = temp.rest; + segment.push(value); + } + + if (segment.length === 2) { + throw new Error('Found a source, but no line and column'); + } + + if (segment.length === 3) { + throw new Error('Found a source and line, but no column'); + } + + cachedSegments[str] = segment; + } + + // Generated column. + mapping.generatedColumn = previousGeneratedColumn + segment[0]; + previousGeneratedColumn = mapping.generatedColumn; + + if (segment.length > 1) { + // Original source. + mapping.source = previousSource + segment[1]; + previousSource += segment[1]; + + // Original line. + mapping.originalLine = previousOriginalLine + segment[2]; + previousOriginalLine = mapping.originalLine; + // Lines are stored 0-based + mapping.originalLine += 1; + + // Original column. + mapping.originalColumn = previousOriginalColumn + segment[3]; + previousOriginalColumn = mapping.originalColumn; + + if (segment.length > 4) { + // Original name. + mapping.name = previousName + segment[4]; + previousName += segment[4]; + } + } + + generatedMappings.push(mapping); + if (typeof mapping.originalLine === 'number') { + originalMappings.push(mapping); + } + } + } + + quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated); + this.__generatedMappings = generatedMappings; + + quickSort(originalMappings, util.compareByOriginalPositions); + this.__originalMappings = originalMappings; + }; + + /** + * Find the mapping that best matches the hypothetical "needle" mapping that + * we are searching for in the given "haystack" of mappings. + */ + BasicSourceMapConsumer.prototype._findMapping = + function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName, + aColumnName, aComparator, aBias) { + // To return the position we are searching for, we must first find the + // mapping for the given position and then return the opposite position it + // points to. Because the mappings are sorted, we can use binary search to + // find the best mapping. + + if (aNeedle[aLineName] <= 0) { + throw new TypeError('Line must be greater than or equal to 1, got ' + + aNeedle[aLineName]); + } + if (aNeedle[aColumnName] < 0) { + throw new TypeError('Column must be greater than or equal to 0, got ' + + aNeedle[aColumnName]); + } + + return binarySearch.search(aNeedle, aMappings, aComparator, aBias); + }; + + /** + * Compute the last column for each generated mapping. The last column is + * inclusive. + */ + BasicSourceMapConsumer.prototype.computeColumnSpans = + function SourceMapConsumer_computeColumnSpans() { + for (var index = 0; index < this._generatedMappings.length; ++index) { + var mapping = this._generatedMappings[index]; + + // Mappings do not contain a field for the last generated columnt. We + // can come up with an optimistic estimate, however, by assuming that + // mappings are contiguous (i.e. given two consecutive mappings, the + // first mapping ends where the second one starts). + if (index + 1 < this._generatedMappings.length) { + var nextMapping = this._generatedMappings[index + 1]; + + if (mapping.generatedLine === nextMapping.generatedLine) { + mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1; + continue; + } + } + + // The last mapping for each line spans the entire line. + mapping.lastGeneratedColumn = Infinity; + } + }; + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + BasicSourceMapConsumer.prototype.originalPositionFor = + function SourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._generatedMappings, + "generatedLine", + "generatedColumn", + util.compareByGeneratedPositionsDeflated, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._generatedMappings[index]; + + if (mapping.generatedLine === needle.generatedLine) { + var source = util.getArg(mapping, 'source', null); + if (source !== null) { + source = this._sources.at(source); + source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL); + } + var name = util.getArg(mapping, 'name', null); + if (name !== null) { + name = this._names.at(name); + } + return { + source: source, + line: util.getArg(mapping, 'originalLine', null), + column: util.getArg(mapping, 'originalColumn', null), + name: name + }; + } + } + + return { + source: null, + line: null, + column: null, + name: null + }; + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + BasicSourceMapConsumer.prototype.hasContentsOfAllSources = + function BasicSourceMapConsumer_hasContentsOfAllSources() { + if (!this.sourcesContent) { + return false; + } + return this.sourcesContent.length >= this._sources.size() && + !this.sourcesContent.some(function (sc) { return sc == null; }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + BasicSourceMapConsumer.prototype.sourceContentFor = + function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + if (!this.sourcesContent) { + return null; + } + + var index = this._findSourceIndex(aSource); + if (index >= 0) { + return this.sourcesContent[index]; + } + + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + var url; + if (this.sourceRoot != null + && (url = util.urlParse(this.sourceRoot))) { + // XXX: file:// URIs and absolute paths lead to unexpected behavior for + // many users. We can help them out when they expect file:// URIs to + // behave like it would if they were running a local HTTP server. See + // https://bugzilla.mozilla.org/show_bug.cgi?id=885597. + var fileUriAbsPath = relativeSource.replace(/^file:\/\//, ""); + if (url.scheme == "file" + && this._sources.has(fileUriAbsPath)) { + return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)] + } + + if ((!url.path || url.path == "/") + && this._sources.has("/" + relativeSource)) { + return this.sourcesContent[this._sources.indexOf("/" + relativeSource)]; + } + } + + // This function is used recursively from + // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we + // don't want to throw if we can't find the source - we just want to + // return null, so we provide a flag to exit gracefully. + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + relativeSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + BasicSourceMapConsumer.prototype.generatedPositionFor = + function SourceMapConsumer_generatedPositionFor(aArgs) { + var source = util.getArg(aArgs, 'source'); + source = this._findSourceIndex(source); + if (source < 0) { + return { + line: null, + column: null, + lastColumn: null + }; + } + + var needle = { + source: source, + originalLine: util.getArg(aArgs, 'line'), + originalColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (mapping.source === needle.source) { + return { + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }; + } + } + + return { + line: null, + column: null, + lastColumn: null + }; + }; + + exports.BasicSourceMapConsumer = BasicSourceMapConsumer; + + /** + * An IndexedSourceMapConsumer instance represents a parsed source map which + * we can query for information. It differs from BasicSourceMapConsumer in + * that it takes "indexed" source maps (i.e. ones with a "sections" field) as + * input. + * + * The first parameter is a raw source map (either as a JSON string, or already + * parsed to an object). According to the spec for indexed source maps, they + * have the following attributes: + * + * - version: Which version of the source map spec this map is following. + * - file: Optional. The generated file this source map is associated with. + * - sections: A list of section definitions. + * + * Each value under the "sections" field has two fields: + * - offset: The offset into the original specified at which this section + * begins to apply, defined as an object with a "line" and "column" + * field. + * - map: A source map definition. This source map could also be indexed, + * but doesn't have to be. + * + * Instead of the "map" field, it's also possible to have a "url" field + * specifying a URL to retrieve a source map from, but that's currently + * unsupported. + * + * Here's an example source map, taken from the source map spec[0], but + * modified to omit a section which uses the "url" field. + * + * { + * version : 3, + * file: "app.js", + * sections: [{ + * offset: {line:100, column:10}, + * map: { + * version : 3, + * file: "section.js", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AAAA,E;;ABCDE;" + * } + * }], + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt + */ + function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sections = util.getArg(sourceMap, 'sections'); + + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + this._sources = new ArraySet(); + this._names = new ArraySet(); + + var lastOffset = { + line: -1, + column: 0 + }; + this._sections = sections.map(function (s) { + if (s.url) { + // The url field will require support for asynchronicity. + // See https://github.com/mozilla/source-map/issues/16 + throw new Error('Support for url field in sections not implemented.'); + } + var offset = util.getArg(s, 'offset'); + var offsetLine = util.getArg(offset, 'line'); + var offsetColumn = util.getArg(offset, 'column'); + + if (offsetLine < lastOffset.line || + (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) { + throw new Error('Section offsets must be ordered and non-overlapping.'); + } + lastOffset = offset; + + return { + generatedOffset: { + // The offset fields are 0-based, but we use 1-based indices when + // encoding/decoding from VLQ. + generatedLine: offsetLine + 1, + generatedColumn: offsetColumn + 1 + }, + consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL) + } + }); + } + + IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer; + + /** + * The version of the source mapping spec that we are consuming. + */ + IndexedSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', { + get: function () { + var sources = []; + for (var i = 0; i < this._sections.length; i++) { + for (var j = 0; j < this._sections[i].consumer.sources.length; j++) { + sources.push(this._sections[i].consumer.sources[j]); + } + } + return sources; + } + }); + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + IndexedSourceMapConsumer.prototype.originalPositionFor = + function IndexedSourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + // Find the section containing the generated position we're trying to map + // to an original position. + var sectionIndex = binarySearch.search(needle, this._sections, + function(needle, section) { + var cmp = needle.generatedLine - section.generatedOffset.generatedLine; + if (cmp) { + return cmp; + } + + return (needle.generatedColumn - + section.generatedOffset.generatedColumn); + }); + var section = this._sections[sectionIndex]; + + if (!section) { + return { + source: null, + line: null, + column: null, + name: null + }; + } + + return section.consumer.originalPositionFor({ + line: needle.generatedLine - + (section.generatedOffset.generatedLine - 1), + column: needle.generatedColumn - + (section.generatedOffset.generatedLine === needle.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + bias: aArgs.bias + }); + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + IndexedSourceMapConsumer.prototype.hasContentsOfAllSources = + function IndexedSourceMapConsumer_hasContentsOfAllSources() { + return this._sections.every(function (s) { + return s.consumer.hasContentsOfAllSources(); + }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + IndexedSourceMapConsumer.prototype.sourceContentFor = + function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + var content = section.consumer.sourceContentFor(aSource, true); + if (content) { + return content; + } + } + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + aSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + IndexedSourceMapConsumer.prototype.generatedPositionFor = + function IndexedSourceMapConsumer_generatedPositionFor(aArgs) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + // Only consider this section if the requested source is in the list of + // sources of the consumer. + if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) { + continue; + } + var generatedPosition = section.consumer.generatedPositionFor(aArgs); + if (generatedPosition) { + var ret = { + line: generatedPosition.line + + (section.generatedOffset.generatedLine - 1), + column: generatedPosition.column + + (section.generatedOffset.generatedLine === generatedPosition.line + ? section.generatedOffset.generatedColumn - 1 + : 0) + }; + return ret; + } + } + + return { + line: null, + column: null + }; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + IndexedSourceMapConsumer.prototype._parseMappings = + function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) { + this.__generatedMappings = []; + this.__originalMappings = []; + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + var sectionMappings = section.consumer._generatedMappings; + for (var j = 0; j < sectionMappings.length; j++) { + var mapping = sectionMappings[j]; + + var source = section.consumer._sources.at(mapping.source); + source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL); + this._sources.add(source); + source = this._sources.indexOf(source); + + var name = null; + if (mapping.name) { + name = section.consumer._names.at(mapping.name); + this._names.add(name); + name = this._names.indexOf(name); + } + + // The mappings coming from the consumer for the section have + // generated positions relative to the start of the section, so we + // need to offset them to be relative to the start of the concatenated + // generated file. + var adjustedMapping = { + source: source, + generatedLine: mapping.generatedLine + + (section.generatedOffset.generatedLine - 1), + generatedColumn: mapping.generatedColumn + + (section.generatedOffset.generatedLine === mapping.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: name + }; + + this.__generatedMappings.push(adjustedMapping); + if (typeof adjustedMapping.originalLine === 'number') { + this.__originalMappings.push(adjustedMapping); + } + } + } + + quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated); + quickSort(this.__originalMappings, util.compareByOriginalPositions); + }; + + exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + exports.GREATEST_LOWER_BOUND = 1; + exports.LEAST_UPPER_BOUND = 2; + + /** + * Recursive implementation of binary search. + * + * @param aLow Indices here and lower do not contain the needle. + * @param aHigh Indices here and higher do not contain the needle. + * @param aNeedle The element being searched for. + * @param aHaystack The non-empty array being searched. + * @param aCompare Function which takes two elements and returns -1, 0, or 1. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + */ + function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) { + // This function terminates when one of the following is true: + // + // 1. We find the exact element we are looking for. + // + // 2. We did not find the exact element, but we can return the index of + // the next-closest element. + // + // 3. We did not find the exact element, and there is no next-closest + // element than the one we are searching for, so we return -1. + var mid = Math.floor((aHigh - aLow) / 2) + aLow; + var cmp = aCompare(aNeedle, aHaystack[mid], true); + if (cmp === 0) { + // Found the element we are looking for. + return mid; + } + else if (cmp > 0) { + // Our needle is greater than aHaystack[mid]. + if (aHigh - mid > 1) { + // The element is in the upper half. + return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias); + } + + // The exact needle element was not found in this haystack. Determine if + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return aHigh < aHaystack.length ? aHigh : -1; + } else { + return mid; + } + } + else { + // Our needle is less than aHaystack[mid]. + if (mid - aLow > 1) { + // The element is in the lower half. + return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias); + } + + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return mid; + } else { + return aLow < 0 ? -1 : aLow; + } + } + } + + /** + * This is an implementation of binary search which will always try and return + * the index of the closest element if there is no exact hit. This is because + * mappings between original and generated line/col pairs are single points, + * and there is an implicit region between each of them, so a miss just means + * that you aren't on the very start of a region. + * + * @param aNeedle The element you are looking for. + * @param aHaystack The array that is being searched. + * @param aCompare A function which takes the needle and an element in the + * array and returns -1, 0, or 1 depending on whether the needle is less + * than, equal to, or greater than the element, respectively. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'. + */ + exports.search = function search(aNeedle, aHaystack, aCompare, aBias) { + if (aHaystack.length === 0) { + return -1; + } + + var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, + aCompare, aBias || exports.GREATEST_LOWER_BOUND); + if (index < 0) { + return -1; + } + + // We have found either the exact element, or the next-closest element than + // the one we are searching for. However, there may be more than one such + // element. Make sure we always return the smallest of these. + while (index - 1 >= 0) { + if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) { + break; + } + --index; + } + + return index; + }; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + // It turns out that some (most?) JavaScript engines don't self-host + // `Array.prototype.sort`. This makes sense because C++ will likely remain + // faster than JS when doing raw CPU-intensive sorting. However, when using a + // custom comparator function, calling back and forth between the VM's C++ and + // JIT'd JS is rather slow *and* loses JIT type information, resulting in + // worse generated code for the comparator function than would be optimal. In + // fact, when sorting with a comparator, these costs outweigh the benefits of + // sorting in C++. By using our own JS-implemented Quick Sort (below), we get + // a ~3500ms mean speed-up in `bench/bench.html`. + + /** + * Swap the elements indexed by `x` and `y` in the array `ary`. + * + * @param {Array} ary + * The array. + * @param {Number} x + * The index of the first item. + * @param {Number} y + * The index of the second item. + */ + function swap(ary, x, y) { + var temp = ary[x]; + ary[x] = ary[y]; + ary[y] = temp; + } + + /** + * Returns a random integer within the range `low .. high` inclusive. + * + * @param {Number} low + * The lower bound on the range. + * @param {Number} high + * The upper bound on the range. + */ + function randomIntInRange(low, high) { + return Math.round(low + (Math.random() * (high - low))); + } + + /** + * The Quick Sort algorithm. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + * @param {Number} p + * Start index of the array + * @param {Number} r + * End index of the array + */ + function doQuickSort(ary, comparator, p, r) { + // If our lower bound is less than our upper bound, we (1) partition the + // array into two pieces and (2) recurse on each half. If it is not, this is + // the empty array and our base case. + + if (p < r) { + // (1) Partitioning. + // + // The partitioning chooses a pivot between `p` and `r` and moves all + // elements that are less than or equal to the pivot to the before it, and + // all the elements that are greater than it after it. The effect is that + // once partition is done, the pivot is in the exact place it will be when + // the array is put in sorted order, and it will not need to be moved + // again. This runs in O(n) time. + + // Always choose a random pivot so that an input array which is reverse + // sorted does not cause O(n^2) running time. + var pivotIndex = randomIntInRange(p, r); + var i = p - 1; + + swap(ary, pivotIndex, r); + var pivot = ary[r]; + + // Immediately after `j` is incremented in this loop, the following hold + // true: + // + // * Every element in `ary[p .. i]` is less than or equal to the pivot. + // + // * Every element in `ary[i+1 .. j-1]` is greater than the pivot. + for (var j = p; j < r; j++) { + if (comparator(ary[j], pivot) <= 0) { + i += 1; + swap(ary, i, j); + } + } + + swap(ary, i + 1, j); + var q = i + 1; + + // (2) Recurse on each half. + + doQuickSort(ary, comparator, p, q - 1); + doQuickSort(ary, comparator, q + 1, r); + } + } + + /** + * Sort the given array in-place with the given comparator function. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + */ + exports.quickSort = function (ary, comparator) { + doQuickSort(ary, comparator, 0, ary.length - 1); + }; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + var util = __webpack_require__(4); + + // Matches a Windows-style `\r\n` newline or a `\n` newline used by all other + // operating systems these days (capturing the result). + var REGEX_NEWLINE = /(\r?\n)/; + + // Newline character code for charCodeAt() comparisons + var NEWLINE_CODE = 10; + + // Private symbol for identifying `SourceNode`s when multiple versions of + // the source-map library are loaded. This MUST NOT CHANGE across + // versions! + var isSourceNode = "$$$isSourceNode$$$"; + + /** + * SourceNodes provide a way to abstract over interpolating/concatenating + * snippets of generated JavaScript source code while maintaining the line and + * column information associated with the original source code. + * + * @param aLine The original line number. + * @param aColumn The original column number. + * @param aSource The original source's filename. + * @param aChunks Optional. An array of strings which are snippets of + * generated JS, or other SourceNodes. + * @param aName The original identifier. + */ + function SourceNode(aLine, aColumn, aSource, aChunks, aName) { + this.children = []; + this.sourceContents = {}; + this.line = aLine == null ? null : aLine; + this.column = aColumn == null ? null : aColumn; + this.source = aSource == null ? null : aSource; + this.name = aName == null ? null : aName; + this[isSourceNode] = true; + if (aChunks != null) this.add(aChunks); + } + + /** + * Creates a SourceNode from generated code and a SourceMapConsumer. + * + * @param aGeneratedCode The generated code + * @param aSourceMapConsumer The SourceMap for the generated code + * @param aRelativePath Optional. The path that relative sources in the + * SourceMapConsumer should be relative to. + */ + SourceNode.fromStringWithSourceMap = + function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) { + // The SourceNode we want to fill with the generated code + // and the SourceMap + var node = new SourceNode(); + + // All even indices of this array are one line of the generated code, + // while all odd indices are the newlines between two adjacent lines + // (since `REGEX_NEWLINE` captures its match). + // Processed fragments are accessed by calling `shiftNextLine`. + var remainingLines = aGeneratedCode.split(REGEX_NEWLINE); + var remainingLinesIndex = 0; + var shiftNextLine = function() { + var lineContents = getNextLine(); + // The last line of a file might not have a newline. + var newLine = getNextLine() || ""; + return lineContents + newLine; + + function getNextLine() { + return remainingLinesIndex < remainingLines.length ? + remainingLines[remainingLinesIndex++] : undefined; + } + }; + + // We need to remember the position of "remainingLines" + var lastGeneratedLine = 1, lastGeneratedColumn = 0; + + // The generate SourceNodes we need a code range. + // To extract it current and last mapping is used. + // Here we store the last mapping. + var lastMapping = null; + + aSourceMapConsumer.eachMapping(function (mapping) { + if (lastMapping !== null) { + // We add the code from "lastMapping" to "mapping": + // First check if there is a new line in between. + if (lastGeneratedLine < mapping.generatedLine) { + // Associate first line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + lastGeneratedLine++; + lastGeneratedColumn = 0; + // The remaining code is added without mapping + } else { + // There is no new line in between. + // Associate the code between "lastGeneratedColumn" and + // "mapping.generatedColumn" with "lastMapping" + var nextLine = remainingLines[remainingLinesIndex] || ''; + var code = nextLine.substr(0, mapping.generatedColumn - + lastGeneratedColumn); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn - + lastGeneratedColumn); + lastGeneratedColumn = mapping.generatedColumn; + addMappingWithCode(lastMapping, code); + // No more remaining code, continue + lastMapping = mapping; + return; + } + } + // We add the generated code until the first mapping + // to the SourceNode without any mapping. + // Each line is added as separate string. + while (lastGeneratedLine < mapping.generatedLine) { + node.add(shiftNextLine()); + lastGeneratedLine++; + } + if (lastGeneratedColumn < mapping.generatedColumn) { + var nextLine = remainingLines[remainingLinesIndex] || ''; + node.add(nextLine.substr(0, mapping.generatedColumn)); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn); + lastGeneratedColumn = mapping.generatedColumn; + } + lastMapping = mapping; + }, this); + // We have processed all mappings. + if (remainingLinesIndex < remainingLines.length) { + if (lastMapping) { + // Associate the remaining code in the current line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + } + // and add the remaining lines without any mapping + node.add(remainingLines.splice(remainingLinesIndex).join("")); + } + + // Copy sourcesContent into SourceNode + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aRelativePath != null) { + sourceFile = util.join(aRelativePath, sourceFile); + } + node.setSourceContent(sourceFile, content); + } + }); + + return node; + + function addMappingWithCode(mapping, code) { + if (mapping === null || mapping.source === undefined) { + node.add(code); + } else { + var source = aRelativePath + ? util.join(aRelativePath, mapping.source) + : mapping.source; + node.add(new SourceNode(mapping.originalLine, + mapping.originalColumn, + source, + code, + mapping.name)); + } + } + }; + + /** + * Add a chunk of generated JS to this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.add = function SourceNode_add(aChunk) { + if (Array.isArray(aChunk)) { + aChunk.forEach(function (chunk) { + this.add(chunk); + }, this); + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + if (aChunk) { + this.children.push(aChunk); + } + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Add a chunk of generated JS to the beginning of this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) { + if (Array.isArray(aChunk)) { + for (var i = aChunk.length-1; i >= 0; i--) { + this.prepend(aChunk[i]); + } + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + this.children.unshift(aChunk); + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Walk over the tree of JS snippets in this node and its children. The + * walking function is called once for each snippet of JS and is passed that + * snippet and the its original associated source's line/column location. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walk = function SourceNode_walk(aFn) { + var chunk; + for (var i = 0, len = this.children.length; i < len; i++) { + chunk = this.children[i]; + if (chunk[isSourceNode]) { + chunk.walk(aFn); + } + else { + if (chunk !== '') { + aFn(chunk, { source: this.source, + line: this.line, + column: this.column, + name: this.name }); + } + } + } + }; + + /** + * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between + * each of `this.children`. + * + * @param aSep The separator. + */ + SourceNode.prototype.join = function SourceNode_join(aSep) { + var newChildren; + var i; + var len = this.children.length; + if (len > 0) { + newChildren = []; + for (i = 0; i < len-1; i++) { + newChildren.push(this.children[i]); + newChildren.push(aSep); + } + newChildren.push(this.children[i]); + this.children = newChildren; + } + return this; + }; + + /** + * Call String.prototype.replace on the very right-most source snippet. Useful + * for trimming whitespace from the end of a source node, etc. + * + * @param aPattern The pattern to replace. + * @param aReplacement The thing to replace the pattern with. + */ + SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) { + var lastChild = this.children[this.children.length - 1]; + if (lastChild[isSourceNode]) { + lastChild.replaceRight(aPattern, aReplacement); + } + else if (typeof lastChild === 'string') { + this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement); + } + else { + this.children.push(''.replace(aPattern, aReplacement)); + } + return this; + }; + + /** + * Set the source content for a source file. This will be added to the SourceMapGenerator + * in the sourcesContent field. + * + * @param aSourceFile The filename of the source file + * @param aSourceContent The content of the source file + */ + SourceNode.prototype.setSourceContent = + function SourceNode_setSourceContent(aSourceFile, aSourceContent) { + this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent; + }; + + /** + * Walk over the tree of SourceNodes. The walking function is called for each + * source file content and is passed the filename and source content. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walkSourceContents = + function SourceNode_walkSourceContents(aFn) { + for (var i = 0, len = this.children.length; i < len; i++) { + if (this.children[i][isSourceNode]) { + this.children[i].walkSourceContents(aFn); + } + } + + var sources = Object.keys(this.sourceContents); + for (var i = 0, len = sources.length; i < len; i++) { + aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]); + } + }; + + /** + * Return the string representation of this source node. Walks over the tree + * and concatenates all the various snippets together to one string. + */ + SourceNode.prototype.toString = function SourceNode_toString() { + var str = ""; + this.walk(function (chunk) { + str += chunk; + }); + return str; + }; + + /** + * Returns the string representation of this source node along with a source + * map. + */ + SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) { + var generated = { + code: "", + line: 1, + column: 0 + }; + var map = new SourceMapGenerator(aArgs); + var sourceMappingActive = false; + var lastOriginalSource = null; + var lastOriginalLine = null; + var lastOriginalColumn = null; + var lastOriginalName = null; + this.walk(function (chunk, original) { + generated.code += chunk; + if (original.source !== null + && original.line !== null + && original.column !== null) { + if(lastOriginalSource !== original.source + || lastOriginalLine !== original.line + || lastOriginalColumn !== original.column + || lastOriginalName !== original.name) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + lastOriginalSource = original.source; + lastOriginalLine = original.line; + lastOriginalColumn = original.column; + lastOriginalName = original.name; + sourceMappingActive = true; + } else if (sourceMappingActive) { + map.addMapping({ + generated: { + line: generated.line, + column: generated.column + } + }); + lastOriginalSource = null; + sourceMappingActive = false; + } + for (var idx = 0, length = chunk.length; idx < length; idx++) { + if (chunk.charCodeAt(idx) === NEWLINE_CODE) { + generated.line++; + generated.column = 0; + // Mappings end at eol + if (idx + 1 === length) { + lastOriginalSource = null; + sourceMappingActive = false; + } else if (sourceMappingActive) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + } else { + generated.column++; + } + } + }); + this.walkSourceContents(function (sourceFile, sourceContent) { + map.setSourceContent(sourceFile, sourceContent); + }); + + return { code: generated.code, map: map }; + }; + + exports.SourceNode = SourceNode; + + +/***/ }) +/******/ ]) +}); +; \ No newline at end of file diff --git a/resources/app/node_modules/source-map/dist/source-map.min.js b/resources/app/node_modules/source-map/dist/source-map.min.js new file mode 100644 index 0000000..c7c72da --- /dev/null +++ b/resources/app/node_modules/source-map/dist/source-map.min.js @@ -0,0 +1,2 @@ +!function(e,n){"object"==typeof exports&&"object"==typeof module?module.exports=n():"function"==typeof define&&define.amd?define([],n):"object"==typeof exports?exports.sourceMap=n():e.sourceMap=n()}(this,function(){return function(e){function n(t){if(r[t])return r[t].exports;var o=r[t]={exports:{},id:t,loaded:!1};return e[t].call(o.exports,o,o.exports,n),o.loaded=!0,o.exports}var r={};return n.m=e,n.c=r,n.p="",n(0)}([function(e,n,r){n.SourceMapGenerator=r(1).SourceMapGenerator,n.SourceMapConsumer=r(7).SourceMapConsumer,n.SourceNode=r(10).SourceNode},function(e,n,r){function t(e){e||(e={}),this._file=i.getArg(e,"file",null),this._sourceRoot=i.getArg(e,"sourceRoot",null),this._skipValidation=i.getArg(e,"skipValidation",!1),this._sources=new s,this._names=new s,this._mappings=new a,this._sourcesContents=null}var o=r(2),i=r(4),s=r(5).ArraySet,a=r(6).MappingList;t.prototype._version=3,t.fromSourceMap=function(e){var n=e.sourceRoot,r=new t({file:e.file,sourceRoot:n});return e.eachMapping(function(e){var t={generated:{line:e.generatedLine,column:e.generatedColumn}};null!=e.source&&(t.source=e.source,null!=n&&(t.source=i.relative(n,t.source)),t.original={line:e.originalLine,column:e.originalColumn},null!=e.name&&(t.name=e.name)),r.addMapping(t)}),e.sources.forEach(function(t){var o=t;null!==n&&(o=i.relative(n,t)),r._sources.has(o)||r._sources.add(o);var s=e.sourceContentFor(t);null!=s&&r.setSourceContent(t,s)}),r},t.prototype.addMapping=function(e){var n=i.getArg(e,"generated"),r=i.getArg(e,"original",null),t=i.getArg(e,"source",null),o=i.getArg(e,"name",null);this._skipValidation||this._validateMapping(n,r,t,o),null!=t&&(t=String(t),this._sources.has(t)||this._sources.add(t)),null!=o&&(o=String(o),this._names.has(o)||this._names.add(o)),this._mappings.add({generatedLine:n.line,generatedColumn:n.column,originalLine:null!=r&&r.line,originalColumn:null!=r&&r.column,source:t,name:o})},t.prototype.setSourceContent=function(e,n){var r=e;null!=this._sourceRoot&&(r=i.relative(this._sourceRoot,r)),null!=n?(this._sourcesContents||(this._sourcesContents=Object.create(null)),this._sourcesContents[i.toSetString(r)]=n):this._sourcesContents&&(delete this._sourcesContents[i.toSetString(r)],0===Object.keys(this._sourcesContents).length&&(this._sourcesContents=null))},t.prototype.applySourceMap=function(e,n,r){var t=n;if(null==n){if(null==e.file)throw new Error('SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, or the source map\'s "file" property. Both were omitted.');t=e.file}var o=this._sourceRoot;null!=o&&(t=i.relative(o,t));var a=new s,u=new s;this._mappings.unsortedForEach(function(n){if(n.source===t&&null!=n.originalLine){var s=e.originalPositionFor({line:n.originalLine,column:n.originalColumn});null!=s.source&&(n.source=s.source,null!=r&&(n.source=i.join(r,n.source)),null!=o&&(n.source=i.relative(o,n.source)),n.originalLine=s.line,n.originalColumn=s.column,null!=s.name&&(n.name=s.name))}var l=n.source;null==l||a.has(l)||a.add(l);var c=n.name;null==c||u.has(c)||u.add(c)},this),this._sources=a,this._names=u,e.sources.forEach(function(n){var t=e.sourceContentFor(n);null!=t&&(null!=r&&(n=i.join(r,n)),null!=o&&(n=i.relative(o,n)),this.setSourceContent(n,t))},this)},t.prototype._validateMapping=function(e,n,r,t){if(n&&"number"!=typeof n.line&&"number"!=typeof n.column)throw new Error("original.line and original.column are not numbers -- you probably meant to omit the original mapping entirely and only map the generated position. If so, pass null for the original mapping instead of an object with empty or null values.");if((!(e&&"line"in e&&"column"in e&&e.line>0&&e.column>=0)||n||r||t)&&!(e&&"line"in e&&"column"in e&&n&&"line"in n&&"column"in n&&e.line>0&&e.column>=0&&n.line>0&&n.column>=0&&r))throw new Error("Invalid mapping: "+JSON.stringify({generated:e,source:r,original:n,name:t}))},t.prototype._serializeMappings=function(){for(var e,n,r,t,s=0,a=1,u=0,l=0,c=0,g=0,p="",h=this._mappings.toArray(),f=0,d=h.length;f<d;f++){if(n=h[f],e="",n.generatedLine!==a)for(s=0;n.generatedLine!==a;)e+=";",a++;else if(f>0){if(!i.compareByGeneratedPositionsInflated(n,h[f-1]))continue;e+=","}e+=o.encode(n.generatedColumn-s),s=n.generatedColumn,null!=n.source&&(t=this._sources.indexOf(n.source),e+=o.encode(t-g),g=t,e+=o.encode(n.originalLine-1-l),l=n.originalLine-1,e+=o.encode(n.originalColumn-u),u=n.originalColumn,null!=n.name&&(r=this._names.indexOf(n.name),e+=o.encode(r-c),c=r)),p+=e}return p},t.prototype._generateSourcesContent=function(e,n){return e.map(function(e){if(!this._sourcesContents)return null;null!=n&&(e=i.relative(n,e));var r=i.toSetString(e);return Object.prototype.hasOwnProperty.call(this._sourcesContents,r)?this._sourcesContents[r]:null},this)},t.prototype.toJSON=function(){var e={version:this._version,sources:this._sources.toArray(),names:this._names.toArray(),mappings:this._serializeMappings()};return null!=this._file&&(e.file=this._file),null!=this._sourceRoot&&(e.sourceRoot=this._sourceRoot),this._sourcesContents&&(e.sourcesContent=this._generateSourcesContent(e.sources,e.sourceRoot)),e},t.prototype.toString=function(){return JSON.stringify(this.toJSON())},n.SourceMapGenerator=t},function(e,n,r){function t(e){return e<0?(-e<<1)+1:(e<<1)+0}function o(e){var n=1===(1&e),r=e>>1;return n?-r:r}var i=r(3),s=5,a=1<<s,u=a-1,l=a;n.encode=function(e){var n,r="",o=t(e);do n=o&u,o>>>=s,o>0&&(n|=l),r+=i.encode(n);while(o>0);return r},n.decode=function(e,n,r){var t,a,c=e.length,g=0,p=0;do{if(n>=c)throw new Error("Expected more digits in base 64 VLQ value.");if(a=i.decode(e.charCodeAt(n++)),a===-1)throw new Error("Invalid base64 digit: "+e.charAt(n-1));t=!!(a&l),a&=u,g+=a<<p,p+=s}while(t);r.value=o(g),r.rest=n}},function(e,n){var r="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".split("");n.encode=function(e){if(0<=e&&e<r.length)return r[e];throw new TypeError("Must be between 0 and 63: "+e)},n.decode=function(e){var n=65,r=90,t=97,o=122,i=48,s=57,a=43,u=47,l=26,c=52;return n<=e&&e<=r?e-n:t<=e&&e<=o?e-t+l:i<=e&&e<=s?e-i+c:e==a?62:e==u?63:-1}},function(e,n){function r(e,n,r){if(n in e)return e[n];if(3===arguments.length)return r;throw new Error('"'+n+'" is a required argument.')}function t(e){var n=e.match(v);return n?{scheme:n[1],auth:n[2],host:n[3],port:n[4],path:n[5]}:null}function o(e){var n="";return e.scheme&&(n+=e.scheme+":"),n+="//",e.auth&&(n+=e.auth+"@"),e.host&&(n+=e.host),e.port&&(n+=":"+e.port),e.path&&(n+=e.path),n}function i(e){var r=e,i=t(e);if(i){if(!i.path)return e;r=i.path}for(var s,a=n.isAbsolute(r),u=r.split(/\/+/),l=0,c=u.length-1;c>=0;c--)s=u[c],"."===s?u.splice(c,1):".."===s?l++:l>0&&(""===s?(u.splice(c+1,l),l=0):(u.splice(c,2),l--));return r=u.join("/"),""===r&&(r=a?"/":"."),i?(i.path=r,o(i)):r}function s(e,n){""===e&&(e="."),""===n&&(n=".");var r=t(n),s=t(e);if(s&&(e=s.path||"/"),r&&!r.scheme)return s&&(r.scheme=s.scheme),o(r);if(r||n.match(y))return n;if(s&&!s.host&&!s.path)return s.host=n,o(s);var a="/"===n.charAt(0)?n:i(e.replace(/\/+$/,"")+"/"+n);return s?(s.path=a,o(s)):a}function a(e,n){""===e&&(e="."),e=e.replace(/\/$/,"");for(var r=0;0!==n.indexOf(e+"/");){var t=e.lastIndexOf("/");if(t<0)return n;if(e=e.slice(0,t),e.match(/^([^\/]+:\/)?\/*$/))return n;++r}return Array(r+1).join("../")+n.substr(e.length+1)}function u(e){return e}function l(e){return g(e)?"$"+e:e}function c(e){return g(e)?e.slice(1):e}function g(e){if(!e)return!1;var n=e.length;if(n<9)return!1;if(95!==e.charCodeAt(n-1)||95!==e.charCodeAt(n-2)||111!==e.charCodeAt(n-3)||116!==e.charCodeAt(n-4)||111!==e.charCodeAt(n-5)||114!==e.charCodeAt(n-6)||112!==e.charCodeAt(n-7)||95!==e.charCodeAt(n-8)||95!==e.charCodeAt(n-9))return!1;for(var r=n-10;r>=0;r--)if(36!==e.charCodeAt(r))return!1;return!0}function p(e,n,r){var t=f(e.source,n.source);return 0!==t?t:(t=e.originalLine-n.originalLine,0!==t?t:(t=e.originalColumn-n.originalColumn,0!==t||r?t:(t=e.generatedColumn-n.generatedColumn,0!==t?t:(t=e.generatedLine-n.generatedLine,0!==t?t:f(e.name,n.name)))))}function h(e,n,r){var t=e.generatedLine-n.generatedLine;return 0!==t?t:(t=e.generatedColumn-n.generatedColumn,0!==t||r?t:(t=f(e.source,n.source),0!==t?t:(t=e.originalLine-n.originalLine,0!==t?t:(t=e.originalColumn-n.originalColumn,0!==t?t:f(e.name,n.name)))))}function f(e,n){return e===n?0:null===e?1:null===n?-1:e>n?1:-1}function d(e,n){var r=e.generatedLine-n.generatedLine;return 0!==r?r:(r=e.generatedColumn-n.generatedColumn,0!==r?r:(r=f(e.source,n.source),0!==r?r:(r=e.originalLine-n.originalLine,0!==r?r:(r=e.originalColumn-n.originalColumn,0!==r?r:f(e.name,n.name)))))}function m(e){return JSON.parse(e.replace(/^\)]}'[^\n]*\n/,""))}function _(e,n,r){if(n=n||"",e&&("/"!==e[e.length-1]&&"/"!==n[0]&&(e+="/"),n=e+n),r){var a=t(r);if(!a)throw new Error("sourceMapURL could not be parsed");if(a.path){var u=a.path.lastIndexOf("/");u>=0&&(a.path=a.path.substring(0,u+1))}n=s(o(a),n)}return i(n)}n.getArg=r;var v=/^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/,y=/^data:.+\,.+$/;n.urlParse=t,n.urlGenerate=o,n.normalize=i,n.join=s,n.isAbsolute=function(e){return"/"===e.charAt(0)||v.test(e)},n.relative=a;var C=function(){var e=Object.create(null);return!("__proto__"in e)}();n.toSetString=C?u:l,n.fromSetString=C?u:c,n.compareByOriginalPositions=p,n.compareByGeneratedPositionsDeflated=h,n.compareByGeneratedPositionsInflated=d,n.parseSourceMapInput=m,n.computeSourceURL=_},function(e,n,r){function t(){this._array=[],this._set=s?new Map:Object.create(null)}var o=r(4),i=Object.prototype.hasOwnProperty,s="undefined"!=typeof Map;t.fromArray=function(e,n){for(var r=new t,o=0,i=e.length;o<i;o++)r.add(e[o],n);return r},t.prototype.size=function(){return s?this._set.size:Object.getOwnPropertyNames(this._set).length},t.prototype.add=function(e,n){var r=s?e:o.toSetString(e),t=s?this.has(e):i.call(this._set,r),a=this._array.length;t&&!n||this._array.push(e),t||(s?this._set.set(e,a):this._set[r]=a)},t.prototype.has=function(e){if(s)return this._set.has(e);var n=o.toSetString(e);return i.call(this._set,n)},t.prototype.indexOf=function(e){if(s){var n=this._set.get(e);if(n>=0)return n}else{var r=o.toSetString(e);if(i.call(this._set,r))return this._set[r]}throw new Error('"'+e+'" is not in the set.')},t.prototype.at=function(e){if(e>=0&&e<this._array.length)return this._array[e];throw new Error("No element indexed by "+e)},t.prototype.toArray=function(){return this._array.slice()},n.ArraySet=t},function(e,n,r){function t(e,n){var r=e.generatedLine,t=n.generatedLine,o=e.generatedColumn,s=n.generatedColumn;return t>r||t==r&&s>=o||i.compareByGeneratedPositionsInflated(e,n)<=0}function o(){this._array=[],this._sorted=!0,this._last={generatedLine:-1,generatedColumn:0}}var i=r(4);o.prototype.unsortedForEach=function(e,n){this._array.forEach(e,n)},o.prototype.add=function(e){t(this._last,e)?(this._last=e,this._array.push(e)):(this._sorted=!1,this._array.push(e))},o.prototype.toArray=function(){return this._sorted||(this._array.sort(i.compareByGeneratedPositionsInflated),this._sorted=!0),this._array},n.MappingList=o},function(e,n,r){function t(e,n){var r=e;return"string"==typeof e&&(r=a.parseSourceMapInput(e)),null!=r.sections?new s(r,n):new o(r,n)}function o(e,n){var r=e;"string"==typeof e&&(r=a.parseSourceMapInput(e));var t=a.getArg(r,"version"),o=a.getArg(r,"sources"),i=a.getArg(r,"names",[]),s=a.getArg(r,"sourceRoot",null),u=a.getArg(r,"sourcesContent",null),c=a.getArg(r,"mappings"),g=a.getArg(r,"file",null);if(t!=this._version)throw new Error("Unsupported version: "+t);s&&(s=a.normalize(s)),o=o.map(String).map(a.normalize).map(function(e){return s&&a.isAbsolute(s)&&a.isAbsolute(e)?a.relative(s,e):e}),this._names=l.fromArray(i.map(String),!0),this._sources=l.fromArray(o,!0),this._absoluteSources=this._sources.toArray().map(function(e){return a.computeSourceURL(s,e,n)}),this.sourceRoot=s,this.sourcesContent=u,this._mappings=c,this._sourceMapURL=n,this.file=g}function i(){this.generatedLine=0,this.generatedColumn=0,this.source=null,this.originalLine=null,this.originalColumn=null,this.name=null}function s(e,n){var r=e;"string"==typeof e&&(r=a.parseSourceMapInput(e));var o=a.getArg(r,"version"),i=a.getArg(r,"sections");if(o!=this._version)throw new Error("Unsupported version: "+o);this._sources=new l,this._names=new l;var s={line:-1,column:0};this._sections=i.map(function(e){if(e.url)throw new Error("Support for url field in sections not implemented.");var r=a.getArg(e,"offset"),o=a.getArg(r,"line"),i=a.getArg(r,"column");if(o<s.line||o===s.line&&i<s.column)throw new Error("Section offsets must be ordered and non-overlapping.");return s=r,{generatedOffset:{generatedLine:o+1,generatedColumn:i+1},consumer:new t(a.getArg(e,"map"),n)}})}var a=r(4),u=r(8),l=r(5).ArraySet,c=r(2),g=r(9).quickSort;t.fromSourceMap=function(e,n){return o.fromSourceMap(e,n)},t.prototype._version=3,t.prototype.__generatedMappings=null,Object.defineProperty(t.prototype,"_generatedMappings",{configurable:!0,enumerable:!0,get:function(){return this.__generatedMappings||this._parseMappings(this._mappings,this.sourceRoot),this.__generatedMappings}}),t.prototype.__originalMappings=null,Object.defineProperty(t.prototype,"_originalMappings",{configurable:!0,enumerable:!0,get:function(){return this.__originalMappings||this._parseMappings(this._mappings,this.sourceRoot),this.__originalMappings}}),t.prototype._charIsMappingSeparator=function(e,n){var r=e.charAt(n);return";"===r||","===r},t.prototype._parseMappings=function(e,n){throw new Error("Subclasses must implement _parseMappings")},t.GENERATED_ORDER=1,t.ORIGINAL_ORDER=2,t.GREATEST_LOWER_BOUND=1,t.LEAST_UPPER_BOUND=2,t.prototype.eachMapping=function(e,n,r){var o,i=n||null,s=r||t.GENERATED_ORDER;switch(s){case t.GENERATED_ORDER:o=this._generatedMappings;break;case t.ORIGINAL_ORDER:o=this._originalMappings;break;default:throw new Error("Unknown order of iteration.")}var u=this.sourceRoot;o.map(function(e){var n=null===e.source?null:this._sources.at(e.source);return n=a.computeSourceURL(u,n,this._sourceMapURL),{source:n,generatedLine:e.generatedLine,generatedColumn:e.generatedColumn,originalLine:e.originalLine,originalColumn:e.originalColumn,name:null===e.name?null:this._names.at(e.name)}},this).forEach(e,i)},t.prototype.allGeneratedPositionsFor=function(e){var n=a.getArg(e,"line"),r={source:a.getArg(e,"source"),originalLine:n,originalColumn:a.getArg(e,"column",0)};if(r.source=this._findSourceIndex(r.source),r.source<0)return[];var t=[],o=this._findMapping(r,this._originalMappings,"originalLine","originalColumn",a.compareByOriginalPositions,u.LEAST_UPPER_BOUND);if(o>=0){var i=this._originalMappings[o];if(void 0===e.column)for(var s=i.originalLine;i&&i.originalLine===s;)t.push({line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}),i=this._originalMappings[++o];else for(var l=i.originalColumn;i&&i.originalLine===n&&i.originalColumn==l;)t.push({line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}),i=this._originalMappings[++o]}return t},n.SourceMapConsumer=t,o.prototype=Object.create(t.prototype),o.prototype.consumer=t,o.prototype._findSourceIndex=function(e){var n=e;if(null!=this.sourceRoot&&(n=a.relative(this.sourceRoot,n)),this._sources.has(n))return this._sources.indexOf(n);var r;for(r=0;r<this._absoluteSources.length;++r)if(this._absoluteSources[r]==e)return r;return-1},o.fromSourceMap=function(e,n){var r=Object.create(o.prototype),t=r._names=l.fromArray(e._names.toArray(),!0),s=r._sources=l.fromArray(e._sources.toArray(),!0);r.sourceRoot=e._sourceRoot,r.sourcesContent=e._generateSourcesContent(r._sources.toArray(),r.sourceRoot),r.file=e._file,r._sourceMapURL=n,r._absoluteSources=r._sources.toArray().map(function(e){return a.computeSourceURL(r.sourceRoot,e,n)});for(var u=e._mappings.toArray().slice(),c=r.__generatedMappings=[],p=r.__originalMappings=[],h=0,f=u.length;h<f;h++){var d=u[h],m=new i;m.generatedLine=d.generatedLine,m.generatedColumn=d.generatedColumn,d.source&&(m.source=s.indexOf(d.source),m.originalLine=d.originalLine,m.originalColumn=d.originalColumn,d.name&&(m.name=t.indexOf(d.name)),p.push(m)),c.push(m)}return g(r.__originalMappings,a.compareByOriginalPositions),r},o.prototype._version=3,Object.defineProperty(o.prototype,"sources",{get:function(){return this._absoluteSources.slice()}}),o.prototype._parseMappings=function(e,n){for(var r,t,o,s,u,l=1,p=0,h=0,f=0,d=0,m=0,_=e.length,v=0,y={},C={},S=[],A=[];v<_;)if(";"===e.charAt(v))l++,v++,p=0;else if(","===e.charAt(v))v++;else{for(r=new i,r.generatedLine=l,s=v;s<_&&!this._charIsMappingSeparator(e,s);s++);if(t=e.slice(v,s),o=y[t])v+=t.length;else{for(o=[];v<s;)c.decode(e,v,C),u=C.value,v=C.rest,o.push(u);if(2===o.length)throw new Error("Found a source, but no line and column");if(3===o.length)throw new Error("Found a source and line, but no column");y[t]=o}r.generatedColumn=p+o[0],p=r.generatedColumn,o.length>1&&(r.source=d+o[1],d+=o[1],r.originalLine=h+o[2],h=r.originalLine,r.originalLine+=1,r.originalColumn=f+o[3],f=r.originalColumn,o.length>4&&(r.name=m+o[4],m+=o[4])),A.push(r),"number"==typeof r.originalLine&&S.push(r)}g(A,a.compareByGeneratedPositionsDeflated),this.__generatedMappings=A,g(S,a.compareByOriginalPositions),this.__originalMappings=S},o.prototype._findMapping=function(e,n,r,t,o,i){if(e[r]<=0)throw new TypeError("Line must be greater than or equal to 1, got "+e[r]);if(e[t]<0)throw new TypeError("Column must be greater than or equal to 0, got "+e[t]);return u.search(e,n,o,i)},o.prototype.computeColumnSpans=function(){for(var e=0;e<this._generatedMappings.length;++e){var n=this._generatedMappings[e];if(e+1<this._generatedMappings.length){var r=this._generatedMappings[e+1];if(n.generatedLine===r.generatedLine){n.lastGeneratedColumn=r.generatedColumn-1;continue}}n.lastGeneratedColumn=1/0}},o.prototype.originalPositionFor=function(e){var n={generatedLine:a.getArg(e,"line"),generatedColumn:a.getArg(e,"column")},r=this._findMapping(n,this._generatedMappings,"generatedLine","generatedColumn",a.compareByGeneratedPositionsDeflated,a.getArg(e,"bias",t.GREATEST_LOWER_BOUND));if(r>=0){var o=this._generatedMappings[r];if(o.generatedLine===n.generatedLine){var i=a.getArg(o,"source",null);null!==i&&(i=this._sources.at(i),i=a.computeSourceURL(this.sourceRoot,i,this._sourceMapURL));var s=a.getArg(o,"name",null);return null!==s&&(s=this._names.at(s)),{source:i,line:a.getArg(o,"originalLine",null),column:a.getArg(o,"originalColumn",null),name:s}}}return{source:null,line:null,column:null,name:null}},o.prototype.hasContentsOfAllSources=function(){return!!this.sourcesContent&&(this.sourcesContent.length>=this._sources.size()&&!this.sourcesContent.some(function(e){return null==e}))},o.prototype.sourceContentFor=function(e,n){if(!this.sourcesContent)return null;var r=this._findSourceIndex(e);if(r>=0)return this.sourcesContent[r];var t=e;null!=this.sourceRoot&&(t=a.relative(this.sourceRoot,t));var o;if(null!=this.sourceRoot&&(o=a.urlParse(this.sourceRoot))){var i=t.replace(/^file:\/\//,"");if("file"==o.scheme&&this._sources.has(i))return this.sourcesContent[this._sources.indexOf(i)];if((!o.path||"/"==o.path)&&this._sources.has("/"+t))return this.sourcesContent[this._sources.indexOf("/"+t)]}if(n)return null;throw new Error('"'+t+'" is not in the SourceMap.')},o.prototype.generatedPositionFor=function(e){var n=a.getArg(e,"source");if(n=this._findSourceIndex(n),n<0)return{line:null,column:null,lastColumn:null};var r={source:n,originalLine:a.getArg(e,"line"),originalColumn:a.getArg(e,"column")},o=this._findMapping(r,this._originalMappings,"originalLine","originalColumn",a.compareByOriginalPositions,a.getArg(e,"bias",t.GREATEST_LOWER_BOUND));if(o>=0){var i=this._originalMappings[o];if(i.source===r.source)return{line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}}return{line:null,column:null,lastColumn:null}},n.BasicSourceMapConsumer=o,s.prototype=Object.create(t.prototype),s.prototype.constructor=t,s.prototype._version=3,Object.defineProperty(s.prototype,"sources",{get:function(){for(var e=[],n=0;n<this._sections.length;n++)for(var r=0;r<this._sections[n].consumer.sources.length;r++)e.push(this._sections[n].consumer.sources[r]);return e}}),s.prototype.originalPositionFor=function(e){var n={generatedLine:a.getArg(e,"line"),generatedColumn:a.getArg(e,"column")},r=u.search(n,this._sections,function(e,n){var r=e.generatedLine-n.generatedOffset.generatedLine;return r?r:e.generatedColumn-n.generatedOffset.generatedColumn}),t=this._sections[r];return t?t.consumer.originalPositionFor({line:n.generatedLine-(t.generatedOffset.generatedLine-1),column:n.generatedColumn-(t.generatedOffset.generatedLine===n.generatedLine?t.generatedOffset.generatedColumn-1:0),bias:e.bias}):{source:null,line:null,column:null,name:null}},s.prototype.hasContentsOfAllSources=function(){return this._sections.every(function(e){return e.consumer.hasContentsOfAllSources()})},s.prototype.sourceContentFor=function(e,n){for(var r=0;r<this._sections.length;r++){var t=this._sections[r],o=t.consumer.sourceContentFor(e,!0);if(o)return o}if(n)return null;throw new Error('"'+e+'" is not in the SourceMap.')},s.prototype.generatedPositionFor=function(e){for(var n=0;n<this._sections.length;n++){var r=this._sections[n];if(r.consumer._findSourceIndex(a.getArg(e,"source"))!==-1){var t=r.consumer.generatedPositionFor(e);if(t){var o={line:t.line+(r.generatedOffset.generatedLine-1),column:t.column+(r.generatedOffset.generatedLine===t.line?r.generatedOffset.generatedColumn-1:0)};return o}}}return{line:null,column:null}},s.prototype._parseMappings=function(e,n){this.__generatedMappings=[],this.__originalMappings=[];for(var r=0;r<this._sections.length;r++)for(var t=this._sections[r],o=t.consumer._generatedMappings,i=0;i<o.length;i++){var s=o[i],u=t.consumer._sources.at(s.source);u=a.computeSourceURL(t.consumer.sourceRoot,u,this._sourceMapURL),this._sources.add(u),u=this._sources.indexOf(u);var l=null;s.name&&(l=t.consumer._names.at(s.name),this._names.add(l),l=this._names.indexOf(l));var c={source:u,generatedLine:s.generatedLine+(t.generatedOffset.generatedLine-1),generatedColumn:s.generatedColumn+(t.generatedOffset.generatedLine===s.generatedLine?t.generatedOffset.generatedColumn-1:0),originalLine:s.originalLine,originalColumn:s.originalColumn,name:l};this.__generatedMappings.push(c),"number"==typeof c.originalLine&&this.__originalMappings.push(c)}g(this.__generatedMappings,a.compareByGeneratedPositionsDeflated),g(this.__originalMappings,a.compareByOriginalPositions)},n.IndexedSourceMapConsumer=s},function(e,n){function r(e,t,o,i,s,a){var u=Math.floor((t-e)/2)+e,l=s(o,i[u],!0);return 0===l?u:l>0?t-u>1?r(u,t,o,i,s,a):a==n.LEAST_UPPER_BOUND?t<i.length?t:-1:u:u-e>1?r(e,u,o,i,s,a):a==n.LEAST_UPPER_BOUND?u:e<0?-1:e}n.GREATEST_LOWER_BOUND=1,n.LEAST_UPPER_BOUND=2,n.search=function(e,t,o,i){if(0===t.length)return-1;var s=r(-1,t.length,e,t,o,i||n.GREATEST_LOWER_BOUND);if(s<0)return-1;for(;s-1>=0&&0===o(t[s],t[s-1],!0);)--s;return s}},function(e,n){function r(e,n,r){var t=e[n];e[n]=e[r],e[r]=t}function t(e,n){return Math.round(e+Math.random()*(n-e))}function o(e,n,i,s){if(i<s){var a=t(i,s),u=i-1;r(e,a,s);for(var l=e[s],c=i;c<s;c++)n(e[c],l)<=0&&(u+=1,r(e,u,c));r(e,u+1,c);var g=u+1;o(e,n,i,g-1),o(e,n,g+1,s)}}n.quickSort=function(e,n){o(e,n,0,e.length-1)}},function(e,n,r){function t(e,n,r,t,o){this.children=[],this.sourceContents={},this.line=null==e?null:e,this.column=null==n?null:n,this.source=null==r?null:r,this.name=null==o?null:o,this[u]=!0,null!=t&&this.add(t)}var o=r(1).SourceMapGenerator,i=r(4),s=/(\r?\n)/,a=10,u="$$$isSourceNode$$$";t.fromStringWithSourceMap=function(e,n,r){function o(e,n){if(null===e||void 0===e.source)a.add(n);else{var o=r?i.join(r,e.source):e.source;a.add(new t(e.originalLine,e.originalColumn,o,n,e.name))}}var a=new t,u=e.split(s),l=0,c=function(){function e(){return l<u.length?u[l++]:void 0}var n=e(),r=e()||"";return n+r},g=1,p=0,h=null;return n.eachMapping(function(e){if(null!==h){if(!(g<e.generatedLine)){var n=u[l]||"",r=n.substr(0,e.generatedColumn-p);return u[l]=n.substr(e.generatedColumn-p),p=e.generatedColumn,o(h,r),void(h=e)}o(h,c()),g++,p=0}for(;g<e.generatedLine;)a.add(c()),g++;if(p<e.generatedColumn){var n=u[l]||"";a.add(n.substr(0,e.generatedColumn)),u[l]=n.substr(e.generatedColumn),p=e.generatedColumn}h=e},this),l<u.length&&(h&&o(h,c()),a.add(u.splice(l).join(""))),n.sources.forEach(function(e){var t=n.sourceContentFor(e);null!=t&&(null!=r&&(e=i.join(r,e)),a.setSourceContent(e,t))}),a},t.prototype.add=function(e){if(Array.isArray(e))e.forEach(function(e){this.add(e)},this);else{if(!e[u]&&"string"!=typeof e)throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+e);e&&this.children.push(e)}return this},t.prototype.prepend=function(e){if(Array.isArray(e))for(var n=e.length-1;n>=0;n--)this.prepend(e[n]);else{if(!e[u]&&"string"!=typeof e)throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+e);this.children.unshift(e)}return this},t.prototype.walk=function(e){for(var n,r=0,t=this.children.length;r<t;r++)n=this.children[r],n[u]?n.walk(e):""!==n&&e(n,{source:this.source,line:this.line,column:this.column,name:this.name})},t.prototype.join=function(e){var n,r,t=this.children.length;if(t>0){for(n=[],r=0;r<t-1;r++)n.push(this.children[r]),n.push(e);n.push(this.children[r]),this.children=n}return this},t.prototype.replaceRight=function(e,n){var r=this.children[this.children.length-1];return r[u]?r.replaceRight(e,n):"string"==typeof r?this.children[this.children.length-1]=r.replace(e,n):this.children.push("".replace(e,n)),this},t.prototype.setSourceContent=function(e,n){this.sourceContents[i.toSetString(e)]=n},t.prototype.walkSourceContents=function(e){for(var n=0,r=this.children.length;n<r;n++)this.children[n][u]&&this.children[n].walkSourceContents(e);for(var t=Object.keys(this.sourceContents),n=0,r=t.length;n<r;n++)e(i.fromSetString(t[n]),this.sourceContents[t[n]])},t.prototype.toString=function(){var e="";return this.walk(function(n){e+=n}),e},t.prototype.toStringWithSourceMap=function(e){var n={code:"",line:1,column:0},r=new o(e),t=!1,i=null,s=null,u=null,l=null;return this.walk(function(e,o){n.code+=e,null!==o.source&&null!==o.line&&null!==o.column?(i===o.source&&s===o.line&&u===o.column&&l===o.name||r.addMapping({source:o.source,original:{line:o.line,column:o.column},generated:{line:n.line,column:n.column},name:o.name}),i=o.source,s=o.line,u=o.column,l=o.name,t=!0):t&&(r.addMapping({generated:{line:n.line,column:n.column}}),i=null,t=!1);for(var c=0,g=e.length;c<g;c++)e.charCodeAt(c)===a?(n.line++,n.column=0,c+1===g?(i=null,t=!1):t&&r.addMapping({source:o.source,original:{line:o.line,column:o.column},generated:{line:n.line,column:n.column},name:o.name})):n.column++}),this.walkSourceContents(function(e,n){r.setSourceContent(e,n)}),{code:n.code,map:r}},n.SourceNode=t}])}); +//# sourceMappingURL=source-map.min.js.map \ No newline at end of file diff --git a/resources/app/node_modules/source-map/dist/source-map.min.js.map b/resources/app/node_modules/source-map/dist/source-map.min.js.map new file mode 100644 index 0000000..d2cc86e --- /dev/null +++ b/resources/app/node_modules/source-map/dist/source-map.min.js.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///source-map.min.js","webpack:///webpack/bootstrap 0fd5815da764db5fb9fe","webpack:///./source-map.js","webpack:///./lib/source-map-generator.js","webpack:///./lib/base64-vlq.js","webpack:///./lib/base64.js","webpack:///./lib/util.js","webpack:///./lib/array-set.js","webpack:///./lib/mapping-list.js","webpack:///./lib/source-map-consumer.js","webpack:///./lib/binary-search.js","webpack:///./lib/quick-sort.js","webpack:///./lib/source-node.js"],"names":["root","factory","exports","module","define","amd","this","modules","__webpack_require__","moduleId","installedModules","id","loaded","call","m","c","p","SourceMapGenerator","SourceMapConsumer","SourceNode","aArgs","_file","util","getArg","_sourceRoot","_skipValidation","_sources","ArraySet","_names","_mappings","MappingList","_sourcesContents","base64VLQ","prototype","_version","fromSourceMap","aSourceMapConsumer","sourceRoot","generator","file","eachMapping","mapping","newMapping","generated","line","generatedLine","column","generatedColumn","source","relative","original","originalLine","originalColumn","name","addMapping","sources","forEach","sourceFile","sourceRelative","has","add","content","sourceContentFor","setSourceContent","_validateMapping","String","aSourceFile","aSourceContent","Object","create","toSetString","keys","length","applySourceMap","aSourceMapPath","Error","newSources","newNames","unsortedForEach","originalPositionFor","join","aGenerated","aOriginal","aSource","aName","JSON","stringify","_serializeMappings","next","nameIdx","sourceIdx","previousGeneratedColumn","previousGeneratedLine","previousOriginalColumn","previousOriginalLine","previousName","previousSource","result","mappings","toArray","i","len","compareByGeneratedPositionsInflated","encode","indexOf","_generateSourcesContent","aSources","aSourceRoot","map","key","hasOwnProperty","toJSON","version","names","sourcesContent","toString","toVLQSigned","aValue","fromVLQSigned","isNegative","shifted","base64","VLQ_BASE_SHIFT","VLQ_BASE","VLQ_BASE_MASK","VLQ_CONTINUATION_BIT","digit","encoded","vlq","decode","aStr","aIndex","aOutParam","continuation","strLen","shift","charCodeAt","charAt","value","rest","intToCharMap","split","number","TypeError","charCode","bigA","bigZ","littleA","littleZ","zero","nine","plus","slash","littleOffset","numberOffset","aDefaultValue","arguments","urlParse","aUrl","match","urlRegexp","scheme","auth","host","port","path","urlGenerate","aParsedUrl","url","normalize","aPath","part","isAbsolute","parts","up","splice","aRoot","aPathUrl","aRootUrl","dataUrlRegexp","joined","replace","level","index","lastIndexOf","slice","Array","substr","identity","s","isProtoString","fromSetString","compareByOriginalPositions","mappingA","mappingB","onlyCompareOriginal","cmp","strcmp","compareByGeneratedPositionsDeflated","onlyCompareGenerated","aStr1","aStr2","parseSourceMapInput","str","parse","computeSourceURL","sourceURL","sourceMapURL","parsed","substring","test","supportsNullProto","obj","_array","_set","hasNativeMap","Map","fromArray","aArray","aAllowDuplicates","set","size","getOwnPropertyNames","sStr","isDuplicate","idx","push","get","at","aIdx","generatedPositionAfter","lineA","lineB","columnA","columnB","_sorted","_last","aCallback","aThisArg","aMapping","sort","aSourceMap","aSourceMapURL","sourceMap","sections","IndexedSourceMapConsumer","BasicSourceMapConsumer","_absoluteSources","_sourceMapURL","Mapping","lastOffset","_sections","offset","offsetLine","offsetColumn","generatedOffset","consumer","binarySearch","quickSort","__generatedMappings","defineProperty","configurable","enumerable","_parseMappings","__originalMappings","_charIsMappingSeparator","GENERATED_ORDER","ORIGINAL_ORDER","GREATEST_LOWER_BOUND","LEAST_UPPER_BOUND","aContext","aOrder","context","order","_generatedMappings","_originalMappings","allGeneratedPositionsFor","needle","_findSourceIndex","_findMapping","undefined","lastColumn","relativeSource","smc","generatedMappings","destGeneratedMappings","destOriginalMappings","srcMapping","destMapping","segment","end","cachedSegments","temp","originalMappings","aNeedle","aMappings","aLineName","aColumnName","aComparator","aBias","search","computeColumnSpans","nextMapping","lastGeneratedColumn","Infinity","hasContentsOfAllSources","some","sc","nullOnMissing","fileUriAbsPath","generatedPositionFor","constructor","j","sectionIndex","section","bias","every","generatedPosition","ret","sectionMappings","adjustedMapping","recursiveSearch","aLow","aHigh","aHaystack","aCompare","mid","Math","floor","swap","ary","x","y","randomIntInRange","low","high","round","random","doQuickSort","comparator","r","pivotIndex","pivot","q","aLine","aColumn","aChunks","children","sourceContents","isSourceNode","REGEX_NEWLINE","NEWLINE_CODE","fromStringWithSourceMap","aGeneratedCode","aRelativePath","addMappingWithCode","code","node","remainingLines","remainingLinesIndex","shiftNextLine","getNextLine","lineContents","newLine","lastGeneratedLine","lastMapping","nextLine","aChunk","isArray","chunk","prepend","unshift","walk","aFn","aSep","newChildren","replaceRight","aPattern","aReplacement","lastChild","walkSourceContents","toStringWithSourceMap","sourceMappingActive","lastOriginalSource","lastOriginalLine","lastOriginalColumn","lastOriginalName","sourceContent"],"mappings":"CAAA,SAAAA,EAAAC,GACA,gBAAAC,UAAA,gBAAAC,QACAA,OAAAD,QAAAD,IACA,kBAAAG,gBAAAC,IACAD,UAAAH,GACA,gBAAAC,SACAA,QAAA,UAAAD,IAEAD,EAAA,UAAAC,KACCK,KAAA,WACD,MCAgB,UAAUC,GCN1B,QAAAC,GAAAC,GAGA,GAAAC,EAAAD,GACA,MAAAC,GAAAD,GAAAP,OAGA,IAAAC,GAAAO,EAAAD,IACAP,WACAS,GAAAF,EACAG,QAAA,EAUA,OANAL,GAAAE,GAAAI,KAAAV,EAAAD,QAAAC,IAAAD,QAAAM,GAGAL,EAAAS,QAAA,EAGAT,EAAAD,QAvBA,GAAAQ,KAqCA,OATAF,GAAAM,EAAAP,EAGAC,EAAAO,EAAAL,EAGAF,EAAAQ,EAAA,GAGAR,EAAA,KDgBM,SAAUL,EAAQD,EAASM,GEjDjCN,EAAAe,mBAAAT,EAAA,GAAAS,mBACAf,EAAAgB,kBAAAV,EAAA,GAAAU,kBACAhB,EAAAiB,WAAAX,EAAA,IAAAW,YF6DM,SAAUhB,EAAQD,EAASM,GGhDjC,QAAAS,GAAAG,GACAA,IACAA,MAEAd,KAAAe,MAAAC,EAAAC,OAAAH,EAAA,aACAd,KAAAkB,YAAAF,EAAAC,OAAAH,EAAA,mBACAd,KAAAmB,gBAAAH,EAAAC,OAAAH,EAAA,qBACAd,KAAAoB,SAAA,GAAAC,GACArB,KAAAsB,OAAA,GAAAD,GACArB,KAAAuB,UAAA,GAAAC,GACAxB,KAAAyB,iBAAA,KAvBA,GAAAC,GAAAxB,EAAA,GACAc,EAAAd,EAAA,GACAmB,EAAAnB,EAAA,GAAAmB,SACAG,EAAAtB,EAAA,GAAAsB,WAuBAb,GAAAgB,UAAAC,SAAA,EAOAjB,EAAAkB,cACA,SAAAC,GACA,GAAAC,GAAAD,EAAAC,WACAC,EAAA,GAAArB,IACAsB,KAAAH,EAAAG,KACAF,cA2CA,OAzCAD,GAAAI,YAAA,SAAAC,GACA,GAAAC,IACAC,WACAC,KAAAH,EAAAI,cACAC,OAAAL,EAAAM,iBAIA,OAAAN,EAAAO,SACAN,EAAAM,OAAAP,EAAAO,OACA,MAAAX,IACAK,EAAAM,OAAA1B,EAAA2B,SAAAZ,EAAAK,EAAAM,SAGAN,EAAAQ,UACAN,KAAAH,EAAAU,aACAL,OAAAL,EAAAW,gBAGA,MAAAX,EAAAY,OACAX,EAAAW,KAAAZ,EAAAY,OAIAf,EAAAgB,WAAAZ,KAEAN,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAC,GAAAD,CACA,QAAApB,IACAqB,EAAApC,EAAA2B,SAAAZ,EAAAoB,IAGAnB,EAAAZ,SAAAiC,IAAAD,IACApB,EAAAZ,SAAAkC,IAAAF,EAGA,IAAAG,GAAAzB,EAAA0B,iBAAAL,EACA,OAAAI,GACAvB,EAAAyB,iBAAAN,EAAAI,KAGAvB,GAaArB,EAAAgB,UAAAqB,WACA,SAAAlC,GACA,GAAAuB,GAAArB,EAAAC,OAAAH,EAAA,aACA8B,EAAA5B,EAAAC,OAAAH,EAAA,iBACA4B,EAAA1B,EAAAC,OAAAH,EAAA,eACAiC,EAAA/B,EAAAC,OAAAH,EAAA,YAEAd,MAAAmB,iBACAnB,KAAA0D,iBAAArB,EAAAO,EAAAF,EAAAK,GAGA,MAAAL,IACAA,EAAAiB,OAAAjB,GACA1C,KAAAoB,SAAAiC,IAAAX,IACA1C,KAAAoB,SAAAkC,IAAAZ,IAIA,MAAAK,IACAA,EAAAY,OAAAZ,GACA/C,KAAAsB,OAAA+B,IAAAN,IACA/C,KAAAsB,OAAAgC,IAAAP,IAIA/C,KAAAuB,UAAA+B,KACAf,cAAAF,EAAAC,KACAG,gBAAAJ,EAAAG,OACAK,aAAA,MAAAD,KAAAN,KACAQ,eAAA,MAAAF,KAAAJ,OACAE,SACAK,UAOApC,EAAAgB,UAAA8B,iBACA,SAAAG,EAAAC,GACA,GAAAnB,GAAAkB,CACA,OAAA5D,KAAAkB,cACAwB,EAAA1B,EAAA2B,SAAA3C,KAAAkB,YAAAwB,IAGA,MAAAmB,GAGA7D,KAAAyB,mBACAzB,KAAAyB,iBAAAqC,OAAAC,OAAA,OAEA/D,KAAAyB,iBAAAT,EAAAgD,YAAAtB,IAAAmB,GACK7D,KAAAyB,yBAGLzB,MAAAyB,iBAAAT,EAAAgD,YAAAtB,IACA,IAAAoB,OAAAG,KAAAjE,KAAAyB,kBAAAyC,SACAlE,KAAAyB,iBAAA,QAqBAd,EAAAgB,UAAAwC,eACA,SAAArC,EAAA8B,EAAAQ,GACA,GAAAjB,GAAAS,CAEA,UAAAA,EAAA,CACA,SAAA9B,EAAAG,KACA,SAAAoC,OACA,gJAIAlB,GAAArB,EAAAG,KAEA,GAAAF,GAAA/B,KAAAkB,WAEA,OAAAa,IACAoB,EAAAnC,EAAA2B,SAAAZ,EAAAoB,GAIA,IAAAmB,GAAA,GAAAjD,GACAkD,EAAA,GAAAlD,EAGArB,MAAAuB,UAAAiD,gBAAA,SAAArC,GACA,GAAAA,EAAAO,SAAAS,GAAA,MAAAhB,EAAAU,aAAA,CAEA,GAAAD,GAAAd,EAAA2C,qBACAnC,KAAAH,EAAAU,aACAL,OAAAL,EAAAW,gBAEA,OAAAF,EAAAF,SAEAP,EAAAO,OAAAE,EAAAF,OACA,MAAA0B,IACAjC,EAAAO,OAAA1B,EAAA0D,KAAAN,EAAAjC,EAAAO,SAEA,MAAAX,IACAI,EAAAO,OAAA1B,EAAA2B,SAAAZ,EAAAI,EAAAO,SAEAP,EAAAU,aAAAD,EAAAN,KACAH,EAAAW,eAAAF,EAAAJ,OACA,MAAAI,EAAAG,OACAZ,EAAAY,KAAAH,EAAAG,OAKA,GAAAL,GAAAP,EAAAO,MACA,OAAAA,GAAA4B,EAAAjB,IAAAX,IACA4B,EAAAhB,IAAAZ,EAGA,IAAAK,GAAAZ,EAAAY,IACA,OAAAA,GAAAwB,EAAAlB,IAAAN,IACAwB,EAAAjB,IAAAP,IAGK/C,MACLA,KAAAoB,SAAAkD,EACAtE,KAAAsB,OAAAiD,EAGAzC,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAI,GAAAzB,EAAA0B,iBAAAL,EACA,OAAAI,IACA,MAAAa,IACAjB,EAAAnC,EAAA0D,KAAAN,EAAAjB,IAEA,MAAApB,IACAoB,EAAAnC,EAAA2B,SAAAZ,EAAAoB,IAEAnD,KAAAyD,iBAAAN,EAAAI,KAEKvD,OAcLW,EAAAgB,UAAA+B,iBACA,SAAAiB,EAAAC,EAAAC,EACAC,GAKA,GAAAF,GAAA,gBAAAA,GAAAtC,MAAA,gBAAAsC,GAAApC,OACA,SAAA6B,OACA,+OAMA,OAAAM,GAAA,QAAAA,IAAA,UAAAA,IACAA,EAAArC,KAAA,GAAAqC,EAAAnC,QAAA,IACAoC,GAAAC,GAAAC,MAIAH,GAAA,QAAAA,IAAA,UAAAA,IACAC,GAAA,QAAAA,IAAA,UAAAA,IACAD,EAAArC,KAAA,GAAAqC,EAAAnC,QAAA,GACAoC,EAAAtC,KAAA,GAAAsC,EAAApC,QAAA,GACAqC,GAKA,SAAAR,OAAA,oBAAAU,KAAAC,WACA3C,UAAAsC,EACAjC,OAAAmC,EACAjC,SAAAgC,EACA7B,KAAA+B,MASAnE,EAAAgB,UAAAsD,mBACA,WAcA,OANAC,GACA/C,EACAgD,EACAC,EAVAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,GAMAC,EAAA5F,KAAAuB,UAAAsE,UACAC,EAAA,EAAAC,EAAAH,EAAA1B,OAA0C4B,EAAAC,EAASD,IAAA,CAInD,GAHA3D,EAAAyD,EAAAE,GACAZ,EAAA,GAEA/C,EAAAI,gBAAA+C,EAEA,IADAD,EAAA,EACAlD,EAAAI,gBAAA+C,GACAJ,GAAA,IACAI,QAIA,IAAAQ,EAAA,GACA,IAAA9E,EAAAgF,oCAAA7D,EAAAyD,EAAAE,EAAA,IACA,QAEAZ,IAAA,IAIAA,GAAAxD,EAAAuE,OAAA9D,EAAAM,gBACA4C,GACAA,EAAAlD,EAAAM,gBAEA,MAAAN,EAAAO,SACA0C,EAAApF,KAAAoB,SAAA8E,QAAA/D,EAAAO,QACAwC,GAAAxD,EAAAuE,OAAAb,EAAAM,GACAA,EAAAN,EAGAF,GAAAxD,EAAAuE,OAAA9D,EAAAU,aAAA,EACA2C,GACAA,EAAArD,EAAAU,aAAA,EAEAqC,GAAAxD,EAAAuE,OAAA9D,EAAAW,eACAyC,GACAA,EAAApD,EAAAW,eAEA,MAAAX,EAAAY,OACAoC,EAAAnF,KAAAsB,OAAA4E,QAAA/D,EAAAY,MACAmC,GAAAxD,EAAAuE,OAAAd,EAAAM,GACAA,EAAAN,IAIAQ,GAAAT,EAGA,MAAAS,IAGAhF,EAAAgB,UAAAwE,wBACA,SAAAC,EAAAC,GACA,MAAAD,GAAAE,IAAA,SAAA5D,GACA,IAAA1C,KAAAyB,iBACA,WAEA,OAAA4E,IACA3D,EAAA1B,EAAA2B,SAAA0D,EAAA3D,GAEA,IAAA6D,GAAAvF,EAAAgD,YAAAtB,EACA,OAAAoB,QAAAnC,UAAA6E,eAAAjG,KAAAP,KAAAyB,iBAAA8E,GACAvG,KAAAyB,iBAAA8E,GACA,MACKvG,OAMLW,EAAAgB,UAAA8E,OACA,WACA,GAAAH,IACAI,QAAA1G,KAAA4B,SACAqB,QAAAjD,KAAAoB,SAAAyE,UACAc,MAAA3G,KAAAsB,OAAAuE,UACAD,SAAA5F,KAAAiF,qBAYA,OAVA,OAAAjF,KAAAe,QACAuF,EAAArE,KAAAjC,KAAAe,OAEA,MAAAf,KAAAkB,cACAoF,EAAAvE,WAAA/B,KAAAkB,aAEAlB,KAAAyB,mBACA6E,EAAAM,eAAA5G,KAAAmG,wBAAAG,EAAArD,QAAAqD,EAAAvE,aAGAuE,GAMA3F,EAAAgB,UAAAkF,SACA,WACA,MAAA9B,MAAAC,UAAAhF,KAAAyG,WAGA7G,EAAAe,sBH2EM,SAAUd,EAAQD,EAASM,GI/ajC,QAAA4G,GAAAC,GACA,MAAAA,GAAA,IACAA,GAAA,MACAA,GAAA,KASA,QAAAC,GAAAD,GACA,GAAAE,GAAA,OAAAF,GACAG,EAAAH,GAAA,CACA,OAAAE,IACAC,EACAA,EAhDA,GAAAC,GAAAjH,EAAA,GAcAkH,EAAA,EAGAC,EAAA,GAAAD,EAGAE,EAAAD,EAAA,EAGAE,EAAAF,CA+BAzH,GAAAqG,OAAA,SAAAc,GACA,GACAS,GADAC,EAAA,GAGAC,EAAAZ,EAAAC,EAEA,GACAS,GAAAE,EAAAJ,EACAI,KAAAN,EACAM,EAAA,IAGAF,GAAAD,GAEAE,GAAAN,EAAAlB,OAAAuB,SACGE,EAAA,EAEH,OAAAD,IAOA7H,EAAA+H,OAAA,SAAAC,EAAAC,EAAAC,GACA,GAGAC,GAAAP,EAHAQ,EAAAJ,EAAA1D,OACAyB,EAAA,EACAsC,EAAA,CAGA,IACA,GAAAJ,GAAAG,EACA,SAAA3D,OAAA,6CAIA,IADAmD,EAAAL,EAAAQ,OAAAC,EAAAM,WAAAL,MACAL,KAAA,EACA,SAAAnD,OAAA,yBAAAuD,EAAAO,OAAAN,EAAA,GAGAE,MAAAP,EAAAD,GACAC,GAAAF,EACA3B,GAAA6B,GAAAS,EACAA,GAAAb,QACGW,EAEHD,GAAAM,MAAApB,EAAArB,GACAmC,EAAAO,KAAAR,IJ2fM,SAAUhI,EAAQD,GK9nBxB,GAAA0I,GAAA,mEAAAC,MAAA,GAKA3I,GAAAqG,OAAA,SAAAuC,GACA,MAAAA,KAAAF,EAAApE,OACA,MAAAoE,GAAAE,EAEA,UAAAC,WAAA,6BAAAD,IAOA5I,EAAA+H,OAAA,SAAAe,GACA,GAAAC,GAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,IAEAC,EAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,EAGA,OAAAT,IAAAD,MAAAE,EACAF,EAAAC,EAIAE,GAAAH,MAAAI,EACAJ,EAAAG,EAAAM,EAIAJ,GAAAL,MAAAM,EACAN,EAAAK,EAAAK,EAIAV,GAAAO,EACA,GAIAP,GAAAQ,EACA,IAIA,IL6oBM,SAAUrJ,EAAQD,GM7rBxB,QAAAqB,GAAAH,EAAAgE,EAAAuE,GACA,GAAAvE,IAAAhE,GACA,MAAAA,GAAAgE,EACG,QAAAwE,UAAApF,OACH,MAAAmF,EAEA,UAAAhF,OAAA,IAAAS,EAAA,6BAQA,QAAAyE,GAAAC,GACA,GAAAC,GAAAD,EAAAC,MAAAC,EACA,OAAAD,IAIAE,OAAAF,EAAA,GACAG,KAAAH,EAAA,GACAI,KAAAJ,EAAA,GACAK,KAAAL,EAAA,GACAM,KAAAN,EAAA,IAPA,KAYA,QAAAO,GAAAC,GACA,GAAAC,GAAA,EAiBA,OAhBAD,GAAAN,SACAO,GAAAD,EAAAN,OAAA,KAEAO,GAAA,KACAD,EAAAL,OACAM,GAAAD,EAAAL,KAAA,KAEAK,EAAAJ,OACAK,GAAAD,EAAAJ,MAEAI,EAAAH,OACAI,GAAA,IAAAD,EAAAH,MAEAG,EAAAF,OACAG,GAAAD,EAAAF,MAEAG,EAeA,QAAAC,GAAAC,GACA,GAAAL,GAAAK,EACAF,EAAAX,EAAAa,EACA,IAAAF,EAAA,CACA,IAAAA,EAAAH,KACA,MAAAK,EAEAL,GAAAG,EAAAH,KAKA,OAAAM,GAHAC,EAAA1K,EAAA0K,WAAAP,GAEAQ,EAAAR,EAAAxB,MAAA,OACAiC,EAAA,EAAA1E,EAAAyE,EAAArG,OAAA,EAA8C4B,GAAA,EAAQA,IACtDuE,EAAAE,EAAAzE,GACA,MAAAuE,EACAE,EAAAE,OAAA3E,EAAA,GACK,OAAAuE,EACLG,IACKA,EAAA,IACL,KAAAH,GAIAE,EAAAE,OAAA3E,EAAA,EAAA0E,GACAA,EAAA,IAEAD,EAAAE,OAAA3E,EAAA,GACA0E,KAUA,OANAT,GAAAQ,EAAA7F,KAAA,KAEA,KAAAqF,IACAA,EAAAO,EAAA,SAGAJ,GACAA,EAAAH,OACAC,EAAAE,IAEAH,EAoBA,QAAArF,GAAAgG,EAAAN,GACA,KAAAM,IACAA,EAAA,KAEA,KAAAN,IACAA,EAAA,IAEA,IAAAO,GAAApB,EAAAa,GACAQ,EAAArB,EAAAmB,EAMA,IALAE,IACAF,EAAAE,EAAAb,MAAA,KAIAY,MAAAhB,OAIA,MAHAiB,KACAD,EAAAhB,OAAAiB,EAAAjB,QAEAK,EAAAW,EAGA,IAAAA,GAAAP,EAAAX,MAAAoB,GACA,MAAAT,EAIA,IAAAQ,MAAAf,OAAAe,EAAAb,KAEA,MADAa,GAAAf,KAAAO,EACAJ,EAAAY,EAGA,IAAAE,GAAA,MAAAV,EAAAjC,OAAA,GACAiC,EACAD,EAAAO,EAAAK,QAAA,eAAAX,EAEA,OAAAQ,IACAA,EAAAb,KAAAe,EACAd,EAAAY,IAEAE,EAcA,QAAAnI,GAAA+H,EAAAN,GACA,KAAAM,IACAA,EAAA,KAGAA,IAAAK,QAAA,SAOA,KADA,GAAAC,GAAA,EACA,IAAAZ,EAAAlE,QAAAwE,EAAA,OACA,GAAAO,GAAAP,EAAAQ,YAAA,IACA,IAAAD,EAAA,EACA,MAAAb,EAOA,IADAM,IAAAS,MAAA,EAAAF,GACAP,EAAAjB,MAAA,qBACA,MAAAW,KAGAY,EAIA,MAAAI,OAAAJ,EAAA,GAAAtG,KAAA,OAAA0F,EAAAiB,OAAAX,EAAAxG,OAAA,GASA,QAAAoH,GAAAC,GACA,MAAAA,GAYA,QAAAvH,GAAA4D,GACA,MAAA4D,GAAA5D,GACA,IAAAA,EAGAA,EAIA,QAAA6D,GAAA7D,GACA,MAAA4D,GAAA5D,GACAA,EAAAuD,MAAA,GAGAvD,EAIA,QAAA4D,GAAAD,GACA,IAAAA,EACA,QAGA,IAAArH,GAAAqH,EAAArH,MAEA,IAAAA,EAAA,EACA,QAGA,SAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,GACA,QAGA,QAAA4B,GAAA5B,EAAA,GAA2B4B,GAAA,EAAQA,IACnC,QAAAyF,EAAArD,WAAApC,GACA,QAIA,UAWA,QAAA4F,GAAAC,EAAAC,EAAAC,GACA,GAAAC,GAAAC,EAAAJ,EAAAjJ,OAAAkJ,EAAAlJ,OACA,YAAAoJ,EACAA,GAGAA,EAAAH,EAAA9I,aAAA+I,EAAA/I,aACA,IAAAiJ,EACAA,GAGAA,EAAAH,EAAA7I,eAAA8I,EAAA9I,eACA,IAAAgJ,GAAAD,EACAC,GAGAA,EAAAH,EAAAlJ,gBAAAmJ,EAAAnJ,gBACA,IAAAqJ,EACAA,GAGAA,EAAAH,EAAApJ,cAAAqJ,EAAArJ,cACA,IAAAuJ,EACAA,EAGAC,EAAAJ,EAAA5I,KAAA6I,EAAA7I,UAaA,QAAAiJ,GAAAL,EAAAC,EAAAK,GACA,GAAAH,GAAAH,EAAApJ,cAAAqJ,EAAArJ,aACA,YAAAuJ,EACAA,GAGAA,EAAAH,EAAAlJ,gBAAAmJ,EAAAnJ,gBACA,IAAAqJ,GAAAG,EACAH,GAGAA,EAAAC,EAAAJ,EAAAjJ,OAAAkJ,EAAAlJ,QACA,IAAAoJ,EACAA,GAGAA,EAAAH,EAAA9I,aAAA+I,EAAA/I,aACA,IAAAiJ,EACAA,GAGAA,EAAAH,EAAA7I,eAAA8I,EAAA9I,eACA,IAAAgJ,EACAA,EAGAC,EAAAJ,EAAA5I,KAAA6I,EAAA7I,UAIA,QAAAgJ,GAAAG,EAAAC,GACA,MAAAD,KAAAC,EACA,EAGA,OAAAD,EACA,EAGA,OAAAC,GACA,EAGAD,EAAAC,EACA,GAGA,EAOA,QAAAnG,GAAA2F,EAAAC,GACA,GAAAE,GAAAH,EAAApJ,cAAAqJ,EAAArJ,aACA,YAAAuJ,EACAA,GAGAA,EAAAH,EAAAlJ,gBAAAmJ,EAAAnJ,gBACA,IAAAqJ,EACAA,GAGAA,EAAAC,EAAAJ,EAAAjJ,OAAAkJ,EAAAlJ,QACA,IAAAoJ,EACAA,GAGAA,EAAAH,EAAA9I,aAAA+I,EAAA/I,aACA,IAAAiJ,EACAA,GAGAA,EAAAH,EAAA7I,eAAA8I,EAAA9I,eACA,IAAAgJ,EACAA,EAGAC,EAAAJ,EAAA5I,KAAA6I,EAAA7I,UASA,QAAAqJ,GAAAC,GACA,MAAAtH,MAAAuH,MAAAD,EAAAtB,QAAA,iBAAsC,KAQtC,QAAAwB,GAAAxK,EAAAyK,EAAAC,GA8BA,GA7BAD,KAAA,GAEAzK,IAEA,MAAAA,IAAAmC,OAAA,UAAAsI,EAAA,KACAzK,GAAA,KAOAyK,EAAAzK,EAAAyK,GAiBAC,EAAA,CACA,GAAAC,GAAAnD,EAAAkD,EACA,KAAAC,EACA,SAAArI,OAAA,mCAEA,IAAAqI,EAAA3C,KAAA,CAEA,GAAAkB,GAAAyB,EAAA3C,KAAAmB,YAAA,IACAD,IAAA,IACAyB,EAAA3C,KAAA2C,EAAA3C,KAAA4C,UAAA,EAAA1B,EAAA,IAGAuB,EAAA9H,EAAAsF,EAAA0C,GAAAF,GAGA,MAAArC,GAAAqC,GA3cA5M,EAAAqB,QAEA,IAAAyI,GAAA,iEACAmB,EAAA,eAeAjL,GAAA2J,WAsBA3J,EAAAoK,cAwDApK,EAAAuK,YA2DAvK,EAAA8E,OAEA9E,EAAA0K,WAAA,SAAAF,GACA,YAAAA,EAAAjC,OAAA,IAAAuB,EAAAkD,KAAAxC,IAyCAxK,EAAA+C,UAEA,IAAAkK,GAAA,WACA,GAAAC,GAAAhJ,OAAAC,OAAA,KACA,sBAAA+I,MAuBAlN,GAAAoE,YAAA6I,EAAAvB,EAAAtH,EASApE,EAAA6L,cAAAoB,EAAAvB,EAAAG,EAsEA7L,EAAA8L,6BAuCA9L,EAAAoM,sCAsDApM,EAAAoG,sCAUApG,EAAAwM,sBAqDAxM,EAAA2M,oBNqtBM,SAAU1M,EAAQD,EAASM,GO3qCjC,QAAAmB,KACArB,KAAA+M,UACA/M,KAAAgN,KAAAC,EAAA,GAAAC,KAAApJ,OAAAC,OAAA,MAZA,GAAA/C,GAAAd,EAAA,GACAmD,EAAAS,OAAAnC,UAAA6E,eACAyG,EAAA,mBAAAC,IAgBA7L,GAAA8L,UAAA,SAAAC,EAAAC,GAEA,OADAC,GAAA,GAAAjM,GACAyE,EAAA,EAAAC,EAAAqH,EAAAlJ,OAAsC4B,EAAAC,EAASD,IAC/CwH,EAAAhK,IAAA8J,EAAAtH,GAAAuH,EAEA,OAAAC,IASAjM,EAAAM,UAAA4L,KAAA,WACA,MAAAN,GAAAjN,KAAAgN,KAAAO,KAAAzJ,OAAA0J,oBAAAxN,KAAAgN,MAAA9I,QAQA7C,EAAAM,UAAA2B,IAAA,SAAAsE,EAAAyF,GACA,GAAAI,GAAAR,EAAArF,EAAA5G,EAAAgD,YAAA4D,GACA8F,EAAAT,EAAAjN,KAAAqD,IAAAuE,GAAAvE,EAAA9C,KAAAP,KAAAgN,KAAAS,GACAE,EAAA3N,KAAA+M,OAAA7I,MACAwJ,KAAAL,GACArN,KAAA+M,OAAAa,KAAAhG,GAEA8F,IACAT,EACAjN,KAAAgN,KAAAM,IAAA1F,EAAA+F,GAEA3N,KAAAgN,KAAAS,GAAAE,IAUAtM,EAAAM,UAAA0B,IAAA,SAAAuE,GACA,GAAAqF,EACA,MAAAjN,MAAAgN,KAAA3J,IAAAuE,EAEA,IAAA6F,GAAAzM,EAAAgD,YAAA4D,EACA,OAAAvE,GAAA9C,KAAAP,KAAAgN,KAAAS,IASApM,EAAAM,UAAAuE,QAAA,SAAA0B,GACA,GAAAqF,EAAA,CACA,GAAAU,GAAA3N,KAAAgN,KAAAa,IAAAjG,EACA,IAAA+F,GAAA,EACA,MAAAA,OAEG,CACH,GAAAF,GAAAzM,EAAAgD,YAAA4D,EACA,IAAAvE,EAAA9C,KAAAP,KAAAgN,KAAAS,GACA,MAAAzN,MAAAgN,KAAAS,GAIA,SAAApJ,OAAA,IAAAuD,EAAA,yBAQAvG,EAAAM,UAAAmM,GAAA,SAAAC,GACA,GAAAA,GAAA,GAAAA,EAAA/N,KAAA+M,OAAA7I,OACA,MAAAlE,MAAA+M,OAAAgB,EAEA,UAAA1J,OAAA,yBAAA0J,IAQA1M,EAAAM,UAAAkE,QAAA,WACA,MAAA7F,MAAA+M,OAAA5B,SAGAvL,EAAAyB,YPmsCM,SAAUxB,EAAQD,EAASM,GQ9yCjC,QAAA8N,GAAArC,EAAAC,GAEA,GAAAqC,GAAAtC,EAAApJ,cACA2L,EAAAtC,EAAArJ,cACA4L,EAAAxC,EAAAlJ,gBACA2L,EAAAxC,EAAAnJ,eACA,OAAAyL,GAAAD,GAAAC,GAAAD,GAAAG,GAAAD,GACAnN,EAAAgF,oCAAA2F,EAAAC,IAAA,EAQA,QAAApK,KACAxB,KAAA+M,UACA/M,KAAAqO,SAAA,EAEArO,KAAAsO,OAAgB/L,eAAA,EAAAE,gBAAA,GAzBhB,GAAAzB,GAAAd,EAAA,EAkCAsB,GAAAG,UAAA6C,gBACA,SAAA+J,EAAAC,GACAxO,KAAA+M,OAAA7J,QAAAqL,EAAAC,IAQAhN,EAAAG,UAAA2B,IAAA,SAAAmL,GACAT,EAAAhO,KAAAsO,MAAAG,IACAzO,KAAAsO,MAAAG,EACAzO,KAAA+M,OAAAa,KAAAa,KAEAzO,KAAAqO,SAAA,EACArO,KAAA+M,OAAAa,KAAAa,KAaAjN,EAAAG,UAAAkE,QAAA,WAKA,MAJA7F,MAAAqO,UACArO,KAAA+M,OAAA2B,KAAA1N,EAAAgF,qCACAhG,KAAAqO,SAAA,GAEArO,KAAA+M,QAGAnN,EAAA4B,eRk0CM,SAAU3B,EAAQD,EAASM,GSn4CjC,QAAAU,GAAA+N,EAAAC,GACA,GAAAC,GAAAF,CAKA,OAJA,gBAAAA,KACAE,EAAA7N,EAAAoL,oBAAAuC,IAGA,MAAAE,EAAAC,SACA,GAAAC,GAAAF,EAAAD,GACA,GAAAI,GAAAH,EAAAD,GA0QA,QAAAI,GAAAL,EAAAC,GACA,GAAAC,GAAAF,CACA,iBAAAA,KACAE,EAAA7N,EAAAoL,oBAAAuC,GAGA,IAAAjI,GAAA1F,EAAAC,OAAA4N,EAAA,WACA5L,EAAAjC,EAAAC,OAAA4N,EAAA,WAGAlI,EAAA3F,EAAAC,OAAA4N,EAAA,YACA9M,EAAAf,EAAAC,OAAA4N,EAAA,mBACAjI,EAAA5F,EAAAC,OAAA4N,EAAA,uBACAjJ,EAAA5E,EAAAC,OAAA4N,EAAA,YACA5M,EAAAjB,EAAAC,OAAA4N,EAAA,YAIA,IAAAnI,GAAA1G,KAAA4B,SACA,SAAAyC,OAAA,wBAAAqC,EAGA3E,KACAA,EAAAf,EAAAmJ,UAAApI,IAGAkB,IACAqD,IAAA3C,QAIA2C,IAAAtF,EAAAmJ,WAKA7D,IAAA,SAAA5D,GACA,MAAAX,IAAAf,EAAAsJ,WAAAvI,IAAAf,EAAAsJ,WAAA5H,GACA1B,EAAA2B,SAAAZ,EAAAW,GACAA,IAOA1C,KAAAsB,OAAAD,EAAA8L,UAAAxG,EAAAL,IAAA3C,SAAA,GACA3D,KAAAoB,SAAAC,EAAA8L,UAAAlK,GAAA,GAEAjD,KAAAiP,iBAAAjP,KAAAoB,SAAAyE,UAAAS,IAAA,SAAAiF,GACA,MAAAvK,GAAAuL,iBAAAxK,EAAAwJ,EAAAqD,KAGA5O,KAAA+B,aACA/B,KAAA4G,iBACA5G,KAAAuB,UAAAqE,EACA5F,KAAAkP,cAAAN,EACA5O,KAAAiC,OA4GA,QAAAkN,KACAnP,KAAAuC,cAAA,EACAvC,KAAAyC,gBAAA,EACAzC,KAAA0C,OAAA,KACA1C,KAAA6C,aAAA,KACA7C,KAAA8C,eAAA,KACA9C,KAAA+C,KAAA,KAkaA,QAAAgM,GAAAJ,EAAAC,GACA,GAAAC,GAAAF,CACA,iBAAAA,KACAE,EAAA7N,EAAAoL,oBAAAuC,GAGA,IAAAjI,GAAA1F,EAAAC,OAAA4N,EAAA,WACAC,EAAA9N,EAAAC,OAAA4N,EAAA,WAEA,IAAAnI,GAAA1G,KAAA4B,SACA,SAAAyC,OAAA,wBAAAqC,EAGA1G,MAAAoB,SAAA,GAAAC,GACArB,KAAAsB,OAAA,GAAAD,EAEA,IAAA+N,IACA9M,MAAA,EACAE,OAAA,EAEAxC,MAAAqP,UAAAP,EAAAxI,IAAA,SAAAiF,GACA,GAAAA,EAAArB,IAGA,SAAA7F,OAAA,qDAEA,IAAAiL,GAAAtO,EAAAC,OAAAsK,EAAA,UACAgE,EAAAvO,EAAAC,OAAAqO,EAAA,QACAE,EAAAxO,EAAAC,OAAAqO,EAAA,SAEA,IAAAC,EAAAH,EAAA9M,MACAiN,IAAAH,EAAA9M,MAAAkN,EAAAJ,EAAA5M,OACA,SAAA6B,OAAA,uDAIA,OAFA+K,GAAAE,GAGAG,iBAGAlN,cAAAgN,EAAA,EACA9M,gBAAA+M,EAAA,GAEAE,SAAA,GAAA9O,GAAAI,EAAAC,OAAAsK,EAAA,OAAAqD,MAh5BA,GAAA5N,GAAAd,EAAA,GACAyP,EAAAzP,EAAA,GACAmB,EAAAnB,EAAA,GAAAmB,SACAK,EAAAxB,EAAA,GACA0P,EAAA1P,EAAA,GAAA0P,SAaAhP,GAAAiB,cAAA,SAAA8M,EAAAC,GACA,MAAAI,GAAAnN,cAAA8M,EAAAC,IAMAhO,EAAAe,UAAAC,SAAA,EAgCAhB,EAAAe,UAAAkO,oBAAA,KACA/L,OAAAgM,eAAAlP,EAAAe,UAAA,sBACAoO,cAAA,EACAC,YAAA,EACAnC,IAAA,WAKA,MAJA7N,MAAA6P,qBACA7P,KAAAiQ,eAAAjQ,KAAAuB,UAAAvB,KAAA+B,YAGA/B,KAAA6P,uBAIAjP,EAAAe,UAAAuO,mBAAA,KACApM,OAAAgM,eAAAlP,EAAAe,UAAA,qBACAoO,cAAA,EACAC,YAAA,EACAnC,IAAA,WAKA,MAJA7N,MAAAkQ,oBACAlQ,KAAAiQ,eAAAjQ,KAAAuB,UAAAvB,KAAA+B,YAGA/B,KAAAkQ,sBAIAtP,EAAAe,UAAAwO,wBACA,SAAAvI,EAAAqD,GACA,GAAAxK,GAAAmH,EAAAO,OAAA8C,EACA,aAAAxK,GAAmB,MAAAA,GAQnBG,EAAAe,UAAAsO,eACA,SAAArI,EAAAvB,GACA,SAAAhC,OAAA,6CAGAzD,EAAAwP,gBAAA,EACAxP,EAAAyP,eAAA,EAEAzP,EAAA0P,qBAAA,EACA1P,EAAA2P,kBAAA,EAkBA3P,EAAAe,UAAAO,YACA,SAAAqM,EAAAiC,EAAAC,GACA,GAGA7K,GAHA8K,EAAAF,GAAA,KACAG,EAAAF,GAAA7P,EAAAwP,eAGA,QAAAO,GACA,IAAA/P,GAAAwP,gBACAxK,EAAA5F,KAAA4Q,kBACA,MACA,KAAAhQ,GAAAyP,eACAzK,EAAA5F,KAAA6Q,iBACA,MACA,SACA,SAAAxM,OAAA,+BAGA,GAAAtC,GAAA/B,KAAA+B,UACA6D,GAAAU,IAAA,SAAAnE,GACA,GAAAO,GAAA,OAAAP,EAAAO,OAAA,KAAA1C,KAAAoB,SAAA0M,GAAA3L,EAAAO,OAEA,OADAA,GAAA1B,EAAAuL,iBAAAxK,EAAAW,EAAA1C,KAAAkP,gBAEAxM,SACAH,cAAAJ,EAAAI,cACAE,gBAAAN,EAAAM,gBACAI,aAAAV,EAAAU,aACAC,eAAAX,EAAAW,eACAC,KAAA,OAAAZ,EAAAY,KAAA,KAAA/C,KAAAsB,OAAAwM,GAAA3L,EAAAY,QAEK/C,MAAAkD,QAAAqL,EAAAmC,IAyBL9P,EAAAe,UAAAmP,yBACA,SAAAhQ,GACA,GAAAwB,GAAAtB,EAAAC,OAAAH,EAAA,QAMAiQ,GACArO,OAAA1B,EAAAC,OAAAH,EAAA,UACA+B,aAAAP,EACAQ,eAAA9B,EAAAC,OAAAH,EAAA,YAIA,IADAiQ,EAAArO,OAAA1C,KAAAgR,iBAAAD,EAAArO,QACAqO,EAAArO,OAAA,EACA,QAGA,IAAAkD,MAEAqF,EAAAjL,KAAAiR,aAAAF,EACA/Q,KAAA6Q,kBACA,eACA,iBACA7P,EAAA0K,2BACAiE,EAAAY,kBACA,IAAAtF,GAAA,GACA,GAAA9I,GAAAnC,KAAA6Q,kBAAA5F,EAEA,IAAAiG,SAAApQ,EAAA0B,OAOA,IANA,GAAAK,GAAAV,EAAAU,aAMAV,KAAAU,kBACA+C,EAAAgI,MACAtL,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAgP,WAAAnQ,EAAAC,OAAAkB,EAAA,8BAGAA,EAAAnC,KAAA6Q,oBAAA5F,OASA,KANA,GAAAnI,GAAAX,EAAAW,eAMAX,GACAA,EAAAU,eAAAP,GACAH,EAAAW,mBACA8C,EAAAgI,MACAtL,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAgP,WAAAnQ,EAAAC,OAAAkB,EAAA,8BAGAA,EAAAnC,KAAA6Q,oBAAA5F,GAKA,MAAArF,IAGAhG,EAAAgB,oBAgGAoO,EAAArN,UAAAmC,OAAAC,OAAAnD,EAAAe,WACAqN,EAAArN,UAAA+N,SAAA9O,EAMAoO,EAAArN,UAAAqP,iBAAA,SAAAnM,GACA,GAAAuM,GAAAvM,CAKA,IAJA,MAAA7E,KAAA+B,aACAqP,EAAApQ,EAAA2B,SAAA3C,KAAA+B,WAAAqP,IAGApR,KAAAoB,SAAAiC,IAAA+N,GACA,MAAApR,MAAAoB,SAAA8E,QAAAkL,EAKA,IAAAtL,EACA,KAAAA,EAAA,EAAaA,EAAA9F,KAAAiP,iBAAA/K,SAAkC4B,EAC/C,GAAA9F,KAAAiP,iBAAAnJ,IAAAjB,EACA,MAAAiB,EAIA,WAYAkJ,EAAAnN,cACA,SAAA8M,EAAAC,GACA,GAAAyC,GAAAvN,OAAAC,OAAAiL,EAAArN,WAEAgF,EAAA0K,EAAA/P,OAAAD,EAAA8L,UAAAwB,EAAArN,OAAAuE,WAAA,GACA5C,EAAAoO,EAAAjQ,SAAAC,EAAA8L,UAAAwB,EAAAvN,SAAAyE,WAAA,EACAwL,GAAAtP,WAAA4M,EAAAzN,YACAmQ,EAAAzK,eAAA+H,EAAAxI,wBAAAkL,EAAAjQ,SAAAyE,UACAwL,EAAAtP,YACAsP,EAAApP,KAAA0M,EAAA5N,MACAsQ,EAAAnC,cAAAN,EACAyC,EAAApC,iBAAAoC,EAAAjQ,SAAAyE,UAAAS,IAAA,SAAAiF,GACA,MAAAvK,GAAAuL,iBAAA8E,EAAAtP,WAAAwJ,EAAAqD,IAYA,QAJA0C,GAAA3C,EAAApN,UAAAsE,UAAAsF,QACAoG,EAAAF,EAAAxB,uBACA2B,EAAAH,EAAAnB,sBAEApK,EAAA,EAAA5B,EAAAoN,EAAApN,OAAsD4B,EAAA5B,EAAY4B,IAAA,CAClE,GAAA2L,GAAAH,EAAAxL,GACA4L,EAAA,GAAAvC,EACAuC,GAAAnP,cAAAkP,EAAAlP,cACAmP,EAAAjP,gBAAAgP,EAAAhP,gBAEAgP,EAAA/O,SACAgP,EAAAhP,OAAAO,EAAAiD,QAAAuL,EAAA/O,QACAgP,EAAA7O,aAAA4O,EAAA5O,aACA6O,EAAA5O,eAAA2O,EAAA3O,eAEA2O,EAAA1O,OACA2O,EAAA3O,KAAA4D,EAAAT,QAAAuL,EAAA1O,OAGAyO,EAAA5D,KAAA8D,IAGAH,EAAA3D,KAAA8D,GAKA,MAFA9B,GAAAyB,EAAAnB,mBAAAlP,EAAA0K,4BAEA2F,GAMArC,EAAArN,UAAAC,SAAA,EAKAkC,OAAAgM,eAAAd,EAAArN,UAAA,WACAkM,IAAA,WACA,MAAA7N,MAAAiP,iBAAA9D,WAqBA6D,EAAArN,UAAAsO,eACA,SAAArI,EAAAvB,GAeA,IAdA,GAYAlE,GAAAkK,EAAAsF,EAAAC,EAAAxJ,EAZA7F,EAAA,EACA8C,EAAA,EACAG,EAAA,EACAD,EAAA,EACAG,EAAA,EACAD,EAAA,EACAvB,EAAA0D,EAAA1D,OACA+G,EAAA,EACA4G,KACAC,KACAC,KACAT,KAGArG,EAAA/G,GACA,SAAA0D,EAAAO,OAAA8C,GACA1I,IACA0I,IACA5F,EAAA,MAEA,UAAAuC,EAAAO,OAAA8C,GACAA,QAEA,CASA,IARA9I,EAAA,GAAAgN,GACAhN,EAAAI,gBAOAqP,EAAA3G,EAAyB2G,EAAA1N,IACzBlE,KAAAmQ,wBAAAvI,EAAAgK,GADuCA,KAQvC,GAHAvF,EAAAzE,EAAAuD,MAAAF,EAAA2G,GAEAD,EAAAE,EAAAxF,GAEApB,GAAAoB,EAAAnI,WACS,CAET,IADAyN,KACA1G,EAAA2G,GACAlQ,EAAAiG,OAAAC,EAAAqD,EAAA6G,GACA1J,EAAA0J,EAAA1J,MACA6C,EAAA6G,EAAAzJ,KACAsJ,EAAA/D,KAAAxF,EAGA,QAAAuJ,EAAAzN,OACA,SAAAG,OAAA,yCAGA,QAAAsN,EAAAzN,OACA,SAAAG,OAAA,yCAGAwN,GAAAxF,GAAAsF,EAIAxP,EAAAM,gBAAA4C,EAAAsM,EAAA,GACAtM,EAAAlD,EAAAM,gBAEAkP,EAAAzN,OAAA,IAEA/B,EAAAO,OAAAgD,EAAAiM,EAAA,GACAjM,GAAAiM,EAAA,GAGAxP,EAAAU,aAAA2C,EAAAmM,EAAA,GACAnM,EAAArD,EAAAU,aAEAV,EAAAU,cAAA,EAGAV,EAAAW,eAAAyC,EAAAoM,EAAA,GACApM,EAAApD,EAAAW,eAEA6O,EAAAzN,OAAA,IAEA/B,EAAAY,KAAA0C,EAAAkM,EAAA,GACAlM,GAAAkM,EAAA,KAIAL,EAAA1D,KAAAzL,GACA,gBAAAA,GAAAU,cACAkP,EAAAnE,KAAAzL,GAKAyN,EAAA0B,EAAAtQ,EAAAgL,qCACAhM,KAAA6P,oBAAAyB,EAEA1B,EAAAmC,EAAA/Q,EAAA0K,4BACA1L,KAAAkQ,mBAAA6B,GAOA/C,EAAArN,UAAAsP,aACA,SAAAe,EAAAC,EAAAC,EACAC,EAAAC,EAAAC,GAMA,GAAAL,EAAAE,IAAA,EACA,SAAAzJ,WAAA,gDACAuJ,EAAAE,GAEA,IAAAF,EAAAG,GAAA,EACA,SAAA1J,WAAA,kDACAuJ,EAAAG,GAGA,OAAAxC,GAAA2C,OAAAN,EAAAC,EAAAG,EAAAC,IAOArD,EAAArN,UAAA4Q,mBACA,WACA,OAAAtH,GAAA,EAAuBA,EAAAjL,KAAA4Q,mBAAA1M,SAAwC+G,EAAA,CAC/D,GAAA9I,GAAAnC,KAAA4Q,mBAAA3F,EAMA,IAAAA,EAAA,EAAAjL,KAAA4Q,mBAAA1M,OAAA,CACA,GAAAsO,GAAAxS,KAAA4Q,mBAAA3F,EAAA,EAEA,IAAA9I,EAAAI,gBAAAiQ,EAAAjQ,cAAA,CACAJ,EAAAsQ,oBAAAD,EAAA/P,gBAAA,CACA,WAKAN,EAAAsQ,oBAAAC,MA4BA1D,EAAArN,UAAA8C,oBACA,SAAA3D,GACA,GAAAiQ,IACAxO,cAAAvB,EAAAC,OAAAH,EAAA,QACA2B,gBAAAzB,EAAAC,OAAAH,EAAA,WAGAmK,EAAAjL,KAAAiR,aACAF,EACA/Q,KAAA4Q,mBACA,gBACA,kBACA5P,EAAAgL,oCACAhL,EAAAC,OAAAH,EAAA,OAAAF,EAAA0P,sBAGA,IAAArF,GAAA,GACA,GAAA9I,GAAAnC,KAAA4Q,mBAAA3F,EAEA,IAAA9I,EAAAI,gBAAAwO,EAAAxO,cAAA,CACA,GAAAG,GAAA1B,EAAAC,OAAAkB,EAAA,cACA,QAAAO,IACAA,EAAA1C,KAAAoB,SAAA0M,GAAApL,GACAA,EAAA1B,EAAAuL,iBAAAvM,KAAA+B,WAAAW,EAAA1C,KAAAkP,eAEA,IAAAnM,GAAA/B,EAAAC,OAAAkB,EAAA,YAIA,OAHA,QAAAY,IACAA,EAAA/C,KAAAsB,OAAAwM,GAAA/K,KAGAL,SACAJ,KAAAtB,EAAAC,OAAAkB,EAAA,qBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,uBACAY,SAKA,OACAL,OAAA,KACAJ,KAAA,KACAE,OAAA,KACAO,KAAA,OAQAiM,EAAArN,UAAAgR,wBACA,WACA,QAAA3S,KAAA4G,iBAGA5G,KAAA4G,eAAA1C,QAAAlE,KAAAoB,SAAAmM,SACAvN,KAAA4G,eAAAgM,KAAA,SAAAC,GAA+C,aAAAA,MAQ/C7D,EAAArN,UAAA6B,iBACA,SAAAqB,EAAAiO,GACA,IAAA9S,KAAA4G,eACA,WAGA,IAAAqE,GAAAjL,KAAAgR,iBAAAnM,EACA,IAAAoG,GAAA,EACA,MAAAjL,MAAA4G,eAAAqE,EAGA,IAAAmG,GAAAvM,CACA,OAAA7E,KAAA+B,aACAqP,EAAApQ,EAAA2B,SAAA3C,KAAA+B,WAAAqP,GAGA,IAAAlH,EACA,UAAAlK,KAAA+B,aACAmI,EAAAlJ,EAAAuI,SAAAvJ,KAAA+B,aAAA,CAKA,GAAAgR,GAAA3B,EAAArG,QAAA,gBACA,YAAAb,EAAAP,QACA3J,KAAAoB,SAAAiC,IAAA0P,GACA,MAAA/S,MAAA4G,eAAA5G,KAAAoB,SAAA8E,QAAA6M,GAGA,MAAA7I,EAAAH,MAAA,KAAAG,EAAAH,OACA/J,KAAAoB,SAAAiC,IAAA,IAAA+N,GACA,MAAApR,MAAA4G,eAAA5G,KAAAoB,SAAA8E,QAAA,IAAAkL,IAQA,GAAA0B,EACA,WAGA,UAAAzO,OAAA,IAAA+M,EAAA,+BA2BApC,EAAArN,UAAAqR,qBACA,SAAAlS,GACA,GAAA4B,GAAA1B,EAAAC,OAAAH,EAAA,SAEA,IADA4B,EAAA1C,KAAAgR,iBAAAtO,GACAA,EAAA,EACA,OACAJ,KAAA,KACAE,OAAA,KACA2O,WAAA,KAIA,IAAAJ,IACArO,SACAG,aAAA7B,EAAAC,OAAAH,EAAA,QACAgC,eAAA9B,EAAAC,OAAAH,EAAA,WAGAmK,EAAAjL,KAAAiR,aACAF,EACA/Q,KAAA6Q,kBACA,eACA,iBACA7P,EAAA0K,2BACA1K,EAAAC,OAAAH,EAAA,OAAAF,EAAA0P,sBAGA,IAAArF,GAAA,GACA,GAAA9I,GAAAnC,KAAA6Q,kBAAA5F,EAEA,IAAA9I,EAAAO,SAAAqO,EAAArO,OACA,OACAJ,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAgP,WAAAnQ,EAAAC,OAAAkB,EAAA,6BAKA,OACAG,KAAA,KACAE,OAAA,KACA2O,WAAA,OAIAvR,EAAAoP,yBAmGAD,EAAApN,UAAAmC,OAAAC,OAAAnD,EAAAe,WACAoN,EAAApN,UAAAsR,YAAArS,EAKAmO,EAAApN,UAAAC,SAAA,EAKAkC,OAAAgM,eAAAf,EAAApN,UAAA,WACAkM,IAAA,WAEA,OADA5K,MACA6C,EAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAC9C,OAAAoN,GAAA,EAAqBA,EAAAlT,KAAAqP,UAAAvJ,GAAA4J,SAAAzM,QAAAiB,OAA+CgP,IACpEjQ,EAAA2K,KAAA5N,KAAAqP,UAAAvJ,GAAA4J,SAAAzM,QAAAiQ,GAGA,OAAAjQ,MAuBA8L,EAAApN,UAAA8C,oBACA,SAAA3D,GACA,GAAAiQ,IACAxO,cAAAvB,EAAAC,OAAAH,EAAA,QACA2B,gBAAAzB,EAAAC,OAAAH,EAAA,WAKAqS,EAAAxD,EAAA2C,OAAAvB,EAAA/Q,KAAAqP,UACA,SAAA0B,EAAAqC,GACA,GAAAtH,GAAAiF,EAAAxO,cAAA6Q,EAAA3D,gBAAAlN,aACA,OAAAuJ,GACAA,EAGAiF,EAAAtO,gBACA2Q,EAAA3D,gBAAAhN,kBAEA2Q,EAAApT,KAAAqP,UAAA8D,EAEA,OAAAC,GASAA,EAAA1D,SAAAjL,qBACAnC,KAAAyO,EAAAxO,eACA6Q,EAAA3D,gBAAAlN,cAAA,GACAC,OAAAuO,EAAAtO,iBACA2Q,EAAA3D,gBAAAlN,gBAAAwO,EAAAxO,cACA6Q,EAAA3D,gBAAAhN,gBAAA,EACA,GACA4Q,KAAAvS,EAAAuS,QAdA3Q,OAAA,KACAJ,KAAA,KACAE,OAAA,KACAO,KAAA,OAmBAgM,EAAApN,UAAAgR,wBACA,WACA,MAAA3S,MAAAqP,UAAAiE,MAAA,SAAA/H,GACA,MAAAA,GAAAmE,SAAAiD,6BASA5D,EAAApN,UAAA6B,iBACA,SAAAqB,EAAAiO,GACA,OAAAhN,GAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAAA,CAC9C,GAAAsN,GAAApT,KAAAqP,UAAAvJ,GAEAvC,EAAA6P,EAAA1D,SAAAlM,iBAAAqB,GAAA,EACA,IAAAtB,EACA,MAAAA,GAGA,GAAAuP,EACA,WAGA,UAAAzO,OAAA,IAAAQ,EAAA,+BAsBAkK,EAAApN,UAAAqR,qBACA,SAAAlS,GACA,OAAAgF,GAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAAA,CAC9C,GAAAsN,GAAApT,KAAAqP,UAAAvJ,EAIA,IAAAsN,EAAA1D,SAAAsB,iBAAAhQ,EAAAC,OAAAH,EAAA,iBAGA,GAAAyS,GAAAH,EAAA1D,SAAAsD,qBAAAlS,EACA,IAAAyS,EAAA,CACA,GAAAC,IACAlR,KAAAiR,EAAAjR,MACA8Q,EAAA3D,gBAAAlN,cAAA,GACAC,OAAA+Q,EAAA/Q,QACA4Q,EAAA3D,gBAAAlN,gBAAAgR,EAAAjR,KACA8Q,EAAA3D,gBAAAhN,gBAAA,EACA,GAEA,OAAA+Q,KAIA,OACAlR,KAAA,KACAE,OAAA,OASAuM,EAAApN,UAAAsO,eACA,SAAArI,EAAAvB,GACArG,KAAA6P,uBACA7P,KAAAkQ,qBACA,QAAApK,GAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAG9C,OAFAsN,GAAApT,KAAAqP,UAAAvJ,GACA2N,EAAAL,EAAA1D,SAAAkB,mBACAsC,EAAA,EAAqBA,EAAAO,EAAAvP,OAA4BgP,IAAA,CACjD,GAAA/Q,GAAAsR,EAAAP,GAEAxQ,EAAA0Q,EAAA1D,SAAAtO,SAAA0M,GAAA3L,EAAAO,OACAA,GAAA1B,EAAAuL,iBAAA6G,EAAA1D,SAAA3N,WAAAW,EAAA1C,KAAAkP,eACAlP,KAAAoB,SAAAkC,IAAAZ,GACAA,EAAA1C,KAAAoB,SAAA8E,QAAAxD,EAEA,IAAAK,GAAA,IACAZ,GAAAY,OACAA,EAAAqQ,EAAA1D,SAAApO,OAAAwM,GAAA3L,EAAAY,MACA/C,KAAAsB,OAAAgC,IAAAP,GACAA,EAAA/C,KAAAsB,OAAA4E,QAAAnD,GAOA,IAAA2Q,IACAhR,SACAH,cAAAJ,EAAAI,eACA6Q,EAAA3D,gBAAAlN,cAAA,GACAE,gBAAAN,EAAAM,iBACA2Q,EAAA3D,gBAAAlN,gBAAAJ,EAAAI,cACA6Q,EAAA3D,gBAAAhN,gBAAA,EACA,GACAI,aAAAV,EAAAU,aACAC,eAAAX,EAAAW,eACAC,OAGA/C,MAAA6P,oBAAAjC,KAAA8F,GACA,gBAAAA,GAAA7Q,cACA7C,KAAAkQ,mBAAAtC,KAAA8F,GAKA9D,EAAA5P,KAAA6P,oBAAA7O,EAAAgL,qCACA4D,EAAA5P,KAAAkQ,mBAAAlP,EAAA0K,6BAGA9L,EAAAmP,4BTu5CM,SAAUlP,EAAQD,GUx/ExB,QAAA+T,GAAAC,EAAAC,EAAA7B,EAAA8B,EAAAC,EAAA1B,GAUA,GAAA2B,GAAAC,KAAAC,OAAAL,EAAAD,GAAA,GAAAA,EACA9H,EAAAiI,EAAA/B,EAAA8B,EAAAE,IAAA,EACA,YAAAlI,EAEAkI,EAEAlI,EAAA,EAEA+H,EAAAG,EAAA,EAEAL,EAAAK,EAAAH,EAAA7B,EAAA8B,EAAAC,EAAA1B,GAKAA,GAAAzS,EAAA2Q,kBACAsD,EAAAC,EAAA5P,OAAA2P,GAAA,EAEAG,EAKAA,EAAAJ,EAAA,EAEAD,EAAAC,EAAAI,EAAAhC,EAAA8B,EAAAC,EAAA1B,GAIAA,GAAAzS,EAAA2Q,kBACAyD,EAEAJ,EAAA,KAAAA,EA1DAhU,EAAA0Q,qBAAA,EACA1Q,EAAA2Q,kBAAA,EAgFA3Q,EAAA0S,OAAA,SAAAN,EAAA8B,EAAAC,EAAA1B,GACA,OAAAyB,EAAA5P,OACA,QAGA,IAAA+G,GAAA0I,GAAA,EAAAG,EAAA5P,OAAA8N,EAAA8B,EACAC,EAAA1B,GAAAzS,EAAA0Q,qBACA,IAAArF,EAAA,EACA,QAMA,MAAAA,EAAA,MACA,IAAA8I,EAAAD,EAAA7I,GAAA6I,EAAA7I,EAAA,UAGAA,CAGA,OAAAA,KVuhFM,SAAUpL,EAAQD,GWzmFxB,QAAAuU,GAAAC,EAAAC,EAAAC,GACA,GAAAxC,GAAAsC,EAAAC,EACAD,GAAAC,GAAAD,EAAAE,GACAF,EAAAE,GAAAxC,EAWA,QAAAyC,GAAAC,EAAAC,GACA,MAAAR,MAAAS,MAAAF,EAAAP,KAAAU,UAAAF,EAAAD,IAeA,QAAAI,GAAAR,EAAAS,EAAAnU,EAAAoU,GAKA,GAAApU,EAAAoU,EAAA,CAYA,GAAAC,GAAAR,EAAA7T,EAAAoU,GACAhP,EAAApF,EAAA,CAEAyT,GAAAC,EAAAW,EAAAD,EASA,QARAE,GAAAZ,EAAAU,GAQA5B,EAAAxS,EAAmBwS,EAAA4B,EAAO5B,IAC1B2B,EAAAT,EAAAlB,GAAA8B,IAAA,IACAlP,GAAA,EACAqO,EAAAC,EAAAtO,EAAAoN,GAIAiB,GAAAC,EAAAtO,EAAA,EAAAoN,EACA,IAAA+B,GAAAnP,EAAA,CAIA8O,GAAAR,EAAAS,EAAAnU,EAAAuU,EAAA,GACAL,EAAAR,EAAAS,EAAAI,EAAA,EAAAH,IAYAlV,EAAAgQ,UAAA,SAAAwE,EAAAS,GACAD,EAAAR,EAAAS,EAAA,EAAAT,EAAAlQ,OAAA,KX4oFM,SAAUrE,EAAQD,EAASM,GY1tFjC,QAAAW,GAAAqU,EAAAC,EAAAtQ,EAAAuQ,EAAAtQ,GACA9E,KAAAqV,YACArV,KAAAsV,kBACAtV,KAAAsC,KAAA,MAAA4S,EAAA,KAAAA,EACAlV,KAAAwC,OAAA,MAAA2S,EAAA,KAAAA,EACAnV,KAAA0C,OAAA,MAAAmC,EAAA,KAAAA,EACA7E,KAAA+C,KAAA,MAAA+B,EAAA,KAAAA,EACA9E,KAAAuV,IAAA,EACA,MAAAH,GAAApV,KAAAsD,IAAA8R,GAnCA,GAAAzU,GAAAT,EAAA,GAAAS,mBACAK,EAAAd,EAAA,GAIAsV,EAAA,UAGAC,EAAA,GAKAF,EAAA,oBAiCA1U,GAAA6U,wBACA,SAAAC,EAAA7T,EAAA8T,GA+FA,QAAAC,GAAA1T,EAAA2T,GACA,UAAA3T,GAAA+O,SAAA/O,EAAAO,OACAqT,EAAAzS,IAAAwS,OACO,CACP,GAAApT,GAAAkT,EACA5U,EAAA0D,KAAAkR,EAAAzT,EAAAO,QACAP,EAAAO,MACAqT,GAAAzS,IAAA,GAAAzC,GAAAsB,EAAAU,aACAV,EAAAW,eACAJ,EACAoT,EACA3T,EAAAY,QAvGA,GAAAgT,GAAA,GAAAlV,GAMAmV,EAAAL,EAAApN,MAAAiN,GACAS,EAAA,EACAC,EAAA,WAMA,QAAAC,KACA,MAAAF,GAAAD,EAAA9R,OACA8R,EAAAC,KAAA/E,OAPA,GAAAkF,GAAAD,IAEAE,EAAAF,KAAA,EACA,OAAAC,GAAAC,GASAC,EAAA,EAAA7D,EAAA,EAKA8D,EAAA,IAgEA,OA9DAzU,GAAAI,YAAA,SAAAC,GACA,UAAAoU,EAAA,CAGA,KAAAD,EAAAnU,EAAAI,eAMS,CAIT,GAAAiU,GAAAR,EAAAC,IAAA,GACAH,EAAAU,EAAAnL,OAAA,EAAAlJ,EAAAM,gBACAgQ,EAOA,OANAuD,GAAAC,GAAAO,EAAAnL,OAAAlJ,EAAAM,gBACAgQ,GACAA,EAAAtQ,EAAAM,gBACAoT,EAAAU,EAAAT,QAEAS,EAAApU,GAhBA0T,EAAAU,EAAAL,KACAI,IACA7D,EAAA,EAqBA,KAAA6D,EAAAnU,EAAAI,eACAwT,EAAAzS,IAAA4S,KACAI,GAEA,IAAA7D,EAAAtQ,EAAAM,gBAAA,CACA,GAAA+T,GAAAR,EAAAC,IAAA,EACAF,GAAAzS,IAAAkT,EAAAnL,OAAA,EAAAlJ,EAAAM,kBACAuT,EAAAC,GAAAO,EAAAnL,OAAAlJ,EAAAM,iBACAgQ,EAAAtQ,EAAAM,gBAEA8T,EAAApU,GACKnC,MAELiW,EAAAD,EAAA9R,SACAqS,GAEAV,EAAAU,EAAAL,KAGAH,EAAAzS,IAAA0S,EAAAvL,OAAAwL,GAAAvR,KAAA,MAIA5C,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAI,GAAAzB,EAAA0B,iBAAAL,EACA,OAAAI,IACA,MAAAqS,IACAzS,EAAAnC,EAAA0D,KAAAkR,EAAAzS,IAEA4S,EAAAtS,iBAAAN,EAAAI,MAIAwS,GAwBAlV,EAAAc,UAAA2B,IAAA,SAAAmT,GACA,GAAArL,MAAAsL,QAAAD,GACAA,EAAAvT,QAAA,SAAAyT,GACA3W,KAAAsD,IAAAqT,IACK3W,UAEL,KAAAyW,EAAAlB,IAAA,gBAAAkB,GAMA,SAAAhO,WACA,8EAAAgO,EANAA,IACAzW,KAAAqV,SAAAzH,KAAA6I,GAQA,MAAAzW,OASAa,EAAAc,UAAAiV,QAAA,SAAAH,GACA,GAAArL,MAAAsL,QAAAD,GACA,OAAA3Q,GAAA2Q,EAAAvS,OAAA,EAAiC4B,GAAA,EAAQA,IACzC9F,KAAA4W,QAAAH,EAAA3Q,QAGA,KAAA2Q,EAAAlB,IAAA,gBAAAkB,GAIA,SAAAhO,WACA,8EAAAgO,EAJAzW,MAAAqV,SAAAwB,QAAAJ,GAOA,MAAAzW,OAUAa,EAAAc,UAAAmV,KAAA,SAAAC,GAEA,OADAJ,GACA7Q,EAAA,EAAAC,EAAA/F,KAAAqV,SAAAnR,OAA6C4B,EAAAC,EAASD,IACtD6Q,EAAA3W,KAAAqV,SAAAvP,GACA6Q,EAAApB,GACAoB,EAAAG,KAAAC,GAGA,KAAAJ,GACAI,EAAAJ,GAAoBjU,OAAA1C,KAAA0C,OACpBJ,KAAAtC,KAAAsC,KACAE,OAAAxC,KAAAwC,OACAO,KAAA/C,KAAA+C,QAYAlC,EAAAc,UAAA+C,KAAA,SAAAsS,GACA,GAAAC,GACAnR,EACAC,EAAA/F,KAAAqV,SAAAnR,MACA,IAAA6B,EAAA,GAEA,IADAkR,KACAnR,EAAA,EAAeA,EAAAC,EAAA,EAAWD,IAC1BmR,EAAArJ,KAAA5N,KAAAqV,SAAAvP,IACAmR,EAAArJ,KAAAoJ,EAEAC,GAAArJ,KAAA5N,KAAAqV,SAAAvP,IACA9F,KAAAqV,SAAA4B,EAEA,MAAAjX,OAUAa,EAAAc,UAAAuV,aAAA,SAAAC,EAAAC,GACA,GAAAC,GAAArX,KAAAqV,SAAArV,KAAAqV,SAAAnR,OAAA,EAUA,OATAmT,GAAA9B,GACA8B,EAAAH,aAAAC,EAAAC,GAEA,gBAAAC,GACArX,KAAAqV,SAAArV,KAAAqV,SAAAnR,OAAA,GAAAmT,EAAAtM,QAAAoM,EAAAC,GAGApX,KAAAqV,SAAAzH,KAAA,GAAA7C,QAAAoM,EAAAC,IAEApX,MAUAa,EAAAc,UAAA8B,iBACA,SAAAG,EAAAC,GACA7D,KAAAsV,eAAAtU,EAAAgD,YAAAJ,IAAAC,GASAhD,EAAAc,UAAA2V,mBACA,SAAAP,GACA,OAAAjR,GAAA,EAAAC,EAAA/F,KAAAqV,SAAAnR,OAA+C4B,EAAAC,EAASD,IACxD9F,KAAAqV,SAAAvP,GAAAyP,IACAvV,KAAAqV,SAAAvP,GAAAwR,mBAAAP,EAKA,QADA9T,GAAAa,OAAAG,KAAAjE,KAAAsV,gBACAxP,EAAA,EAAAC,EAAA9C,EAAAiB,OAAyC4B,EAAAC,EAASD,IAClDiR,EAAA/V,EAAAyK,cAAAxI,EAAA6C,IAAA9F,KAAAsV,eAAArS,EAAA6C,MAQAjF,EAAAc,UAAAkF,SAAA,WACA,GAAAwF,GAAA,EAIA,OAHArM,MAAA8W,KAAA,SAAAH,GACAtK,GAAAsK,IAEAtK,GAOAxL,EAAAc,UAAA4V,sBAAA,SAAAzW,GACA,GAAAuB,IACAyT,KAAA,GACAxT,KAAA,EACAE,OAAA,GAEA8D,EAAA,GAAA3F,GAAAG,GACA0W,GAAA,EACAC,EAAA,KACAC,EAAA,KACAC,EAAA,KACAC,EAAA,IAqEA,OApEA5X,MAAA8W,KAAA,SAAAH,EAAA/T,GACAP,EAAAyT,MAAAa,EACA,OAAA/T,EAAAF,QACA,OAAAE,EAAAN,MACA,OAAAM,EAAAJ,QACAiV,IAAA7U,EAAAF,QACAgV,IAAA9U,EAAAN,MACAqV,IAAA/U,EAAAJ,QACAoV,IAAAhV,EAAAG,MACAuD,EAAAtD,YACAN,OAAAE,EAAAF,OACAE,UACAN,KAAAM,EAAAN,KACAE,OAAAI,EAAAJ,QAEAH,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,QAEAO,KAAAH,EAAAG,OAGA0U,EAAA7U,EAAAF,OACAgV,EAAA9U,EAAAN,KACAqV,EAAA/U,EAAAJ,OACAoV,EAAAhV,EAAAG,KACAyU,GAAA,GACKA,IACLlR,EAAAtD,YACAX,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,UAGAiV,EAAA,KACAD,GAAA,EAEA,QAAA7J,GAAA,EAAAzJ,EAAAyS,EAAAzS,OAA4CyJ,EAAAzJ,EAAcyJ,IAC1DgJ,EAAAzO,WAAAyF,KAAA8H,GACApT,EAAAC,OACAD,EAAAG,OAAA,EAEAmL,EAAA,IAAAzJ,GACAuT,EAAA,KACAD,GAAA,GACSA,GACTlR,EAAAtD,YACAN,OAAAE,EAAAF,OACAE,UACAN,KAAAM,EAAAN,KACAE,OAAAI,EAAAJ,QAEAH,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,QAEAO,KAAAH,EAAAG,QAIAV,EAAAG,WAIAxC,KAAAsX,mBAAA,SAAAnU,EAAA0U,GACAvR,EAAA7C,iBAAAN,EAAA0U,MAGU/B,KAAAzT,EAAAyT,KAAAxP,QAGV1G,EAAAiB","file":"source-map.min.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"sourceMap\"] = factory();\n\telse\n\t\troot[\"sourceMap\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition","(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"sourceMap\"] = factory();\n\telse\n\t\troot[\"sourceMap\"] = factory();\n})(this, function() {\nreturn /******/ (function(modules) { // webpackBootstrap\n/******/ \t// The module cache\n/******/ \tvar installedModules = {};\n/******/\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/\n/******/ \t\t// Check if module is in cache\n/******/ \t\tif(installedModules[moduleId])\n/******/ \t\t\treturn installedModules[moduleId].exports;\n/******/\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = installedModules[moduleId] = {\n/******/ \t\t\texports: {},\n/******/ \t\t\tid: moduleId,\n/******/ \t\t\tloaded: false\n/******/ \t\t};\n/******/\n/******/ \t\t// Execute the module function\n/******/ \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n/******/\n/******/ \t\t// Flag the module as loaded\n/******/ \t\tmodule.loaded = true;\n/******/\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/\n/******/\n/******/ \t// expose the modules object (__webpack_modules__)\n/******/ \t__webpack_require__.m = modules;\n/******/\n/******/ \t// expose the module cache\n/******/ \t__webpack_require__.c = installedModules;\n/******/\n/******/ \t// __webpack_public_path__\n/******/ \t__webpack_require__.p = \"\";\n/******/\n/******/ \t// Load entry module and return exports\n/******/ \treturn __webpack_require__(0);\n/******/ })\n/************************************************************************/\n/******/ ([\n/* 0 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/*\n\t * Copyright 2009-2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE.txt or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\texports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;\n\texports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer;\n\texports.SourceNode = __webpack_require__(10).SourceNode;\n\n\n/***/ }),\n/* 1 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar base64VLQ = __webpack_require__(2);\n\tvar util = __webpack_require__(4);\n\tvar ArraySet = __webpack_require__(5).ArraySet;\n\tvar MappingList = __webpack_require__(6).MappingList;\n\t\n\t/**\n\t * An instance of the SourceMapGenerator represents a source map which is\n\t * being built incrementally. You may pass an object with the following\n\t * properties:\n\t *\n\t * - file: The filename of the generated source.\n\t * - sourceRoot: A root for all relative URLs in this source map.\n\t */\n\tfunction SourceMapGenerator(aArgs) {\n\t if (!aArgs) {\n\t aArgs = {};\n\t }\n\t this._file = util.getArg(aArgs, 'file', null);\n\t this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);\n\t this._skipValidation = util.getArg(aArgs, 'skipValidation', false);\n\t this._sources = new ArraySet();\n\t this._names = new ArraySet();\n\t this._mappings = new MappingList();\n\t this._sourcesContents = null;\n\t}\n\t\n\tSourceMapGenerator.prototype._version = 3;\n\t\n\t/**\n\t * Creates a new SourceMapGenerator based on a SourceMapConsumer\n\t *\n\t * @param aSourceMapConsumer The SourceMap.\n\t */\n\tSourceMapGenerator.fromSourceMap =\n\t function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {\n\t var sourceRoot = aSourceMapConsumer.sourceRoot;\n\t var generator = new SourceMapGenerator({\n\t file: aSourceMapConsumer.file,\n\t sourceRoot: sourceRoot\n\t });\n\t aSourceMapConsumer.eachMapping(function (mapping) {\n\t var newMapping = {\n\t generated: {\n\t line: mapping.generatedLine,\n\t column: mapping.generatedColumn\n\t }\n\t };\n\t\n\t if (mapping.source != null) {\n\t newMapping.source = mapping.source;\n\t if (sourceRoot != null) {\n\t newMapping.source = util.relative(sourceRoot, newMapping.source);\n\t }\n\t\n\t newMapping.original = {\n\t line: mapping.originalLine,\n\t column: mapping.originalColumn\n\t };\n\t\n\t if (mapping.name != null) {\n\t newMapping.name = mapping.name;\n\t }\n\t }\n\t\n\t generator.addMapping(newMapping);\n\t });\n\t aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t var sourceRelative = sourceFile;\n\t if (sourceRoot !== null) {\n\t sourceRelative = util.relative(sourceRoot, sourceFile);\n\t }\n\t\n\t if (!generator._sources.has(sourceRelative)) {\n\t generator._sources.add(sourceRelative);\n\t }\n\t\n\t var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t if (content != null) {\n\t generator.setSourceContent(sourceFile, content);\n\t }\n\t });\n\t return generator;\n\t };\n\t\n\t/**\n\t * Add a single mapping from original source line and column to the generated\n\t * source's line and column for this source map being created. The mapping\n\t * object should have the following properties:\n\t *\n\t * - generated: An object with the generated line and column positions.\n\t * - original: An object with the original line and column positions.\n\t * - source: The original source file (relative to the sourceRoot).\n\t * - name: An optional original token name for this mapping.\n\t */\n\tSourceMapGenerator.prototype.addMapping =\n\t function SourceMapGenerator_addMapping(aArgs) {\n\t var generated = util.getArg(aArgs, 'generated');\n\t var original = util.getArg(aArgs, 'original', null);\n\t var source = util.getArg(aArgs, 'source', null);\n\t var name = util.getArg(aArgs, 'name', null);\n\t\n\t if (!this._skipValidation) {\n\t this._validateMapping(generated, original, source, name);\n\t }\n\t\n\t if (source != null) {\n\t source = String(source);\n\t if (!this._sources.has(source)) {\n\t this._sources.add(source);\n\t }\n\t }\n\t\n\t if (name != null) {\n\t name = String(name);\n\t if (!this._names.has(name)) {\n\t this._names.add(name);\n\t }\n\t }\n\t\n\t this._mappings.add({\n\t generatedLine: generated.line,\n\t generatedColumn: generated.column,\n\t originalLine: original != null && original.line,\n\t originalColumn: original != null && original.column,\n\t source: source,\n\t name: name\n\t });\n\t };\n\t\n\t/**\n\t * Set the source content for a source file.\n\t */\n\tSourceMapGenerator.prototype.setSourceContent =\n\t function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {\n\t var source = aSourceFile;\n\t if (this._sourceRoot != null) {\n\t source = util.relative(this._sourceRoot, source);\n\t }\n\t\n\t if (aSourceContent != null) {\n\t // Add the source content to the _sourcesContents map.\n\t // Create a new _sourcesContents map if the property is null.\n\t if (!this._sourcesContents) {\n\t this._sourcesContents = Object.create(null);\n\t }\n\t this._sourcesContents[util.toSetString(source)] = aSourceContent;\n\t } else if (this._sourcesContents) {\n\t // Remove the source file from the _sourcesContents map.\n\t // If the _sourcesContents map is empty, set the property to null.\n\t delete this._sourcesContents[util.toSetString(source)];\n\t if (Object.keys(this._sourcesContents).length === 0) {\n\t this._sourcesContents = null;\n\t }\n\t }\n\t };\n\t\n\t/**\n\t * Applies the mappings of a sub-source-map for a specific source file to the\n\t * source map being generated. Each mapping to the supplied source file is\n\t * rewritten using the supplied source map. Note: The resolution for the\n\t * resulting mappings is the minimium of this map and the supplied map.\n\t *\n\t * @param aSourceMapConsumer The source map to be applied.\n\t * @param aSourceFile Optional. The filename of the source file.\n\t * If omitted, SourceMapConsumer's file property will be used.\n\t * @param aSourceMapPath Optional. The dirname of the path to the source map\n\t * to be applied. If relative, it is relative to the SourceMapConsumer.\n\t * This parameter is needed when the two source maps aren't in the same\n\t * directory, and the source map to be applied contains relative source\n\t * paths. If so, those relative source paths need to be rewritten\n\t * relative to the SourceMapGenerator.\n\t */\n\tSourceMapGenerator.prototype.applySourceMap =\n\t function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {\n\t var sourceFile = aSourceFile;\n\t // If aSourceFile is omitted, we will use the file property of the SourceMap\n\t if (aSourceFile == null) {\n\t if (aSourceMapConsumer.file == null) {\n\t throw new Error(\n\t 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +\n\t 'or the source map\\'s \"file\" property. Both were omitted.'\n\t );\n\t }\n\t sourceFile = aSourceMapConsumer.file;\n\t }\n\t var sourceRoot = this._sourceRoot;\n\t // Make \"sourceFile\" relative if an absolute Url is passed.\n\t if (sourceRoot != null) {\n\t sourceFile = util.relative(sourceRoot, sourceFile);\n\t }\n\t // Applying the SourceMap can add and remove items from the sources and\n\t // the names array.\n\t var newSources = new ArraySet();\n\t var newNames = new ArraySet();\n\t\n\t // Find mappings for the \"sourceFile\"\n\t this._mappings.unsortedForEach(function (mapping) {\n\t if (mapping.source === sourceFile && mapping.originalLine != null) {\n\t // Check if it can be mapped by the source map, then update the mapping.\n\t var original = aSourceMapConsumer.originalPositionFor({\n\t line: mapping.originalLine,\n\t column: mapping.originalColumn\n\t });\n\t if (original.source != null) {\n\t // Copy mapping\n\t mapping.source = original.source;\n\t if (aSourceMapPath != null) {\n\t mapping.source = util.join(aSourceMapPath, mapping.source)\n\t }\n\t if (sourceRoot != null) {\n\t mapping.source = util.relative(sourceRoot, mapping.source);\n\t }\n\t mapping.originalLine = original.line;\n\t mapping.originalColumn = original.column;\n\t if (original.name != null) {\n\t mapping.name = original.name;\n\t }\n\t }\n\t }\n\t\n\t var source = mapping.source;\n\t if (source != null && !newSources.has(source)) {\n\t newSources.add(source);\n\t }\n\t\n\t var name = mapping.name;\n\t if (name != null && !newNames.has(name)) {\n\t newNames.add(name);\n\t }\n\t\n\t }, this);\n\t this._sources = newSources;\n\t this._names = newNames;\n\t\n\t // Copy sourcesContents of applied map.\n\t aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t if (content != null) {\n\t if (aSourceMapPath != null) {\n\t sourceFile = util.join(aSourceMapPath, sourceFile);\n\t }\n\t if (sourceRoot != null) {\n\t sourceFile = util.relative(sourceRoot, sourceFile);\n\t }\n\t this.setSourceContent(sourceFile, content);\n\t }\n\t }, this);\n\t };\n\t\n\t/**\n\t * A mapping can have one of the three levels of data:\n\t *\n\t * 1. Just the generated position.\n\t * 2. The Generated position, original position, and original source.\n\t * 3. Generated and original position, original source, as well as a name\n\t * token.\n\t *\n\t * To maintain consistency, we validate that any new mapping being added falls\n\t * in to one of these categories.\n\t */\n\tSourceMapGenerator.prototype._validateMapping =\n\t function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,\n\t aName) {\n\t // When aOriginal is truthy but has empty values for .line and .column,\n\t // it is most likely a programmer error. In this case we throw a very\n\t // specific error message to try to guide them the right way.\n\t // For example: https://github.com/Polymer/polymer-bundler/pull/519\n\t if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {\n\t throw new Error(\n\t 'original.line and original.column are not numbers -- you probably meant to omit ' +\n\t 'the original mapping entirely and only map the generated position. If so, pass ' +\n\t 'null for the original mapping instead of an object with empty or null values.'\n\t );\n\t }\n\t\n\t if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n\t && aGenerated.line > 0 && aGenerated.column >= 0\n\t && !aOriginal && !aSource && !aName) {\n\t // Case 1.\n\t return;\n\t }\n\t else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n\t && aOriginal && 'line' in aOriginal && 'column' in aOriginal\n\t && aGenerated.line > 0 && aGenerated.column >= 0\n\t && aOriginal.line > 0 && aOriginal.column >= 0\n\t && aSource) {\n\t // Cases 2 and 3.\n\t return;\n\t }\n\t else {\n\t throw new Error('Invalid mapping: ' + JSON.stringify({\n\t generated: aGenerated,\n\t source: aSource,\n\t original: aOriginal,\n\t name: aName\n\t }));\n\t }\n\t };\n\t\n\t/**\n\t * Serialize the accumulated mappings in to the stream of base 64 VLQs\n\t * specified by the source map format.\n\t */\n\tSourceMapGenerator.prototype._serializeMappings =\n\t function SourceMapGenerator_serializeMappings() {\n\t var previousGeneratedColumn = 0;\n\t var previousGeneratedLine = 1;\n\t var previousOriginalColumn = 0;\n\t var previousOriginalLine = 0;\n\t var previousName = 0;\n\t var previousSource = 0;\n\t var result = '';\n\t var next;\n\t var mapping;\n\t var nameIdx;\n\t var sourceIdx;\n\t\n\t var mappings = this._mappings.toArray();\n\t for (var i = 0, len = mappings.length; i < len; i++) {\n\t mapping = mappings[i];\n\t next = ''\n\t\n\t if (mapping.generatedLine !== previousGeneratedLine) {\n\t previousGeneratedColumn = 0;\n\t while (mapping.generatedLine !== previousGeneratedLine) {\n\t next += ';';\n\t previousGeneratedLine++;\n\t }\n\t }\n\t else {\n\t if (i > 0) {\n\t if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {\n\t continue;\n\t }\n\t next += ',';\n\t }\n\t }\n\t\n\t next += base64VLQ.encode(mapping.generatedColumn\n\t - previousGeneratedColumn);\n\t previousGeneratedColumn = mapping.generatedColumn;\n\t\n\t if (mapping.source != null) {\n\t sourceIdx = this._sources.indexOf(mapping.source);\n\t next += base64VLQ.encode(sourceIdx - previousSource);\n\t previousSource = sourceIdx;\n\t\n\t // lines are stored 0-based in SourceMap spec version 3\n\t next += base64VLQ.encode(mapping.originalLine - 1\n\t - previousOriginalLine);\n\t previousOriginalLine = mapping.originalLine - 1;\n\t\n\t next += base64VLQ.encode(mapping.originalColumn\n\t - previousOriginalColumn);\n\t previousOriginalColumn = mapping.originalColumn;\n\t\n\t if (mapping.name != null) {\n\t nameIdx = this._names.indexOf(mapping.name);\n\t next += base64VLQ.encode(nameIdx - previousName);\n\t previousName = nameIdx;\n\t }\n\t }\n\t\n\t result += next;\n\t }\n\t\n\t return result;\n\t };\n\t\n\tSourceMapGenerator.prototype._generateSourcesContent =\n\t function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {\n\t return aSources.map(function (source) {\n\t if (!this._sourcesContents) {\n\t return null;\n\t }\n\t if (aSourceRoot != null) {\n\t source = util.relative(aSourceRoot, source);\n\t }\n\t var key = util.toSetString(source);\n\t return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)\n\t ? this._sourcesContents[key]\n\t : null;\n\t }, this);\n\t };\n\t\n\t/**\n\t * Externalize the source map.\n\t */\n\tSourceMapGenerator.prototype.toJSON =\n\t function SourceMapGenerator_toJSON() {\n\t var map = {\n\t version: this._version,\n\t sources: this._sources.toArray(),\n\t names: this._names.toArray(),\n\t mappings: this._serializeMappings()\n\t };\n\t if (this._file != null) {\n\t map.file = this._file;\n\t }\n\t if (this._sourceRoot != null) {\n\t map.sourceRoot = this._sourceRoot;\n\t }\n\t if (this._sourcesContents) {\n\t map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);\n\t }\n\t\n\t return map;\n\t };\n\t\n\t/**\n\t * Render the source map being generated to a string.\n\t */\n\tSourceMapGenerator.prototype.toString =\n\t function SourceMapGenerator_toString() {\n\t return JSON.stringify(this.toJSON());\n\t };\n\t\n\texports.SourceMapGenerator = SourceMapGenerator;\n\n\n/***/ }),\n/* 2 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t *\n\t * Based on the Base 64 VLQ implementation in Closure Compiler:\n\t * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java\n\t *\n\t * Copyright 2011 The Closure Compiler Authors. All rights reserved.\n\t * Redistribution and use in source and binary forms, with or without\n\t * modification, are permitted provided that the following conditions are\n\t * met:\n\t *\n\t * * Redistributions of source code must retain the above copyright\n\t * notice, this list of conditions and the following disclaimer.\n\t * * Redistributions in binary form must reproduce the above\n\t * copyright notice, this list of conditions and the following\n\t * disclaimer in the documentation and/or other materials provided\n\t * with the distribution.\n\t * * Neither the name of Google Inc. nor the names of its\n\t * contributors may be used to endorse or promote products derived\n\t * from this software without specific prior written permission.\n\t *\n\t * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n\t * \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n\t * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n\t * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n\t * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n\t * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n\t * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n\t * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n\t * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n\t * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n\t * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n\t */\n\t\n\tvar base64 = __webpack_require__(3);\n\t\n\t// A single base 64 digit can contain 6 bits of data. For the base 64 variable\n\t// length quantities we use in the source map spec, the first bit is the sign,\n\t// the next four bits are the actual value, and the 6th bit is the\n\t// continuation bit. The continuation bit tells us whether there are more\n\t// digits in this value following this digit.\n\t//\n\t// Continuation\n\t// | Sign\n\t// | |\n\t// V V\n\t// 101011\n\t\n\tvar VLQ_BASE_SHIFT = 5;\n\t\n\t// binary: 100000\n\tvar VLQ_BASE = 1 << VLQ_BASE_SHIFT;\n\t\n\t// binary: 011111\n\tvar VLQ_BASE_MASK = VLQ_BASE - 1;\n\t\n\t// binary: 100000\n\tvar VLQ_CONTINUATION_BIT = VLQ_BASE;\n\t\n\t/**\n\t * Converts from a two-complement value to a value where the sign bit is\n\t * placed in the least significant bit. For example, as decimals:\n\t * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary)\n\t * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary)\n\t */\n\tfunction toVLQSigned(aValue) {\n\t return aValue < 0\n\t ? ((-aValue) << 1) + 1\n\t : (aValue << 1) + 0;\n\t}\n\t\n\t/**\n\t * Converts to a two-complement value from a value where the sign bit is\n\t * placed in the least significant bit. For example, as decimals:\n\t * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1\n\t * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2\n\t */\n\tfunction fromVLQSigned(aValue) {\n\t var isNegative = (aValue & 1) === 1;\n\t var shifted = aValue >> 1;\n\t return isNegative\n\t ? -shifted\n\t : shifted;\n\t}\n\t\n\t/**\n\t * Returns the base 64 VLQ encoded value.\n\t */\n\texports.encode = function base64VLQ_encode(aValue) {\n\t var encoded = \"\";\n\t var digit;\n\t\n\t var vlq = toVLQSigned(aValue);\n\t\n\t do {\n\t digit = vlq & VLQ_BASE_MASK;\n\t vlq >>>= VLQ_BASE_SHIFT;\n\t if (vlq > 0) {\n\t // There are still more digits in this value, so we must make sure the\n\t // continuation bit is marked.\n\t digit |= VLQ_CONTINUATION_BIT;\n\t }\n\t encoded += base64.encode(digit);\n\t } while (vlq > 0);\n\t\n\t return encoded;\n\t};\n\t\n\t/**\n\t * Decodes the next base 64 VLQ value from the given string and returns the\n\t * value and the rest of the string via the out parameter.\n\t */\n\texports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {\n\t var strLen = aStr.length;\n\t var result = 0;\n\t var shift = 0;\n\t var continuation, digit;\n\t\n\t do {\n\t if (aIndex >= strLen) {\n\t throw new Error(\"Expected more digits in base 64 VLQ value.\");\n\t }\n\t\n\t digit = base64.decode(aStr.charCodeAt(aIndex++));\n\t if (digit === -1) {\n\t throw new Error(\"Invalid base64 digit: \" + aStr.charAt(aIndex - 1));\n\t }\n\t\n\t continuation = !!(digit & VLQ_CONTINUATION_BIT);\n\t digit &= VLQ_BASE_MASK;\n\t result = result + (digit << shift);\n\t shift += VLQ_BASE_SHIFT;\n\t } while (continuation);\n\t\n\t aOutParam.value = fromVLQSigned(result);\n\t aOutParam.rest = aIndex;\n\t};\n\n\n/***/ }),\n/* 3 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');\n\t\n\t/**\n\t * Encode an integer in the range of 0 to 63 to a single base 64 digit.\n\t */\n\texports.encode = function (number) {\n\t if (0 <= number && number < intToCharMap.length) {\n\t return intToCharMap[number];\n\t }\n\t throw new TypeError(\"Must be between 0 and 63: \" + number);\n\t};\n\t\n\t/**\n\t * Decode a single base 64 character code digit to an integer. Returns -1 on\n\t * failure.\n\t */\n\texports.decode = function (charCode) {\n\t var bigA = 65; // 'A'\n\t var bigZ = 90; // 'Z'\n\t\n\t var littleA = 97; // 'a'\n\t var littleZ = 122; // 'z'\n\t\n\t var zero = 48; // '0'\n\t var nine = 57; // '9'\n\t\n\t var plus = 43; // '+'\n\t var slash = 47; // '/'\n\t\n\t var littleOffset = 26;\n\t var numberOffset = 52;\n\t\n\t // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ\n\t if (bigA <= charCode && charCode <= bigZ) {\n\t return (charCode - bigA);\n\t }\n\t\n\t // 26 - 51: abcdefghijklmnopqrstuvwxyz\n\t if (littleA <= charCode && charCode <= littleZ) {\n\t return (charCode - littleA + littleOffset);\n\t }\n\t\n\t // 52 - 61: 0123456789\n\t if (zero <= charCode && charCode <= nine) {\n\t return (charCode - zero + numberOffset);\n\t }\n\t\n\t // 62: +\n\t if (charCode == plus) {\n\t return 62;\n\t }\n\t\n\t // 63: /\n\t if (charCode == slash) {\n\t return 63;\n\t }\n\t\n\t // Invalid base64 digit.\n\t return -1;\n\t};\n\n\n/***/ }),\n/* 4 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\t/**\n\t * This is a helper function for getting values from parameter/options\n\t * objects.\n\t *\n\t * @param args The object we are extracting values from\n\t * @param name The name of the property we are getting.\n\t * @param defaultValue An optional value to return if the property is missing\n\t * from the object. If this is not specified and the property is missing, an\n\t * error will be thrown.\n\t */\n\tfunction getArg(aArgs, aName, aDefaultValue) {\n\t if (aName in aArgs) {\n\t return aArgs[aName];\n\t } else if (arguments.length === 3) {\n\t return aDefaultValue;\n\t } else {\n\t throw new Error('\"' + aName + '\" is a required argument.');\n\t }\n\t}\n\texports.getArg = getArg;\n\t\n\tvar urlRegexp = /^(?:([\\w+\\-.]+):)?\\/\\/(?:(\\w+:\\w+)@)?([\\w.-]*)(?::(\\d+))?(.*)$/;\n\tvar dataUrlRegexp = /^data:.+\\,.+$/;\n\t\n\tfunction urlParse(aUrl) {\n\t var match = aUrl.match(urlRegexp);\n\t if (!match) {\n\t return null;\n\t }\n\t return {\n\t scheme: match[1],\n\t auth: match[2],\n\t host: match[3],\n\t port: match[4],\n\t path: match[5]\n\t };\n\t}\n\texports.urlParse = urlParse;\n\t\n\tfunction urlGenerate(aParsedUrl) {\n\t var url = '';\n\t if (aParsedUrl.scheme) {\n\t url += aParsedUrl.scheme + ':';\n\t }\n\t url += '//';\n\t if (aParsedUrl.auth) {\n\t url += aParsedUrl.auth + '@';\n\t }\n\t if (aParsedUrl.host) {\n\t url += aParsedUrl.host;\n\t }\n\t if (aParsedUrl.port) {\n\t url += \":\" + aParsedUrl.port\n\t }\n\t if (aParsedUrl.path) {\n\t url += aParsedUrl.path;\n\t }\n\t return url;\n\t}\n\texports.urlGenerate = urlGenerate;\n\t\n\t/**\n\t * Normalizes a path, or the path portion of a URL:\n\t *\n\t * - Replaces consecutive slashes with one slash.\n\t * - Removes unnecessary '.' parts.\n\t * - Removes unnecessary '<dir>/..' parts.\n\t *\n\t * Based on code in the Node.js 'path' core module.\n\t *\n\t * @param aPath The path or url to normalize.\n\t */\n\tfunction normalize(aPath) {\n\t var path = aPath;\n\t var url = urlParse(aPath);\n\t if (url) {\n\t if (!url.path) {\n\t return aPath;\n\t }\n\t path = url.path;\n\t }\n\t var isAbsolute = exports.isAbsolute(path);\n\t\n\t var parts = path.split(/\\/+/);\n\t for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {\n\t part = parts[i];\n\t if (part === '.') {\n\t parts.splice(i, 1);\n\t } else if (part === '..') {\n\t up++;\n\t } else if (up > 0) {\n\t if (part === '') {\n\t // The first part is blank if the path is absolute. Trying to go\n\t // above the root is a no-op. Therefore we can remove all '..' parts\n\t // directly after the root.\n\t parts.splice(i + 1, up);\n\t up = 0;\n\t } else {\n\t parts.splice(i, 2);\n\t up--;\n\t }\n\t }\n\t }\n\t path = parts.join('/');\n\t\n\t if (path === '') {\n\t path = isAbsolute ? '/' : '.';\n\t }\n\t\n\t if (url) {\n\t url.path = path;\n\t return urlGenerate(url);\n\t }\n\t return path;\n\t}\n\texports.normalize = normalize;\n\t\n\t/**\n\t * Joins two paths/URLs.\n\t *\n\t * @param aRoot The root path or URL.\n\t * @param aPath The path or URL to be joined with the root.\n\t *\n\t * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a\n\t * scheme-relative URL: Then the scheme of aRoot, if any, is prepended\n\t * first.\n\t * - Otherwise aPath is a path. If aRoot is a URL, then its path portion\n\t * is updated with the result and aRoot is returned. Otherwise the result\n\t * is returned.\n\t * - If aPath is absolute, the result is aPath.\n\t * - Otherwise the two paths are joined with a slash.\n\t * - Joining for example 'http://' and 'www.example.com' is also supported.\n\t */\n\tfunction join(aRoot, aPath) {\n\t if (aRoot === \"\") {\n\t aRoot = \".\";\n\t }\n\t if (aPath === \"\") {\n\t aPath = \".\";\n\t }\n\t var aPathUrl = urlParse(aPath);\n\t var aRootUrl = urlParse(aRoot);\n\t if (aRootUrl) {\n\t aRoot = aRootUrl.path || '/';\n\t }\n\t\n\t // `join(foo, '//www.example.org')`\n\t if (aPathUrl && !aPathUrl.scheme) {\n\t if (aRootUrl) {\n\t aPathUrl.scheme = aRootUrl.scheme;\n\t }\n\t return urlGenerate(aPathUrl);\n\t }\n\t\n\t if (aPathUrl || aPath.match(dataUrlRegexp)) {\n\t return aPath;\n\t }\n\t\n\t // `join('http://', 'www.example.com')`\n\t if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {\n\t aRootUrl.host = aPath;\n\t return urlGenerate(aRootUrl);\n\t }\n\t\n\t var joined = aPath.charAt(0) === '/'\n\t ? aPath\n\t : normalize(aRoot.replace(/\\/+$/, '') + '/' + aPath);\n\t\n\t if (aRootUrl) {\n\t aRootUrl.path = joined;\n\t return urlGenerate(aRootUrl);\n\t }\n\t return joined;\n\t}\n\texports.join = join;\n\t\n\texports.isAbsolute = function (aPath) {\n\t return aPath.charAt(0) === '/' || urlRegexp.test(aPath);\n\t};\n\t\n\t/**\n\t * Make a path relative to a URL or another path.\n\t *\n\t * @param aRoot The root path or URL.\n\t * @param aPath The path or URL to be made relative to aRoot.\n\t */\n\tfunction relative(aRoot, aPath) {\n\t if (aRoot === \"\") {\n\t aRoot = \".\";\n\t }\n\t\n\t aRoot = aRoot.replace(/\\/$/, '');\n\t\n\t // It is possible for the path to be above the root. In this case, simply\n\t // checking whether the root is a prefix of the path won't work. Instead, we\n\t // need to remove components from the root one by one, until either we find\n\t // a prefix that fits, or we run out of components to remove.\n\t var level = 0;\n\t while (aPath.indexOf(aRoot + '/') !== 0) {\n\t var index = aRoot.lastIndexOf(\"/\");\n\t if (index < 0) {\n\t return aPath;\n\t }\n\t\n\t // If the only part of the root that is left is the scheme (i.e. http://,\n\t // file:///, etc.), one or more slashes (/), or simply nothing at all, we\n\t // have exhausted all components, so the path is not relative to the root.\n\t aRoot = aRoot.slice(0, index);\n\t if (aRoot.match(/^([^\\/]+:\\/)?\\/*$/)) {\n\t return aPath;\n\t }\n\t\n\t ++level;\n\t }\n\t\n\t // Make sure we add a \"../\" for each component we removed from the root.\n\t return Array(level + 1).join(\"../\") + aPath.substr(aRoot.length + 1);\n\t}\n\texports.relative = relative;\n\t\n\tvar supportsNullProto = (function () {\n\t var obj = Object.create(null);\n\t return !('__proto__' in obj);\n\t}());\n\t\n\tfunction identity (s) {\n\t return s;\n\t}\n\t\n\t/**\n\t * Because behavior goes wacky when you set `__proto__` on objects, we\n\t * have to prefix all the strings in our set with an arbitrary character.\n\t *\n\t * See https://github.com/mozilla/source-map/pull/31 and\n\t * https://github.com/mozilla/source-map/issues/30\n\t *\n\t * @param String aStr\n\t */\n\tfunction toSetString(aStr) {\n\t if (isProtoString(aStr)) {\n\t return '$' + aStr;\n\t }\n\t\n\t return aStr;\n\t}\n\texports.toSetString = supportsNullProto ? identity : toSetString;\n\t\n\tfunction fromSetString(aStr) {\n\t if (isProtoString(aStr)) {\n\t return aStr.slice(1);\n\t }\n\t\n\t return aStr;\n\t}\n\texports.fromSetString = supportsNullProto ? identity : fromSetString;\n\t\n\tfunction isProtoString(s) {\n\t if (!s) {\n\t return false;\n\t }\n\t\n\t var length = s.length;\n\t\n\t if (length < 9 /* \"__proto__\".length */) {\n\t return false;\n\t }\n\t\n\t if (s.charCodeAt(length - 1) !== 95 /* '_' */ ||\n\t s.charCodeAt(length - 2) !== 95 /* '_' */ ||\n\t s.charCodeAt(length - 3) !== 111 /* 'o' */ ||\n\t s.charCodeAt(length - 4) !== 116 /* 't' */ ||\n\t s.charCodeAt(length - 5) !== 111 /* 'o' */ ||\n\t s.charCodeAt(length - 6) !== 114 /* 'r' */ ||\n\t s.charCodeAt(length - 7) !== 112 /* 'p' */ ||\n\t s.charCodeAt(length - 8) !== 95 /* '_' */ ||\n\t s.charCodeAt(length - 9) !== 95 /* '_' */) {\n\t return false;\n\t }\n\t\n\t for (var i = length - 10; i >= 0; i--) {\n\t if (s.charCodeAt(i) !== 36 /* '$' */) {\n\t return false;\n\t }\n\t }\n\t\n\t return true;\n\t}\n\t\n\t/**\n\t * Comparator between two mappings where the original positions are compared.\n\t *\n\t * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n\t * mappings with the same original source/line/column, but different generated\n\t * line and column the same. Useful when searching for a mapping with a\n\t * stubbed out mapping.\n\t */\n\tfunction compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {\n\t var cmp = strcmp(mappingA.source, mappingB.source);\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalLine - mappingB.originalLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t if (cmp !== 0 || onlyCompareOriginal) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t return strcmp(mappingA.name, mappingB.name);\n\t}\n\texports.compareByOriginalPositions = compareByOriginalPositions;\n\t\n\t/**\n\t * Comparator between two mappings with deflated source and name indices where\n\t * the generated positions are compared.\n\t *\n\t * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n\t * mappings with the same generated line and column, but different\n\t * source/name/original line and column the same. Useful when searching for a\n\t * mapping with a stubbed out mapping.\n\t */\n\tfunction compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {\n\t var cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t if (cmp !== 0 || onlyCompareGenerated) {\n\t return cmp;\n\t }\n\t\n\t cmp = strcmp(mappingA.source, mappingB.source);\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalLine - mappingB.originalLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t return strcmp(mappingA.name, mappingB.name);\n\t}\n\texports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;\n\t\n\tfunction strcmp(aStr1, aStr2) {\n\t if (aStr1 === aStr2) {\n\t return 0;\n\t }\n\t\n\t if (aStr1 === null) {\n\t return 1; // aStr2 !== null\n\t }\n\t\n\t if (aStr2 === null) {\n\t return -1; // aStr1 !== null\n\t }\n\t\n\t if (aStr1 > aStr2) {\n\t return 1;\n\t }\n\t\n\t return -1;\n\t}\n\t\n\t/**\n\t * Comparator between two mappings with inflated source and name strings where\n\t * the generated positions are compared.\n\t */\n\tfunction compareByGeneratedPositionsInflated(mappingA, mappingB) {\n\t var cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = strcmp(mappingA.source, mappingB.source);\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalLine - mappingB.originalLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t return strcmp(mappingA.name, mappingB.name);\n\t}\n\texports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;\n\t\n\t/**\n\t * Strip any JSON XSSI avoidance prefix from the string (as documented\n\t * in the source maps specification), and then parse the string as\n\t * JSON.\n\t */\n\tfunction parseSourceMapInput(str) {\n\t return JSON.parse(str.replace(/^\\)]}'[^\\n]*\\n/, ''));\n\t}\n\texports.parseSourceMapInput = parseSourceMapInput;\n\t\n\t/**\n\t * Compute the URL of a source given the the source root, the source's\n\t * URL, and the source map's URL.\n\t */\n\tfunction computeSourceURL(sourceRoot, sourceURL, sourceMapURL) {\n\t sourceURL = sourceURL || '';\n\t\n\t if (sourceRoot) {\n\t // This follows what Chrome does.\n\t if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') {\n\t sourceRoot += '/';\n\t }\n\t // The spec says:\n\t // Line 4: An optional source root, useful for relocating source\n\t // files on a server or removing repeated values in the\n\t // “sources” entry. This value is prepended to the individual\n\t // entries in the “source” field.\n\t sourceURL = sourceRoot + sourceURL;\n\t }\n\t\n\t // Historically, SourceMapConsumer did not take the sourceMapURL as\n\t // a parameter. This mode is still somewhat supported, which is why\n\t // this code block is conditional. However, it's preferable to pass\n\t // the source map URL to SourceMapConsumer, so that this function\n\t // can implement the source URL resolution algorithm as outlined in\n\t // the spec. This block is basically the equivalent of:\n\t // new URL(sourceURL, sourceMapURL).toString()\n\t // ... except it avoids using URL, which wasn't available in the\n\t // older releases of node still supported by this library.\n\t //\n\t // The spec says:\n\t // If the sources are not absolute URLs after prepending of the\n\t // “sourceRoot”, the sources are resolved relative to the\n\t // SourceMap (like resolving script src in a html document).\n\t if (sourceMapURL) {\n\t var parsed = urlParse(sourceMapURL);\n\t if (!parsed) {\n\t throw new Error(\"sourceMapURL could not be parsed\");\n\t }\n\t if (parsed.path) {\n\t // Strip the last path component, but keep the \"/\".\n\t var index = parsed.path.lastIndexOf('/');\n\t if (index >= 0) {\n\t parsed.path = parsed.path.substring(0, index + 1);\n\t }\n\t }\n\t sourceURL = join(urlGenerate(parsed), sourceURL);\n\t }\n\t\n\t return normalize(sourceURL);\n\t}\n\texports.computeSourceURL = computeSourceURL;\n\n\n/***/ }),\n/* 5 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\tvar has = Object.prototype.hasOwnProperty;\n\tvar hasNativeMap = typeof Map !== \"undefined\";\n\t\n\t/**\n\t * A data structure which is a combination of an array and a set. Adding a new\n\t * member is O(1), testing for membership is O(1), and finding the index of an\n\t * element is O(1). Removing elements from the set is not supported. Only\n\t * strings are supported for membership.\n\t */\n\tfunction ArraySet() {\n\t this._array = [];\n\t this._set = hasNativeMap ? new Map() : Object.create(null);\n\t}\n\t\n\t/**\n\t * Static method for creating ArraySet instances from an existing array.\n\t */\n\tArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {\n\t var set = new ArraySet();\n\t for (var i = 0, len = aArray.length; i < len; i++) {\n\t set.add(aArray[i], aAllowDuplicates);\n\t }\n\t return set;\n\t};\n\t\n\t/**\n\t * Return how many unique items are in this ArraySet. If duplicates have been\n\t * added, than those do not count towards the size.\n\t *\n\t * @returns Number\n\t */\n\tArraySet.prototype.size = function ArraySet_size() {\n\t return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;\n\t};\n\t\n\t/**\n\t * Add the given string to this set.\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {\n\t var sStr = hasNativeMap ? aStr : util.toSetString(aStr);\n\t var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);\n\t var idx = this._array.length;\n\t if (!isDuplicate || aAllowDuplicates) {\n\t this._array.push(aStr);\n\t }\n\t if (!isDuplicate) {\n\t if (hasNativeMap) {\n\t this._set.set(aStr, idx);\n\t } else {\n\t this._set[sStr] = idx;\n\t }\n\t }\n\t};\n\t\n\t/**\n\t * Is the given string a member of this set?\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.has = function ArraySet_has(aStr) {\n\t if (hasNativeMap) {\n\t return this._set.has(aStr);\n\t } else {\n\t var sStr = util.toSetString(aStr);\n\t return has.call(this._set, sStr);\n\t }\n\t};\n\t\n\t/**\n\t * What is the index of the given string in the array?\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {\n\t if (hasNativeMap) {\n\t var idx = this._set.get(aStr);\n\t if (idx >= 0) {\n\t return idx;\n\t }\n\t } else {\n\t var sStr = util.toSetString(aStr);\n\t if (has.call(this._set, sStr)) {\n\t return this._set[sStr];\n\t }\n\t }\n\t\n\t throw new Error('\"' + aStr + '\" is not in the set.');\n\t};\n\t\n\t/**\n\t * What is the element at the given index?\n\t *\n\t * @param Number aIdx\n\t */\n\tArraySet.prototype.at = function ArraySet_at(aIdx) {\n\t if (aIdx >= 0 && aIdx < this._array.length) {\n\t return this._array[aIdx];\n\t }\n\t throw new Error('No element indexed by ' + aIdx);\n\t};\n\t\n\t/**\n\t * Returns the array representation of this set (which has the proper indices\n\t * indicated by indexOf). Note that this is a copy of the internal array used\n\t * for storing the members so that no one can mess with internal state.\n\t */\n\tArraySet.prototype.toArray = function ArraySet_toArray() {\n\t return this._array.slice();\n\t};\n\t\n\texports.ArraySet = ArraySet;\n\n\n/***/ }),\n/* 6 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2014 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\t\n\t/**\n\t * Determine whether mappingB is after mappingA with respect to generated\n\t * position.\n\t */\n\tfunction generatedPositionAfter(mappingA, mappingB) {\n\t // Optimized for most common case\n\t var lineA = mappingA.generatedLine;\n\t var lineB = mappingB.generatedLine;\n\t var columnA = mappingA.generatedColumn;\n\t var columnB = mappingB.generatedColumn;\n\t return lineB > lineA || lineB == lineA && columnB >= columnA ||\n\t util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;\n\t}\n\t\n\t/**\n\t * A data structure to provide a sorted view of accumulated mappings in a\n\t * performance conscious manner. It trades a neglibable overhead in general\n\t * case for a large speedup in case of mappings being added in order.\n\t */\n\tfunction MappingList() {\n\t this._array = [];\n\t this._sorted = true;\n\t // Serves as infimum\n\t this._last = {generatedLine: -1, generatedColumn: 0};\n\t}\n\t\n\t/**\n\t * Iterate through internal items. This method takes the same arguments that\n\t * `Array.prototype.forEach` takes.\n\t *\n\t * NOTE: The order of the mappings is NOT guaranteed.\n\t */\n\tMappingList.prototype.unsortedForEach =\n\t function MappingList_forEach(aCallback, aThisArg) {\n\t this._array.forEach(aCallback, aThisArg);\n\t };\n\t\n\t/**\n\t * Add the given source mapping.\n\t *\n\t * @param Object aMapping\n\t */\n\tMappingList.prototype.add = function MappingList_add(aMapping) {\n\t if (generatedPositionAfter(this._last, aMapping)) {\n\t this._last = aMapping;\n\t this._array.push(aMapping);\n\t } else {\n\t this._sorted = false;\n\t this._array.push(aMapping);\n\t }\n\t};\n\t\n\t/**\n\t * Returns the flat, sorted array of mappings. The mappings are sorted by\n\t * generated position.\n\t *\n\t * WARNING: This method returns internal data without copying, for\n\t * performance. The return value must NOT be mutated, and should be treated as\n\t * an immutable borrow. If you want to take ownership, you must make your own\n\t * copy.\n\t */\n\tMappingList.prototype.toArray = function MappingList_toArray() {\n\t if (!this._sorted) {\n\t this._array.sort(util.compareByGeneratedPositionsInflated);\n\t this._sorted = true;\n\t }\n\t return this._array;\n\t};\n\t\n\texports.MappingList = MappingList;\n\n\n/***/ }),\n/* 7 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\tvar binarySearch = __webpack_require__(8);\n\tvar ArraySet = __webpack_require__(5).ArraySet;\n\tvar base64VLQ = __webpack_require__(2);\n\tvar quickSort = __webpack_require__(9).quickSort;\n\t\n\tfunction SourceMapConsumer(aSourceMap, aSourceMapURL) {\n\t var sourceMap = aSourceMap;\n\t if (typeof aSourceMap === 'string') {\n\t sourceMap = util.parseSourceMapInput(aSourceMap);\n\t }\n\t\n\t return sourceMap.sections != null\n\t ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL)\n\t : new BasicSourceMapConsumer(sourceMap, aSourceMapURL);\n\t}\n\t\n\tSourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) {\n\t return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL);\n\t}\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tSourceMapConsumer.prototype._version = 3;\n\t\n\t// `__generatedMappings` and `__originalMappings` are arrays that hold the\n\t// parsed mapping coordinates from the source map's \"mappings\" attribute. They\n\t// are lazily instantiated, accessed via the `_generatedMappings` and\n\t// `_originalMappings` getters respectively, and we only parse the mappings\n\t// and create these arrays once queried for a source location. We jump through\n\t// these hoops because there can be many thousands of mappings, and parsing\n\t// them is expensive, so we only want to do it if we must.\n\t//\n\t// Each object in the arrays is of the form:\n\t//\n\t// {\n\t// generatedLine: The line number in the generated code,\n\t// generatedColumn: The column number in the generated code,\n\t// source: The path to the original source file that generated this\n\t// chunk of code,\n\t// originalLine: The line number in the original source that\n\t// corresponds to this chunk of generated code,\n\t// originalColumn: The column number in the original source that\n\t// corresponds to this chunk of generated code,\n\t// name: The name of the original symbol which generated this chunk of\n\t// code.\n\t// }\n\t//\n\t// All properties except for `generatedLine` and `generatedColumn` can be\n\t// `null`.\n\t//\n\t// `_generatedMappings` is ordered by the generated positions.\n\t//\n\t// `_originalMappings` is ordered by the original positions.\n\t\n\tSourceMapConsumer.prototype.__generatedMappings = null;\n\tObject.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {\n\t configurable: true,\n\t enumerable: true,\n\t get: function () {\n\t if (!this.__generatedMappings) {\n\t this._parseMappings(this._mappings, this.sourceRoot);\n\t }\n\t\n\t return this.__generatedMappings;\n\t }\n\t});\n\t\n\tSourceMapConsumer.prototype.__originalMappings = null;\n\tObject.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {\n\t configurable: true,\n\t enumerable: true,\n\t get: function () {\n\t if (!this.__originalMappings) {\n\t this._parseMappings(this._mappings, this.sourceRoot);\n\t }\n\t\n\t return this.__originalMappings;\n\t }\n\t});\n\t\n\tSourceMapConsumer.prototype._charIsMappingSeparator =\n\t function SourceMapConsumer_charIsMappingSeparator(aStr, index) {\n\t var c = aStr.charAt(index);\n\t return c === \";\" || c === \",\";\n\t };\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tSourceMapConsumer.prototype._parseMappings =\n\t function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t throw new Error(\"Subclasses must implement _parseMappings\");\n\t };\n\t\n\tSourceMapConsumer.GENERATED_ORDER = 1;\n\tSourceMapConsumer.ORIGINAL_ORDER = 2;\n\t\n\tSourceMapConsumer.GREATEST_LOWER_BOUND = 1;\n\tSourceMapConsumer.LEAST_UPPER_BOUND = 2;\n\t\n\t/**\n\t * Iterate over each mapping between an original source/line/column and a\n\t * generated line/column in this source map.\n\t *\n\t * @param Function aCallback\n\t * The function that is called with each mapping.\n\t * @param Object aContext\n\t * Optional. If specified, this object will be the value of `this` every\n\t * time that `aCallback` is called.\n\t * @param aOrder\n\t * Either `SourceMapConsumer.GENERATED_ORDER` or\n\t * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to\n\t * iterate over the mappings sorted by the generated file's line/column\n\t * order or the original's source/line/column order, respectively. Defaults to\n\t * `SourceMapConsumer.GENERATED_ORDER`.\n\t */\n\tSourceMapConsumer.prototype.eachMapping =\n\t function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {\n\t var context = aContext || null;\n\t var order = aOrder || SourceMapConsumer.GENERATED_ORDER;\n\t\n\t var mappings;\n\t switch (order) {\n\t case SourceMapConsumer.GENERATED_ORDER:\n\t mappings = this._generatedMappings;\n\t break;\n\t case SourceMapConsumer.ORIGINAL_ORDER:\n\t mappings = this._originalMappings;\n\t break;\n\t default:\n\t throw new Error(\"Unknown order of iteration.\");\n\t }\n\t\n\t var sourceRoot = this.sourceRoot;\n\t mappings.map(function (mapping) {\n\t var source = mapping.source === null ? null : this._sources.at(mapping.source);\n\t source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL);\n\t return {\n\t source: source,\n\t generatedLine: mapping.generatedLine,\n\t generatedColumn: mapping.generatedColumn,\n\t originalLine: mapping.originalLine,\n\t originalColumn: mapping.originalColumn,\n\t name: mapping.name === null ? null : this._names.at(mapping.name)\n\t };\n\t }, this).forEach(aCallback, context);\n\t };\n\t\n\t/**\n\t * Returns all generated line and column information for the original source,\n\t * line, and column provided. If no column is provided, returns all mappings\n\t * corresponding to a either the line we are searching for or the next\n\t * closest line that has any mappings. Otherwise, returns all mappings\n\t * corresponding to the given line and either the column we are searching for\n\t * or the next closest column that has any offsets.\n\t *\n\t * The only argument is an object with the following properties:\n\t *\n\t * - source: The filename of the original source.\n\t * - line: The line number in the original source. The line number is 1-based.\n\t * - column: Optional. the column number in the original source.\n\t * The column number is 0-based.\n\t *\n\t * and an array of objects is returned, each with the following properties:\n\t *\n\t * - line: The line number in the generated source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the generated source, or null.\n\t * The column number is 0-based.\n\t */\n\tSourceMapConsumer.prototype.allGeneratedPositionsFor =\n\t function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {\n\t var line = util.getArg(aArgs, 'line');\n\t\n\t // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping\n\t // returns the index of the closest mapping less than the needle. By\n\t // setting needle.originalColumn to 0, we thus find the last mapping for\n\t // the given line, provided such a mapping exists.\n\t var needle = {\n\t source: util.getArg(aArgs, 'source'),\n\t originalLine: line,\n\t originalColumn: util.getArg(aArgs, 'column', 0)\n\t };\n\t\n\t needle.source = this._findSourceIndex(needle.source);\n\t if (needle.source < 0) {\n\t return [];\n\t }\n\t\n\t var mappings = [];\n\t\n\t var index = this._findMapping(needle,\n\t this._originalMappings,\n\t \"originalLine\",\n\t \"originalColumn\",\n\t util.compareByOriginalPositions,\n\t binarySearch.LEAST_UPPER_BOUND);\n\t if (index >= 0) {\n\t var mapping = this._originalMappings[index];\n\t\n\t if (aArgs.column === undefined) {\n\t var originalLine = mapping.originalLine;\n\t\n\t // Iterate until either we run out of mappings, or we run into\n\t // a mapping for a different line than the one we found. Since\n\t // mappings are sorted, this is guaranteed to find all mappings for\n\t // the line we found.\n\t while (mapping && mapping.originalLine === originalLine) {\n\t mappings.push({\n\t line: util.getArg(mapping, 'generatedLine', null),\n\t column: util.getArg(mapping, 'generatedColumn', null),\n\t lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t });\n\t\n\t mapping = this._originalMappings[++index];\n\t }\n\t } else {\n\t var originalColumn = mapping.originalColumn;\n\t\n\t // Iterate until either we run out of mappings, or we run into\n\t // a mapping for a different line than the one we were searching for.\n\t // Since mappings are sorted, this is guaranteed to find all mappings for\n\t // the line we are searching for.\n\t while (mapping &&\n\t mapping.originalLine === line &&\n\t mapping.originalColumn == originalColumn) {\n\t mappings.push({\n\t line: util.getArg(mapping, 'generatedLine', null),\n\t column: util.getArg(mapping, 'generatedColumn', null),\n\t lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t });\n\t\n\t mapping = this._originalMappings[++index];\n\t }\n\t }\n\t }\n\t\n\t return mappings;\n\t };\n\t\n\texports.SourceMapConsumer = SourceMapConsumer;\n\t\n\t/**\n\t * A BasicSourceMapConsumer instance represents a parsed source map which we can\n\t * query for information about the original file positions by giving it a file\n\t * position in the generated source.\n\t *\n\t * The first parameter is the raw source map (either as a JSON string, or\n\t * already parsed to an object). According to the spec, source maps have the\n\t * following attributes:\n\t *\n\t * - version: Which version of the source map spec this map is following.\n\t * - sources: An array of URLs to the original source files.\n\t * - names: An array of identifiers which can be referrenced by individual mappings.\n\t * - sourceRoot: Optional. The URL root from which all sources are relative.\n\t * - sourcesContent: Optional. An array of contents of the original source files.\n\t * - mappings: A string of base64 VLQs which contain the actual mappings.\n\t * - file: Optional. The generated file this source map is associated with.\n\t *\n\t * Here is an example source map, taken from the source map spec[0]:\n\t *\n\t * {\n\t * version : 3,\n\t * file: \"out.js\",\n\t * sourceRoot : \"\",\n\t * sources: [\"foo.js\", \"bar.js\"],\n\t * names: [\"src\", \"maps\", \"are\", \"fun\"],\n\t * mappings: \"AA,AB;;ABCDE;\"\n\t * }\n\t *\n\t * The second parameter, if given, is a string whose value is the URL\n\t * at which the source map was found. This URL is used to compute the\n\t * sources array.\n\t *\n\t * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#\n\t */\n\tfunction BasicSourceMapConsumer(aSourceMap, aSourceMapURL) {\n\t var sourceMap = aSourceMap;\n\t if (typeof aSourceMap === 'string') {\n\t sourceMap = util.parseSourceMapInput(aSourceMap);\n\t }\n\t\n\t var version = util.getArg(sourceMap, 'version');\n\t var sources = util.getArg(sourceMap, 'sources');\n\t // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which\n\t // requires the array) to play nice here.\n\t var names = util.getArg(sourceMap, 'names', []);\n\t var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);\n\t var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);\n\t var mappings = util.getArg(sourceMap, 'mappings');\n\t var file = util.getArg(sourceMap, 'file', null);\n\t\n\t // Once again, Sass deviates from the spec and supplies the version as a\n\t // string rather than a number, so we use loose equality checking here.\n\t if (version != this._version) {\n\t throw new Error('Unsupported version: ' + version);\n\t }\n\t\n\t if (sourceRoot) {\n\t sourceRoot = util.normalize(sourceRoot);\n\t }\n\t\n\t sources = sources\n\t .map(String)\n\t // Some source maps produce relative source paths like \"./foo.js\" instead of\n\t // \"foo.js\". Normalize these first so that future comparisons will succeed.\n\t // See bugzil.la/1090768.\n\t .map(util.normalize)\n\t // Always ensure that absolute sources are internally stored relative to\n\t // the source root, if the source root is absolute. Not doing this would\n\t // be particularly problematic when the source root is a prefix of the\n\t // source (valid, but why??). See github issue #199 and bugzil.la/1188982.\n\t .map(function (source) {\n\t return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)\n\t ? util.relative(sourceRoot, source)\n\t : source;\n\t });\n\t\n\t // Pass `true` below to allow duplicate names and sources. While source maps\n\t // are intended to be compressed and deduplicated, the TypeScript compiler\n\t // sometimes generates source maps with duplicates in them. See Github issue\n\t // #72 and bugzil.la/889492.\n\t this._names = ArraySet.fromArray(names.map(String), true);\n\t this._sources = ArraySet.fromArray(sources, true);\n\t\n\t this._absoluteSources = this._sources.toArray().map(function (s) {\n\t return util.computeSourceURL(sourceRoot, s, aSourceMapURL);\n\t });\n\t\n\t this.sourceRoot = sourceRoot;\n\t this.sourcesContent = sourcesContent;\n\t this._mappings = mappings;\n\t this._sourceMapURL = aSourceMapURL;\n\t this.file = file;\n\t}\n\t\n\tBasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\n\tBasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;\n\t\n\t/**\n\t * Utility function to find the index of a source. Returns -1 if not\n\t * found.\n\t */\n\tBasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) {\n\t var relativeSource = aSource;\n\t if (this.sourceRoot != null) {\n\t relativeSource = util.relative(this.sourceRoot, relativeSource);\n\t }\n\t\n\t if (this._sources.has(relativeSource)) {\n\t return this._sources.indexOf(relativeSource);\n\t }\n\t\n\t // Maybe aSource is an absolute URL as returned by |sources|. In\n\t // this case we can't simply undo the transform.\n\t var i;\n\t for (i = 0; i < this._absoluteSources.length; ++i) {\n\t if (this._absoluteSources[i] == aSource) {\n\t return i;\n\t }\n\t }\n\t\n\t return -1;\n\t};\n\t\n\t/**\n\t * Create a BasicSourceMapConsumer from a SourceMapGenerator.\n\t *\n\t * @param SourceMapGenerator aSourceMap\n\t * The source map that will be consumed.\n\t * @param String aSourceMapURL\n\t * The URL at which the source map can be found (optional)\n\t * @returns BasicSourceMapConsumer\n\t */\n\tBasicSourceMapConsumer.fromSourceMap =\n\t function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) {\n\t var smc = Object.create(BasicSourceMapConsumer.prototype);\n\t\n\t var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);\n\t var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);\n\t smc.sourceRoot = aSourceMap._sourceRoot;\n\t smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),\n\t smc.sourceRoot);\n\t smc.file = aSourceMap._file;\n\t smc._sourceMapURL = aSourceMapURL;\n\t smc._absoluteSources = smc._sources.toArray().map(function (s) {\n\t return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL);\n\t });\n\t\n\t // Because we are modifying the entries (by converting string sources and\n\t // names to indices into the sources and names ArraySets), we have to make\n\t // a copy of the entry or else bad things happen. Shared mutable state\n\t // strikes again! See github issue #191.\n\t\n\t var generatedMappings = aSourceMap._mappings.toArray().slice();\n\t var destGeneratedMappings = smc.__generatedMappings = [];\n\t var destOriginalMappings = smc.__originalMappings = [];\n\t\n\t for (var i = 0, length = generatedMappings.length; i < length; i++) {\n\t var srcMapping = generatedMappings[i];\n\t var destMapping = new Mapping;\n\t destMapping.generatedLine = srcMapping.generatedLine;\n\t destMapping.generatedColumn = srcMapping.generatedColumn;\n\t\n\t if (srcMapping.source) {\n\t destMapping.source = sources.indexOf(srcMapping.source);\n\t destMapping.originalLine = srcMapping.originalLine;\n\t destMapping.originalColumn = srcMapping.originalColumn;\n\t\n\t if (srcMapping.name) {\n\t destMapping.name = names.indexOf(srcMapping.name);\n\t }\n\t\n\t destOriginalMappings.push(destMapping);\n\t }\n\t\n\t destGeneratedMappings.push(destMapping);\n\t }\n\t\n\t quickSort(smc.__originalMappings, util.compareByOriginalPositions);\n\t\n\t return smc;\n\t };\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tBasicSourceMapConsumer.prototype._version = 3;\n\t\n\t/**\n\t * The list of original sources.\n\t */\n\tObject.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {\n\t get: function () {\n\t return this._absoluteSources.slice();\n\t }\n\t});\n\t\n\t/**\n\t * Provide the JIT with a nice shape / hidden class.\n\t */\n\tfunction Mapping() {\n\t this.generatedLine = 0;\n\t this.generatedColumn = 0;\n\t this.source = null;\n\t this.originalLine = null;\n\t this.originalColumn = null;\n\t this.name = null;\n\t}\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tBasicSourceMapConsumer.prototype._parseMappings =\n\t function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t var generatedLine = 1;\n\t var previousGeneratedColumn = 0;\n\t var previousOriginalLine = 0;\n\t var previousOriginalColumn = 0;\n\t var previousSource = 0;\n\t var previousName = 0;\n\t var length = aStr.length;\n\t var index = 0;\n\t var cachedSegments = {};\n\t var temp = {};\n\t var originalMappings = [];\n\t var generatedMappings = [];\n\t var mapping, str, segment, end, value;\n\t\n\t while (index < length) {\n\t if (aStr.charAt(index) === ';') {\n\t generatedLine++;\n\t index++;\n\t previousGeneratedColumn = 0;\n\t }\n\t else if (aStr.charAt(index) === ',') {\n\t index++;\n\t }\n\t else {\n\t mapping = new Mapping();\n\t mapping.generatedLine = generatedLine;\n\t\n\t // Because each offset is encoded relative to the previous one,\n\t // many segments often have the same encoding. We can exploit this\n\t // fact by caching the parsed variable length fields of each segment,\n\t // allowing us to avoid a second parse if we encounter the same\n\t // segment again.\n\t for (end = index; end < length; end++) {\n\t if (this._charIsMappingSeparator(aStr, end)) {\n\t break;\n\t }\n\t }\n\t str = aStr.slice(index, end);\n\t\n\t segment = cachedSegments[str];\n\t if (segment) {\n\t index += str.length;\n\t } else {\n\t segment = [];\n\t while (index < end) {\n\t base64VLQ.decode(aStr, index, temp);\n\t value = temp.value;\n\t index = temp.rest;\n\t segment.push(value);\n\t }\n\t\n\t if (segment.length === 2) {\n\t throw new Error('Found a source, but no line and column');\n\t }\n\t\n\t if (segment.length === 3) {\n\t throw new Error('Found a source and line, but no column');\n\t }\n\t\n\t cachedSegments[str] = segment;\n\t }\n\t\n\t // Generated column.\n\t mapping.generatedColumn = previousGeneratedColumn + segment[0];\n\t previousGeneratedColumn = mapping.generatedColumn;\n\t\n\t if (segment.length > 1) {\n\t // Original source.\n\t mapping.source = previousSource + segment[1];\n\t previousSource += segment[1];\n\t\n\t // Original line.\n\t mapping.originalLine = previousOriginalLine + segment[2];\n\t previousOriginalLine = mapping.originalLine;\n\t // Lines are stored 0-based\n\t mapping.originalLine += 1;\n\t\n\t // Original column.\n\t mapping.originalColumn = previousOriginalColumn + segment[3];\n\t previousOriginalColumn = mapping.originalColumn;\n\t\n\t if (segment.length > 4) {\n\t // Original name.\n\t mapping.name = previousName + segment[4];\n\t previousName += segment[4];\n\t }\n\t }\n\t\n\t generatedMappings.push(mapping);\n\t if (typeof mapping.originalLine === 'number') {\n\t originalMappings.push(mapping);\n\t }\n\t }\n\t }\n\t\n\t quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);\n\t this.__generatedMappings = generatedMappings;\n\t\n\t quickSort(originalMappings, util.compareByOriginalPositions);\n\t this.__originalMappings = originalMappings;\n\t };\n\t\n\t/**\n\t * Find the mapping that best matches the hypothetical \"needle\" mapping that\n\t * we are searching for in the given \"haystack\" of mappings.\n\t */\n\tBasicSourceMapConsumer.prototype._findMapping =\n\t function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,\n\t aColumnName, aComparator, aBias) {\n\t // To return the position we are searching for, we must first find the\n\t // mapping for the given position and then return the opposite position it\n\t // points to. Because the mappings are sorted, we can use binary search to\n\t // find the best mapping.\n\t\n\t if (aNeedle[aLineName] <= 0) {\n\t throw new TypeError('Line must be greater than or equal to 1, got '\n\t + aNeedle[aLineName]);\n\t }\n\t if (aNeedle[aColumnName] < 0) {\n\t throw new TypeError('Column must be greater than or equal to 0, got '\n\t + aNeedle[aColumnName]);\n\t }\n\t\n\t return binarySearch.search(aNeedle, aMappings, aComparator, aBias);\n\t };\n\t\n\t/**\n\t * Compute the last column for each generated mapping. The last column is\n\t * inclusive.\n\t */\n\tBasicSourceMapConsumer.prototype.computeColumnSpans =\n\t function SourceMapConsumer_computeColumnSpans() {\n\t for (var index = 0; index < this._generatedMappings.length; ++index) {\n\t var mapping = this._generatedMappings[index];\n\t\n\t // Mappings do not contain a field for the last generated columnt. We\n\t // can come up with an optimistic estimate, however, by assuming that\n\t // mappings are contiguous (i.e. given two consecutive mappings, the\n\t // first mapping ends where the second one starts).\n\t if (index + 1 < this._generatedMappings.length) {\n\t var nextMapping = this._generatedMappings[index + 1];\n\t\n\t if (mapping.generatedLine === nextMapping.generatedLine) {\n\t mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;\n\t continue;\n\t }\n\t }\n\t\n\t // The last mapping for each line spans the entire line.\n\t mapping.lastGeneratedColumn = Infinity;\n\t }\n\t };\n\t\n\t/**\n\t * Returns the original source, line, and column information for the generated\n\t * source's line and column positions provided. The only argument is an object\n\t * with the following properties:\n\t *\n\t * - line: The line number in the generated source. The line number\n\t * is 1-based.\n\t * - column: The column number in the generated source. The column\n\t * number is 0-based.\n\t * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n\t * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - source: The original source file, or null.\n\t * - line: The line number in the original source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the original source, or null. The\n\t * column number is 0-based.\n\t * - name: The original identifier, or null.\n\t */\n\tBasicSourceMapConsumer.prototype.originalPositionFor =\n\t function SourceMapConsumer_originalPositionFor(aArgs) {\n\t var needle = {\n\t generatedLine: util.getArg(aArgs, 'line'),\n\t generatedColumn: util.getArg(aArgs, 'column')\n\t };\n\t\n\t var index = this._findMapping(\n\t needle,\n\t this._generatedMappings,\n\t \"generatedLine\",\n\t \"generatedColumn\",\n\t util.compareByGeneratedPositionsDeflated,\n\t util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n\t );\n\t\n\t if (index >= 0) {\n\t var mapping = this._generatedMappings[index];\n\t\n\t if (mapping.generatedLine === needle.generatedLine) {\n\t var source = util.getArg(mapping, 'source', null);\n\t if (source !== null) {\n\t source = this._sources.at(source);\n\t source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL);\n\t }\n\t var name = util.getArg(mapping, 'name', null);\n\t if (name !== null) {\n\t name = this._names.at(name);\n\t }\n\t return {\n\t source: source,\n\t line: util.getArg(mapping, 'originalLine', null),\n\t column: util.getArg(mapping, 'originalColumn', null),\n\t name: name\n\t };\n\t }\n\t }\n\t\n\t return {\n\t source: null,\n\t line: null,\n\t column: null,\n\t name: null\n\t };\n\t };\n\t\n\t/**\n\t * Return true if we have the source content for every source in the source\n\t * map, false otherwise.\n\t */\n\tBasicSourceMapConsumer.prototype.hasContentsOfAllSources =\n\t function BasicSourceMapConsumer_hasContentsOfAllSources() {\n\t if (!this.sourcesContent) {\n\t return false;\n\t }\n\t return this.sourcesContent.length >= this._sources.size() &&\n\t !this.sourcesContent.some(function (sc) { return sc == null; });\n\t };\n\t\n\t/**\n\t * Returns the original source content. The only argument is the url of the\n\t * original source file. Returns null if no original source content is\n\t * available.\n\t */\n\tBasicSourceMapConsumer.prototype.sourceContentFor =\n\t function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n\t if (!this.sourcesContent) {\n\t return null;\n\t }\n\t\n\t var index = this._findSourceIndex(aSource);\n\t if (index >= 0) {\n\t return this.sourcesContent[index];\n\t }\n\t\n\t var relativeSource = aSource;\n\t if (this.sourceRoot != null) {\n\t relativeSource = util.relative(this.sourceRoot, relativeSource);\n\t }\n\t\n\t var url;\n\t if (this.sourceRoot != null\n\t && (url = util.urlParse(this.sourceRoot))) {\n\t // XXX: file:// URIs and absolute paths lead to unexpected behavior for\n\t // many users. We can help them out when they expect file:// URIs to\n\t // behave like it would if they were running a local HTTP server. See\n\t // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.\n\t var fileUriAbsPath = relativeSource.replace(/^file:\\/\\//, \"\");\n\t if (url.scheme == \"file\"\n\t && this._sources.has(fileUriAbsPath)) {\n\t return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]\n\t }\n\t\n\t if ((!url.path || url.path == \"/\")\n\t && this._sources.has(\"/\" + relativeSource)) {\n\t return this.sourcesContent[this._sources.indexOf(\"/\" + relativeSource)];\n\t }\n\t }\n\t\n\t // This function is used recursively from\n\t // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we\n\t // don't want to throw if we can't find the source - we just want to\n\t // return null, so we provide a flag to exit gracefully.\n\t if (nullOnMissing) {\n\t return null;\n\t }\n\t else {\n\t throw new Error('\"' + relativeSource + '\" is not in the SourceMap.');\n\t }\n\t };\n\t\n\t/**\n\t * Returns the generated line and column information for the original source,\n\t * line, and column positions provided. The only argument is an object with\n\t * the following properties:\n\t *\n\t * - source: The filename of the original source.\n\t * - line: The line number in the original source. The line number\n\t * is 1-based.\n\t * - column: The column number in the original source. The column\n\t * number is 0-based.\n\t * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n\t * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - line: The line number in the generated source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the generated source, or null.\n\t * The column number is 0-based.\n\t */\n\tBasicSourceMapConsumer.prototype.generatedPositionFor =\n\t function SourceMapConsumer_generatedPositionFor(aArgs) {\n\t var source = util.getArg(aArgs, 'source');\n\t source = this._findSourceIndex(source);\n\t if (source < 0) {\n\t return {\n\t line: null,\n\t column: null,\n\t lastColumn: null\n\t };\n\t }\n\t\n\t var needle = {\n\t source: source,\n\t originalLine: util.getArg(aArgs, 'line'),\n\t originalColumn: util.getArg(aArgs, 'column')\n\t };\n\t\n\t var index = this._findMapping(\n\t needle,\n\t this._originalMappings,\n\t \"originalLine\",\n\t \"originalColumn\",\n\t util.compareByOriginalPositions,\n\t util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n\t );\n\t\n\t if (index >= 0) {\n\t var mapping = this._originalMappings[index];\n\t\n\t if (mapping.source === needle.source) {\n\t return {\n\t line: util.getArg(mapping, 'generatedLine', null),\n\t column: util.getArg(mapping, 'generatedColumn', null),\n\t lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t };\n\t }\n\t }\n\t\n\t return {\n\t line: null,\n\t column: null,\n\t lastColumn: null\n\t };\n\t };\n\t\n\texports.BasicSourceMapConsumer = BasicSourceMapConsumer;\n\t\n\t/**\n\t * An IndexedSourceMapConsumer instance represents a parsed source map which\n\t * we can query for information. It differs from BasicSourceMapConsumer in\n\t * that it takes \"indexed\" source maps (i.e. ones with a \"sections\" field) as\n\t * input.\n\t *\n\t * The first parameter is a raw source map (either as a JSON string, or already\n\t * parsed to an object). According to the spec for indexed source maps, they\n\t * have the following attributes:\n\t *\n\t * - version: Which version of the source map spec this map is following.\n\t * - file: Optional. The generated file this source map is associated with.\n\t * - sections: A list of section definitions.\n\t *\n\t * Each value under the \"sections\" field has two fields:\n\t * - offset: The offset into the original specified at which this section\n\t * begins to apply, defined as an object with a \"line\" and \"column\"\n\t * field.\n\t * - map: A source map definition. This source map could also be indexed,\n\t * but doesn't have to be.\n\t *\n\t * Instead of the \"map\" field, it's also possible to have a \"url\" field\n\t * specifying a URL to retrieve a source map from, but that's currently\n\t * unsupported.\n\t *\n\t * Here's an example source map, taken from the source map spec[0], but\n\t * modified to omit a section which uses the \"url\" field.\n\t *\n\t * {\n\t * version : 3,\n\t * file: \"app.js\",\n\t * sections: [{\n\t * offset: {line:100, column:10},\n\t * map: {\n\t * version : 3,\n\t * file: \"section.js\",\n\t * sources: [\"foo.js\", \"bar.js\"],\n\t * names: [\"src\", \"maps\", \"are\", \"fun\"],\n\t * mappings: \"AAAA,E;;ABCDE;\"\n\t * }\n\t * }],\n\t * }\n\t *\n\t * The second parameter, if given, is a string whose value is the URL\n\t * at which the source map was found. This URL is used to compute the\n\t * sources array.\n\t *\n\t * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt\n\t */\n\tfunction IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) {\n\t var sourceMap = aSourceMap;\n\t if (typeof aSourceMap === 'string') {\n\t sourceMap = util.parseSourceMapInput(aSourceMap);\n\t }\n\t\n\t var version = util.getArg(sourceMap, 'version');\n\t var sections = util.getArg(sourceMap, 'sections');\n\t\n\t if (version != this._version) {\n\t throw new Error('Unsupported version: ' + version);\n\t }\n\t\n\t this._sources = new ArraySet();\n\t this._names = new ArraySet();\n\t\n\t var lastOffset = {\n\t line: -1,\n\t column: 0\n\t };\n\t this._sections = sections.map(function (s) {\n\t if (s.url) {\n\t // The url field will require support for asynchronicity.\n\t // See https://github.com/mozilla/source-map/issues/16\n\t throw new Error('Support for url field in sections not implemented.');\n\t }\n\t var offset = util.getArg(s, 'offset');\n\t var offsetLine = util.getArg(offset, 'line');\n\t var offsetColumn = util.getArg(offset, 'column');\n\t\n\t if (offsetLine < lastOffset.line ||\n\t (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {\n\t throw new Error('Section offsets must be ordered and non-overlapping.');\n\t }\n\t lastOffset = offset;\n\t\n\t return {\n\t generatedOffset: {\n\t // The offset fields are 0-based, but we use 1-based indices when\n\t // encoding/decoding from VLQ.\n\t generatedLine: offsetLine + 1,\n\t generatedColumn: offsetColumn + 1\n\t },\n\t consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL)\n\t }\n\t });\n\t}\n\t\n\tIndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\n\tIndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tIndexedSourceMapConsumer.prototype._version = 3;\n\t\n\t/**\n\t * The list of original sources.\n\t */\n\tObject.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {\n\t get: function () {\n\t var sources = [];\n\t for (var i = 0; i < this._sections.length; i++) {\n\t for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {\n\t sources.push(this._sections[i].consumer.sources[j]);\n\t }\n\t }\n\t return sources;\n\t }\n\t});\n\t\n\t/**\n\t * Returns the original source, line, and column information for the generated\n\t * source's line and column positions provided. The only argument is an object\n\t * with the following properties:\n\t *\n\t * - line: The line number in the generated source. The line number\n\t * is 1-based.\n\t * - column: The column number in the generated source. The column\n\t * number is 0-based.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - source: The original source file, or null.\n\t * - line: The line number in the original source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the original source, or null. The\n\t * column number is 0-based.\n\t * - name: The original identifier, or null.\n\t */\n\tIndexedSourceMapConsumer.prototype.originalPositionFor =\n\t function IndexedSourceMapConsumer_originalPositionFor(aArgs) {\n\t var needle = {\n\t generatedLine: util.getArg(aArgs, 'line'),\n\t generatedColumn: util.getArg(aArgs, 'column')\n\t };\n\t\n\t // Find the section containing the generated position we're trying to map\n\t // to an original position.\n\t var sectionIndex = binarySearch.search(needle, this._sections,\n\t function(needle, section) {\n\t var cmp = needle.generatedLine - section.generatedOffset.generatedLine;\n\t if (cmp) {\n\t return cmp;\n\t }\n\t\n\t return (needle.generatedColumn -\n\t section.generatedOffset.generatedColumn);\n\t });\n\t var section = this._sections[sectionIndex];\n\t\n\t if (!section) {\n\t return {\n\t source: null,\n\t line: null,\n\t column: null,\n\t name: null\n\t };\n\t }\n\t\n\t return section.consumer.originalPositionFor({\n\t line: needle.generatedLine -\n\t (section.generatedOffset.generatedLine - 1),\n\t column: needle.generatedColumn -\n\t (section.generatedOffset.generatedLine === needle.generatedLine\n\t ? section.generatedOffset.generatedColumn - 1\n\t : 0),\n\t bias: aArgs.bias\n\t });\n\t };\n\t\n\t/**\n\t * Return true if we have the source content for every source in the source\n\t * map, false otherwise.\n\t */\n\tIndexedSourceMapConsumer.prototype.hasContentsOfAllSources =\n\t function IndexedSourceMapConsumer_hasContentsOfAllSources() {\n\t return this._sections.every(function (s) {\n\t return s.consumer.hasContentsOfAllSources();\n\t });\n\t };\n\t\n\t/**\n\t * Returns the original source content. The only argument is the url of the\n\t * original source file. Returns null if no original source content is\n\t * available.\n\t */\n\tIndexedSourceMapConsumer.prototype.sourceContentFor =\n\t function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n\t for (var i = 0; i < this._sections.length; i++) {\n\t var section = this._sections[i];\n\t\n\t var content = section.consumer.sourceContentFor(aSource, true);\n\t if (content) {\n\t return content;\n\t }\n\t }\n\t if (nullOnMissing) {\n\t return null;\n\t }\n\t else {\n\t throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n\t }\n\t };\n\t\n\t/**\n\t * Returns the generated line and column information for the original source,\n\t * line, and column positions provided. The only argument is an object with\n\t * the following properties:\n\t *\n\t * - source: The filename of the original source.\n\t * - line: The line number in the original source. The line number\n\t * is 1-based.\n\t * - column: The column number in the original source. The column\n\t * number is 0-based.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - line: The line number in the generated source, or null. The\n\t * line number is 1-based. \n\t * - column: The column number in the generated source, or null.\n\t * The column number is 0-based.\n\t */\n\tIndexedSourceMapConsumer.prototype.generatedPositionFor =\n\t function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {\n\t for (var i = 0; i < this._sections.length; i++) {\n\t var section = this._sections[i];\n\t\n\t // Only consider this section if the requested source is in the list of\n\t // sources of the consumer.\n\t if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) {\n\t continue;\n\t }\n\t var generatedPosition = section.consumer.generatedPositionFor(aArgs);\n\t if (generatedPosition) {\n\t var ret = {\n\t line: generatedPosition.line +\n\t (section.generatedOffset.generatedLine - 1),\n\t column: generatedPosition.column +\n\t (section.generatedOffset.generatedLine === generatedPosition.line\n\t ? section.generatedOffset.generatedColumn - 1\n\t : 0)\n\t };\n\t return ret;\n\t }\n\t }\n\t\n\t return {\n\t line: null,\n\t column: null\n\t };\n\t };\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tIndexedSourceMapConsumer.prototype._parseMappings =\n\t function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t this.__generatedMappings = [];\n\t this.__originalMappings = [];\n\t for (var i = 0; i < this._sections.length; i++) {\n\t var section = this._sections[i];\n\t var sectionMappings = section.consumer._generatedMappings;\n\t for (var j = 0; j < sectionMappings.length; j++) {\n\t var mapping = sectionMappings[j];\n\t\n\t var source = section.consumer._sources.at(mapping.source);\n\t source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL);\n\t this._sources.add(source);\n\t source = this._sources.indexOf(source);\n\t\n\t var name = null;\n\t if (mapping.name) {\n\t name = section.consumer._names.at(mapping.name);\n\t this._names.add(name);\n\t name = this._names.indexOf(name);\n\t }\n\t\n\t // The mappings coming from the consumer for the section have\n\t // generated positions relative to the start of the section, so we\n\t // need to offset them to be relative to the start of the concatenated\n\t // generated file.\n\t var adjustedMapping = {\n\t source: source,\n\t generatedLine: mapping.generatedLine +\n\t (section.generatedOffset.generatedLine - 1),\n\t generatedColumn: mapping.generatedColumn +\n\t (section.generatedOffset.generatedLine === mapping.generatedLine\n\t ? section.generatedOffset.generatedColumn - 1\n\t : 0),\n\t originalLine: mapping.originalLine,\n\t originalColumn: mapping.originalColumn,\n\t name: name\n\t };\n\t\n\t this.__generatedMappings.push(adjustedMapping);\n\t if (typeof adjustedMapping.originalLine === 'number') {\n\t this.__originalMappings.push(adjustedMapping);\n\t }\n\t }\n\t }\n\t\n\t quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);\n\t quickSort(this.__originalMappings, util.compareByOriginalPositions);\n\t };\n\t\n\texports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;\n\n\n/***/ }),\n/* 8 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\texports.GREATEST_LOWER_BOUND = 1;\n\texports.LEAST_UPPER_BOUND = 2;\n\t\n\t/**\n\t * Recursive implementation of binary search.\n\t *\n\t * @param aLow Indices here and lower do not contain the needle.\n\t * @param aHigh Indices here and higher do not contain the needle.\n\t * @param aNeedle The element being searched for.\n\t * @param aHaystack The non-empty array being searched.\n\t * @param aCompare Function which takes two elements and returns -1, 0, or 1.\n\t * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n\t * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t */\n\tfunction recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {\n\t // This function terminates when one of the following is true:\n\t //\n\t // 1. We find the exact element we are looking for.\n\t //\n\t // 2. We did not find the exact element, but we can return the index of\n\t // the next-closest element.\n\t //\n\t // 3. We did not find the exact element, and there is no next-closest\n\t // element than the one we are searching for, so we return -1.\n\t var mid = Math.floor((aHigh - aLow) / 2) + aLow;\n\t var cmp = aCompare(aNeedle, aHaystack[mid], true);\n\t if (cmp === 0) {\n\t // Found the element we are looking for.\n\t return mid;\n\t }\n\t else if (cmp > 0) {\n\t // Our needle is greater than aHaystack[mid].\n\t if (aHigh - mid > 1) {\n\t // The element is in the upper half.\n\t return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);\n\t }\n\t\n\t // The exact needle element was not found in this haystack. Determine if\n\t // we are in termination case (3) or (2) and return the appropriate thing.\n\t if (aBias == exports.LEAST_UPPER_BOUND) {\n\t return aHigh < aHaystack.length ? aHigh : -1;\n\t } else {\n\t return mid;\n\t }\n\t }\n\t else {\n\t // Our needle is less than aHaystack[mid].\n\t if (mid - aLow > 1) {\n\t // The element is in the lower half.\n\t return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);\n\t }\n\t\n\t // we are in termination case (3) or (2) and return the appropriate thing.\n\t if (aBias == exports.LEAST_UPPER_BOUND) {\n\t return mid;\n\t } else {\n\t return aLow < 0 ? -1 : aLow;\n\t }\n\t }\n\t}\n\t\n\t/**\n\t * This is an implementation of binary search which will always try and return\n\t * the index of the closest element if there is no exact hit. This is because\n\t * mappings between original and generated line/col pairs are single points,\n\t * and there is an implicit region between each of them, so a miss just means\n\t * that you aren't on the very start of a region.\n\t *\n\t * @param aNeedle The element you are looking for.\n\t * @param aHaystack The array that is being searched.\n\t * @param aCompare A function which takes the needle and an element in the\n\t * array and returns -1, 0, or 1 depending on whether the needle is less\n\t * than, equal to, or greater than the element, respectively.\n\t * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n\t * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.\n\t */\n\texports.search = function search(aNeedle, aHaystack, aCompare, aBias) {\n\t if (aHaystack.length === 0) {\n\t return -1;\n\t }\n\t\n\t var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,\n\t aCompare, aBias || exports.GREATEST_LOWER_BOUND);\n\t if (index < 0) {\n\t return -1;\n\t }\n\t\n\t // We have found either the exact element, or the next-closest element than\n\t // the one we are searching for. However, there may be more than one such\n\t // element. Make sure we always return the smallest of these.\n\t while (index - 1 >= 0) {\n\t if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {\n\t break;\n\t }\n\t --index;\n\t }\n\t\n\t return index;\n\t};\n\n\n/***/ }),\n/* 9 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\t// It turns out that some (most?) JavaScript engines don't self-host\n\t// `Array.prototype.sort`. This makes sense because C++ will likely remain\n\t// faster than JS when doing raw CPU-intensive sorting. However, when using a\n\t// custom comparator function, calling back and forth between the VM's C++ and\n\t// JIT'd JS is rather slow *and* loses JIT type information, resulting in\n\t// worse generated code for the comparator function than would be optimal. In\n\t// fact, when sorting with a comparator, these costs outweigh the benefits of\n\t// sorting in C++. By using our own JS-implemented Quick Sort (below), we get\n\t// a ~3500ms mean speed-up in `bench/bench.html`.\n\t\n\t/**\n\t * Swap the elements indexed by `x` and `y` in the array `ary`.\n\t *\n\t * @param {Array} ary\n\t * The array.\n\t * @param {Number} x\n\t * The index of the first item.\n\t * @param {Number} y\n\t * The index of the second item.\n\t */\n\tfunction swap(ary, x, y) {\n\t var temp = ary[x];\n\t ary[x] = ary[y];\n\t ary[y] = temp;\n\t}\n\t\n\t/**\n\t * Returns a random integer within the range `low .. high` inclusive.\n\t *\n\t * @param {Number} low\n\t * The lower bound on the range.\n\t * @param {Number} high\n\t * The upper bound on the range.\n\t */\n\tfunction randomIntInRange(low, high) {\n\t return Math.round(low + (Math.random() * (high - low)));\n\t}\n\t\n\t/**\n\t * The Quick Sort algorithm.\n\t *\n\t * @param {Array} ary\n\t * An array to sort.\n\t * @param {function} comparator\n\t * Function to use to compare two items.\n\t * @param {Number} p\n\t * Start index of the array\n\t * @param {Number} r\n\t * End index of the array\n\t */\n\tfunction doQuickSort(ary, comparator, p, r) {\n\t // If our lower bound is less than our upper bound, we (1) partition the\n\t // array into two pieces and (2) recurse on each half. If it is not, this is\n\t // the empty array and our base case.\n\t\n\t if (p < r) {\n\t // (1) Partitioning.\n\t //\n\t // The partitioning chooses a pivot between `p` and `r` and moves all\n\t // elements that are less than or equal to the pivot to the before it, and\n\t // all the elements that are greater than it after it. The effect is that\n\t // once partition is done, the pivot is in the exact place it will be when\n\t // the array is put in sorted order, and it will not need to be moved\n\t // again. This runs in O(n) time.\n\t\n\t // Always choose a random pivot so that an input array which is reverse\n\t // sorted does not cause O(n^2) running time.\n\t var pivotIndex = randomIntInRange(p, r);\n\t var i = p - 1;\n\t\n\t swap(ary, pivotIndex, r);\n\t var pivot = ary[r];\n\t\n\t // Immediately after `j` is incremented in this loop, the following hold\n\t // true:\n\t //\n\t // * Every element in `ary[p .. i]` is less than or equal to the pivot.\n\t //\n\t // * Every element in `ary[i+1 .. j-1]` is greater than the pivot.\n\t for (var j = p; j < r; j++) {\n\t if (comparator(ary[j], pivot) <= 0) {\n\t i += 1;\n\t swap(ary, i, j);\n\t }\n\t }\n\t\n\t swap(ary, i + 1, j);\n\t var q = i + 1;\n\t\n\t // (2) Recurse on each half.\n\t\n\t doQuickSort(ary, comparator, p, q - 1);\n\t doQuickSort(ary, comparator, q + 1, r);\n\t }\n\t}\n\t\n\t/**\n\t * Sort the given array in-place with the given comparator function.\n\t *\n\t * @param {Array} ary\n\t * An array to sort.\n\t * @param {function} comparator\n\t * Function to use to compare two items.\n\t */\n\texports.quickSort = function (ary, comparator) {\n\t doQuickSort(ary, comparator, 0, ary.length - 1);\n\t};\n\n\n/***/ }),\n/* 10 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;\n\tvar util = __webpack_require__(4);\n\t\n\t// Matches a Windows-style `\\r\\n` newline or a `\\n` newline used by all other\n\t// operating systems these days (capturing the result).\n\tvar REGEX_NEWLINE = /(\\r?\\n)/;\n\t\n\t// Newline character code for charCodeAt() comparisons\n\tvar NEWLINE_CODE = 10;\n\t\n\t// Private symbol for identifying `SourceNode`s when multiple versions of\n\t// the source-map library are loaded. This MUST NOT CHANGE across\n\t// versions!\n\tvar isSourceNode = \"$$$isSourceNode$$$\";\n\t\n\t/**\n\t * SourceNodes provide a way to abstract over interpolating/concatenating\n\t * snippets of generated JavaScript source code while maintaining the line and\n\t * column information associated with the original source code.\n\t *\n\t * @param aLine The original line number.\n\t * @param aColumn The original column number.\n\t * @param aSource The original source's filename.\n\t * @param aChunks Optional. An array of strings which are snippets of\n\t * generated JS, or other SourceNodes.\n\t * @param aName The original identifier.\n\t */\n\tfunction SourceNode(aLine, aColumn, aSource, aChunks, aName) {\n\t this.children = [];\n\t this.sourceContents = {};\n\t this.line = aLine == null ? null : aLine;\n\t this.column = aColumn == null ? null : aColumn;\n\t this.source = aSource == null ? null : aSource;\n\t this.name = aName == null ? null : aName;\n\t this[isSourceNode] = true;\n\t if (aChunks != null) this.add(aChunks);\n\t}\n\t\n\t/**\n\t * Creates a SourceNode from generated code and a SourceMapConsumer.\n\t *\n\t * @param aGeneratedCode The generated code\n\t * @param aSourceMapConsumer The SourceMap for the generated code\n\t * @param aRelativePath Optional. The path that relative sources in the\n\t * SourceMapConsumer should be relative to.\n\t */\n\tSourceNode.fromStringWithSourceMap =\n\t function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {\n\t // The SourceNode we want to fill with the generated code\n\t // and the SourceMap\n\t var node = new SourceNode();\n\t\n\t // All even indices of this array are one line of the generated code,\n\t // while all odd indices are the newlines between two adjacent lines\n\t // (since `REGEX_NEWLINE` captures its match).\n\t // Processed fragments are accessed by calling `shiftNextLine`.\n\t var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);\n\t var remainingLinesIndex = 0;\n\t var shiftNextLine = function() {\n\t var lineContents = getNextLine();\n\t // The last line of a file might not have a newline.\n\t var newLine = getNextLine() || \"\";\n\t return lineContents + newLine;\n\t\n\t function getNextLine() {\n\t return remainingLinesIndex < remainingLines.length ?\n\t remainingLines[remainingLinesIndex++] : undefined;\n\t }\n\t };\n\t\n\t // We need to remember the position of \"remainingLines\"\n\t var lastGeneratedLine = 1, lastGeneratedColumn = 0;\n\t\n\t // The generate SourceNodes we need a code range.\n\t // To extract it current and last mapping is used.\n\t // Here we store the last mapping.\n\t var lastMapping = null;\n\t\n\t aSourceMapConsumer.eachMapping(function (mapping) {\n\t if (lastMapping !== null) {\n\t // We add the code from \"lastMapping\" to \"mapping\":\n\t // First check if there is a new line in between.\n\t if (lastGeneratedLine < mapping.generatedLine) {\n\t // Associate first line with \"lastMapping\"\n\t addMappingWithCode(lastMapping, shiftNextLine());\n\t lastGeneratedLine++;\n\t lastGeneratedColumn = 0;\n\t // The remaining code is added without mapping\n\t } else {\n\t // There is no new line in between.\n\t // Associate the code between \"lastGeneratedColumn\" and\n\t // \"mapping.generatedColumn\" with \"lastMapping\"\n\t var nextLine = remainingLines[remainingLinesIndex] || '';\n\t var code = nextLine.substr(0, mapping.generatedColumn -\n\t lastGeneratedColumn);\n\t remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -\n\t lastGeneratedColumn);\n\t lastGeneratedColumn = mapping.generatedColumn;\n\t addMappingWithCode(lastMapping, code);\n\t // No more remaining code, continue\n\t lastMapping = mapping;\n\t return;\n\t }\n\t }\n\t // We add the generated code until the first mapping\n\t // to the SourceNode without any mapping.\n\t // Each line is added as separate string.\n\t while (lastGeneratedLine < mapping.generatedLine) {\n\t node.add(shiftNextLine());\n\t lastGeneratedLine++;\n\t }\n\t if (lastGeneratedColumn < mapping.generatedColumn) {\n\t var nextLine = remainingLines[remainingLinesIndex] || '';\n\t node.add(nextLine.substr(0, mapping.generatedColumn));\n\t remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);\n\t lastGeneratedColumn = mapping.generatedColumn;\n\t }\n\t lastMapping = mapping;\n\t }, this);\n\t // We have processed all mappings.\n\t if (remainingLinesIndex < remainingLines.length) {\n\t if (lastMapping) {\n\t // Associate the remaining code in the current line with \"lastMapping\"\n\t addMappingWithCode(lastMapping, shiftNextLine());\n\t }\n\t // and add the remaining lines without any mapping\n\t node.add(remainingLines.splice(remainingLinesIndex).join(\"\"));\n\t }\n\t\n\t // Copy sourcesContent into SourceNode\n\t aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t if (content != null) {\n\t if (aRelativePath != null) {\n\t sourceFile = util.join(aRelativePath, sourceFile);\n\t }\n\t node.setSourceContent(sourceFile, content);\n\t }\n\t });\n\t\n\t return node;\n\t\n\t function addMappingWithCode(mapping, code) {\n\t if (mapping === null || mapping.source === undefined) {\n\t node.add(code);\n\t } else {\n\t var source = aRelativePath\n\t ? util.join(aRelativePath, mapping.source)\n\t : mapping.source;\n\t node.add(new SourceNode(mapping.originalLine,\n\t mapping.originalColumn,\n\t source,\n\t code,\n\t mapping.name));\n\t }\n\t }\n\t };\n\t\n\t/**\n\t * Add a chunk of generated JS to this source node.\n\t *\n\t * @param aChunk A string snippet of generated JS code, another instance of\n\t * SourceNode, or an array where each member is one of those things.\n\t */\n\tSourceNode.prototype.add = function SourceNode_add(aChunk) {\n\t if (Array.isArray(aChunk)) {\n\t aChunk.forEach(function (chunk) {\n\t this.add(chunk);\n\t }, this);\n\t }\n\t else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n\t if (aChunk) {\n\t this.children.push(aChunk);\n\t }\n\t }\n\t else {\n\t throw new TypeError(\n\t \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n\t );\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Add a chunk of generated JS to the beginning of this source node.\n\t *\n\t * @param aChunk A string snippet of generated JS code, another instance of\n\t * SourceNode, or an array where each member is one of those things.\n\t */\n\tSourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {\n\t if (Array.isArray(aChunk)) {\n\t for (var i = aChunk.length-1; i >= 0; i--) {\n\t this.prepend(aChunk[i]);\n\t }\n\t }\n\t else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n\t this.children.unshift(aChunk);\n\t }\n\t else {\n\t throw new TypeError(\n\t \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n\t );\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Walk over the tree of JS snippets in this node and its children. The\n\t * walking function is called once for each snippet of JS and is passed that\n\t * snippet and the its original associated source's line/column location.\n\t *\n\t * @param aFn The traversal function.\n\t */\n\tSourceNode.prototype.walk = function SourceNode_walk(aFn) {\n\t var chunk;\n\t for (var i = 0, len = this.children.length; i < len; i++) {\n\t chunk = this.children[i];\n\t if (chunk[isSourceNode]) {\n\t chunk.walk(aFn);\n\t }\n\t else {\n\t if (chunk !== '') {\n\t aFn(chunk, { source: this.source,\n\t line: this.line,\n\t column: this.column,\n\t name: this.name });\n\t }\n\t }\n\t }\n\t};\n\t\n\t/**\n\t * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between\n\t * each of `this.children`.\n\t *\n\t * @param aSep The separator.\n\t */\n\tSourceNode.prototype.join = function SourceNode_join(aSep) {\n\t var newChildren;\n\t var i;\n\t var len = this.children.length;\n\t if (len > 0) {\n\t newChildren = [];\n\t for (i = 0; i < len-1; i++) {\n\t newChildren.push(this.children[i]);\n\t newChildren.push(aSep);\n\t }\n\t newChildren.push(this.children[i]);\n\t this.children = newChildren;\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Call String.prototype.replace on the very right-most source snippet. Useful\n\t * for trimming whitespace from the end of a source node, etc.\n\t *\n\t * @param aPattern The pattern to replace.\n\t * @param aReplacement The thing to replace the pattern with.\n\t */\n\tSourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {\n\t var lastChild = this.children[this.children.length - 1];\n\t if (lastChild[isSourceNode]) {\n\t lastChild.replaceRight(aPattern, aReplacement);\n\t }\n\t else if (typeof lastChild === 'string') {\n\t this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);\n\t }\n\t else {\n\t this.children.push(''.replace(aPattern, aReplacement));\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Set the source content for a source file. This will be added to the SourceMapGenerator\n\t * in the sourcesContent field.\n\t *\n\t * @param aSourceFile The filename of the source file\n\t * @param aSourceContent The content of the source file\n\t */\n\tSourceNode.prototype.setSourceContent =\n\t function SourceNode_setSourceContent(aSourceFile, aSourceContent) {\n\t this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;\n\t };\n\t\n\t/**\n\t * Walk over the tree of SourceNodes. The walking function is called for each\n\t * source file content and is passed the filename and source content.\n\t *\n\t * @param aFn The traversal function.\n\t */\n\tSourceNode.prototype.walkSourceContents =\n\t function SourceNode_walkSourceContents(aFn) {\n\t for (var i = 0, len = this.children.length; i < len; i++) {\n\t if (this.children[i][isSourceNode]) {\n\t this.children[i].walkSourceContents(aFn);\n\t }\n\t }\n\t\n\t var sources = Object.keys(this.sourceContents);\n\t for (var i = 0, len = sources.length; i < len; i++) {\n\t aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);\n\t }\n\t };\n\t\n\t/**\n\t * Return the string representation of this source node. Walks over the tree\n\t * and concatenates all the various snippets together to one string.\n\t */\n\tSourceNode.prototype.toString = function SourceNode_toString() {\n\t var str = \"\";\n\t this.walk(function (chunk) {\n\t str += chunk;\n\t });\n\t return str;\n\t};\n\t\n\t/**\n\t * Returns the string representation of this source node along with a source\n\t * map.\n\t */\n\tSourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {\n\t var generated = {\n\t code: \"\",\n\t line: 1,\n\t column: 0\n\t };\n\t var map = new SourceMapGenerator(aArgs);\n\t var sourceMappingActive = false;\n\t var lastOriginalSource = null;\n\t var lastOriginalLine = null;\n\t var lastOriginalColumn = null;\n\t var lastOriginalName = null;\n\t this.walk(function (chunk, original) {\n\t generated.code += chunk;\n\t if (original.source !== null\n\t && original.line !== null\n\t && original.column !== null) {\n\t if(lastOriginalSource !== original.source\n\t || lastOriginalLine !== original.line\n\t || lastOriginalColumn !== original.column\n\t || lastOriginalName !== original.name) {\n\t map.addMapping({\n\t source: original.source,\n\t original: {\n\t line: original.line,\n\t column: original.column\n\t },\n\t generated: {\n\t line: generated.line,\n\t column: generated.column\n\t },\n\t name: original.name\n\t });\n\t }\n\t lastOriginalSource = original.source;\n\t lastOriginalLine = original.line;\n\t lastOriginalColumn = original.column;\n\t lastOriginalName = original.name;\n\t sourceMappingActive = true;\n\t } else if (sourceMappingActive) {\n\t map.addMapping({\n\t generated: {\n\t line: generated.line,\n\t column: generated.column\n\t }\n\t });\n\t lastOriginalSource = null;\n\t sourceMappingActive = false;\n\t }\n\t for (var idx = 0, length = chunk.length; idx < length; idx++) {\n\t if (chunk.charCodeAt(idx) === NEWLINE_CODE) {\n\t generated.line++;\n\t generated.column = 0;\n\t // Mappings end at eol\n\t if (idx + 1 === length) {\n\t lastOriginalSource = null;\n\t sourceMappingActive = false;\n\t } else if (sourceMappingActive) {\n\t map.addMapping({\n\t source: original.source,\n\t original: {\n\t line: original.line,\n\t column: original.column\n\t },\n\t generated: {\n\t line: generated.line,\n\t column: generated.column\n\t },\n\t name: original.name\n\t });\n\t }\n\t } else {\n\t generated.column++;\n\t }\n\t }\n\t });\n\t this.walkSourceContents(function (sourceFile, sourceContent) {\n\t map.setSourceContent(sourceFile, sourceContent);\n\t });\n\t\n\t return { code: generated.code, map: map };\n\t};\n\t\n\texports.SourceNode = SourceNode;\n\n\n/***/ })\n/******/ ])\n});\n;\n\n\n// WEBPACK FOOTER //\n// source-map.min.js"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 0fd5815da764db5fb9fe","/*\n * Copyright 2009-2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE.txt or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\nexports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator;\nexports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer;\nexports.SourceNode = require('./lib/source-node').SourceNode;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./source-map.js\n// module id = 0\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar base64VLQ = require('./base64-vlq');\nvar util = require('./util');\nvar ArraySet = require('./array-set').ArraySet;\nvar MappingList = require('./mapping-list').MappingList;\n\n/**\n * An instance of the SourceMapGenerator represents a source map which is\n * being built incrementally. You may pass an object with the following\n * properties:\n *\n * - file: The filename of the generated source.\n * - sourceRoot: A root for all relative URLs in this source map.\n */\nfunction SourceMapGenerator(aArgs) {\n if (!aArgs) {\n aArgs = {};\n }\n this._file = util.getArg(aArgs, 'file', null);\n this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);\n this._skipValidation = util.getArg(aArgs, 'skipValidation', false);\n this._sources = new ArraySet();\n this._names = new ArraySet();\n this._mappings = new MappingList();\n this._sourcesContents = null;\n}\n\nSourceMapGenerator.prototype._version = 3;\n\n/**\n * Creates a new SourceMapGenerator based on a SourceMapConsumer\n *\n * @param aSourceMapConsumer The SourceMap.\n */\nSourceMapGenerator.fromSourceMap =\n function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {\n var sourceRoot = aSourceMapConsumer.sourceRoot;\n var generator = new SourceMapGenerator({\n file: aSourceMapConsumer.file,\n sourceRoot: sourceRoot\n });\n aSourceMapConsumer.eachMapping(function (mapping) {\n var newMapping = {\n generated: {\n line: mapping.generatedLine,\n column: mapping.generatedColumn\n }\n };\n\n if (mapping.source != null) {\n newMapping.source = mapping.source;\n if (sourceRoot != null) {\n newMapping.source = util.relative(sourceRoot, newMapping.source);\n }\n\n newMapping.original = {\n line: mapping.originalLine,\n column: mapping.originalColumn\n };\n\n if (mapping.name != null) {\n newMapping.name = mapping.name;\n }\n }\n\n generator.addMapping(newMapping);\n });\n aSourceMapConsumer.sources.forEach(function (sourceFile) {\n var sourceRelative = sourceFile;\n if (sourceRoot !== null) {\n sourceRelative = util.relative(sourceRoot, sourceFile);\n }\n\n if (!generator._sources.has(sourceRelative)) {\n generator._sources.add(sourceRelative);\n }\n\n var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n if (content != null) {\n generator.setSourceContent(sourceFile, content);\n }\n });\n return generator;\n };\n\n/**\n * Add a single mapping from original source line and column to the generated\n * source's line and column for this source map being created. The mapping\n * object should have the following properties:\n *\n * - generated: An object with the generated line and column positions.\n * - original: An object with the original line and column positions.\n * - source: The original source file (relative to the sourceRoot).\n * - name: An optional original token name for this mapping.\n */\nSourceMapGenerator.prototype.addMapping =\n function SourceMapGenerator_addMapping(aArgs) {\n var generated = util.getArg(aArgs, 'generated');\n var original = util.getArg(aArgs, 'original', null);\n var source = util.getArg(aArgs, 'source', null);\n var name = util.getArg(aArgs, 'name', null);\n\n if (!this._skipValidation) {\n this._validateMapping(generated, original, source, name);\n }\n\n if (source != null) {\n source = String(source);\n if (!this._sources.has(source)) {\n this._sources.add(source);\n }\n }\n\n if (name != null) {\n name = String(name);\n if (!this._names.has(name)) {\n this._names.add(name);\n }\n }\n\n this._mappings.add({\n generatedLine: generated.line,\n generatedColumn: generated.column,\n originalLine: original != null && original.line,\n originalColumn: original != null && original.column,\n source: source,\n name: name\n });\n };\n\n/**\n * Set the source content for a source file.\n */\nSourceMapGenerator.prototype.setSourceContent =\n function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {\n var source = aSourceFile;\n if (this._sourceRoot != null) {\n source = util.relative(this._sourceRoot, source);\n }\n\n if (aSourceContent != null) {\n // Add the source content to the _sourcesContents map.\n // Create a new _sourcesContents map if the property is null.\n if (!this._sourcesContents) {\n this._sourcesContents = Object.create(null);\n }\n this._sourcesContents[util.toSetString(source)] = aSourceContent;\n } else if (this._sourcesContents) {\n // Remove the source file from the _sourcesContents map.\n // If the _sourcesContents map is empty, set the property to null.\n delete this._sourcesContents[util.toSetString(source)];\n if (Object.keys(this._sourcesContents).length === 0) {\n this._sourcesContents = null;\n }\n }\n };\n\n/**\n * Applies the mappings of a sub-source-map for a specific source file to the\n * source map being generated. Each mapping to the supplied source file is\n * rewritten using the supplied source map. Note: The resolution for the\n * resulting mappings is the minimium of this map and the supplied map.\n *\n * @param aSourceMapConsumer The source map to be applied.\n * @param aSourceFile Optional. The filename of the source file.\n * If omitted, SourceMapConsumer's file property will be used.\n * @param aSourceMapPath Optional. The dirname of the path to the source map\n * to be applied. If relative, it is relative to the SourceMapConsumer.\n * This parameter is needed when the two source maps aren't in the same\n * directory, and the source map to be applied contains relative source\n * paths. If so, those relative source paths need to be rewritten\n * relative to the SourceMapGenerator.\n */\nSourceMapGenerator.prototype.applySourceMap =\n function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {\n var sourceFile = aSourceFile;\n // If aSourceFile is omitted, we will use the file property of the SourceMap\n if (aSourceFile == null) {\n if (aSourceMapConsumer.file == null) {\n throw new Error(\n 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +\n 'or the source map\\'s \"file\" property. Both were omitted.'\n );\n }\n sourceFile = aSourceMapConsumer.file;\n }\n var sourceRoot = this._sourceRoot;\n // Make \"sourceFile\" relative if an absolute Url is passed.\n if (sourceRoot != null) {\n sourceFile = util.relative(sourceRoot, sourceFile);\n }\n // Applying the SourceMap can add and remove items from the sources and\n // the names array.\n var newSources = new ArraySet();\n var newNames = new ArraySet();\n\n // Find mappings for the \"sourceFile\"\n this._mappings.unsortedForEach(function (mapping) {\n if (mapping.source === sourceFile && mapping.originalLine != null) {\n // Check if it can be mapped by the source map, then update the mapping.\n var original = aSourceMapConsumer.originalPositionFor({\n line: mapping.originalLine,\n column: mapping.originalColumn\n });\n if (original.source != null) {\n // Copy mapping\n mapping.source = original.source;\n if (aSourceMapPath != null) {\n mapping.source = util.join(aSourceMapPath, mapping.source)\n }\n if (sourceRoot != null) {\n mapping.source = util.relative(sourceRoot, mapping.source);\n }\n mapping.originalLine = original.line;\n mapping.originalColumn = original.column;\n if (original.name != null) {\n mapping.name = original.name;\n }\n }\n }\n\n var source = mapping.source;\n if (source != null && !newSources.has(source)) {\n newSources.add(source);\n }\n\n var name = mapping.name;\n if (name != null && !newNames.has(name)) {\n newNames.add(name);\n }\n\n }, this);\n this._sources = newSources;\n this._names = newNames;\n\n // Copy sourcesContents of applied map.\n aSourceMapConsumer.sources.forEach(function (sourceFile) {\n var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n if (content != null) {\n if (aSourceMapPath != null) {\n sourceFile = util.join(aSourceMapPath, sourceFile);\n }\n if (sourceRoot != null) {\n sourceFile = util.relative(sourceRoot, sourceFile);\n }\n this.setSourceContent(sourceFile, content);\n }\n }, this);\n };\n\n/**\n * A mapping can have one of the three levels of data:\n *\n * 1. Just the generated position.\n * 2. The Generated position, original position, and original source.\n * 3. Generated and original position, original source, as well as a name\n * token.\n *\n * To maintain consistency, we validate that any new mapping being added falls\n * in to one of these categories.\n */\nSourceMapGenerator.prototype._validateMapping =\n function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,\n aName) {\n // When aOriginal is truthy but has empty values for .line and .column,\n // it is most likely a programmer error. In this case we throw a very\n // specific error message to try to guide them the right way.\n // For example: https://github.com/Polymer/polymer-bundler/pull/519\n if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {\n throw new Error(\n 'original.line and original.column are not numbers -- you probably meant to omit ' +\n 'the original mapping entirely and only map the generated position. If so, pass ' +\n 'null for the original mapping instead of an object with empty or null values.'\n );\n }\n\n if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n && aGenerated.line > 0 && aGenerated.column >= 0\n && !aOriginal && !aSource && !aName) {\n // Case 1.\n return;\n }\n else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n && aOriginal && 'line' in aOriginal && 'column' in aOriginal\n && aGenerated.line > 0 && aGenerated.column >= 0\n && aOriginal.line > 0 && aOriginal.column >= 0\n && aSource) {\n // Cases 2 and 3.\n return;\n }\n else {\n throw new Error('Invalid mapping: ' + JSON.stringify({\n generated: aGenerated,\n source: aSource,\n original: aOriginal,\n name: aName\n }));\n }\n };\n\n/**\n * Serialize the accumulated mappings in to the stream of base 64 VLQs\n * specified by the source map format.\n */\nSourceMapGenerator.prototype._serializeMappings =\n function SourceMapGenerator_serializeMappings() {\n var previousGeneratedColumn = 0;\n var previousGeneratedLine = 1;\n var previousOriginalColumn = 0;\n var previousOriginalLine = 0;\n var previousName = 0;\n var previousSource = 0;\n var result = '';\n var next;\n var mapping;\n var nameIdx;\n var sourceIdx;\n\n var mappings = this._mappings.toArray();\n for (var i = 0, len = mappings.length; i < len; i++) {\n mapping = mappings[i];\n next = ''\n\n if (mapping.generatedLine !== previousGeneratedLine) {\n previousGeneratedColumn = 0;\n while (mapping.generatedLine !== previousGeneratedLine) {\n next += ';';\n previousGeneratedLine++;\n }\n }\n else {\n if (i > 0) {\n if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {\n continue;\n }\n next += ',';\n }\n }\n\n next += base64VLQ.encode(mapping.generatedColumn\n - previousGeneratedColumn);\n previousGeneratedColumn = mapping.generatedColumn;\n\n if (mapping.source != null) {\n sourceIdx = this._sources.indexOf(mapping.source);\n next += base64VLQ.encode(sourceIdx - previousSource);\n previousSource = sourceIdx;\n\n // lines are stored 0-based in SourceMap spec version 3\n next += base64VLQ.encode(mapping.originalLine - 1\n - previousOriginalLine);\n previousOriginalLine = mapping.originalLine - 1;\n\n next += base64VLQ.encode(mapping.originalColumn\n - previousOriginalColumn);\n previousOriginalColumn = mapping.originalColumn;\n\n if (mapping.name != null) {\n nameIdx = this._names.indexOf(mapping.name);\n next += base64VLQ.encode(nameIdx - previousName);\n previousName = nameIdx;\n }\n }\n\n result += next;\n }\n\n return result;\n };\n\nSourceMapGenerator.prototype._generateSourcesContent =\n function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {\n return aSources.map(function (source) {\n if (!this._sourcesContents) {\n return null;\n }\n if (aSourceRoot != null) {\n source = util.relative(aSourceRoot, source);\n }\n var key = util.toSetString(source);\n return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)\n ? this._sourcesContents[key]\n : null;\n }, this);\n };\n\n/**\n * Externalize the source map.\n */\nSourceMapGenerator.prototype.toJSON =\n function SourceMapGenerator_toJSON() {\n var map = {\n version: this._version,\n sources: this._sources.toArray(),\n names: this._names.toArray(),\n mappings: this._serializeMappings()\n };\n if (this._file != null) {\n map.file = this._file;\n }\n if (this._sourceRoot != null) {\n map.sourceRoot = this._sourceRoot;\n }\n if (this._sourcesContents) {\n map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);\n }\n\n return map;\n };\n\n/**\n * Render the source map being generated to a string.\n */\nSourceMapGenerator.prototype.toString =\n function SourceMapGenerator_toString() {\n return JSON.stringify(this.toJSON());\n };\n\nexports.SourceMapGenerator = SourceMapGenerator;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-map-generator.js\n// module id = 1\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n *\n * Based on the Base 64 VLQ implementation in Closure Compiler:\n * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java\n *\n * Copyright 2011 The Closure Compiler Authors. All rights reserved.\n * Redistribution and use in source and binary forms, with or without\n * modification, are permitted provided that the following conditions are\n * met:\n *\n * * Redistributions of source code must retain the above copyright\n * notice, this list of conditions and the following disclaimer.\n * * Redistributions in binary form must reproduce the above\n * copyright notice, this list of conditions and the following\n * disclaimer in the documentation and/or other materials provided\n * with the distribution.\n * * Neither the name of Google Inc. nor the names of its\n * contributors may be used to endorse or promote products derived\n * from this software without specific prior written permission.\n *\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n * \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n */\n\nvar base64 = require('./base64');\n\n// A single base 64 digit can contain 6 bits of data. For the base 64 variable\n// length quantities we use in the source map spec, the first bit is the sign,\n// the next four bits are the actual value, and the 6th bit is the\n// continuation bit. The continuation bit tells us whether there are more\n// digits in this value following this digit.\n//\n// Continuation\n// | Sign\n// | |\n// V V\n// 101011\n\nvar VLQ_BASE_SHIFT = 5;\n\n// binary: 100000\nvar VLQ_BASE = 1 << VLQ_BASE_SHIFT;\n\n// binary: 011111\nvar VLQ_BASE_MASK = VLQ_BASE - 1;\n\n// binary: 100000\nvar VLQ_CONTINUATION_BIT = VLQ_BASE;\n\n/**\n * Converts from a two-complement value to a value where the sign bit is\n * placed in the least significant bit. For example, as decimals:\n * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary)\n * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary)\n */\nfunction toVLQSigned(aValue) {\n return aValue < 0\n ? ((-aValue) << 1) + 1\n : (aValue << 1) + 0;\n}\n\n/**\n * Converts to a two-complement value from a value where the sign bit is\n * placed in the least significant bit. For example, as decimals:\n * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1\n * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2\n */\nfunction fromVLQSigned(aValue) {\n var isNegative = (aValue & 1) === 1;\n var shifted = aValue >> 1;\n return isNegative\n ? -shifted\n : shifted;\n}\n\n/**\n * Returns the base 64 VLQ encoded value.\n */\nexports.encode = function base64VLQ_encode(aValue) {\n var encoded = \"\";\n var digit;\n\n var vlq = toVLQSigned(aValue);\n\n do {\n digit = vlq & VLQ_BASE_MASK;\n vlq >>>= VLQ_BASE_SHIFT;\n if (vlq > 0) {\n // There are still more digits in this value, so we must make sure the\n // continuation bit is marked.\n digit |= VLQ_CONTINUATION_BIT;\n }\n encoded += base64.encode(digit);\n } while (vlq > 0);\n\n return encoded;\n};\n\n/**\n * Decodes the next base 64 VLQ value from the given string and returns the\n * value and the rest of the string via the out parameter.\n */\nexports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {\n var strLen = aStr.length;\n var result = 0;\n var shift = 0;\n var continuation, digit;\n\n do {\n if (aIndex >= strLen) {\n throw new Error(\"Expected more digits in base 64 VLQ value.\");\n }\n\n digit = base64.decode(aStr.charCodeAt(aIndex++));\n if (digit === -1) {\n throw new Error(\"Invalid base64 digit: \" + aStr.charAt(aIndex - 1));\n }\n\n continuation = !!(digit & VLQ_CONTINUATION_BIT);\n digit &= VLQ_BASE_MASK;\n result = result + (digit << shift);\n shift += VLQ_BASE_SHIFT;\n } while (continuation);\n\n aOutParam.value = fromVLQSigned(result);\n aOutParam.rest = aIndex;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/base64-vlq.js\n// module id = 2\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');\n\n/**\n * Encode an integer in the range of 0 to 63 to a single base 64 digit.\n */\nexports.encode = function (number) {\n if (0 <= number && number < intToCharMap.length) {\n return intToCharMap[number];\n }\n throw new TypeError(\"Must be between 0 and 63: \" + number);\n};\n\n/**\n * Decode a single base 64 character code digit to an integer. Returns -1 on\n * failure.\n */\nexports.decode = function (charCode) {\n var bigA = 65; // 'A'\n var bigZ = 90; // 'Z'\n\n var littleA = 97; // 'a'\n var littleZ = 122; // 'z'\n\n var zero = 48; // '0'\n var nine = 57; // '9'\n\n var plus = 43; // '+'\n var slash = 47; // '/'\n\n var littleOffset = 26;\n var numberOffset = 52;\n\n // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ\n if (bigA <= charCode && charCode <= bigZ) {\n return (charCode - bigA);\n }\n\n // 26 - 51: abcdefghijklmnopqrstuvwxyz\n if (littleA <= charCode && charCode <= littleZ) {\n return (charCode - littleA + littleOffset);\n }\n\n // 52 - 61: 0123456789\n if (zero <= charCode && charCode <= nine) {\n return (charCode - zero + numberOffset);\n }\n\n // 62: +\n if (charCode == plus) {\n return 62;\n }\n\n // 63: /\n if (charCode == slash) {\n return 63;\n }\n\n // Invalid base64 digit.\n return -1;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/base64.js\n// module id = 3\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\n/**\n * This is a helper function for getting values from parameter/options\n * objects.\n *\n * @param args The object we are extracting values from\n * @param name The name of the property we are getting.\n * @param defaultValue An optional value to return if the property is missing\n * from the object. If this is not specified and the property is missing, an\n * error will be thrown.\n */\nfunction getArg(aArgs, aName, aDefaultValue) {\n if (aName in aArgs) {\n return aArgs[aName];\n } else if (arguments.length === 3) {\n return aDefaultValue;\n } else {\n throw new Error('\"' + aName + '\" is a required argument.');\n }\n}\nexports.getArg = getArg;\n\nvar urlRegexp = /^(?:([\\w+\\-.]+):)?\\/\\/(?:(\\w+:\\w+)@)?([\\w.-]*)(?::(\\d+))?(.*)$/;\nvar dataUrlRegexp = /^data:.+\\,.+$/;\n\nfunction urlParse(aUrl) {\n var match = aUrl.match(urlRegexp);\n if (!match) {\n return null;\n }\n return {\n scheme: match[1],\n auth: match[2],\n host: match[3],\n port: match[4],\n path: match[5]\n };\n}\nexports.urlParse = urlParse;\n\nfunction urlGenerate(aParsedUrl) {\n var url = '';\n if (aParsedUrl.scheme) {\n url += aParsedUrl.scheme + ':';\n }\n url += '//';\n if (aParsedUrl.auth) {\n url += aParsedUrl.auth + '@';\n }\n if (aParsedUrl.host) {\n url += aParsedUrl.host;\n }\n if (aParsedUrl.port) {\n url += \":\" + aParsedUrl.port\n }\n if (aParsedUrl.path) {\n url += aParsedUrl.path;\n }\n return url;\n}\nexports.urlGenerate = urlGenerate;\n\n/**\n * Normalizes a path, or the path portion of a URL:\n *\n * - Replaces consecutive slashes with one slash.\n * - Removes unnecessary '.' parts.\n * - Removes unnecessary '<dir>/..' parts.\n *\n * Based on code in the Node.js 'path' core module.\n *\n * @param aPath The path or url to normalize.\n */\nfunction normalize(aPath) {\n var path = aPath;\n var url = urlParse(aPath);\n if (url) {\n if (!url.path) {\n return aPath;\n }\n path = url.path;\n }\n var isAbsolute = exports.isAbsolute(path);\n\n var parts = path.split(/\\/+/);\n for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {\n part = parts[i];\n if (part === '.') {\n parts.splice(i, 1);\n } else if (part === '..') {\n up++;\n } else if (up > 0) {\n if (part === '') {\n // The first part is blank if the path is absolute. Trying to go\n // above the root is a no-op. Therefore we can remove all '..' parts\n // directly after the root.\n parts.splice(i + 1, up);\n up = 0;\n } else {\n parts.splice(i, 2);\n up--;\n }\n }\n }\n path = parts.join('/');\n\n if (path === '') {\n path = isAbsolute ? '/' : '.';\n }\n\n if (url) {\n url.path = path;\n return urlGenerate(url);\n }\n return path;\n}\nexports.normalize = normalize;\n\n/**\n * Joins two paths/URLs.\n *\n * @param aRoot The root path or URL.\n * @param aPath The path or URL to be joined with the root.\n *\n * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a\n * scheme-relative URL: Then the scheme of aRoot, if any, is prepended\n * first.\n * - Otherwise aPath is a path. If aRoot is a URL, then its path portion\n * is updated with the result and aRoot is returned. Otherwise the result\n * is returned.\n * - If aPath is absolute, the result is aPath.\n * - Otherwise the two paths are joined with a slash.\n * - Joining for example 'http://' and 'www.example.com' is also supported.\n */\nfunction join(aRoot, aPath) {\n if (aRoot === \"\") {\n aRoot = \".\";\n }\n if (aPath === \"\") {\n aPath = \".\";\n }\n var aPathUrl = urlParse(aPath);\n var aRootUrl = urlParse(aRoot);\n if (aRootUrl) {\n aRoot = aRootUrl.path || '/';\n }\n\n // `join(foo, '//www.example.org')`\n if (aPathUrl && !aPathUrl.scheme) {\n if (aRootUrl) {\n aPathUrl.scheme = aRootUrl.scheme;\n }\n return urlGenerate(aPathUrl);\n }\n\n if (aPathUrl || aPath.match(dataUrlRegexp)) {\n return aPath;\n }\n\n // `join('http://', 'www.example.com')`\n if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {\n aRootUrl.host = aPath;\n return urlGenerate(aRootUrl);\n }\n\n var joined = aPath.charAt(0) === '/'\n ? aPath\n : normalize(aRoot.replace(/\\/+$/, '') + '/' + aPath);\n\n if (aRootUrl) {\n aRootUrl.path = joined;\n return urlGenerate(aRootUrl);\n }\n return joined;\n}\nexports.join = join;\n\nexports.isAbsolute = function (aPath) {\n return aPath.charAt(0) === '/' || urlRegexp.test(aPath);\n};\n\n/**\n * Make a path relative to a URL or another path.\n *\n * @param aRoot The root path or URL.\n * @param aPath The path or URL to be made relative to aRoot.\n */\nfunction relative(aRoot, aPath) {\n if (aRoot === \"\") {\n aRoot = \".\";\n }\n\n aRoot = aRoot.replace(/\\/$/, '');\n\n // It is possible for the path to be above the root. In this case, simply\n // checking whether the root is a prefix of the path won't work. Instead, we\n // need to remove components from the root one by one, until either we find\n // a prefix that fits, or we run out of components to remove.\n var level = 0;\n while (aPath.indexOf(aRoot + '/') !== 0) {\n var index = aRoot.lastIndexOf(\"/\");\n if (index < 0) {\n return aPath;\n }\n\n // If the only part of the root that is left is the scheme (i.e. http://,\n // file:///, etc.), one or more slashes (/), or simply nothing at all, we\n // have exhausted all components, so the path is not relative to the root.\n aRoot = aRoot.slice(0, index);\n if (aRoot.match(/^([^\\/]+:\\/)?\\/*$/)) {\n return aPath;\n }\n\n ++level;\n }\n\n // Make sure we add a \"../\" for each component we removed from the root.\n return Array(level + 1).join(\"../\") + aPath.substr(aRoot.length + 1);\n}\nexports.relative = relative;\n\nvar supportsNullProto = (function () {\n var obj = Object.create(null);\n return !('__proto__' in obj);\n}());\n\nfunction identity (s) {\n return s;\n}\n\n/**\n * Because behavior goes wacky when you set `__proto__` on objects, we\n * have to prefix all the strings in our set with an arbitrary character.\n *\n * See https://github.com/mozilla/source-map/pull/31 and\n * https://github.com/mozilla/source-map/issues/30\n *\n * @param String aStr\n */\nfunction toSetString(aStr) {\n if (isProtoString(aStr)) {\n return '$' + aStr;\n }\n\n return aStr;\n}\nexports.toSetString = supportsNullProto ? identity : toSetString;\n\nfunction fromSetString(aStr) {\n if (isProtoString(aStr)) {\n return aStr.slice(1);\n }\n\n return aStr;\n}\nexports.fromSetString = supportsNullProto ? identity : fromSetString;\n\nfunction isProtoString(s) {\n if (!s) {\n return false;\n }\n\n var length = s.length;\n\n if (length < 9 /* \"__proto__\".length */) {\n return false;\n }\n\n if (s.charCodeAt(length - 1) !== 95 /* '_' */ ||\n s.charCodeAt(length - 2) !== 95 /* '_' */ ||\n s.charCodeAt(length - 3) !== 111 /* 'o' */ ||\n s.charCodeAt(length - 4) !== 116 /* 't' */ ||\n s.charCodeAt(length - 5) !== 111 /* 'o' */ ||\n s.charCodeAt(length - 6) !== 114 /* 'r' */ ||\n s.charCodeAt(length - 7) !== 112 /* 'p' */ ||\n s.charCodeAt(length - 8) !== 95 /* '_' */ ||\n s.charCodeAt(length - 9) !== 95 /* '_' */) {\n return false;\n }\n\n for (var i = length - 10; i >= 0; i--) {\n if (s.charCodeAt(i) !== 36 /* '$' */) {\n return false;\n }\n }\n\n return true;\n}\n\n/**\n * Comparator between two mappings where the original positions are compared.\n *\n * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n * mappings with the same original source/line/column, but different generated\n * line and column the same. Useful when searching for a mapping with a\n * stubbed out mapping.\n */\nfunction compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {\n var cmp = strcmp(mappingA.source, mappingB.source);\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalLine - mappingB.originalLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalColumn - mappingB.originalColumn;\n if (cmp !== 0 || onlyCompareOriginal) {\n return cmp;\n }\n\n cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.generatedLine - mappingB.generatedLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n return strcmp(mappingA.name, mappingB.name);\n}\nexports.compareByOriginalPositions = compareByOriginalPositions;\n\n/**\n * Comparator between two mappings with deflated source and name indices where\n * the generated positions are compared.\n *\n * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n * mappings with the same generated line and column, but different\n * source/name/original line and column the same. Useful when searching for a\n * mapping with a stubbed out mapping.\n */\nfunction compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {\n var cmp = mappingA.generatedLine - mappingB.generatedLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n if (cmp !== 0 || onlyCompareGenerated) {\n return cmp;\n }\n\n cmp = strcmp(mappingA.source, mappingB.source);\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalLine - mappingB.originalLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalColumn - mappingB.originalColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n return strcmp(mappingA.name, mappingB.name);\n}\nexports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;\n\nfunction strcmp(aStr1, aStr2) {\n if (aStr1 === aStr2) {\n return 0;\n }\n\n if (aStr1 === null) {\n return 1; // aStr2 !== null\n }\n\n if (aStr2 === null) {\n return -1; // aStr1 !== null\n }\n\n if (aStr1 > aStr2) {\n return 1;\n }\n\n return -1;\n}\n\n/**\n * Comparator between two mappings with inflated source and name strings where\n * the generated positions are compared.\n */\nfunction compareByGeneratedPositionsInflated(mappingA, mappingB) {\n var cmp = mappingA.generatedLine - mappingB.generatedLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = strcmp(mappingA.source, mappingB.source);\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalLine - mappingB.originalLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalColumn - mappingB.originalColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n return strcmp(mappingA.name, mappingB.name);\n}\nexports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;\n\n/**\n * Strip any JSON XSSI avoidance prefix from the string (as documented\n * in the source maps specification), and then parse the string as\n * JSON.\n */\nfunction parseSourceMapInput(str) {\n return JSON.parse(str.replace(/^\\)]}'[^\\n]*\\n/, ''));\n}\nexports.parseSourceMapInput = parseSourceMapInput;\n\n/**\n * Compute the URL of a source given the the source root, the source's\n * URL, and the source map's URL.\n */\nfunction computeSourceURL(sourceRoot, sourceURL, sourceMapURL) {\n sourceURL = sourceURL || '';\n\n if (sourceRoot) {\n // This follows what Chrome does.\n if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') {\n sourceRoot += '/';\n }\n // The spec says:\n // Line 4: An optional source root, useful for relocating source\n // files on a server or removing repeated values in the\n // “sources” entry. This value is prepended to the individual\n // entries in the “source” field.\n sourceURL = sourceRoot + sourceURL;\n }\n\n // Historically, SourceMapConsumer did not take the sourceMapURL as\n // a parameter. This mode is still somewhat supported, which is why\n // this code block is conditional. However, it's preferable to pass\n // the source map URL to SourceMapConsumer, so that this function\n // can implement the source URL resolution algorithm as outlined in\n // the spec. This block is basically the equivalent of:\n // new URL(sourceURL, sourceMapURL).toString()\n // ... except it avoids using URL, which wasn't available in the\n // older releases of node still supported by this library.\n //\n // The spec says:\n // If the sources are not absolute URLs after prepending of the\n // “sourceRoot”, the sources are resolved relative to the\n // SourceMap (like resolving script src in a html document).\n if (sourceMapURL) {\n var parsed = urlParse(sourceMapURL);\n if (!parsed) {\n throw new Error(\"sourceMapURL could not be parsed\");\n }\n if (parsed.path) {\n // Strip the last path component, but keep the \"/\".\n var index = parsed.path.lastIndexOf('/');\n if (index >= 0) {\n parsed.path = parsed.path.substring(0, index + 1);\n }\n }\n sourceURL = join(urlGenerate(parsed), sourceURL);\n }\n\n return normalize(sourceURL);\n}\nexports.computeSourceURL = computeSourceURL;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/util.js\n// module id = 4\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\nvar has = Object.prototype.hasOwnProperty;\nvar hasNativeMap = typeof Map !== \"undefined\";\n\n/**\n * A data structure which is a combination of an array and a set. Adding a new\n * member is O(1), testing for membership is O(1), and finding the index of an\n * element is O(1). Removing elements from the set is not supported. Only\n * strings are supported for membership.\n */\nfunction ArraySet() {\n this._array = [];\n this._set = hasNativeMap ? new Map() : Object.create(null);\n}\n\n/**\n * Static method for creating ArraySet instances from an existing array.\n */\nArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {\n var set = new ArraySet();\n for (var i = 0, len = aArray.length; i < len; i++) {\n set.add(aArray[i], aAllowDuplicates);\n }\n return set;\n};\n\n/**\n * Return how many unique items are in this ArraySet. If duplicates have been\n * added, than those do not count towards the size.\n *\n * @returns Number\n */\nArraySet.prototype.size = function ArraySet_size() {\n return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;\n};\n\n/**\n * Add the given string to this set.\n *\n * @param String aStr\n */\nArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {\n var sStr = hasNativeMap ? aStr : util.toSetString(aStr);\n var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);\n var idx = this._array.length;\n if (!isDuplicate || aAllowDuplicates) {\n this._array.push(aStr);\n }\n if (!isDuplicate) {\n if (hasNativeMap) {\n this._set.set(aStr, idx);\n } else {\n this._set[sStr] = idx;\n }\n }\n};\n\n/**\n * Is the given string a member of this set?\n *\n * @param String aStr\n */\nArraySet.prototype.has = function ArraySet_has(aStr) {\n if (hasNativeMap) {\n return this._set.has(aStr);\n } else {\n var sStr = util.toSetString(aStr);\n return has.call(this._set, sStr);\n }\n};\n\n/**\n * What is the index of the given string in the array?\n *\n * @param String aStr\n */\nArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {\n if (hasNativeMap) {\n var idx = this._set.get(aStr);\n if (idx >= 0) {\n return idx;\n }\n } else {\n var sStr = util.toSetString(aStr);\n if (has.call(this._set, sStr)) {\n return this._set[sStr];\n }\n }\n\n throw new Error('\"' + aStr + '\" is not in the set.');\n};\n\n/**\n * What is the element at the given index?\n *\n * @param Number aIdx\n */\nArraySet.prototype.at = function ArraySet_at(aIdx) {\n if (aIdx >= 0 && aIdx < this._array.length) {\n return this._array[aIdx];\n }\n throw new Error('No element indexed by ' + aIdx);\n};\n\n/**\n * Returns the array representation of this set (which has the proper indices\n * indicated by indexOf). Note that this is a copy of the internal array used\n * for storing the members so that no one can mess with internal state.\n */\nArraySet.prototype.toArray = function ArraySet_toArray() {\n return this._array.slice();\n};\n\nexports.ArraySet = ArraySet;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/array-set.js\n// module id = 5\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2014 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\n\n/**\n * Determine whether mappingB is after mappingA with respect to generated\n * position.\n */\nfunction generatedPositionAfter(mappingA, mappingB) {\n // Optimized for most common case\n var lineA = mappingA.generatedLine;\n var lineB = mappingB.generatedLine;\n var columnA = mappingA.generatedColumn;\n var columnB = mappingB.generatedColumn;\n return lineB > lineA || lineB == lineA && columnB >= columnA ||\n util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;\n}\n\n/**\n * A data structure to provide a sorted view of accumulated mappings in a\n * performance conscious manner. It trades a neglibable overhead in general\n * case for a large speedup in case of mappings being added in order.\n */\nfunction MappingList() {\n this._array = [];\n this._sorted = true;\n // Serves as infimum\n this._last = {generatedLine: -1, generatedColumn: 0};\n}\n\n/**\n * Iterate through internal items. This method takes the same arguments that\n * `Array.prototype.forEach` takes.\n *\n * NOTE: The order of the mappings is NOT guaranteed.\n */\nMappingList.prototype.unsortedForEach =\n function MappingList_forEach(aCallback, aThisArg) {\n this._array.forEach(aCallback, aThisArg);\n };\n\n/**\n * Add the given source mapping.\n *\n * @param Object aMapping\n */\nMappingList.prototype.add = function MappingList_add(aMapping) {\n if (generatedPositionAfter(this._last, aMapping)) {\n this._last = aMapping;\n this._array.push(aMapping);\n } else {\n this._sorted = false;\n this._array.push(aMapping);\n }\n};\n\n/**\n * Returns the flat, sorted array of mappings. The mappings are sorted by\n * generated position.\n *\n * WARNING: This method returns internal data without copying, for\n * performance. The return value must NOT be mutated, and should be treated as\n * an immutable borrow. If you want to take ownership, you must make your own\n * copy.\n */\nMappingList.prototype.toArray = function MappingList_toArray() {\n if (!this._sorted) {\n this._array.sort(util.compareByGeneratedPositionsInflated);\n this._sorted = true;\n }\n return this._array;\n};\n\nexports.MappingList = MappingList;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/mapping-list.js\n// module id = 6\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\nvar binarySearch = require('./binary-search');\nvar ArraySet = require('./array-set').ArraySet;\nvar base64VLQ = require('./base64-vlq');\nvar quickSort = require('./quick-sort').quickSort;\n\nfunction SourceMapConsumer(aSourceMap, aSourceMapURL) {\n var sourceMap = aSourceMap;\n if (typeof aSourceMap === 'string') {\n sourceMap = util.parseSourceMapInput(aSourceMap);\n }\n\n return sourceMap.sections != null\n ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL)\n : new BasicSourceMapConsumer(sourceMap, aSourceMapURL);\n}\n\nSourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) {\n return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL);\n}\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nSourceMapConsumer.prototype._version = 3;\n\n// `__generatedMappings` and `__originalMappings` are arrays that hold the\n// parsed mapping coordinates from the source map's \"mappings\" attribute. They\n// are lazily instantiated, accessed via the `_generatedMappings` and\n// `_originalMappings` getters respectively, and we only parse the mappings\n// and create these arrays once queried for a source location. We jump through\n// these hoops because there can be many thousands of mappings, and parsing\n// them is expensive, so we only want to do it if we must.\n//\n// Each object in the arrays is of the form:\n//\n// {\n// generatedLine: The line number in the generated code,\n// generatedColumn: The column number in the generated code,\n// source: The path to the original source file that generated this\n// chunk of code,\n// originalLine: The line number in the original source that\n// corresponds to this chunk of generated code,\n// originalColumn: The column number in the original source that\n// corresponds to this chunk of generated code,\n// name: The name of the original symbol which generated this chunk of\n// code.\n// }\n//\n// All properties except for `generatedLine` and `generatedColumn` can be\n// `null`.\n//\n// `_generatedMappings` is ordered by the generated positions.\n//\n// `_originalMappings` is ordered by the original positions.\n\nSourceMapConsumer.prototype.__generatedMappings = null;\nObject.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {\n configurable: true,\n enumerable: true,\n get: function () {\n if (!this.__generatedMappings) {\n this._parseMappings(this._mappings, this.sourceRoot);\n }\n\n return this.__generatedMappings;\n }\n});\n\nSourceMapConsumer.prototype.__originalMappings = null;\nObject.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {\n configurable: true,\n enumerable: true,\n get: function () {\n if (!this.__originalMappings) {\n this._parseMappings(this._mappings, this.sourceRoot);\n }\n\n return this.__originalMappings;\n }\n});\n\nSourceMapConsumer.prototype._charIsMappingSeparator =\n function SourceMapConsumer_charIsMappingSeparator(aStr, index) {\n var c = aStr.charAt(index);\n return c === \";\" || c === \",\";\n };\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nSourceMapConsumer.prototype._parseMappings =\n function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n throw new Error(\"Subclasses must implement _parseMappings\");\n };\n\nSourceMapConsumer.GENERATED_ORDER = 1;\nSourceMapConsumer.ORIGINAL_ORDER = 2;\n\nSourceMapConsumer.GREATEST_LOWER_BOUND = 1;\nSourceMapConsumer.LEAST_UPPER_BOUND = 2;\n\n/**\n * Iterate over each mapping between an original source/line/column and a\n * generated line/column in this source map.\n *\n * @param Function aCallback\n * The function that is called with each mapping.\n * @param Object aContext\n * Optional. If specified, this object will be the value of `this` every\n * time that `aCallback` is called.\n * @param aOrder\n * Either `SourceMapConsumer.GENERATED_ORDER` or\n * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to\n * iterate over the mappings sorted by the generated file's line/column\n * order or the original's source/line/column order, respectively. Defaults to\n * `SourceMapConsumer.GENERATED_ORDER`.\n */\nSourceMapConsumer.prototype.eachMapping =\n function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {\n var context = aContext || null;\n var order = aOrder || SourceMapConsumer.GENERATED_ORDER;\n\n var mappings;\n switch (order) {\n case SourceMapConsumer.GENERATED_ORDER:\n mappings = this._generatedMappings;\n break;\n case SourceMapConsumer.ORIGINAL_ORDER:\n mappings = this._originalMappings;\n break;\n default:\n throw new Error(\"Unknown order of iteration.\");\n }\n\n var sourceRoot = this.sourceRoot;\n mappings.map(function (mapping) {\n var source = mapping.source === null ? null : this._sources.at(mapping.source);\n source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL);\n return {\n source: source,\n generatedLine: mapping.generatedLine,\n generatedColumn: mapping.generatedColumn,\n originalLine: mapping.originalLine,\n originalColumn: mapping.originalColumn,\n name: mapping.name === null ? null : this._names.at(mapping.name)\n };\n }, this).forEach(aCallback, context);\n };\n\n/**\n * Returns all generated line and column information for the original source,\n * line, and column provided. If no column is provided, returns all mappings\n * corresponding to a either the line we are searching for or the next\n * closest line that has any mappings. Otherwise, returns all mappings\n * corresponding to the given line and either the column we are searching for\n * or the next closest column that has any offsets.\n *\n * The only argument is an object with the following properties:\n *\n * - source: The filename of the original source.\n * - line: The line number in the original source. The line number is 1-based.\n * - column: Optional. the column number in the original source.\n * The column number is 0-based.\n *\n * and an array of objects is returned, each with the following properties:\n *\n * - line: The line number in the generated source, or null. The\n * line number is 1-based.\n * - column: The column number in the generated source, or null.\n * The column number is 0-based.\n */\nSourceMapConsumer.prototype.allGeneratedPositionsFor =\n function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {\n var line = util.getArg(aArgs, 'line');\n\n // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping\n // returns the index of the closest mapping less than the needle. By\n // setting needle.originalColumn to 0, we thus find the last mapping for\n // the given line, provided such a mapping exists.\n var needle = {\n source: util.getArg(aArgs, 'source'),\n originalLine: line,\n originalColumn: util.getArg(aArgs, 'column', 0)\n };\n\n needle.source = this._findSourceIndex(needle.source);\n if (needle.source < 0) {\n return [];\n }\n\n var mappings = [];\n\n var index = this._findMapping(needle,\n this._originalMappings,\n \"originalLine\",\n \"originalColumn\",\n util.compareByOriginalPositions,\n binarySearch.LEAST_UPPER_BOUND);\n if (index >= 0) {\n var mapping = this._originalMappings[index];\n\n if (aArgs.column === undefined) {\n var originalLine = mapping.originalLine;\n\n // Iterate until either we run out of mappings, or we run into\n // a mapping for a different line than the one we found. Since\n // mappings are sorted, this is guaranteed to find all mappings for\n // the line we found.\n while (mapping && mapping.originalLine === originalLine) {\n mappings.push({\n line: util.getArg(mapping, 'generatedLine', null),\n column: util.getArg(mapping, 'generatedColumn', null),\n lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n });\n\n mapping = this._originalMappings[++index];\n }\n } else {\n var originalColumn = mapping.originalColumn;\n\n // Iterate until either we run out of mappings, or we run into\n // a mapping for a different line than the one we were searching for.\n // Since mappings are sorted, this is guaranteed to find all mappings for\n // the line we are searching for.\n while (mapping &&\n mapping.originalLine === line &&\n mapping.originalColumn == originalColumn) {\n mappings.push({\n line: util.getArg(mapping, 'generatedLine', null),\n column: util.getArg(mapping, 'generatedColumn', null),\n lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n });\n\n mapping = this._originalMappings[++index];\n }\n }\n }\n\n return mappings;\n };\n\nexports.SourceMapConsumer = SourceMapConsumer;\n\n/**\n * A BasicSourceMapConsumer instance represents a parsed source map which we can\n * query for information about the original file positions by giving it a file\n * position in the generated source.\n *\n * The first parameter is the raw source map (either as a JSON string, or\n * already parsed to an object). According to the spec, source maps have the\n * following attributes:\n *\n * - version: Which version of the source map spec this map is following.\n * - sources: An array of URLs to the original source files.\n * - names: An array of identifiers which can be referrenced by individual mappings.\n * - sourceRoot: Optional. The URL root from which all sources are relative.\n * - sourcesContent: Optional. An array of contents of the original source files.\n * - mappings: A string of base64 VLQs which contain the actual mappings.\n * - file: Optional. The generated file this source map is associated with.\n *\n * Here is an example source map, taken from the source map spec[0]:\n *\n * {\n * version : 3,\n * file: \"out.js\",\n * sourceRoot : \"\",\n * sources: [\"foo.js\", \"bar.js\"],\n * names: [\"src\", \"maps\", \"are\", \"fun\"],\n * mappings: \"AA,AB;;ABCDE;\"\n * }\n *\n * The second parameter, if given, is a string whose value is the URL\n * at which the source map was found. This URL is used to compute the\n * sources array.\n *\n * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#\n */\nfunction BasicSourceMapConsumer(aSourceMap, aSourceMapURL) {\n var sourceMap = aSourceMap;\n if (typeof aSourceMap === 'string') {\n sourceMap = util.parseSourceMapInput(aSourceMap);\n }\n\n var version = util.getArg(sourceMap, 'version');\n var sources = util.getArg(sourceMap, 'sources');\n // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which\n // requires the array) to play nice here.\n var names = util.getArg(sourceMap, 'names', []);\n var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);\n var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);\n var mappings = util.getArg(sourceMap, 'mappings');\n var file = util.getArg(sourceMap, 'file', null);\n\n // Once again, Sass deviates from the spec and supplies the version as a\n // string rather than a number, so we use loose equality checking here.\n if (version != this._version) {\n throw new Error('Unsupported version: ' + version);\n }\n\n if (sourceRoot) {\n sourceRoot = util.normalize(sourceRoot);\n }\n\n sources = sources\n .map(String)\n // Some source maps produce relative source paths like \"./foo.js\" instead of\n // \"foo.js\". Normalize these first so that future comparisons will succeed.\n // See bugzil.la/1090768.\n .map(util.normalize)\n // Always ensure that absolute sources are internally stored relative to\n // the source root, if the source root is absolute. Not doing this would\n // be particularly problematic when the source root is a prefix of the\n // source (valid, but why??). See github issue #199 and bugzil.la/1188982.\n .map(function (source) {\n return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)\n ? util.relative(sourceRoot, source)\n : source;\n });\n\n // Pass `true` below to allow duplicate names and sources. While source maps\n // are intended to be compressed and deduplicated, the TypeScript compiler\n // sometimes generates source maps with duplicates in them. See Github issue\n // #72 and bugzil.la/889492.\n this._names = ArraySet.fromArray(names.map(String), true);\n this._sources = ArraySet.fromArray(sources, true);\n\n this._absoluteSources = this._sources.toArray().map(function (s) {\n return util.computeSourceURL(sourceRoot, s, aSourceMapURL);\n });\n\n this.sourceRoot = sourceRoot;\n this.sourcesContent = sourcesContent;\n this._mappings = mappings;\n this._sourceMapURL = aSourceMapURL;\n this.file = file;\n}\n\nBasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\nBasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;\n\n/**\n * Utility function to find the index of a source. Returns -1 if not\n * found.\n */\nBasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) {\n var relativeSource = aSource;\n if (this.sourceRoot != null) {\n relativeSource = util.relative(this.sourceRoot, relativeSource);\n }\n\n if (this._sources.has(relativeSource)) {\n return this._sources.indexOf(relativeSource);\n }\n\n // Maybe aSource is an absolute URL as returned by |sources|. In\n // this case we can't simply undo the transform.\n var i;\n for (i = 0; i < this._absoluteSources.length; ++i) {\n if (this._absoluteSources[i] == aSource) {\n return i;\n }\n }\n\n return -1;\n};\n\n/**\n * Create a BasicSourceMapConsumer from a SourceMapGenerator.\n *\n * @param SourceMapGenerator aSourceMap\n * The source map that will be consumed.\n * @param String aSourceMapURL\n * The URL at which the source map can be found (optional)\n * @returns BasicSourceMapConsumer\n */\nBasicSourceMapConsumer.fromSourceMap =\n function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) {\n var smc = Object.create(BasicSourceMapConsumer.prototype);\n\n var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);\n var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);\n smc.sourceRoot = aSourceMap._sourceRoot;\n smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),\n smc.sourceRoot);\n smc.file = aSourceMap._file;\n smc._sourceMapURL = aSourceMapURL;\n smc._absoluteSources = smc._sources.toArray().map(function (s) {\n return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL);\n });\n\n // Because we are modifying the entries (by converting string sources and\n // names to indices into the sources and names ArraySets), we have to make\n // a copy of the entry or else bad things happen. Shared mutable state\n // strikes again! See github issue #191.\n\n var generatedMappings = aSourceMap._mappings.toArray().slice();\n var destGeneratedMappings = smc.__generatedMappings = [];\n var destOriginalMappings = smc.__originalMappings = [];\n\n for (var i = 0, length = generatedMappings.length; i < length; i++) {\n var srcMapping = generatedMappings[i];\n var destMapping = new Mapping;\n destMapping.generatedLine = srcMapping.generatedLine;\n destMapping.generatedColumn = srcMapping.generatedColumn;\n\n if (srcMapping.source) {\n destMapping.source = sources.indexOf(srcMapping.source);\n destMapping.originalLine = srcMapping.originalLine;\n destMapping.originalColumn = srcMapping.originalColumn;\n\n if (srcMapping.name) {\n destMapping.name = names.indexOf(srcMapping.name);\n }\n\n destOriginalMappings.push(destMapping);\n }\n\n destGeneratedMappings.push(destMapping);\n }\n\n quickSort(smc.__originalMappings, util.compareByOriginalPositions);\n\n return smc;\n };\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nBasicSourceMapConsumer.prototype._version = 3;\n\n/**\n * The list of original sources.\n */\nObject.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {\n get: function () {\n return this._absoluteSources.slice();\n }\n});\n\n/**\n * Provide the JIT with a nice shape / hidden class.\n */\nfunction Mapping() {\n this.generatedLine = 0;\n this.generatedColumn = 0;\n this.source = null;\n this.originalLine = null;\n this.originalColumn = null;\n this.name = null;\n}\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nBasicSourceMapConsumer.prototype._parseMappings =\n function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n var generatedLine = 1;\n var previousGeneratedColumn = 0;\n var previousOriginalLine = 0;\n var previousOriginalColumn = 0;\n var previousSource = 0;\n var previousName = 0;\n var length = aStr.length;\n var index = 0;\n var cachedSegments = {};\n var temp = {};\n var originalMappings = [];\n var generatedMappings = [];\n var mapping, str, segment, end, value;\n\n while (index < length) {\n if (aStr.charAt(index) === ';') {\n generatedLine++;\n index++;\n previousGeneratedColumn = 0;\n }\n else if (aStr.charAt(index) === ',') {\n index++;\n }\n else {\n mapping = new Mapping();\n mapping.generatedLine = generatedLine;\n\n // Because each offset is encoded relative to the previous one,\n // many segments often have the same encoding. We can exploit this\n // fact by caching the parsed variable length fields of each segment,\n // allowing us to avoid a second parse if we encounter the same\n // segment again.\n for (end = index; end < length; end++) {\n if (this._charIsMappingSeparator(aStr, end)) {\n break;\n }\n }\n str = aStr.slice(index, end);\n\n segment = cachedSegments[str];\n if (segment) {\n index += str.length;\n } else {\n segment = [];\n while (index < end) {\n base64VLQ.decode(aStr, index, temp);\n value = temp.value;\n index = temp.rest;\n segment.push(value);\n }\n\n if (segment.length === 2) {\n throw new Error('Found a source, but no line and column');\n }\n\n if (segment.length === 3) {\n throw new Error('Found a source and line, but no column');\n }\n\n cachedSegments[str] = segment;\n }\n\n // Generated column.\n mapping.generatedColumn = previousGeneratedColumn + segment[0];\n previousGeneratedColumn = mapping.generatedColumn;\n\n if (segment.length > 1) {\n // Original source.\n mapping.source = previousSource + segment[1];\n previousSource += segment[1];\n\n // Original line.\n mapping.originalLine = previousOriginalLine + segment[2];\n previousOriginalLine = mapping.originalLine;\n // Lines are stored 0-based\n mapping.originalLine += 1;\n\n // Original column.\n mapping.originalColumn = previousOriginalColumn + segment[3];\n previousOriginalColumn = mapping.originalColumn;\n\n if (segment.length > 4) {\n // Original name.\n mapping.name = previousName + segment[4];\n previousName += segment[4];\n }\n }\n\n generatedMappings.push(mapping);\n if (typeof mapping.originalLine === 'number') {\n originalMappings.push(mapping);\n }\n }\n }\n\n quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);\n this.__generatedMappings = generatedMappings;\n\n quickSort(originalMappings, util.compareByOriginalPositions);\n this.__originalMappings = originalMappings;\n };\n\n/**\n * Find the mapping that best matches the hypothetical \"needle\" mapping that\n * we are searching for in the given \"haystack\" of mappings.\n */\nBasicSourceMapConsumer.prototype._findMapping =\n function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,\n aColumnName, aComparator, aBias) {\n // To return the position we are searching for, we must first find the\n // mapping for the given position and then return the opposite position it\n // points to. Because the mappings are sorted, we can use binary search to\n // find the best mapping.\n\n if (aNeedle[aLineName] <= 0) {\n throw new TypeError('Line must be greater than or equal to 1, got '\n + aNeedle[aLineName]);\n }\n if (aNeedle[aColumnName] < 0) {\n throw new TypeError('Column must be greater than or equal to 0, got '\n + aNeedle[aColumnName]);\n }\n\n return binarySearch.search(aNeedle, aMappings, aComparator, aBias);\n };\n\n/**\n * Compute the last column for each generated mapping. The last column is\n * inclusive.\n */\nBasicSourceMapConsumer.prototype.computeColumnSpans =\n function SourceMapConsumer_computeColumnSpans() {\n for (var index = 0; index < this._generatedMappings.length; ++index) {\n var mapping = this._generatedMappings[index];\n\n // Mappings do not contain a field for the last generated columnt. We\n // can come up with an optimistic estimate, however, by assuming that\n // mappings are contiguous (i.e. given two consecutive mappings, the\n // first mapping ends where the second one starts).\n if (index + 1 < this._generatedMappings.length) {\n var nextMapping = this._generatedMappings[index + 1];\n\n if (mapping.generatedLine === nextMapping.generatedLine) {\n mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;\n continue;\n }\n }\n\n // The last mapping for each line spans the entire line.\n mapping.lastGeneratedColumn = Infinity;\n }\n };\n\n/**\n * Returns the original source, line, and column information for the generated\n * source's line and column positions provided. The only argument is an object\n * with the following properties:\n *\n * - line: The line number in the generated source. The line number\n * is 1-based.\n * - column: The column number in the generated source. The column\n * number is 0-based.\n * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n *\n * and an object is returned with the following properties:\n *\n * - source: The original source file, or null.\n * - line: The line number in the original source, or null. The\n * line number is 1-based.\n * - column: The column number in the original source, or null. The\n * column number is 0-based.\n * - name: The original identifier, or null.\n */\nBasicSourceMapConsumer.prototype.originalPositionFor =\n function SourceMapConsumer_originalPositionFor(aArgs) {\n var needle = {\n generatedLine: util.getArg(aArgs, 'line'),\n generatedColumn: util.getArg(aArgs, 'column')\n };\n\n var index = this._findMapping(\n needle,\n this._generatedMappings,\n \"generatedLine\",\n \"generatedColumn\",\n util.compareByGeneratedPositionsDeflated,\n util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n );\n\n if (index >= 0) {\n var mapping = this._generatedMappings[index];\n\n if (mapping.generatedLine === needle.generatedLine) {\n var source = util.getArg(mapping, 'source', null);\n if (source !== null) {\n source = this._sources.at(source);\n source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL);\n }\n var name = util.getArg(mapping, 'name', null);\n if (name !== null) {\n name = this._names.at(name);\n }\n return {\n source: source,\n line: util.getArg(mapping, 'originalLine', null),\n column: util.getArg(mapping, 'originalColumn', null),\n name: name\n };\n }\n }\n\n return {\n source: null,\n line: null,\n column: null,\n name: null\n };\n };\n\n/**\n * Return true if we have the source content for every source in the source\n * map, false otherwise.\n */\nBasicSourceMapConsumer.prototype.hasContentsOfAllSources =\n function BasicSourceMapConsumer_hasContentsOfAllSources() {\n if (!this.sourcesContent) {\n return false;\n }\n return this.sourcesContent.length >= this._sources.size() &&\n !this.sourcesContent.some(function (sc) { return sc == null; });\n };\n\n/**\n * Returns the original source content. The only argument is the url of the\n * original source file. Returns null if no original source content is\n * available.\n */\nBasicSourceMapConsumer.prototype.sourceContentFor =\n function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n if (!this.sourcesContent) {\n return null;\n }\n\n var index = this._findSourceIndex(aSource);\n if (index >= 0) {\n return this.sourcesContent[index];\n }\n\n var relativeSource = aSource;\n if (this.sourceRoot != null) {\n relativeSource = util.relative(this.sourceRoot, relativeSource);\n }\n\n var url;\n if (this.sourceRoot != null\n && (url = util.urlParse(this.sourceRoot))) {\n // XXX: file:// URIs and absolute paths lead to unexpected behavior for\n // many users. We can help them out when they expect file:// URIs to\n // behave like it would if they were running a local HTTP server. See\n // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.\n var fileUriAbsPath = relativeSource.replace(/^file:\\/\\//, \"\");\n if (url.scheme == \"file\"\n && this._sources.has(fileUriAbsPath)) {\n return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]\n }\n\n if ((!url.path || url.path == \"/\")\n && this._sources.has(\"/\" + relativeSource)) {\n return this.sourcesContent[this._sources.indexOf(\"/\" + relativeSource)];\n }\n }\n\n // This function is used recursively from\n // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we\n // don't want to throw if we can't find the source - we just want to\n // return null, so we provide a flag to exit gracefully.\n if (nullOnMissing) {\n return null;\n }\n else {\n throw new Error('\"' + relativeSource + '\" is not in the SourceMap.');\n }\n };\n\n/**\n * Returns the generated line and column information for the original source,\n * line, and column positions provided. The only argument is an object with\n * the following properties:\n *\n * - source: The filename of the original source.\n * - line: The line number in the original source. The line number\n * is 1-based.\n * - column: The column number in the original source. The column\n * number is 0-based.\n * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n *\n * and an object is returned with the following properties:\n *\n * - line: The line number in the generated source, or null. The\n * line number is 1-based.\n * - column: The column number in the generated source, or null.\n * The column number is 0-based.\n */\nBasicSourceMapConsumer.prototype.generatedPositionFor =\n function SourceMapConsumer_generatedPositionFor(aArgs) {\n var source = util.getArg(aArgs, 'source');\n source = this._findSourceIndex(source);\n if (source < 0) {\n return {\n line: null,\n column: null,\n lastColumn: null\n };\n }\n\n var needle = {\n source: source,\n originalLine: util.getArg(aArgs, 'line'),\n originalColumn: util.getArg(aArgs, 'column')\n };\n\n var index = this._findMapping(\n needle,\n this._originalMappings,\n \"originalLine\",\n \"originalColumn\",\n util.compareByOriginalPositions,\n util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n );\n\n if (index >= 0) {\n var mapping = this._originalMappings[index];\n\n if (mapping.source === needle.source) {\n return {\n line: util.getArg(mapping, 'generatedLine', null),\n column: util.getArg(mapping, 'generatedColumn', null),\n lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n };\n }\n }\n\n return {\n line: null,\n column: null,\n lastColumn: null\n };\n };\n\nexports.BasicSourceMapConsumer = BasicSourceMapConsumer;\n\n/**\n * An IndexedSourceMapConsumer instance represents a parsed source map which\n * we can query for information. It differs from BasicSourceMapConsumer in\n * that it takes \"indexed\" source maps (i.e. ones with a \"sections\" field) as\n * input.\n *\n * The first parameter is a raw source map (either as a JSON string, or already\n * parsed to an object). According to the spec for indexed source maps, they\n * have the following attributes:\n *\n * - version: Which version of the source map spec this map is following.\n * - file: Optional. The generated file this source map is associated with.\n * - sections: A list of section definitions.\n *\n * Each value under the \"sections\" field has two fields:\n * - offset: The offset into the original specified at which this section\n * begins to apply, defined as an object with a \"line\" and \"column\"\n * field.\n * - map: A source map definition. This source map could also be indexed,\n * but doesn't have to be.\n *\n * Instead of the \"map\" field, it's also possible to have a \"url\" field\n * specifying a URL to retrieve a source map from, but that's currently\n * unsupported.\n *\n * Here's an example source map, taken from the source map spec[0], but\n * modified to omit a section which uses the \"url\" field.\n *\n * {\n * version : 3,\n * file: \"app.js\",\n * sections: [{\n * offset: {line:100, column:10},\n * map: {\n * version : 3,\n * file: \"section.js\",\n * sources: [\"foo.js\", \"bar.js\"],\n * names: [\"src\", \"maps\", \"are\", \"fun\"],\n * mappings: \"AAAA,E;;ABCDE;\"\n * }\n * }],\n * }\n *\n * The second parameter, if given, is a string whose value is the URL\n * at which the source map was found. This URL is used to compute the\n * sources array.\n *\n * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt\n */\nfunction IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) {\n var sourceMap = aSourceMap;\n if (typeof aSourceMap === 'string') {\n sourceMap = util.parseSourceMapInput(aSourceMap);\n }\n\n var version = util.getArg(sourceMap, 'version');\n var sections = util.getArg(sourceMap, 'sections');\n\n if (version != this._version) {\n throw new Error('Unsupported version: ' + version);\n }\n\n this._sources = new ArraySet();\n this._names = new ArraySet();\n\n var lastOffset = {\n line: -1,\n column: 0\n };\n this._sections = sections.map(function (s) {\n if (s.url) {\n // The url field will require support for asynchronicity.\n // See https://github.com/mozilla/source-map/issues/16\n throw new Error('Support for url field in sections not implemented.');\n }\n var offset = util.getArg(s, 'offset');\n var offsetLine = util.getArg(offset, 'line');\n var offsetColumn = util.getArg(offset, 'column');\n\n if (offsetLine < lastOffset.line ||\n (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {\n throw new Error('Section offsets must be ordered and non-overlapping.');\n }\n lastOffset = offset;\n\n return {\n generatedOffset: {\n // The offset fields are 0-based, but we use 1-based indices when\n // encoding/decoding from VLQ.\n generatedLine: offsetLine + 1,\n generatedColumn: offsetColumn + 1\n },\n consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL)\n }\n });\n}\n\nIndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\nIndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nIndexedSourceMapConsumer.prototype._version = 3;\n\n/**\n * The list of original sources.\n */\nObject.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {\n get: function () {\n var sources = [];\n for (var i = 0; i < this._sections.length; i++) {\n for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {\n sources.push(this._sections[i].consumer.sources[j]);\n }\n }\n return sources;\n }\n});\n\n/**\n * Returns the original source, line, and column information for the generated\n * source's line and column positions provided. The only argument is an object\n * with the following properties:\n *\n * - line: The line number in the generated source. The line number\n * is 1-based.\n * - column: The column number in the generated source. The column\n * number is 0-based.\n *\n * and an object is returned with the following properties:\n *\n * - source: The original source file, or null.\n * - line: The line number in the original source, or null. The\n * line number is 1-based.\n * - column: The column number in the original source, or null. The\n * column number is 0-based.\n * - name: The original identifier, or null.\n */\nIndexedSourceMapConsumer.prototype.originalPositionFor =\n function IndexedSourceMapConsumer_originalPositionFor(aArgs) {\n var needle = {\n generatedLine: util.getArg(aArgs, 'line'),\n generatedColumn: util.getArg(aArgs, 'column')\n };\n\n // Find the section containing the generated position we're trying to map\n // to an original position.\n var sectionIndex = binarySearch.search(needle, this._sections,\n function(needle, section) {\n var cmp = needle.generatedLine - section.generatedOffset.generatedLine;\n if (cmp) {\n return cmp;\n }\n\n return (needle.generatedColumn -\n section.generatedOffset.generatedColumn);\n });\n var section = this._sections[sectionIndex];\n\n if (!section) {\n return {\n source: null,\n line: null,\n column: null,\n name: null\n };\n }\n\n return section.consumer.originalPositionFor({\n line: needle.generatedLine -\n (section.generatedOffset.generatedLine - 1),\n column: needle.generatedColumn -\n (section.generatedOffset.generatedLine === needle.generatedLine\n ? section.generatedOffset.generatedColumn - 1\n : 0),\n bias: aArgs.bias\n });\n };\n\n/**\n * Return true if we have the source content for every source in the source\n * map, false otherwise.\n */\nIndexedSourceMapConsumer.prototype.hasContentsOfAllSources =\n function IndexedSourceMapConsumer_hasContentsOfAllSources() {\n return this._sections.every(function (s) {\n return s.consumer.hasContentsOfAllSources();\n });\n };\n\n/**\n * Returns the original source content. The only argument is the url of the\n * original source file. Returns null if no original source content is\n * available.\n */\nIndexedSourceMapConsumer.prototype.sourceContentFor =\n function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n for (var i = 0; i < this._sections.length; i++) {\n var section = this._sections[i];\n\n var content = section.consumer.sourceContentFor(aSource, true);\n if (content) {\n return content;\n }\n }\n if (nullOnMissing) {\n return null;\n }\n else {\n throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n }\n };\n\n/**\n * Returns the generated line and column information for the original source,\n * line, and column positions provided. The only argument is an object with\n * the following properties:\n *\n * - source: The filename of the original source.\n * - line: The line number in the original source. The line number\n * is 1-based.\n * - column: The column number in the original source. The column\n * number is 0-based.\n *\n * and an object is returned with the following properties:\n *\n * - line: The line number in the generated source, or null. The\n * line number is 1-based. \n * - column: The column number in the generated source, or null.\n * The column number is 0-based.\n */\nIndexedSourceMapConsumer.prototype.generatedPositionFor =\n function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {\n for (var i = 0; i < this._sections.length; i++) {\n var section = this._sections[i];\n\n // Only consider this section if the requested source is in the list of\n // sources of the consumer.\n if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) {\n continue;\n }\n var generatedPosition = section.consumer.generatedPositionFor(aArgs);\n if (generatedPosition) {\n var ret = {\n line: generatedPosition.line +\n (section.generatedOffset.generatedLine - 1),\n column: generatedPosition.column +\n (section.generatedOffset.generatedLine === generatedPosition.line\n ? section.generatedOffset.generatedColumn - 1\n : 0)\n };\n return ret;\n }\n }\n\n return {\n line: null,\n column: null\n };\n };\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nIndexedSourceMapConsumer.prototype._parseMappings =\n function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n this.__generatedMappings = [];\n this.__originalMappings = [];\n for (var i = 0; i < this._sections.length; i++) {\n var section = this._sections[i];\n var sectionMappings = section.consumer._generatedMappings;\n for (var j = 0; j < sectionMappings.length; j++) {\n var mapping = sectionMappings[j];\n\n var source = section.consumer._sources.at(mapping.source);\n source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL);\n this._sources.add(source);\n source = this._sources.indexOf(source);\n\n var name = null;\n if (mapping.name) {\n name = section.consumer._names.at(mapping.name);\n this._names.add(name);\n name = this._names.indexOf(name);\n }\n\n // The mappings coming from the consumer for the section have\n // generated positions relative to the start of the section, so we\n // need to offset them to be relative to the start of the concatenated\n // generated file.\n var adjustedMapping = {\n source: source,\n generatedLine: mapping.generatedLine +\n (section.generatedOffset.generatedLine - 1),\n generatedColumn: mapping.generatedColumn +\n (section.generatedOffset.generatedLine === mapping.generatedLine\n ? section.generatedOffset.generatedColumn - 1\n : 0),\n originalLine: mapping.originalLine,\n originalColumn: mapping.originalColumn,\n name: name\n };\n\n this.__generatedMappings.push(adjustedMapping);\n if (typeof adjustedMapping.originalLine === 'number') {\n this.__originalMappings.push(adjustedMapping);\n }\n }\n }\n\n quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);\n quickSort(this.__originalMappings, util.compareByOriginalPositions);\n };\n\nexports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-map-consumer.js\n// module id = 7\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nexports.GREATEST_LOWER_BOUND = 1;\nexports.LEAST_UPPER_BOUND = 2;\n\n/**\n * Recursive implementation of binary search.\n *\n * @param aLow Indices here and lower do not contain the needle.\n * @param aHigh Indices here and higher do not contain the needle.\n * @param aNeedle The element being searched for.\n * @param aHaystack The non-empty array being searched.\n * @param aCompare Function which takes two elements and returns -1, 0, or 1.\n * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n */\nfunction recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {\n // This function terminates when one of the following is true:\n //\n // 1. We find the exact element we are looking for.\n //\n // 2. We did not find the exact element, but we can return the index of\n // the next-closest element.\n //\n // 3. We did not find the exact element, and there is no next-closest\n // element than the one we are searching for, so we return -1.\n var mid = Math.floor((aHigh - aLow) / 2) + aLow;\n var cmp = aCompare(aNeedle, aHaystack[mid], true);\n if (cmp === 0) {\n // Found the element we are looking for.\n return mid;\n }\n else if (cmp > 0) {\n // Our needle is greater than aHaystack[mid].\n if (aHigh - mid > 1) {\n // The element is in the upper half.\n return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);\n }\n\n // The exact needle element was not found in this haystack. Determine if\n // we are in termination case (3) or (2) and return the appropriate thing.\n if (aBias == exports.LEAST_UPPER_BOUND) {\n return aHigh < aHaystack.length ? aHigh : -1;\n } else {\n return mid;\n }\n }\n else {\n // Our needle is less than aHaystack[mid].\n if (mid - aLow > 1) {\n // The element is in the lower half.\n return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);\n }\n\n // we are in termination case (3) or (2) and return the appropriate thing.\n if (aBias == exports.LEAST_UPPER_BOUND) {\n return mid;\n } else {\n return aLow < 0 ? -1 : aLow;\n }\n }\n}\n\n/**\n * This is an implementation of binary search which will always try and return\n * the index of the closest element if there is no exact hit. This is because\n * mappings between original and generated line/col pairs are single points,\n * and there is an implicit region between each of them, so a miss just means\n * that you aren't on the very start of a region.\n *\n * @param aNeedle The element you are looking for.\n * @param aHaystack The array that is being searched.\n * @param aCompare A function which takes the needle and an element in the\n * array and returns -1, 0, or 1 depending on whether the needle is less\n * than, equal to, or greater than the element, respectively.\n * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.\n */\nexports.search = function search(aNeedle, aHaystack, aCompare, aBias) {\n if (aHaystack.length === 0) {\n return -1;\n }\n\n var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,\n aCompare, aBias || exports.GREATEST_LOWER_BOUND);\n if (index < 0) {\n return -1;\n }\n\n // We have found either the exact element, or the next-closest element than\n // the one we are searching for. However, there may be more than one such\n // element. Make sure we always return the smallest of these.\n while (index - 1 >= 0) {\n if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {\n break;\n }\n --index;\n }\n\n return index;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/binary-search.js\n// module id = 8\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\n// It turns out that some (most?) JavaScript engines don't self-host\n// `Array.prototype.sort`. This makes sense because C++ will likely remain\n// faster than JS when doing raw CPU-intensive sorting. However, when using a\n// custom comparator function, calling back and forth between the VM's C++ and\n// JIT'd JS is rather slow *and* loses JIT type information, resulting in\n// worse generated code for the comparator function than would be optimal. In\n// fact, when sorting with a comparator, these costs outweigh the benefits of\n// sorting in C++. By using our own JS-implemented Quick Sort (below), we get\n// a ~3500ms mean speed-up in `bench/bench.html`.\n\n/**\n * Swap the elements indexed by `x` and `y` in the array `ary`.\n *\n * @param {Array} ary\n * The array.\n * @param {Number} x\n * The index of the first item.\n * @param {Number} y\n * The index of the second item.\n */\nfunction swap(ary, x, y) {\n var temp = ary[x];\n ary[x] = ary[y];\n ary[y] = temp;\n}\n\n/**\n * Returns a random integer within the range `low .. high` inclusive.\n *\n * @param {Number} low\n * The lower bound on the range.\n * @param {Number} high\n * The upper bound on the range.\n */\nfunction randomIntInRange(low, high) {\n return Math.round(low + (Math.random() * (high - low)));\n}\n\n/**\n * The Quick Sort algorithm.\n *\n * @param {Array} ary\n * An array to sort.\n * @param {function} comparator\n * Function to use to compare two items.\n * @param {Number} p\n * Start index of the array\n * @param {Number} r\n * End index of the array\n */\nfunction doQuickSort(ary, comparator, p, r) {\n // If our lower bound is less than our upper bound, we (1) partition the\n // array into two pieces and (2) recurse on each half. If it is not, this is\n // the empty array and our base case.\n\n if (p < r) {\n // (1) Partitioning.\n //\n // The partitioning chooses a pivot between `p` and `r` and moves all\n // elements that are less than or equal to the pivot to the before it, and\n // all the elements that are greater than it after it. The effect is that\n // once partition is done, the pivot is in the exact place it will be when\n // the array is put in sorted order, and it will not need to be moved\n // again. This runs in O(n) time.\n\n // Always choose a random pivot so that an input array which is reverse\n // sorted does not cause O(n^2) running time.\n var pivotIndex = randomIntInRange(p, r);\n var i = p - 1;\n\n swap(ary, pivotIndex, r);\n var pivot = ary[r];\n\n // Immediately after `j` is incremented in this loop, the following hold\n // true:\n //\n // * Every element in `ary[p .. i]` is less than or equal to the pivot.\n //\n // * Every element in `ary[i+1 .. j-1]` is greater than the pivot.\n for (var j = p; j < r; j++) {\n if (comparator(ary[j], pivot) <= 0) {\n i += 1;\n swap(ary, i, j);\n }\n }\n\n swap(ary, i + 1, j);\n var q = i + 1;\n\n // (2) Recurse on each half.\n\n doQuickSort(ary, comparator, p, q - 1);\n doQuickSort(ary, comparator, q + 1, r);\n }\n}\n\n/**\n * Sort the given array in-place with the given comparator function.\n *\n * @param {Array} ary\n * An array to sort.\n * @param {function} comparator\n * Function to use to compare two items.\n */\nexports.quickSort = function (ary, comparator) {\n doQuickSort(ary, comparator, 0, ary.length - 1);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/quick-sort.js\n// module id = 9\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar SourceMapGenerator = require('./source-map-generator').SourceMapGenerator;\nvar util = require('./util');\n\n// Matches a Windows-style `\\r\\n` newline or a `\\n` newline used by all other\n// operating systems these days (capturing the result).\nvar REGEX_NEWLINE = /(\\r?\\n)/;\n\n// Newline character code for charCodeAt() comparisons\nvar NEWLINE_CODE = 10;\n\n// Private symbol for identifying `SourceNode`s when multiple versions of\n// the source-map library are loaded. This MUST NOT CHANGE across\n// versions!\nvar isSourceNode = \"$$$isSourceNode$$$\";\n\n/**\n * SourceNodes provide a way to abstract over interpolating/concatenating\n * snippets of generated JavaScript source code while maintaining the line and\n * column information associated with the original source code.\n *\n * @param aLine The original line number.\n * @param aColumn The original column number.\n * @param aSource The original source's filename.\n * @param aChunks Optional. An array of strings which are snippets of\n * generated JS, or other SourceNodes.\n * @param aName The original identifier.\n */\nfunction SourceNode(aLine, aColumn, aSource, aChunks, aName) {\n this.children = [];\n this.sourceContents = {};\n this.line = aLine == null ? null : aLine;\n this.column = aColumn == null ? null : aColumn;\n this.source = aSource == null ? null : aSource;\n this.name = aName == null ? null : aName;\n this[isSourceNode] = true;\n if (aChunks != null) this.add(aChunks);\n}\n\n/**\n * Creates a SourceNode from generated code and a SourceMapConsumer.\n *\n * @param aGeneratedCode The generated code\n * @param aSourceMapConsumer The SourceMap for the generated code\n * @param aRelativePath Optional. The path that relative sources in the\n * SourceMapConsumer should be relative to.\n */\nSourceNode.fromStringWithSourceMap =\n function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {\n // The SourceNode we want to fill with the generated code\n // and the SourceMap\n var node = new SourceNode();\n\n // All even indices of this array are one line of the generated code,\n // while all odd indices are the newlines between two adjacent lines\n // (since `REGEX_NEWLINE` captures its match).\n // Processed fragments are accessed by calling `shiftNextLine`.\n var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);\n var remainingLinesIndex = 0;\n var shiftNextLine = function() {\n var lineContents = getNextLine();\n // The last line of a file might not have a newline.\n var newLine = getNextLine() || \"\";\n return lineContents + newLine;\n\n function getNextLine() {\n return remainingLinesIndex < remainingLines.length ?\n remainingLines[remainingLinesIndex++] : undefined;\n }\n };\n\n // We need to remember the position of \"remainingLines\"\n var lastGeneratedLine = 1, lastGeneratedColumn = 0;\n\n // The generate SourceNodes we need a code range.\n // To extract it current and last mapping is used.\n // Here we store the last mapping.\n var lastMapping = null;\n\n aSourceMapConsumer.eachMapping(function (mapping) {\n if (lastMapping !== null) {\n // We add the code from \"lastMapping\" to \"mapping\":\n // First check if there is a new line in between.\n if (lastGeneratedLine < mapping.generatedLine) {\n // Associate first line with \"lastMapping\"\n addMappingWithCode(lastMapping, shiftNextLine());\n lastGeneratedLine++;\n lastGeneratedColumn = 0;\n // The remaining code is added without mapping\n } else {\n // There is no new line in between.\n // Associate the code between \"lastGeneratedColumn\" and\n // \"mapping.generatedColumn\" with \"lastMapping\"\n var nextLine = remainingLines[remainingLinesIndex] || '';\n var code = nextLine.substr(0, mapping.generatedColumn -\n lastGeneratedColumn);\n remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -\n lastGeneratedColumn);\n lastGeneratedColumn = mapping.generatedColumn;\n addMappingWithCode(lastMapping, code);\n // No more remaining code, continue\n lastMapping = mapping;\n return;\n }\n }\n // We add the generated code until the first mapping\n // to the SourceNode without any mapping.\n // Each line is added as separate string.\n while (lastGeneratedLine < mapping.generatedLine) {\n node.add(shiftNextLine());\n lastGeneratedLine++;\n }\n if (lastGeneratedColumn < mapping.generatedColumn) {\n var nextLine = remainingLines[remainingLinesIndex] || '';\n node.add(nextLine.substr(0, mapping.generatedColumn));\n remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);\n lastGeneratedColumn = mapping.generatedColumn;\n }\n lastMapping = mapping;\n }, this);\n // We have processed all mappings.\n if (remainingLinesIndex < remainingLines.length) {\n if (lastMapping) {\n // Associate the remaining code in the current line with \"lastMapping\"\n addMappingWithCode(lastMapping, shiftNextLine());\n }\n // and add the remaining lines without any mapping\n node.add(remainingLines.splice(remainingLinesIndex).join(\"\"));\n }\n\n // Copy sourcesContent into SourceNode\n aSourceMapConsumer.sources.forEach(function (sourceFile) {\n var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n if (content != null) {\n if (aRelativePath != null) {\n sourceFile = util.join(aRelativePath, sourceFile);\n }\n node.setSourceContent(sourceFile, content);\n }\n });\n\n return node;\n\n function addMappingWithCode(mapping, code) {\n if (mapping === null || mapping.source === undefined) {\n node.add(code);\n } else {\n var source = aRelativePath\n ? util.join(aRelativePath, mapping.source)\n : mapping.source;\n node.add(new SourceNode(mapping.originalLine,\n mapping.originalColumn,\n source,\n code,\n mapping.name));\n }\n }\n };\n\n/**\n * Add a chunk of generated JS to this source node.\n *\n * @param aChunk A string snippet of generated JS code, another instance of\n * SourceNode, or an array where each member is one of those things.\n */\nSourceNode.prototype.add = function SourceNode_add(aChunk) {\n if (Array.isArray(aChunk)) {\n aChunk.forEach(function (chunk) {\n this.add(chunk);\n }, this);\n }\n else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n if (aChunk) {\n this.children.push(aChunk);\n }\n }\n else {\n throw new TypeError(\n \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n );\n }\n return this;\n};\n\n/**\n * Add a chunk of generated JS to the beginning of this source node.\n *\n * @param aChunk A string snippet of generated JS code, another instance of\n * SourceNode, or an array where each member is one of those things.\n */\nSourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {\n if (Array.isArray(aChunk)) {\n for (var i = aChunk.length-1; i >= 0; i--) {\n this.prepend(aChunk[i]);\n }\n }\n else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n this.children.unshift(aChunk);\n }\n else {\n throw new TypeError(\n \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n );\n }\n return this;\n};\n\n/**\n * Walk over the tree of JS snippets in this node and its children. The\n * walking function is called once for each snippet of JS and is passed that\n * snippet and the its original associated source's line/column location.\n *\n * @param aFn The traversal function.\n */\nSourceNode.prototype.walk = function SourceNode_walk(aFn) {\n var chunk;\n for (var i = 0, len = this.children.length; i < len; i++) {\n chunk = this.children[i];\n if (chunk[isSourceNode]) {\n chunk.walk(aFn);\n }\n else {\n if (chunk !== '') {\n aFn(chunk, { source: this.source,\n line: this.line,\n column: this.column,\n name: this.name });\n }\n }\n }\n};\n\n/**\n * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between\n * each of `this.children`.\n *\n * @param aSep The separator.\n */\nSourceNode.prototype.join = function SourceNode_join(aSep) {\n var newChildren;\n var i;\n var len = this.children.length;\n if (len > 0) {\n newChildren = [];\n for (i = 0; i < len-1; i++) {\n newChildren.push(this.children[i]);\n newChildren.push(aSep);\n }\n newChildren.push(this.children[i]);\n this.children = newChildren;\n }\n return this;\n};\n\n/**\n * Call String.prototype.replace on the very right-most source snippet. Useful\n * for trimming whitespace from the end of a source node, etc.\n *\n * @param aPattern The pattern to replace.\n * @param aReplacement The thing to replace the pattern with.\n */\nSourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {\n var lastChild = this.children[this.children.length - 1];\n if (lastChild[isSourceNode]) {\n lastChild.replaceRight(aPattern, aReplacement);\n }\n else if (typeof lastChild === 'string') {\n this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);\n }\n else {\n this.children.push(''.replace(aPattern, aReplacement));\n }\n return this;\n};\n\n/**\n * Set the source content for a source file. This will be added to the SourceMapGenerator\n * in the sourcesContent field.\n *\n * @param aSourceFile The filename of the source file\n * @param aSourceContent The content of the source file\n */\nSourceNode.prototype.setSourceContent =\n function SourceNode_setSourceContent(aSourceFile, aSourceContent) {\n this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;\n };\n\n/**\n * Walk over the tree of SourceNodes. The walking function is called for each\n * source file content and is passed the filename and source content.\n *\n * @param aFn The traversal function.\n */\nSourceNode.prototype.walkSourceContents =\n function SourceNode_walkSourceContents(aFn) {\n for (var i = 0, len = this.children.length; i < len; i++) {\n if (this.children[i][isSourceNode]) {\n this.children[i].walkSourceContents(aFn);\n }\n }\n\n var sources = Object.keys(this.sourceContents);\n for (var i = 0, len = sources.length; i < len; i++) {\n aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);\n }\n };\n\n/**\n * Return the string representation of this source node. Walks over the tree\n * and concatenates all the various snippets together to one string.\n */\nSourceNode.prototype.toString = function SourceNode_toString() {\n var str = \"\";\n this.walk(function (chunk) {\n str += chunk;\n });\n return str;\n};\n\n/**\n * Returns the string representation of this source node along with a source\n * map.\n */\nSourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {\n var generated = {\n code: \"\",\n line: 1,\n column: 0\n };\n var map = new SourceMapGenerator(aArgs);\n var sourceMappingActive = false;\n var lastOriginalSource = null;\n var lastOriginalLine = null;\n var lastOriginalColumn = null;\n var lastOriginalName = null;\n this.walk(function (chunk, original) {\n generated.code += chunk;\n if (original.source !== null\n && original.line !== null\n && original.column !== null) {\n if(lastOriginalSource !== original.source\n || lastOriginalLine !== original.line\n || lastOriginalColumn !== original.column\n || lastOriginalName !== original.name) {\n map.addMapping({\n source: original.source,\n original: {\n line: original.line,\n column: original.column\n },\n generated: {\n line: generated.line,\n column: generated.column\n },\n name: original.name\n });\n }\n lastOriginalSource = original.source;\n lastOriginalLine = original.line;\n lastOriginalColumn = original.column;\n lastOriginalName = original.name;\n sourceMappingActive = true;\n } else if (sourceMappingActive) {\n map.addMapping({\n generated: {\n line: generated.line,\n column: generated.column\n }\n });\n lastOriginalSource = null;\n sourceMappingActive = false;\n }\n for (var idx = 0, length = chunk.length; idx < length; idx++) {\n if (chunk.charCodeAt(idx) === NEWLINE_CODE) {\n generated.line++;\n generated.column = 0;\n // Mappings end at eol\n if (idx + 1 === length) {\n lastOriginalSource = null;\n sourceMappingActive = false;\n } else if (sourceMappingActive) {\n map.addMapping({\n source: original.source,\n original: {\n line: original.line,\n column: original.column\n },\n generated: {\n line: generated.line,\n column: generated.column\n },\n name: original.name\n });\n }\n } else {\n generated.column++;\n }\n }\n });\n this.walkSourceContents(function (sourceFile, sourceContent) {\n map.setSourceContent(sourceFile, sourceContent);\n });\n\n return { code: generated.code, map: map };\n};\n\nexports.SourceNode = SourceNode;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-node.js\n// module id = 10\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file diff --git a/resources/app/node_modules/source-map/lib/array-set.js b/resources/app/node_modules/source-map/lib/array-set.js new file mode 100644 index 0000000..fbd5c81 --- /dev/null +++ b/resources/app/node_modules/source-map/lib/array-set.js @@ -0,0 +1,121 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = require('./util'); +var has = Object.prototype.hasOwnProperty; +var hasNativeMap = typeof Map !== "undefined"; + +/** + * A data structure which is a combination of an array and a set. Adding a new + * member is O(1), testing for membership is O(1), and finding the index of an + * element is O(1). Removing elements from the set is not supported. Only + * strings are supported for membership. + */ +function ArraySet() { + this._array = []; + this._set = hasNativeMap ? new Map() : Object.create(null); +} + +/** + * Static method for creating ArraySet instances from an existing array. + */ +ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) { + var set = new ArraySet(); + for (var i = 0, len = aArray.length; i < len; i++) { + set.add(aArray[i], aAllowDuplicates); + } + return set; +}; + +/** + * Return how many unique items are in this ArraySet. If duplicates have been + * added, than those do not count towards the size. + * + * @returns Number + */ +ArraySet.prototype.size = function ArraySet_size() { + return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length; +}; + +/** + * Add the given string to this set. + * + * @param String aStr + */ +ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) { + var sStr = hasNativeMap ? aStr : util.toSetString(aStr); + var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr); + var idx = this._array.length; + if (!isDuplicate || aAllowDuplicates) { + this._array.push(aStr); + } + if (!isDuplicate) { + if (hasNativeMap) { + this._set.set(aStr, idx); + } else { + this._set[sStr] = idx; + } + } +}; + +/** + * Is the given string a member of this set? + * + * @param String aStr + */ +ArraySet.prototype.has = function ArraySet_has(aStr) { + if (hasNativeMap) { + return this._set.has(aStr); + } else { + var sStr = util.toSetString(aStr); + return has.call(this._set, sStr); + } +}; + +/** + * What is the index of the given string in the array? + * + * @param String aStr + */ +ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) { + if (hasNativeMap) { + var idx = this._set.get(aStr); + if (idx >= 0) { + return idx; + } + } else { + var sStr = util.toSetString(aStr); + if (has.call(this._set, sStr)) { + return this._set[sStr]; + } + } + + throw new Error('"' + aStr + '" is not in the set.'); +}; + +/** + * What is the element at the given index? + * + * @param Number aIdx + */ +ArraySet.prototype.at = function ArraySet_at(aIdx) { + if (aIdx >= 0 && aIdx < this._array.length) { + return this._array[aIdx]; + } + throw new Error('No element indexed by ' + aIdx); +}; + +/** + * Returns the array representation of this set (which has the proper indices + * indicated by indexOf). Note that this is a copy of the internal array used + * for storing the members so that no one can mess with internal state. + */ +ArraySet.prototype.toArray = function ArraySet_toArray() { + return this._array.slice(); +}; + +exports.ArraySet = ArraySet; diff --git a/resources/app/node_modules/source-map/lib/base64-vlq.js b/resources/app/node_modules/source-map/lib/base64-vlq.js new file mode 100644 index 0000000..612b404 --- /dev/null +++ b/resources/app/node_modules/source-map/lib/base64-vlq.js @@ -0,0 +1,140 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + * + * Based on the Base 64 VLQ implementation in Closure Compiler: + * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java + * + * Copyright 2011 The Closure Compiler Authors. All rights reserved. + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above + * copyright notice, this list of conditions and the following + * disclaimer in the documentation and/or other materials provided + * with the distribution. + * * Neither the name of Google Inc. nor the names of its + * contributors may be used to endorse or promote products derived + * from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +var base64 = require('./base64'); + +// A single base 64 digit can contain 6 bits of data. For the base 64 variable +// length quantities we use in the source map spec, the first bit is the sign, +// the next four bits are the actual value, and the 6th bit is the +// continuation bit. The continuation bit tells us whether there are more +// digits in this value following this digit. +// +// Continuation +// | Sign +// | | +// V V +// 101011 + +var VLQ_BASE_SHIFT = 5; + +// binary: 100000 +var VLQ_BASE = 1 << VLQ_BASE_SHIFT; + +// binary: 011111 +var VLQ_BASE_MASK = VLQ_BASE - 1; + +// binary: 100000 +var VLQ_CONTINUATION_BIT = VLQ_BASE; + +/** + * Converts from a two-complement value to a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary) + * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary) + */ +function toVLQSigned(aValue) { + return aValue < 0 + ? ((-aValue) << 1) + 1 + : (aValue << 1) + 0; +} + +/** + * Converts to a two-complement value from a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1 + * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2 + */ +function fromVLQSigned(aValue) { + var isNegative = (aValue & 1) === 1; + var shifted = aValue >> 1; + return isNegative + ? -shifted + : shifted; +} + +/** + * Returns the base 64 VLQ encoded value. + */ +exports.encode = function base64VLQ_encode(aValue) { + var encoded = ""; + var digit; + + var vlq = toVLQSigned(aValue); + + do { + digit = vlq & VLQ_BASE_MASK; + vlq >>>= VLQ_BASE_SHIFT; + if (vlq > 0) { + // There are still more digits in this value, so we must make sure the + // continuation bit is marked. + digit |= VLQ_CONTINUATION_BIT; + } + encoded += base64.encode(digit); + } while (vlq > 0); + + return encoded; +}; + +/** + * Decodes the next base 64 VLQ value from the given string and returns the + * value and the rest of the string via the out parameter. + */ +exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) { + var strLen = aStr.length; + var result = 0; + var shift = 0; + var continuation, digit; + + do { + if (aIndex >= strLen) { + throw new Error("Expected more digits in base 64 VLQ value."); + } + + digit = base64.decode(aStr.charCodeAt(aIndex++)); + if (digit === -1) { + throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1)); + } + + continuation = !!(digit & VLQ_CONTINUATION_BIT); + digit &= VLQ_BASE_MASK; + result = result + (digit << shift); + shift += VLQ_BASE_SHIFT; + } while (continuation); + + aOutParam.value = fromVLQSigned(result); + aOutParam.rest = aIndex; +}; diff --git a/resources/app/node_modules/source-map/lib/base64.js b/resources/app/node_modules/source-map/lib/base64.js new file mode 100644 index 0000000..8aa86b3 --- /dev/null +++ b/resources/app/node_modules/source-map/lib/base64.js @@ -0,0 +1,67 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split(''); + +/** + * Encode an integer in the range of 0 to 63 to a single base 64 digit. + */ +exports.encode = function (number) { + if (0 <= number && number < intToCharMap.length) { + return intToCharMap[number]; + } + throw new TypeError("Must be between 0 and 63: " + number); +}; + +/** + * Decode a single base 64 character code digit to an integer. Returns -1 on + * failure. + */ +exports.decode = function (charCode) { + var bigA = 65; // 'A' + var bigZ = 90; // 'Z' + + var littleA = 97; // 'a' + var littleZ = 122; // 'z' + + var zero = 48; // '0' + var nine = 57; // '9' + + var plus = 43; // '+' + var slash = 47; // '/' + + var littleOffset = 26; + var numberOffset = 52; + + // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ + if (bigA <= charCode && charCode <= bigZ) { + return (charCode - bigA); + } + + // 26 - 51: abcdefghijklmnopqrstuvwxyz + if (littleA <= charCode && charCode <= littleZ) { + return (charCode - littleA + littleOffset); + } + + // 52 - 61: 0123456789 + if (zero <= charCode && charCode <= nine) { + return (charCode - zero + numberOffset); + } + + // 62: + + if (charCode == plus) { + return 62; + } + + // 63: / + if (charCode == slash) { + return 63; + } + + // Invalid base64 digit. + return -1; +}; diff --git a/resources/app/node_modules/source-map/lib/binary-search.js b/resources/app/node_modules/source-map/lib/binary-search.js new file mode 100644 index 0000000..010ac94 --- /dev/null +++ b/resources/app/node_modules/source-map/lib/binary-search.js @@ -0,0 +1,111 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +exports.GREATEST_LOWER_BOUND = 1; +exports.LEAST_UPPER_BOUND = 2; + +/** + * Recursive implementation of binary search. + * + * @param aLow Indices here and lower do not contain the needle. + * @param aHigh Indices here and higher do not contain the needle. + * @param aNeedle The element being searched for. + * @param aHaystack The non-empty array being searched. + * @param aCompare Function which takes two elements and returns -1, 0, or 1. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + */ +function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) { + // This function terminates when one of the following is true: + // + // 1. We find the exact element we are looking for. + // + // 2. We did not find the exact element, but we can return the index of + // the next-closest element. + // + // 3. We did not find the exact element, and there is no next-closest + // element than the one we are searching for, so we return -1. + var mid = Math.floor((aHigh - aLow) / 2) + aLow; + var cmp = aCompare(aNeedle, aHaystack[mid], true); + if (cmp === 0) { + // Found the element we are looking for. + return mid; + } + else if (cmp > 0) { + // Our needle is greater than aHaystack[mid]. + if (aHigh - mid > 1) { + // The element is in the upper half. + return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias); + } + + // The exact needle element was not found in this haystack. Determine if + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return aHigh < aHaystack.length ? aHigh : -1; + } else { + return mid; + } + } + else { + // Our needle is less than aHaystack[mid]. + if (mid - aLow > 1) { + // The element is in the lower half. + return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias); + } + + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return mid; + } else { + return aLow < 0 ? -1 : aLow; + } + } +} + +/** + * This is an implementation of binary search which will always try and return + * the index of the closest element if there is no exact hit. This is because + * mappings between original and generated line/col pairs are single points, + * and there is an implicit region between each of them, so a miss just means + * that you aren't on the very start of a region. + * + * @param aNeedle The element you are looking for. + * @param aHaystack The array that is being searched. + * @param aCompare A function which takes the needle and an element in the + * array and returns -1, 0, or 1 depending on whether the needle is less + * than, equal to, or greater than the element, respectively. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'. + */ +exports.search = function search(aNeedle, aHaystack, aCompare, aBias) { + if (aHaystack.length === 0) { + return -1; + } + + var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, + aCompare, aBias || exports.GREATEST_LOWER_BOUND); + if (index < 0) { + return -1; + } + + // We have found either the exact element, or the next-closest element than + // the one we are searching for. However, there may be more than one such + // element. Make sure we always return the smallest of these. + while (index - 1 >= 0) { + if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) { + break; + } + --index; + } + + return index; +}; diff --git a/resources/app/node_modules/source-map/lib/mapping-list.js b/resources/app/node_modules/source-map/lib/mapping-list.js new file mode 100644 index 0000000..06d1274 --- /dev/null +++ b/resources/app/node_modules/source-map/lib/mapping-list.js @@ -0,0 +1,79 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2014 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = require('./util'); + +/** + * Determine whether mappingB is after mappingA with respect to generated + * position. + */ +function generatedPositionAfter(mappingA, mappingB) { + // Optimized for most common case + var lineA = mappingA.generatedLine; + var lineB = mappingB.generatedLine; + var columnA = mappingA.generatedColumn; + var columnB = mappingB.generatedColumn; + return lineB > lineA || lineB == lineA && columnB >= columnA || + util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0; +} + +/** + * A data structure to provide a sorted view of accumulated mappings in a + * performance conscious manner. It trades a neglibable overhead in general + * case for a large speedup in case of mappings being added in order. + */ +function MappingList() { + this._array = []; + this._sorted = true; + // Serves as infimum + this._last = {generatedLine: -1, generatedColumn: 0}; +} + +/** + * Iterate through internal items. This method takes the same arguments that + * `Array.prototype.forEach` takes. + * + * NOTE: The order of the mappings is NOT guaranteed. + */ +MappingList.prototype.unsortedForEach = + function MappingList_forEach(aCallback, aThisArg) { + this._array.forEach(aCallback, aThisArg); + }; + +/** + * Add the given source mapping. + * + * @param Object aMapping + */ +MappingList.prototype.add = function MappingList_add(aMapping) { + if (generatedPositionAfter(this._last, aMapping)) { + this._last = aMapping; + this._array.push(aMapping); + } else { + this._sorted = false; + this._array.push(aMapping); + } +}; + +/** + * Returns the flat, sorted array of mappings. The mappings are sorted by + * generated position. + * + * WARNING: This method returns internal data without copying, for + * performance. The return value must NOT be mutated, and should be treated as + * an immutable borrow. If you want to take ownership, you must make your own + * copy. + */ +MappingList.prototype.toArray = function MappingList_toArray() { + if (!this._sorted) { + this._array.sort(util.compareByGeneratedPositionsInflated); + this._sorted = true; + } + return this._array; +}; + +exports.MappingList = MappingList; diff --git a/resources/app/node_modules/source-map/lib/quick-sort.js b/resources/app/node_modules/source-map/lib/quick-sort.js new file mode 100644 index 0000000..6a7caad --- /dev/null +++ b/resources/app/node_modules/source-map/lib/quick-sort.js @@ -0,0 +1,114 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +// It turns out that some (most?) JavaScript engines don't self-host +// `Array.prototype.sort`. This makes sense because C++ will likely remain +// faster than JS when doing raw CPU-intensive sorting. However, when using a +// custom comparator function, calling back and forth between the VM's C++ and +// JIT'd JS is rather slow *and* loses JIT type information, resulting in +// worse generated code for the comparator function than would be optimal. In +// fact, when sorting with a comparator, these costs outweigh the benefits of +// sorting in C++. By using our own JS-implemented Quick Sort (below), we get +// a ~3500ms mean speed-up in `bench/bench.html`. + +/** + * Swap the elements indexed by `x` and `y` in the array `ary`. + * + * @param {Array} ary + * The array. + * @param {Number} x + * The index of the first item. + * @param {Number} y + * The index of the second item. + */ +function swap(ary, x, y) { + var temp = ary[x]; + ary[x] = ary[y]; + ary[y] = temp; +} + +/** + * Returns a random integer within the range `low .. high` inclusive. + * + * @param {Number} low + * The lower bound on the range. + * @param {Number} high + * The upper bound on the range. + */ +function randomIntInRange(low, high) { + return Math.round(low + (Math.random() * (high - low))); +} + +/** + * The Quick Sort algorithm. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + * @param {Number} p + * Start index of the array + * @param {Number} r + * End index of the array + */ +function doQuickSort(ary, comparator, p, r) { + // If our lower bound is less than our upper bound, we (1) partition the + // array into two pieces and (2) recurse on each half. If it is not, this is + // the empty array and our base case. + + if (p < r) { + // (1) Partitioning. + // + // The partitioning chooses a pivot between `p` and `r` and moves all + // elements that are less than or equal to the pivot to the before it, and + // all the elements that are greater than it after it. The effect is that + // once partition is done, the pivot is in the exact place it will be when + // the array is put in sorted order, and it will not need to be moved + // again. This runs in O(n) time. + + // Always choose a random pivot so that an input array which is reverse + // sorted does not cause O(n^2) running time. + var pivotIndex = randomIntInRange(p, r); + var i = p - 1; + + swap(ary, pivotIndex, r); + var pivot = ary[r]; + + // Immediately after `j` is incremented in this loop, the following hold + // true: + // + // * Every element in `ary[p .. i]` is less than or equal to the pivot. + // + // * Every element in `ary[i+1 .. j-1]` is greater than the pivot. + for (var j = p; j < r; j++) { + if (comparator(ary[j], pivot) <= 0) { + i += 1; + swap(ary, i, j); + } + } + + swap(ary, i + 1, j); + var q = i + 1; + + // (2) Recurse on each half. + + doQuickSort(ary, comparator, p, q - 1); + doQuickSort(ary, comparator, q + 1, r); + } +} + +/** + * Sort the given array in-place with the given comparator function. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + */ +exports.quickSort = function (ary, comparator) { + doQuickSort(ary, comparator, 0, ary.length - 1); +}; diff --git a/resources/app/node_modules/source-map/lib/source-map-consumer.js b/resources/app/node_modules/source-map/lib/source-map-consumer.js new file mode 100644 index 0000000..7b99d1d --- /dev/null +++ b/resources/app/node_modules/source-map/lib/source-map-consumer.js @@ -0,0 +1,1145 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = require('./util'); +var binarySearch = require('./binary-search'); +var ArraySet = require('./array-set').ArraySet; +var base64VLQ = require('./base64-vlq'); +var quickSort = require('./quick-sort').quickSort; + +function SourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + return sourceMap.sections != null + ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL) + : new BasicSourceMapConsumer(sourceMap, aSourceMapURL); +} + +SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) { + return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL); +} + +/** + * The version of the source mapping spec that we are consuming. + */ +SourceMapConsumer.prototype._version = 3; + +// `__generatedMappings` and `__originalMappings` are arrays that hold the +// parsed mapping coordinates from the source map's "mappings" attribute. They +// are lazily instantiated, accessed via the `_generatedMappings` and +// `_originalMappings` getters respectively, and we only parse the mappings +// and create these arrays once queried for a source location. We jump through +// these hoops because there can be many thousands of mappings, and parsing +// them is expensive, so we only want to do it if we must. +// +// Each object in the arrays is of the form: +// +// { +// generatedLine: The line number in the generated code, +// generatedColumn: The column number in the generated code, +// source: The path to the original source file that generated this +// chunk of code, +// originalLine: The line number in the original source that +// corresponds to this chunk of generated code, +// originalColumn: The column number in the original source that +// corresponds to this chunk of generated code, +// name: The name of the original symbol which generated this chunk of +// code. +// } +// +// All properties except for `generatedLine` and `generatedColumn` can be +// `null`. +// +// `_generatedMappings` is ordered by the generated positions. +// +// `_originalMappings` is ordered by the original positions. + +SourceMapConsumer.prototype.__generatedMappings = null; +Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__generatedMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__generatedMappings; + } +}); + +SourceMapConsumer.prototype.__originalMappings = null; +Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__originalMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__originalMappings; + } +}); + +SourceMapConsumer.prototype._charIsMappingSeparator = + function SourceMapConsumer_charIsMappingSeparator(aStr, index) { + var c = aStr.charAt(index); + return c === ";" || c === ","; + }; + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +SourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + throw new Error("Subclasses must implement _parseMappings"); + }; + +SourceMapConsumer.GENERATED_ORDER = 1; +SourceMapConsumer.ORIGINAL_ORDER = 2; + +SourceMapConsumer.GREATEST_LOWER_BOUND = 1; +SourceMapConsumer.LEAST_UPPER_BOUND = 2; + +/** + * Iterate over each mapping between an original source/line/column and a + * generated line/column in this source map. + * + * @param Function aCallback + * The function that is called with each mapping. + * @param Object aContext + * Optional. If specified, this object will be the value of `this` every + * time that `aCallback` is called. + * @param aOrder + * Either `SourceMapConsumer.GENERATED_ORDER` or + * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to + * iterate over the mappings sorted by the generated file's line/column + * order or the original's source/line/column order, respectively. Defaults to + * `SourceMapConsumer.GENERATED_ORDER`. + */ +SourceMapConsumer.prototype.eachMapping = + function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) { + var context = aContext || null; + var order = aOrder || SourceMapConsumer.GENERATED_ORDER; + + var mappings; + switch (order) { + case SourceMapConsumer.GENERATED_ORDER: + mappings = this._generatedMappings; + break; + case SourceMapConsumer.ORIGINAL_ORDER: + mappings = this._originalMappings; + break; + default: + throw new Error("Unknown order of iteration."); + } + + var sourceRoot = this.sourceRoot; + mappings.map(function (mapping) { + var source = mapping.source === null ? null : this._sources.at(mapping.source); + source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL); + return { + source: source, + generatedLine: mapping.generatedLine, + generatedColumn: mapping.generatedColumn, + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: mapping.name === null ? null : this._names.at(mapping.name) + }; + }, this).forEach(aCallback, context); + }; + +/** + * Returns all generated line and column information for the original source, + * line, and column provided. If no column is provided, returns all mappings + * corresponding to a either the line we are searching for or the next + * closest line that has any mappings. Otherwise, returns all mappings + * corresponding to the given line and either the column we are searching for + * or the next closest column that has any offsets. + * + * The only argument is an object with the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number is 1-based. + * - column: Optional. the column number in the original source. + * The column number is 0-based. + * + * and an array of objects is returned, each with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +SourceMapConsumer.prototype.allGeneratedPositionsFor = + function SourceMapConsumer_allGeneratedPositionsFor(aArgs) { + var line = util.getArg(aArgs, 'line'); + + // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping + // returns the index of the closest mapping less than the needle. By + // setting needle.originalColumn to 0, we thus find the last mapping for + // the given line, provided such a mapping exists. + var needle = { + source: util.getArg(aArgs, 'source'), + originalLine: line, + originalColumn: util.getArg(aArgs, 'column', 0) + }; + + needle.source = this._findSourceIndex(needle.source); + if (needle.source < 0) { + return []; + } + + var mappings = []; + + var index = this._findMapping(needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + binarySearch.LEAST_UPPER_BOUND); + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (aArgs.column === undefined) { + var originalLine = mapping.originalLine; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we found. Since + // mappings are sorted, this is guaranteed to find all mappings for + // the line we found. + while (mapping && mapping.originalLine === originalLine) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } else { + var originalColumn = mapping.originalColumn; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we were searching for. + // Since mappings are sorted, this is guaranteed to find all mappings for + // the line we are searching for. + while (mapping && + mapping.originalLine === line && + mapping.originalColumn == originalColumn) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } + } + + return mappings; + }; + +exports.SourceMapConsumer = SourceMapConsumer; + +/** + * A BasicSourceMapConsumer instance represents a parsed source map which we can + * query for information about the original file positions by giving it a file + * position in the generated source. + * + * The first parameter is the raw source map (either as a JSON string, or + * already parsed to an object). According to the spec, source maps have the + * following attributes: + * + * - version: Which version of the source map spec this map is following. + * - sources: An array of URLs to the original source files. + * - names: An array of identifiers which can be referrenced by individual mappings. + * - sourceRoot: Optional. The URL root from which all sources are relative. + * - sourcesContent: Optional. An array of contents of the original source files. + * - mappings: A string of base64 VLQs which contain the actual mappings. + * - file: Optional. The generated file this source map is associated with. + * + * Here is an example source map, taken from the source map spec[0]: + * + * { + * version : 3, + * file: "out.js", + * sourceRoot : "", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AA,AB;;ABCDE;" + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1# + */ +function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sources = util.getArg(sourceMap, 'sources'); + // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which + // requires the array) to play nice here. + var names = util.getArg(sourceMap, 'names', []); + var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null); + var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null); + var mappings = util.getArg(sourceMap, 'mappings'); + var file = util.getArg(sourceMap, 'file', null); + + // Once again, Sass deviates from the spec and supplies the version as a + // string rather than a number, so we use loose equality checking here. + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + if (sourceRoot) { + sourceRoot = util.normalize(sourceRoot); + } + + sources = sources + .map(String) + // Some source maps produce relative source paths like "./foo.js" instead of + // "foo.js". Normalize these first so that future comparisons will succeed. + // See bugzil.la/1090768. + .map(util.normalize) + // Always ensure that absolute sources are internally stored relative to + // the source root, if the source root is absolute. Not doing this would + // be particularly problematic when the source root is a prefix of the + // source (valid, but why??). See github issue #199 and bugzil.la/1188982. + .map(function (source) { + return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source) + ? util.relative(sourceRoot, source) + : source; + }); + + // Pass `true` below to allow duplicate names and sources. While source maps + // are intended to be compressed and deduplicated, the TypeScript compiler + // sometimes generates source maps with duplicates in them. See Github issue + // #72 and bugzil.la/889492. + this._names = ArraySet.fromArray(names.map(String), true); + this._sources = ArraySet.fromArray(sources, true); + + this._absoluteSources = this._sources.toArray().map(function (s) { + return util.computeSourceURL(sourceRoot, s, aSourceMapURL); + }); + + this.sourceRoot = sourceRoot; + this.sourcesContent = sourcesContent; + this._mappings = mappings; + this._sourceMapURL = aSourceMapURL; + this.file = file; +} + +BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); +BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer; + +/** + * Utility function to find the index of a source. Returns -1 if not + * found. + */ +BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) { + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + if (this._sources.has(relativeSource)) { + return this._sources.indexOf(relativeSource); + } + + // Maybe aSource is an absolute URL as returned by |sources|. In + // this case we can't simply undo the transform. + var i; + for (i = 0; i < this._absoluteSources.length; ++i) { + if (this._absoluteSources[i] == aSource) { + return i; + } + } + + return -1; +}; + +/** + * Create a BasicSourceMapConsumer from a SourceMapGenerator. + * + * @param SourceMapGenerator aSourceMap + * The source map that will be consumed. + * @param String aSourceMapURL + * The URL at which the source map can be found (optional) + * @returns BasicSourceMapConsumer + */ +BasicSourceMapConsumer.fromSourceMap = + function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) { + var smc = Object.create(BasicSourceMapConsumer.prototype); + + var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true); + var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true); + smc.sourceRoot = aSourceMap._sourceRoot; + smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(), + smc.sourceRoot); + smc.file = aSourceMap._file; + smc._sourceMapURL = aSourceMapURL; + smc._absoluteSources = smc._sources.toArray().map(function (s) { + return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL); + }); + + // Because we are modifying the entries (by converting string sources and + // names to indices into the sources and names ArraySets), we have to make + // a copy of the entry or else bad things happen. Shared mutable state + // strikes again! See github issue #191. + + var generatedMappings = aSourceMap._mappings.toArray().slice(); + var destGeneratedMappings = smc.__generatedMappings = []; + var destOriginalMappings = smc.__originalMappings = []; + + for (var i = 0, length = generatedMappings.length; i < length; i++) { + var srcMapping = generatedMappings[i]; + var destMapping = new Mapping; + destMapping.generatedLine = srcMapping.generatedLine; + destMapping.generatedColumn = srcMapping.generatedColumn; + + if (srcMapping.source) { + destMapping.source = sources.indexOf(srcMapping.source); + destMapping.originalLine = srcMapping.originalLine; + destMapping.originalColumn = srcMapping.originalColumn; + + if (srcMapping.name) { + destMapping.name = names.indexOf(srcMapping.name); + } + + destOriginalMappings.push(destMapping); + } + + destGeneratedMappings.push(destMapping); + } + + quickSort(smc.__originalMappings, util.compareByOriginalPositions); + + return smc; + }; + +/** + * The version of the source mapping spec that we are consuming. + */ +BasicSourceMapConsumer.prototype._version = 3; + +/** + * The list of original sources. + */ +Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', { + get: function () { + return this._absoluteSources.slice(); + } +}); + +/** + * Provide the JIT with a nice shape / hidden class. + */ +function Mapping() { + this.generatedLine = 0; + this.generatedColumn = 0; + this.source = null; + this.originalLine = null; + this.originalColumn = null; + this.name = null; +} + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +BasicSourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + var generatedLine = 1; + var previousGeneratedColumn = 0; + var previousOriginalLine = 0; + var previousOriginalColumn = 0; + var previousSource = 0; + var previousName = 0; + var length = aStr.length; + var index = 0; + var cachedSegments = {}; + var temp = {}; + var originalMappings = []; + var generatedMappings = []; + var mapping, str, segment, end, value; + + while (index < length) { + if (aStr.charAt(index) === ';') { + generatedLine++; + index++; + previousGeneratedColumn = 0; + } + else if (aStr.charAt(index) === ',') { + index++; + } + else { + mapping = new Mapping(); + mapping.generatedLine = generatedLine; + + // Because each offset is encoded relative to the previous one, + // many segments often have the same encoding. We can exploit this + // fact by caching the parsed variable length fields of each segment, + // allowing us to avoid a second parse if we encounter the same + // segment again. + for (end = index; end < length; end++) { + if (this._charIsMappingSeparator(aStr, end)) { + break; + } + } + str = aStr.slice(index, end); + + segment = cachedSegments[str]; + if (segment) { + index += str.length; + } else { + segment = []; + while (index < end) { + base64VLQ.decode(aStr, index, temp); + value = temp.value; + index = temp.rest; + segment.push(value); + } + + if (segment.length === 2) { + throw new Error('Found a source, but no line and column'); + } + + if (segment.length === 3) { + throw new Error('Found a source and line, but no column'); + } + + cachedSegments[str] = segment; + } + + // Generated column. + mapping.generatedColumn = previousGeneratedColumn + segment[0]; + previousGeneratedColumn = mapping.generatedColumn; + + if (segment.length > 1) { + // Original source. + mapping.source = previousSource + segment[1]; + previousSource += segment[1]; + + // Original line. + mapping.originalLine = previousOriginalLine + segment[2]; + previousOriginalLine = mapping.originalLine; + // Lines are stored 0-based + mapping.originalLine += 1; + + // Original column. + mapping.originalColumn = previousOriginalColumn + segment[3]; + previousOriginalColumn = mapping.originalColumn; + + if (segment.length > 4) { + // Original name. + mapping.name = previousName + segment[4]; + previousName += segment[4]; + } + } + + generatedMappings.push(mapping); + if (typeof mapping.originalLine === 'number') { + originalMappings.push(mapping); + } + } + } + + quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated); + this.__generatedMappings = generatedMappings; + + quickSort(originalMappings, util.compareByOriginalPositions); + this.__originalMappings = originalMappings; + }; + +/** + * Find the mapping that best matches the hypothetical "needle" mapping that + * we are searching for in the given "haystack" of mappings. + */ +BasicSourceMapConsumer.prototype._findMapping = + function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName, + aColumnName, aComparator, aBias) { + // To return the position we are searching for, we must first find the + // mapping for the given position and then return the opposite position it + // points to. Because the mappings are sorted, we can use binary search to + // find the best mapping. + + if (aNeedle[aLineName] <= 0) { + throw new TypeError('Line must be greater than or equal to 1, got ' + + aNeedle[aLineName]); + } + if (aNeedle[aColumnName] < 0) { + throw new TypeError('Column must be greater than or equal to 0, got ' + + aNeedle[aColumnName]); + } + + return binarySearch.search(aNeedle, aMappings, aComparator, aBias); + }; + +/** + * Compute the last column for each generated mapping. The last column is + * inclusive. + */ +BasicSourceMapConsumer.prototype.computeColumnSpans = + function SourceMapConsumer_computeColumnSpans() { + for (var index = 0; index < this._generatedMappings.length; ++index) { + var mapping = this._generatedMappings[index]; + + // Mappings do not contain a field for the last generated columnt. We + // can come up with an optimistic estimate, however, by assuming that + // mappings are contiguous (i.e. given two consecutive mappings, the + // first mapping ends where the second one starts). + if (index + 1 < this._generatedMappings.length) { + var nextMapping = this._generatedMappings[index + 1]; + + if (mapping.generatedLine === nextMapping.generatedLine) { + mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1; + continue; + } + } + + // The last mapping for each line spans the entire line. + mapping.lastGeneratedColumn = Infinity; + } + }; + +/** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ +BasicSourceMapConsumer.prototype.originalPositionFor = + function SourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._generatedMappings, + "generatedLine", + "generatedColumn", + util.compareByGeneratedPositionsDeflated, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._generatedMappings[index]; + + if (mapping.generatedLine === needle.generatedLine) { + var source = util.getArg(mapping, 'source', null); + if (source !== null) { + source = this._sources.at(source); + source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL); + } + var name = util.getArg(mapping, 'name', null); + if (name !== null) { + name = this._names.at(name); + } + return { + source: source, + line: util.getArg(mapping, 'originalLine', null), + column: util.getArg(mapping, 'originalColumn', null), + name: name + }; + } + } + + return { + source: null, + line: null, + column: null, + name: null + }; + }; + +/** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ +BasicSourceMapConsumer.prototype.hasContentsOfAllSources = + function BasicSourceMapConsumer_hasContentsOfAllSources() { + if (!this.sourcesContent) { + return false; + } + return this.sourcesContent.length >= this._sources.size() && + !this.sourcesContent.some(function (sc) { return sc == null; }); + }; + +/** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ +BasicSourceMapConsumer.prototype.sourceContentFor = + function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + if (!this.sourcesContent) { + return null; + } + + var index = this._findSourceIndex(aSource); + if (index >= 0) { + return this.sourcesContent[index]; + } + + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + var url; + if (this.sourceRoot != null + && (url = util.urlParse(this.sourceRoot))) { + // XXX: file:// URIs and absolute paths lead to unexpected behavior for + // many users. We can help them out when they expect file:// URIs to + // behave like it would if they were running a local HTTP server. See + // https://bugzilla.mozilla.org/show_bug.cgi?id=885597. + var fileUriAbsPath = relativeSource.replace(/^file:\/\//, ""); + if (url.scheme == "file" + && this._sources.has(fileUriAbsPath)) { + return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)] + } + + if ((!url.path || url.path == "/") + && this._sources.has("/" + relativeSource)) { + return this.sourcesContent[this._sources.indexOf("/" + relativeSource)]; + } + } + + // This function is used recursively from + // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we + // don't want to throw if we can't find the source - we just want to + // return null, so we provide a flag to exit gracefully. + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + relativeSource + '" is not in the SourceMap.'); + } + }; + +/** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +BasicSourceMapConsumer.prototype.generatedPositionFor = + function SourceMapConsumer_generatedPositionFor(aArgs) { + var source = util.getArg(aArgs, 'source'); + source = this._findSourceIndex(source); + if (source < 0) { + return { + line: null, + column: null, + lastColumn: null + }; + } + + var needle = { + source: source, + originalLine: util.getArg(aArgs, 'line'), + originalColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (mapping.source === needle.source) { + return { + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }; + } + } + + return { + line: null, + column: null, + lastColumn: null + }; + }; + +exports.BasicSourceMapConsumer = BasicSourceMapConsumer; + +/** + * An IndexedSourceMapConsumer instance represents a parsed source map which + * we can query for information. It differs from BasicSourceMapConsumer in + * that it takes "indexed" source maps (i.e. ones with a "sections" field) as + * input. + * + * The first parameter is a raw source map (either as a JSON string, or already + * parsed to an object). According to the spec for indexed source maps, they + * have the following attributes: + * + * - version: Which version of the source map spec this map is following. + * - file: Optional. The generated file this source map is associated with. + * - sections: A list of section definitions. + * + * Each value under the "sections" field has two fields: + * - offset: The offset into the original specified at which this section + * begins to apply, defined as an object with a "line" and "column" + * field. + * - map: A source map definition. This source map could also be indexed, + * but doesn't have to be. + * + * Instead of the "map" field, it's also possible to have a "url" field + * specifying a URL to retrieve a source map from, but that's currently + * unsupported. + * + * Here's an example source map, taken from the source map spec[0], but + * modified to omit a section which uses the "url" field. + * + * { + * version : 3, + * file: "app.js", + * sections: [{ + * offset: {line:100, column:10}, + * map: { + * version : 3, + * file: "section.js", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AAAA,E;;ABCDE;" + * } + * }], + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt + */ +function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sections = util.getArg(sourceMap, 'sections'); + + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + this._sources = new ArraySet(); + this._names = new ArraySet(); + + var lastOffset = { + line: -1, + column: 0 + }; + this._sections = sections.map(function (s) { + if (s.url) { + // The url field will require support for asynchronicity. + // See https://github.com/mozilla/source-map/issues/16 + throw new Error('Support for url field in sections not implemented.'); + } + var offset = util.getArg(s, 'offset'); + var offsetLine = util.getArg(offset, 'line'); + var offsetColumn = util.getArg(offset, 'column'); + + if (offsetLine < lastOffset.line || + (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) { + throw new Error('Section offsets must be ordered and non-overlapping.'); + } + lastOffset = offset; + + return { + generatedOffset: { + // The offset fields are 0-based, but we use 1-based indices when + // encoding/decoding from VLQ. + generatedLine: offsetLine + 1, + generatedColumn: offsetColumn + 1 + }, + consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL) + } + }); +} + +IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); +IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer; + +/** + * The version of the source mapping spec that we are consuming. + */ +IndexedSourceMapConsumer.prototype._version = 3; + +/** + * The list of original sources. + */ +Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', { + get: function () { + var sources = []; + for (var i = 0; i < this._sections.length; i++) { + for (var j = 0; j < this._sections[i].consumer.sources.length; j++) { + sources.push(this._sections[i].consumer.sources[j]); + } + } + return sources; + } +}); + +/** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ +IndexedSourceMapConsumer.prototype.originalPositionFor = + function IndexedSourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + // Find the section containing the generated position we're trying to map + // to an original position. + var sectionIndex = binarySearch.search(needle, this._sections, + function(needle, section) { + var cmp = needle.generatedLine - section.generatedOffset.generatedLine; + if (cmp) { + return cmp; + } + + return (needle.generatedColumn - + section.generatedOffset.generatedColumn); + }); + var section = this._sections[sectionIndex]; + + if (!section) { + return { + source: null, + line: null, + column: null, + name: null + }; + } + + return section.consumer.originalPositionFor({ + line: needle.generatedLine - + (section.generatedOffset.generatedLine - 1), + column: needle.generatedColumn - + (section.generatedOffset.generatedLine === needle.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + bias: aArgs.bias + }); + }; + +/** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ +IndexedSourceMapConsumer.prototype.hasContentsOfAllSources = + function IndexedSourceMapConsumer_hasContentsOfAllSources() { + return this._sections.every(function (s) { + return s.consumer.hasContentsOfAllSources(); + }); + }; + +/** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ +IndexedSourceMapConsumer.prototype.sourceContentFor = + function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + var content = section.consumer.sourceContentFor(aSource, true); + if (content) { + return content; + } + } + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + aSource + '" is not in the SourceMap.'); + } + }; + +/** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +IndexedSourceMapConsumer.prototype.generatedPositionFor = + function IndexedSourceMapConsumer_generatedPositionFor(aArgs) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + // Only consider this section if the requested source is in the list of + // sources of the consumer. + if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) { + continue; + } + var generatedPosition = section.consumer.generatedPositionFor(aArgs); + if (generatedPosition) { + var ret = { + line: generatedPosition.line + + (section.generatedOffset.generatedLine - 1), + column: generatedPosition.column + + (section.generatedOffset.generatedLine === generatedPosition.line + ? section.generatedOffset.generatedColumn - 1 + : 0) + }; + return ret; + } + } + + return { + line: null, + column: null + }; + }; + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +IndexedSourceMapConsumer.prototype._parseMappings = + function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) { + this.__generatedMappings = []; + this.__originalMappings = []; + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + var sectionMappings = section.consumer._generatedMappings; + for (var j = 0; j < sectionMappings.length; j++) { + var mapping = sectionMappings[j]; + + var source = section.consumer._sources.at(mapping.source); + source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL); + this._sources.add(source); + source = this._sources.indexOf(source); + + var name = null; + if (mapping.name) { + name = section.consumer._names.at(mapping.name); + this._names.add(name); + name = this._names.indexOf(name); + } + + // The mappings coming from the consumer for the section have + // generated positions relative to the start of the section, so we + // need to offset them to be relative to the start of the concatenated + // generated file. + var adjustedMapping = { + source: source, + generatedLine: mapping.generatedLine + + (section.generatedOffset.generatedLine - 1), + generatedColumn: mapping.generatedColumn + + (section.generatedOffset.generatedLine === mapping.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: name + }; + + this.__generatedMappings.push(adjustedMapping); + if (typeof adjustedMapping.originalLine === 'number') { + this.__originalMappings.push(adjustedMapping); + } + } + } + + quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated); + quickSort(this.__originalMappings, util.compareByOriginalPositions); + }; + +exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer; diff --git a/resources/app/node_modules/source-map/lib/source-map-generator.js b/resources/app/node_modules/source-map/lib/source-map-generator.js new file mode 100644 index 0000000..508bcfb --- /dev/null +++ b/resources/app/node_modules/source-map/lib/source-map-generator.js @@ -0,0 +1,425 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var base64VLQ = require('./base64-vlq'); +var util = require('./util'); +var ArraySet = require('./array-set').ArraySet; +var MappingList = require('./mapping-list').MappingList; + +/** + * An instance of the SourceMapGenerator represents a source map which is + * being built incrementally. You may pass an object with the following + * properties: + * + * - file: The filename of the generated source. + * - sourceRoot: A root for all relative URLs in this source map. + */ +function SourceMapGenerator(aArgs) { + if (!aArgs) { + aArgs = {}; + } + this._file = util.getArg(aArgs, 'file', null); + this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null); + this._skipValidation = util.getArg(aArgs, 'skipValidation', false); + this._sources = new ArraySet(); + this._names = new ArraySet(); + this._mappings = new MappingList(); + this._sourcesContents = null; +} + +SourceMapGenerator.prototype._version = 3; + +/** + * Creates a new SourceMapGenerator based on a SourceMapConsumer + * + * @param aSourceMapConsumer The SourceMap. + */ +SourceMapGenerator.fromSourceMap = + function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) { + var sourceRoot = aSourceMapConsumer.sourceRoot; + var generator = new SourceMapGenerator({ + file: aSourceMapConsumer.file, + sourceRoot: sourceRoot + }); + aSourceMapConsumer.eachMapping(function (mapping) { + var newMapping = { + generated: { + line: mapping.generatedLine, + column: mapping.generatedColumn + } + }; + + if (mapping.source != null) { + newMapping.source = mapping.source; + if (sourceRoot != null) { + newMapping.source = util.relative(sourceRoot, newMapping.source); + } + + newMapping.original = { + line: mapping.originalLine, + column: mapping.originalColumn + }; + + if (mapping.name != null) { + newMapping.name = mapping.name; + } + } + + generator.addMapping(newMapping); + }); + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var sourceRelative = sourceFile; + if (sourceRoot !== null) { + sourceRelative = util.relative(sourceRoot, sourceFile); + } + + if (!generator._sources.has(sourceRelative)) { + generator._sources.add(sourceRelative); + } + + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + generator.setSourceContent(sourceFile, content); + } + }); + return generator; + }; + +/** + * Add a single mapping from original source line and column to the generated + * source's line and column for this source map being created. The mapping + * object should have the following properties: + * + * - generated: An object with the generated line and column positions. + * - original: An object with the original line and column positions. + * - source: The original source file (relative to the sourceRoot). + * - name: An optional original token name for this mapping. + */ +SourceMapGenerator.prototype.addMapping = + function SourceMapGenerator_addMapping(aArgs) { + var generated = util.getArg(aArgs, 'generated'); + var original = util.getArg(aArgs, 'original', null); + var source = util.getArg(aArgs, 'source', null); + var name = util.getArg(aArgs, 'name', null); + + if (!this._skipValidation) { + this._validateMapping(generated, original, source, name); + } + + if (source != null) { + source = String(source); + if (!this._sources.has(source)) { + this._sources.add(source); + } + } + + if (name != null) { + name = String(name); + if (!this._names.has(name)) { + this._names.add(name); + } + } + + this._mappings.add({ + generatedLine: generated.line, + generatedColumn: generated.column, + originalLine: original != null && original.line, + originalColumn: original != null && original.column, + source: source, + name: name + }); + }; + +/** + * Set the source content for a source file. + */ +SourceMapGenerator.prototype.setSourceContent = + function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) { + var source = aSourceFile; + if (this._sourceRoot != null) { + source = util.relative(this._sourceRoot, source); + } + + if (aSourceContent != null) { + // Add the source content to the _sourcesContents map. + // Create a new _sourcesContents map if the property is null. + if (!this._sourcesContents) { + this._sourcesContents = Object.create(null); + } + this._sourcesContents[util.toSetString(source)] = aSourceContent; + } else if (this._sourcesContents) { + // Remove the source file from the _sourcesContents map. + // If the _sourcesContents map is empty, set the property to null. + delete this._sourcesContents[util.toSetString(source)]; + if (Object.keys(this._sourcesContents).length === 0) { + this._sourcesContents = null; + } + } + }; + +/** + * Applies the mappings of a sub-source-map for a specific source file to the + * source map being generated. Each mapping to the supplied source file is + * rewritten using the supplied source map. Note: The resolution for the + * resulting mappings is the minimium of this map and the supplied map. + * + * @param aSourceMapConsumer The source map to be applied. + * @param aSourceFile Optional. The filename of the source file. + * If omitted, SourceMapConsumer's file property will be used. + * @param aSourceMapPath Optional. The dirname of the path to the source map + * to be applied. If relative, it is relative to the SourceMapConsumer. + * This parameter is needed when the two source maps aren't in the same + * directory, and the source map to be applied contains relative source + * paths. If so, those relative source paths need to be rewritten + * relative to the SourceMapGenerator. + */ +SourceMapGenerator.prototype.applySourceMap = + function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) { + var sourceFile = aSourceFile; + // If aSourceFile is omitted, we will use the file property of the SourceMap + if (aSourceFile == null) { + if (aSourceMapConsumer.file == null) { + throw new Error( + 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' + + 'or the source map\'s "file" property. Both were omitted.' + ); + } + sourceFile = aSourceMapConsumer.file; + } + var sourceRoot = this._sourceRoot; + // Make "sourceFile" relative if an absolute Url is passed. + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + // Applying the SourceMap can add and remove items from the sources and + // the names array. + var newSources = new ArraySet(); + var newNames = new ArraySet(); + + // Find mappings for the "sourceFile" + this._mappings.unsortedForEach(function (mapping) { + if (mapping.source === sourceFile && mapping.originalLine != null) { + // Check if it can be mapped by the source map, then update the mapping. + var original = aSourceMapConsumer.originalPositionFor({ + line: mapping.originalLine, + column: mapping.originalColumn + }); + if (original.source != null) { + // Copy mapping + mapping.source = original.source; + if (aSourceMapPath != null) { + mapping.source = util.join(aSourceMapPath, mapping.source) + } + if (sourceRoot != null) { + mapping.source = util.relative(sourceRoot, mapping.source); + } + mapping.originalLine = original.line; + mapping.originalColumn = original.column; + if (original.name != null) { + mapping.name = original.name; + } + } + } + + var source = mapping.source; + if (source != null && !newSources.has(source)) { + newSources.add(source); + } + + var name = mapping.name; + if (name != null && !newNames.has(name)) { + newNames.add(name); + } + + }, this); + this._sources = newSources; + this._names = newNames; + + // Copy sourcesContents of applied map. + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aSourceMapPath != null) { + sourceFile = util.join(aSourceMapPath, sourceFile); + } + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + this.setSourceContent(sourceFile, content); + } + }, this); + }; + +/** + * A mapping can have one of the three levels of data: + * + * 1. Just the generated position. + * 2. The Generated position, original position, and original source. + * 3. Generated and original position, original source, as well as a name + * token. + * + * To maintain consistency, we validate that any new mapping being added falls + * in to one of these categories. + */ +SourceMapGenerator.prototype._validateMapping = + function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource, + aName) { + // When aOriginal is truthy but has empty values for .line and .column, + // it is most likely a programmer error. In this case we throw a very + // specific error message to try to guide them the right way. + // For example: https://github.com/Polymer/polymer-bundler/pull/519 + if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') { + throw new Error( + 'original.line and original.column are not numbers -- you probably meant to omit ' + + 'the original mapping entirely and only map the generated position. If so, pass ' + + 'null for the original mapping instead of an object with empty or null values.' + ); + } + + if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aGenerated.line > 0 && aGenerated.column >= 0 + && !aOriginal && !aSource && !aName) { + // Case 1. + return; + } + else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aOriginal && 'line' in aOriginal && 'column' in aOriginal + && aGenerated.line > 0 && aGenerated.column >= 0 + && aOriginal.line > 0 && aOriginal.column >= 0 + && aSource) { + // Cases 2 and 3. + return; + } + else { + throw new Error('Invalid mapping: ' + JSON.stringify({ + generated: aGenerated, + source: aSource, + original: aOriginal, + name: aName + })); + } + }; + +/** + * Serialize the accumulated mappings in to the stream of base 64 VLQs + * specified by the source map format. + */ +SourceMapGenerator.prototype._serializeMappings = + function SourceMapGenerator_serializeMappings() { + var previousGeneratedColumn = 0; + var previousGeneratedLine = 1; + var previousOriginalColumn = 0; + var previousOriginalLine = 0; + var previousName = 0; + var previousSource = 0; + var result = ''; + var next; + var mapping; + var nameIdx; + var sourceIdx; + + var mappings = this._mappings.toArray(); + for (var i = 0, len = mappings.length; i < len; i++) { + mapping = mappings[i]; + next = '' + + if (mapping.generatedLine !== previousGeneratedLine) { + previousGeneratedColumn = 0; + while (mapping.generatedLine !== previousGeneratedLine) { + next += ';'; + previousGeneratedLine++; + } + } + else { + if (i > 0) { + if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) { + continue; + } + next += ','; + } + } + + next += base64VLQ.encode(mapping.generatedColumn + - previousGeneratedColumn); + previousGeneratedColumn = mapping.generatedColumn; + + if (mapping.source != null) { + sourceIdx = this._sources.indexOf(mapping.source); + next += base64VLQ.encode(sourceIdx - previousSource); + previousSource = sourceIdx; + + // lines are stored 0-based in SourceMap spec version 3 + next += base64VLQ.encode(mapping.originalLine - 1 + - previousOriginalLine); + previousOriginalLine = mapping.originalLine - 1; + + next += base64VLQ.encode(mapping.originalColumn + - previousOriginalColumn); + previousOriginalColumn = mapping.originalColumn; + + if (mapping.name != null) { + nameIdx = this._names.indexOf(mapping.name); + next += base64VLQ.encode(nameIdx - previousName); + previousName = nameIdx; + } + } + + result += next; + } + + return result; + }; + +SourceMapGenerator.prototype._generateSourcesContent = + function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) { + return aSources.map(function (source) { + if (!this._sourcesContents) { + return null; + } + if (aSourceRoot != null) { + source = util.relative(aSourceRoot, source); + } + var key = util.toSetString(source); + return Object.prototype.hasOwnProperty.call(this._sourcesContents, key) + ? this._sourcesContents[key] + : null; + }, this); + }; + +/** + * Externalize the source map. + */ +SourceMapGenerator.prototype.toJSON = + function SourceMapGenerator_toJSON() { + var map = { + version: this._version, + sources: this._sources.toArray(), + names: this._names.toArray(), + mappings: this._serializeMappings() + }; + if (this._file != null) { + map.file = this._file; + } + if (this._sourceRoot != null) { + map.sourceRoot = this._sourceRoot; + } + if (this._sourcesContents) { + map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot); + } + + return map; + }; + +/** + * Render the source map being generated to a string. + */ +SourceMapGenerator.prototype.toString = + function SourceMapGenerator_toString() { + return JSON.stringify(this.toJSON()); + }; + +exports.SourceMapGenerator = SourceMapGenerator; diff --git a/resources/app/node_modules/source-map/lib/source-node.js b/resources/app/node_modules/source-map/lib/source-node.js new file mode 100644 index 0000000..8bcdbe3 --- /dev/null +++ b/resources/app/node_modules/source-map/lib/source-node.js @@ -0,0 +1,413 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var SourceMapGenerator = require('./source-map-generator').SourceMapGenerator; +var util = require('./util'); + +// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other +// operating systems these days (capturing the result). +var REGEX_NEWLINE = /(\r?\n)/; + +// Newline character code for charCodeAt() comparisons +var NEWLINE_CODE = 10; + +// Private symbol for identifying `SourceNode`s when multiple versions of +// the source-map library are loaded. This MUST NOT CHANGE across +// versions! +var isSourceNode = "$$$isSourceNode$$$"; + +/** + * SourceNodes provide a way to abstract over interpolating/concatenating + * snippets of generated JavaScript source code while maintaining the line and + * column information associated with the original source code. + * + * @param aLine The original line number. + * @param aColumn The original column number. + * @param aSource The original source's filename. + * @param aChunks Optional. An array of strings which are snippets of + * generated JS, or other SourceNodes. + * @param aName The original identifier. + */ +function SourceNode(aLine, aColumn, aSource, aChunks, aName) { + this.children = []; + this.sourceContents = {}; + this.line = aLine == null ? null : aLine; + this.column = aColumn == null ? null : aColumn; + this.source = aSource == null ? null : aSource; + this.name = aName == null ? null : aName; + this[isSourceNode] = true; + if (aChunks != null) this.add(aChunks); +} + +/** + * Creates a SourceNode from generated code and a SourceMapConsumer. + * + * @param aGeneratedCode The generated code + * @param aSourceMapConsumer The SourceMap for the generated code + * @param aRelativePath Optional. The path that relative sources in the + * SourceMapConsumer should be relative to. + */ +SourceNode.fromStringWithSourceMap = + function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) { + // The SourceNode we want to fill with the generated code + // and the SourceMap + var node = new SourceNode(); + + // All even indices of this array are one line of the generated code, + // while all odd indices are the newlines between two adjacent lines + // (since `REGEX_NEWLINE` captures its match). + // Processed fragments are accessed by calling `shiftNextLine`. + var remainingLines = aGeneratedCode.split(REGEX_NEWLINE); + var remainingLinesIndex = 0; + var shiftNextLine = function() { + var lineContents = getNextLine(); + // The last line of a file might not have a newline. + var newLine = getNextLine() || ""; + return lineContents + newLine; + + function getNextLine() { + return remainingLinesIndex < remainingLines.length ? + remainingLines[remainingLinesIndex++] : undefined; + } + }; + + // We need to remember the position of "remainingLines" + var lastGeneratedLine = 1, lastGeneratedColumn = 0; + + // The generate SourceNodes we need a code range. + // To extract it current and last mapping is used. + // Here we store the last mapping. + var lastMapping = null; + + aSourceMapConsumer.eachMapping(function (mapping) { + if (lastMapping !== null) { + // We add the code from "lastMapping" to "mapping": + // First check if there is a new line in between. + if (lastGeneratedLine < mapping.generatedLine) { + // Associate first line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + lastGeneratedLine++; + lastGeneratedColumn = 0; + // The remaining code is added without mapping + } else { + // There is no new line in between. + // Associate the code between "lastGeneratedColumn" and + // "mapping.generatedColumn" with "lastMapping" + var nextLine = remainingLines[remainingLinesIndex] || ''; + var code = nextLine.substr(0, mapping.generatedColumn - + lastGeneratedColumn); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn - + lastGeneratedColumn); + lastGeneratedColumn = mapping.generatedColumn; + addMappingWithCode(lastMapping, code); + // No more remaining code, continue + lastMapping = mapping; + return; + } + } + // We add the generated code until the first mapping + // to the SourceNode without any mapping. + // Each line is added as separate string. + while (lastGeneratedLine < mapping.generatedLine) { + node.add(shiftNextLine()); + lastGeneratedLine++; + } + if (lastGeneratedColumn < mapping.generatedColumn) { + var nextLine = remainingLines[remainingLinesIndex] || ''; + node.add(nextLine.substr(0, mapping.generatedColumn)); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn); + lastGeneratedColumn = mapping.generatedColumn; + } + lastMapping = mapping; + }, this); + // We have processed all mappings. + if (remainingLinesIndex < remainingLines.length) { + if (lastMapping) { + // Associate the remaining code in the current line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + } + // and add the remaining lines without any mapping + node.add(remainingLines.splice(remainingLinesIndex).join("")); + } + + // Copy sourcesContent into SourceNode + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aRelativePath != null) { + sourceFile = util.join(aRelativePath, sourceFile); + } + node.setSourceContent(sourceFile, content); + } + }); + + return node; + + function addMappingWithCode(mapping, code) { + if (mapping === null || mapping.source === undefined) { + node.add(code); + } else { + var source = aRelativePath + ? util.join(aRelativePath, mapping.source) + : mapping.source; + node.add(new SourceNode(mapping.originalLine, + mapping.originalColumn, + source, + code, + mapping.name)); + } + } + }; + +/** + * Add a chunk of generated JS to this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ +SourceNode.prototype.add = function SourceNode_add(aChunk) { + if (Array.isArray(aChunk)) { + aChunk.forEach(function (chunk) { + this.add(chunk); + }, this); + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + if (aChunk) { + this.children.push(aChunk); + } + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; +}; + +/** + * Add a chunk of generated JS to the beginning of this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ +SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) { + if (Array.isArray(aChunk)) { + for (var i = aChunk.length-1; i >= 0; i--) { + this.prepend(aChunk[i]); + } + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + this.children.unshift(aChunk); + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; +}; + +/** + * Walk over the tree of JS snippets in this node and its children. The + * walking function is called once for each snippet of JS and is passed that + * snippet and the its original associated source's line/column location. + * + * @param aFn The traversal function. + */ +SourceNode.prototype.walk = function SourceNode_walk(aFn) { + var chunk; + for (var i = 0, len = this.children.length; i < len; i++) { + chunk = this.children[i]; + if (chunk[isSourceNode]) { + chunk.walk(aFn); + } + else { + if (chunk !== '') { + aFn(chunk, { source: this.source, + line: this.line, + column: this.column, + name: this.name }); + } + } + } +}; + +/** + * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between + * each of `this.children`. + * + * @param aSep The separator. + */ +SourceNode.prototype.join = function SourceNode_join(aSep) { + var newChildren; + var i; + var len = this.children.length; + if (len > 0) { + newChildren = []; + for (i = 0; i < len-1; i++) { + newChildren.push(this.children[i]); + newChildren.push(aSep); + } + newChildren.push(this.children[i]); + this.children = newChildren; + } + return this; +}; + +/** + * Call String.prototype.replace on the very right-most source snippet. Useful + * for trimming whitespace from the end of a source node, etc. + * + * @param aPattern The pattern to replace. + * @param aReplacement The thing to replace the pattern with. + */ +SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) { + var lastChild = this.children[this.children.length - 1]; + if (lastChild[isSourceNode]) { + lastChild.replaceRight(aPattern, aReplacement); + } + else if (typeof lastChild === 'string') { + this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement); + } + else { + this.children.push(''.replace(aPattern, aReplacement)); + } + return this; +}; + +/** + * Set the source content for a source file. This will be added to the SourceMapGenerator + * in the sourcesContent field. + * + * @param aSourceFile The filename of the source file + * @param aSourceContent The content of the source file + */ +SourceNode.prototype.setSourceContent = + function SourceNode_setSourceContent(aSourceFile, aSourceContent) { + this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent; + }; + +/** + * Walk over the tree of SourceNodes. The walking function is called for each + * source file content and is passed the filename and source content. + * + * @param aFn The traversal function. + */ +SourceNode.prototype.walkSourceContents = + function SourceNode_walkSourceContents(aFn) { + for (var i = 0, len = this.children.length; i < len; i++) { + if (this.children[i][isSourceNode]) { + this.children[i].walkSourceContents(aFn); + } + } + + var sources = Object.keys(this.sourceContents); + for (var i = 0, len = sources.length; i < len; i++) { + aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]); + } + }; + +/** + * Return the string representation of this source node. Walks over the tree + * and concatenates all the various snippets together to one string. + */ +SourceNode.prototype.toString = function SourceNode_toString() { + var str = ""; + this.walk(function (chunk) { + str += chunk; + }); + return str; +}; + +/** + * Returns the string representation of this source node along with a source + * map. + */ +SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) { + var generated = { + code: "", + line: 1, + column: 0 + }; + var map = new SourceMapGenerator(aArgs); + var sourceMappingActive = false; + var lastOriginalSource = null; + var lastOriginalLine = null; + var lastOriginalColumn = null; + var lastOriginalName = null; + this.walk(function (chunk, original) { + generated.code += chunk; + if (original.source !== null + && original.line !== null + && original.column !== null) { + if(lastOriginalSource !== original.source + || lastOriginalLine !== original.line + || lastOriginalColumn !== original.column + || lastOriginalName !== original.name) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + lastOriginalSource = original.source; + lastOriginalLine = original.line; + lastOriginalColumn = original.column; + lastOriginalName = original.name; + sourceMappingActive = true; + } else if (sourceMappingActive) { + map.addMapping({ + generated: { + line: generated.line, + column: generated.column + } + }); + lastOriginalSource = null; + sourceMappingActive = false; + } + for (var idx = 0, length = chunk.length; idx < length; idx++) { + if (chunk.charCodeAt(idx) === NEWLINE_CODE) { + generated.line++; + generated.column = 0; + // Mappings end at eol + if (idx + 1 === length) { + lastOriginalSource = null; + sourceMappingActive = false; + } else if (sourceMappingActive) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + } else { + generated.column++; + } + } + }); + this.walkSourceContents(function (sourceFile, sourceContent) { + map.setSourceContent(sourceFile, sourceContent); + }); + + return { code: generated.code, map: map }; +}; + +exports.SourceNode = SourceNode; diff --git a/resources/app/node_modules/source-map/lib/util.js b/resources/app/node_modules/source-map/lib/util.js new file mode 100644 index 0000000..3ca92e5 --- /dev/null +++ b/resources/app/node_modules/source-map/lib/util.js @@ -0,0 +1,488 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +/** + * This is a helper function for getting values from parameter/options + * objects. + * + * @param args The object we are extracting values from + * @param name The name of the property we are getting. + * @param defaultValue An optional value to return if the property is missing + * from the object. If this is not specified and the property is missing, an + * error will be thrown. + */ +function getArg(aArgs, aName, aDefaultValue) { + if (aName in aArgs) { + return aArgs[aName]; + } else if (arguments.length === 3) { + return aDefaultValue; + } else { + throw new Error('"' + aName + '" is a required argument.'); + } +} +exports.getArg = getArg; + +var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/; +var dataUrlRegexp = /^data:.+\,.+$/; + +function urlParse(aUrl) { + var match = aUrl.match(urlRegexp); + if (!match) { + return null; + } + return { + scheme: match[1], + auth: match[2], + host: match[3], + port: match[4], + path: match[5] + }; +} +exports.urlParse = urlParse; + +function urlGenerate(aParsedUrl) { + var url = ''; + if (aParsedUrl.scheme) { + url += aParsedUrl.scheme + ':'; + } + url += '//'; + if (aParsedUrl.auth) { + url += aParsedUrl.auth + '@'; + } + if (aParsedUrl.host) { + url += aParsedUrl.host; + } + if (aParsedUrl.port) { + url += ":" + aParsedUrl.port + } + if (aParsedUrl.path) { + url += aParsedUrl.path; + } + return url; +} +exports.urlGenerate = urlGenerate; + +/** + * Normalizes a path, or the path portion of a URL: + * + * - Replaces consecutive slashes with one slash. + * - Removes unnecessary '.' parts. + * - Removes unnecessary '<dir>/..' parts. + * + * Based on code in the Node.js 'path' core module. + * + * @param aPath The path or url to normalize. + */ +function normalize(aPath) { + var path = aPath; + var url = urlParse(aPath); + if (url) { + if (!url.path) { + return aPath; + } + path = url.path; + } + var isAbsolute = exports.isAbsolute(path); + + var parts = path.split(/\/+/); + for (var part, up = 0, i = parts.length - 1; i >= 0; i--) { + part = parts[i]; + if (part === '.') { + parts.splice(i, 1); + } else if (part === '..') { + up++; + } else if (up > 0) { + if (part === '') { + // The first part is blank if the path is absolute. Trying to go + // above the root is a no-op. Therefore we can remove all '..' parts + // directly after the root. + parts.splice(i + 1, up); + up = 0; + } else { + parts.splice(i, 2); + up--; + } + } + } + path = parts.join('/'); + + if (path === '') { + path = isAbsolute ? '/' : '.'; + } + + if (url) { + url.path = path; + return urlGenerate(url); + } + return path; +} +exports.normalize = normalize; + +/** + * Joins two paths/URLs. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be joined with the root. + * + * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a + * scheme-relative URL: Then the scheme of aRoot, if any, is prepended + * first. + * - Otherwise aPath is a path. If aRoot is a URL, then its path portion + * is updated with the result and aRoot is returned. Otherwise the result + * is returned. + * - If aPath is absolute, the result is aPath. + * - Otherwise the two paths are joined with a slash. + * - Joining for example 'http://' and 'www.example.com' is also supported. + */ +function join(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + if (aPath === "") { + aPath = "."; + } + var aPathUrl = urlParse(aPath); + var aRootUrl = urlParse(aRoot); + if (aRootUrl) { + aRoot = aRootUrl.path || '/'; + } + + // `join(foo, '//www.example.org')` + if (aPathUrl && !aPathUrl.scheme) { + if (aRootUrl) { + aPathUrl.scheme = aRootUrl.scheme; + } + return urlGenerate(aPathUrl); + } + + if (aPathUrl || aPath.match(dataUrlRegexp)) { + return aPath; + } + + // `join('http://', 'www.example.com')` + if (aRootUrl && !aRootUrl.host && !aRootUrl.path) { + aRootUrl.host = aPath; + return urlGenerate(aRootUrl); + } + + var joined = aPath.charAt(0) === '/' + ? aPath + : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath); + + if (aRootUrl) { + aRootUrl.path = joined; + return urlGenerate(aRootUrl); + } + return joined; +} +exports.join = join; + +exports.isAbsolute = function (aPath) { + return aPath.charAt(0) === '/' || urlRegexp.test(aPath); +}; + +/** + * Make a path relative to a URL or another path. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be made relative to aRoot. + */ +function relative(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + + aRoot = aRoot.replace(/\/$/, ''); + + // It is possible for the path to be above the root. In this case, simply + // checking whether the root is a prefix of the path won't work. Instead, we + // need to remove components from the root one by one, until either we find + // a prefix that fits, or we run out of components to remove. + var level = 0; + while (aPath.indexOf(aRoot + '/') !== 0) { + var index = aRoot.lastIndexOf("/"); + if (index < 0) { + return aPath; + } + + // If the only part of the root that is left is the scheme (i.e. http://, + // file:///, etc.), one or more slashes (/), or simply nothing at all, we + // have exhausted all components, so the path is not relative to the root. + aRoot = aRoot.slice(0, index); + if (aRoot.match(/^([^\/]+:\/)?\/*$/)) { + return aPath; + } + + ++level; + } + + // Make sure we add a "../" for each component we removed from the root. + return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1); +} +exports.relative = relative; + +var supportsNullProto = (function () { + var obj = Object.create(null); + return !('__proto__' in obj); +}()); + +function identity (s) { + return s; +} + +/** + * Because behavior goes wacky when you set `__proto__` on objects, we + * have to prefix all the strings in our set with an arbitrary character. + * + * See https://github.com/mozilla/source-map/pull/31 and + * https://github.com/mozilla/source-map/issues/30 + * + * @param String aStr + */ +function toSetString(aStr) { + if (isProtoString(aStr)) { + return '$' + aStr; + } + + return aStr; +} +exports.toSetString = supportsNullProto ? identity : toSetString; + +function fromSetString(aStr) { + if (isProtoString(aStr)) { + return aStr.slice(1); + } + + return aStr; +} +exports.fromSetString = supportsNullProto ? identity : fromSetString; + +function isProtoString(s) { + if (!s) { + return false; + } + + var length = s.length; + + if (length < 9 /* "__proto__".length */) { + return false; + } + + if (s.charCodeAt(length - 1) !== 95 /* '_' */ || + s.charCodeAt(length - 2) !== 95 /* '_' */ || + s.charCodeAt(length - 3) !== 111 /* 'o' */ || + s.charCodeAt(length - 4) !== 116 /* 't' */ || + s.charCodeAt(length - 5) !== 111 /* 'o' */ || + s.charCodeAt(length - 6) !== 114 /* 'r' */ || + s.charCodeAt(length - 7) !== 112 /* 'p' */ || + s.charCodeAt(length - 8) !== 95 /* '_' */ || + s.charCodeAt(length - 9) !== 95 /* '_' */) { + return false; + } + + for (var i = length - 10; i >= 0; i--) { + if (s.charCodeAt(i) !== 36 /* '$' */) { + return false; + } + } + + return true; +} + +/** + * Comparator between two mappings where the original positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same original source/line/column, but different generated + * line and column the same. Useful when searching for a mapping with a + * stubbed out mapping. + */ +function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) { + var cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0 || onlyCompareOriginal) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByOriginalPositions = compareByOriginalPositions; + +/** + * Comparator between two mappings with deflated source and name indices where + * the generated positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same generated line and column, but different + * source/name/original line and column the same. Useful when searching for a + * mapping with a stubbed out mapping. + */ +function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0 || onlyCompareGenerated) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated; + +function strcmp(aStr1, aStr2) { + if (aStr1 === aStr2) { + return 0; + } + + if (aStr1 === null) { + return 1; // aStr2 !== null + } + + if (aStr2 === null) { + return -1; // aStr1 !== null + } + + if (aStr1 > aStr2) { + return 1; + } + + return -1; +} + +/** + * Comparator between two mappings with inflated source and name strings where + * the generated positions are compared. + */ +function compareByGeneratedPositionsInflated(mappingA, mappingB) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated; + +/** + * Strip any JSON XSSI avoidance prefix from the string (as documented + * in the source maps specification), and then parse the string as + * JSON. + */ +function parseSourceMapInput(str) { + return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, '')); +} +exports.parseSourceMapInput = parseSourceMapInput; + +/** + * Compute the URL of a source given the the source root, the source's + * URL, and the source map's URL. + */ +function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) { + sourceURL = sourceURL || ''; + + if (sourceRoot) { + // This follows what Chrome does. + if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') { + sourceRoot += '/'; + } + // The spec says: + // Line 4: An optional source root, useful for relocating source + // files on a server or removing repeated values in the + // “sources” entry. This value is prepended to the individual + // entries in the “source” field. + sourceURL = sourceRoot + sourceURL; + } + + // Historically, SourceMapConsumer did not take the sourceMapURL as + // a parameter. This mode is still somewhat supported, which is why + // this code block is conditional. However, it's preferable to pass + // the source map URL to SourceMapConsumer, so that this function + // can implement the source URL resolution algorithm as outlined in + // the spec. This block is basically the equivalent of: + // new URL(sourceURL, sourceMapURL).toString() + // ... except it avoids using URL, which wasn't available in the + // older releases of node still supported by this library. + // + // The spec says: + // If the sources are not absolute URLs after prepending of the + // “sourceRoot”, the sources are resolved relative to the + // SourceMap (like resolving script src in a html document). + if (sourceMapURL) { + var parsed = urlParse(sourceMapURL); + if (!parsed) { + throw new Error("sourceMapURL could not be parsed"); + } + if (parsed.path) { + // Strip the last path component, but keep the "/". + var index = parsed.path.lastIndexOf('/'); + if (index >= 0) { + parsed.path = parsed.path.substring(0, index + 1); + } + } + sourceURL = join(urlGenerate(parsed), sourceURL); + } + + return normalize(sourceURL); +} +exports.computeSourceURL = computeSourceURL; diff --git a/resources/app/node_modules/source-map/source-map.d.ts b/resources/app/node_modules/source-map/source-map.d.ts new file mode 100644 index 0000000..8f972b0 --- /dev/null +++ b/resources/app/node_modules/source-map/source-map.d.ts @@ -0,0 +1,98 @@ +export interface StartOfSourceMap { + file?: string; + sourceRoot?: string; +} + +export interface RawSourceMap extends StartOfSourceMap { + version: string; + sources: string[]; + names: string[]; + sourcesContent?: string[]; + mappings: string; +} + +export interface Position { + line: number; + column: number; +} + +export interface LineRange extends Position { + lastColumn: number; +} + +export interface FindPosition extends Position { + // SourceMapConsumer.GREATEST_LOWER_BOUND or SourceMapConsumer.LEAST_UPPER_BOUND + bias?: number; +} + +export interface SourceFindPosition extends FindPosition { + source: string; +} + +export interface MappedPosition extends Position { + source: string; + name?: string; +} + +export interface MappingItem { + source: string; + generatedLine: number; + generatedColumn: number; + originalLine: number; + originalColumn: number; + name: string; +} + +export class SourceMapConsumer { + static GENERATED_ORDER: number; + static ORIGINAL_ORDER: number; + + static GREATEST_LOWER_BOUND: number; + static LEAST_UPPER_BOUND: number; + + constructor(rawSourceMap: RawSourceMap); + computeColumnSpans(): void; + originalPositionFor(generatedPosition: FindPosition): MappedPosition; + generatedPositionFor(originalPosition: SourceFindPosition): LineRange; + allGeneratedPositionsFor(originalPosition: MappedPosition): Position[]; + hasContentsOfAllSources(): boolean; + sourceContentFor(source: string, returnNullOnMissing?: boolean): string; + eachMapping(callback: (mapping: MappingItem) => void, context?: any, order?: number): void; +} + +export interface Mapping { + generated: Position; + original: Position; + source: string; + name?: string; +} + +export class SourceMapGenerator { + constructor(startOfSourceMap?: StartOfSourceMap); + static fromSourceMap(sourceMapConsumer: SourceMapConsumer): SourceMapGenerator; + addMapping(mapping: Mapping): void; + setSourceContent(sourceFile: string, sourceContent: string): void; + applySourceMap(sourceMapConsumer: SourceMapConsumer, sourceFile?: string, sourceMapPath?: string): void; + toString(): string; +} + +export interface CodeWithSourceMap { + code: string; + map: SourceMapGenerator; +} + +export class SourceNode { + constructor(); + constructor(line: number, column: number, source: string); + constructor(line: number, column: number, source: string, chunk?: string, name?: string); + static fromStringWithSourceMap(code: string, sourceMapConsumer: SourceMapConsumer, relativePath?: string): SourceNode; + add(chunk: string): void; + prepend(chunk: string): void; + setSourceContent(sourceFile: string, sourceContent: string): void; + walk(fn: (chunk: string, mapping: MappedPosition) => void): void; + walkSourceContents(fn: (file: string, content: string) => void): void; + join(sep: string): SourceNode; + replaceRight(pattern: string, replacement: string): SourceNode; + toString(): string; + toStringWithSourceMap(startOfSourceMap?: StartOfSourceMap): CodeWithSourceMap; +} diff --git a/resources/app/node_modules/source-map/source-map.js b/resources/app/node_modules/source-map/source-map.js new file mode 100644 index 0000000..bc88fe8 --- /dev/null +++ b/resources/app/node_modules/source-map/source-map.js @@ -0,0 +1,8 @@ +/* + * Copyright 2009-2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE.txt or: + * http://opensource.org/licenses/BSD-3-Clause + */ +exports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator; +exports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer; +exports.SourceNode = require('./lib/source-node').SourceNode; diff --git a/resources/app/node_modules/unused-filename/index.js b/resources/app/node_modules/unused-filename/index.js new file mode 100644 index 0000000..cdb127c --- /dev/null +++ b/resources/app/node_modules/unused-filename/index.js @@ -0,0 +1,20 @@ +'use strict'; +const pathExists = require('path-exists'); +const modifyFilename = require('modify-filename'); + +const incrementer = fp => { + let i = 0; + return () => modifyFilename(fp, (filename, ext) => `${filename} (${++i})${ext}`); +}; + +module.exports = fp => { + const getFp = incrementer(fp); + const find = newFp => pathExists(newFp).then(x => x ? find(getFp()) : newFp); + return find(fp); +}; + +module.exports.sync = fp => { + const getFp = incrementer(fp); + const find = newFp => pathExists.sync(newFp) ? find(getFp()) : newFp; + return find(fp); +}; diff --git a/resources/app/node_modules/unused-filename/license b/resources/app/node_modules/unused-filename/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/resources/app/node_modules/unused-filename/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus <[email protected]> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/app/node_modules/unused-filename/readme.md b/resources/app/node_modules/unused-filename/readme.md new file mode 100644 index 0000000..0b75ee9 --- /dev/null +++ b/resources/app/node_modules/unused-filename/readme.md @@ -0,0 +1,56 @@ +# unused-filename [](https://travis-ci.org/sindresorhus/unused-filename) + +> Get an unused filename by appending a number if it exists: `file.txt` → `file (1).txt` + +Useful for safely writing, copying, moving files without overwriting existing files. + + +## Install + +``` +$ npm install --save unused-filename +``` + + +## Usage + +``` +. +├── rainbow (1).txt +├── rainbow.txt +└── unicorn.txt +``` + +```js +const unusedFilename = require('unused-filename'); + +unusedFilename('rainbow.txt').then(filename => { + console.log(filename); + //=> 'rainbow (2).txt' +}); +``` + + +## API + +### unusedFilename(filepath) + +Returns a `Promise<string>`. + +### unusedFilename.sync(filepath) + +Returns a `string`. + +#### filepath + +Type: `string` + + +## Related + +- [filenamify](https://github.com/sindresorhus/filenamify) - Convert a string to a valid safe filename + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/resources/app/node_modules/wurl/README.md b/resources/app/node_modules/wurl/README.md new file mode 100644 index 0000000..64a7c28 --- /dev/null +++ b/resources/app/node_modules/wurl/README.md @@ -0,0 +1,26 @@ +# wurl() + +A simple url parsing library for Node.js. + +Note this is based directly from the [js-url](https://github.com/websanova/js-url) library. To see the documentation and release notes pleas check the [README](https://github.com/websanova/js-url) page there. + +## Install + +``` +npm install wurl +``` + +## Usage + +```js +var wurl = require('wurl'); + +wurl('domain', url); +// etc +``` + +## License + +MIT licensed + +Copyright (C) 2011-2012 Websanova http://www.websanova.com \ No newline at end of file diff --git a/resources/app/node_modules/wurl/package.json b/resources/app/node_modules/wurl/package.json new file mode 100644 index 0000000..490030f --- /dev/null +++ b/resources/app/node_modules/wurl/package.json @@ -0,0 +1,51 @@ +{ + "_from": "wurl@^2.5.2", + "_id": "[email protected]", + "_inBundle": false, + "_integrity": "sha512-LWqZh3ox8gfPwB/xFYFJPnlNOytLtnDtvIDj+iUvD5hxDVWhNa2uhGEQbjyrmolbNFMycqkEnYVXJ7Y72n6h3w==", + "_location": "/wurl", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "wurl@^2.5.2", + "name": "wurl", + "escapedName": "wurl", + "rawSpec": "^2.5.2", + "saveSpec": null, + "fetchSpec": "^2.5.2" + }, + "_requiredBy": [ + "/" + ], + "_resolved": "https://registry.npmjs.org/wurl/-/wurl-2.5.3.tgz", + "_shasum": "79ff7c4d8c6584cb46d239517ecac334380af7fd", + "_spec": "wurl@^2.5.2", + "author": { + "name": "Websanova", + "email": "[email protected]", + "url": "http://websanova.com" + }, + "bugs": { + "url": "https://github.com/websanova/node-url/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "A simple url parsing library.", + "devDependencies": {}, + "homepage": "https://github.com/websanova/node-url#readme", + "keywords": [ + "util", + "url", + "parse" + ], + "licenses": "MIT, GPL", + "main": "wurl.js", + "name": "wurl", + "repository": { + "type": "git", + "url": "git+https://github.com/websanova/node-url.git" + }, + "version": "2.5.3" +} diff --git a/resources/app/node_modules/wurl/test.js b/resources/app/node_modules/wurl/test.js new file mode 100644 index 0000000..ab5fab2 --- /dev/null +++ b/resources/app/node_modules/wurl/test.js @@ -0,0 +1,180 @@ +/** + * Usage: node test.js + */ + +var wurl = require('./wurl.js'), + assert = require('assert'); + +function strictEqual(a, b) { + console.log('Test: ' + a + ' === ' + b); + assert.strictEqual.apply(null, arguments); +} + +// Test URLs. +var url = 'http://rob:[email protected]/path/index.html?query1=test&silly=willy#test=hash&chucky=cheese', + urlHttps = 'https://rob:[email protected]/path/index.html?query1=test&silly=willy#test=hash&chucky=cheese', + urlIp = 'https://rob:[email protected]/path/index.html?query1=test&silly=willy#test=hash&chucky=cheese'; + +/*strictEqual( wurl('{}', url), { + 'auth': 'rob:abcd1234', + 'domain': 'domain.com', + 'file': 'index.html', + 'fileext': 'html', + 'filename': 'index', + 'hash': 'test=hash&chucky=cheese', + 'hostname': 'www.domain.com', + 'pass': 'abcd1234', + 'path': '/path/index.html', + 'port': '80', + 'protocol': 'http', + 'query': 'query1=test&silly=willy', + 'sub': 'www', + 'tld': 'com', + 'user': 'rob' +});*/ + +strictEqual( wurl('tld', 'http://sub.www.domain.co.uk'), 'co.uk' ); +strictEqual( wurl('tld', 'http://www.domain.org.uk'), 'org.uk' ); +strictEqual( wurl('tld', 'http://domain.la'), 'la' ); +strictEqual( wurl('tld', 'http://in'), undefined ); +strictEqual( wurl('tld', 'http://.asia'), 'asia' ); +strictEqual( wurl('tld', 'http://.cao.uk'), undefined ); +strictEqual( wurl('tld', 'http://'), undefined ); +strictEqual( wurl('tld', 'http://domain.zoo'), undefined ); +strictEqual( wurl('tld', url), 'com' ); + +strictEqual( wurl('domain', 'http://sub.www.domain.co.uk'), 'domain.co.uk' ); +strictEqual( wurl('domain', 'http://www.domain.org.uk'), 'domain.org.uk' ); +strictEqual( wurl('domain', 'http://domain.la'), 'domain.la' ); +strictEqual( wurl('domain', 'http://in'), undefined ); +strictEqual( wurl('domain', 'http://.asia'), undefined ); +strictEqual( wurl('domain', 'http://.cao.uk'), undefined ); +strictEqual( wurl('domain', 'http://'), undefined ); +strictEqual( wurl('domain', 'http://domain.zoo'), undefined ); +strictEqual( wurl('domain', url), 'domain.com' ); +strictEqual( wurl('domain', 'https://test.testshi.cn/test.html' ), 'testshi.cn' ); + +strictEqual( wurl('sub', 'http://sub.www.domain.co.uk'), 'sub.www' ); +strictEqual( wurl('sub', 'http://www.domain.org.uk'), 'www' ); +strictEqual( wurl('sub', 'http://domain.la'), undefined ); +strictEqual( wurl('sub', 'http://in'), undefined ); +strictEqual( wurl('sub', 'http://.asia'), undefined ); +strictEqual( wurl('sub', 'http://.cao.uk'), undefined ); +strictEqual( wurl('sub', 'http://'), undefined ); +strictEqual( wurl('sub', 'http://domain.zoo'), undefined ); +strictEqual( wurl('sub', url), 'www' ); + +strictEqual( wurl( 'hostname', url ), 'www.domain.com' ); +strictEqual( wurl( 'hostname', urlIp ), '1.2.3.4' ); + +//strictEqual( wurl( '.', url ), ['www', 'domain', 'com'] ); +strictEqual( wurl( '.0', url ), undefined ); +strictEqual( wurl( '.1', url ), 'www' ); +strictEqual( wurl( '.2', url ), 'domain' ); +strictEqual( wurl( '.-1', url ), 'com' ); + +strictEqual( wurl( 'auth', url ), 'rob:abcd1234' ); + +strictEqual( wurl( 'user', url ), 'rob' ); +strictEqual( wurl( 'email', 'mailto:[email protected]' ), '[email protected]' ); + +strictEqual( wurl( 'pass', url ), 'abcd1234' ); + +strictEqual( wurl( 'port', url ), '80' ); +strictEqual( wurl( 'port', url.toUpperCase() ), '80' ); +strictEqual( wurl( 'port', 'http://example.com:80' ), '80' ); +strictEqual( wurl( 'port', urlHttps ), '443' ); +strictEqual( wurl( 'port', urlHttps.toUpperCase() ), '443' ); +strictEqual( wurl( 'port', 'https://example.com:443' ), '443' ); +strictEqual( wurl( 'port', 'http://domain.com:400?poo=a:b' ), '400' ); +strictEqual( wurl( 'port', 'https://domain.com:80' ), '80' ); +strictEqual( wurl( 'port', 'http://domain.com:443' ), '443' ); +strictEqual( wurl( 'port', 'http://domain.com' ), '80' ); +strictEqual( wurl( 'port', 'https://domain.com' ), '443' ); + +strictEqual( wurl( 'protocol', 'http://domain.com' ), 'http' ); +strictEqual( wurl( 'protocol', 'http://domain.com:80' ), 'http' ); +strictEqual( wurl( 'protocol', 'http://domain.com:443' ), 'http' ); +strictEqual( wurl( 'protocol', 'domain.com' ), 'http' ); +strictEqual( wurl( 'protocol', 'domain.com:80' ), 'http' ); +strictEqual( wurl( 'protocol', 'domain.com:443' ), 'https' ); +strictEqual( wurl( 'protocol', 'https://domain.com:443' ), 'https' ); +strictEqual( wurl( 'protocol', 'https://domain.com:80' ), 'https' ); +strictEqual( wurl( 'protocol', 'mailto:[email protected]' ), 'mailto' ); + +strictEqual( wurl( 'path', url ), '/path/index.html' ); +strictEqual( wurl( 'path', 'http://www.domain.com/first/second' ), '/first/second' ); +strictEqual( wurl( 'path', 'http://www.domain.com/first/second/' ), '/first/second/' ); +strictEqual( wurl( 'path', 'http://www.domain.com:8080/first/second' ), '/first/second' ); +strictEqual( wurl( 'path', 'http://www.domain.com:8080/first/second/' ), '/first/second/' ); +strictEqual( wurl( 'path', 'http://www.domain.com/first/second?test=foo' ), '/first/second' ); +strictEqual( wurl( 'path', 'http://www.domain.com/first/second/?test=foo' ), '/first/second/' ); +strictEqual( wurl( 'path', 'http://www.domain.com/path#anchor' ), '/path' ); +strictEqual( wurl( 'path', 'http://www.domain.com/path/#anchor' ), '/path/' ); +strictEqual( wurl( 'path', 'http://www.domain.com' ), '' ); +strictEqual( wurl( 'path', 'http://www.domain.com/' ), '/' ); +strictEqual( wurl( 'path', 'http://www.domain.com#anchor' ), '' ); +strictEqual( wurl( 'path', 'http://www.domain.com/#anchor' ), '/' ); +strictEqual( wurl( 'path', 'http://www.domain.com?test=foo' ), '' ); +strictEqual( wurl( 'path', 'http://www.domain.com/?test=foo' ), '/' ); +strictEqual( wurl( 'path', 'http://www.domain.com:80' ), '' ); +strictEqual( wurl( 'path', 'http://www.domain.com:80/' ), '/' ); +strictEqual( wurl( 'path', 'http://www.domain.com:80#anchor' ), '' ); +strictEqual( wurl( 'path', 'http://www.domain.com:80/#anchor' ), '/' ); +strictEqual( wurl( 'path', 'http://www.domain.com:80?test=foo' ), '' ); +strictEqual( wurl( 'path', 'http://www.domain.com:80/?test=foo' ), '/' ); + +strictEqual( wurl( 'file', url ), 'index.html' ); +strictEqual( wurl( 'filename', url ), 'index' ); +strictEqual( wurl( 'fileext', url ), 'html' ); + +//strictEqual( wurl( '/', url ), ['path', 'index.html'] ); +strictEqual( wurl( '0', url ), undefined ); +strictEqual( wurl( '-4', url ), undefined ); +strictEqual( wurl( '1', url ), 'path' ); +strictEqual( wurl( 1, url ), 'path' ); +strictEqual( wurl( '2', url ), 'index.html' ); +strictEqual( wurl( '3', url ), undefined ); +strictEqual( wurl( '-1', url ), 'index.html' ); +strictEqual( wurl( '1', 'http://www.domain.com/first/second' ), 'first' ); +strictEqual( wurl( '1', 'http://www.domain.com/first/second/' ), 'first' ); +strictEqual( wurl( '-1', 'http://www.domain.com/first/second?test=foo' ), 'second' ); +strictEqual( wurl( '-1', 'http://www.domain.com/first/second/?test=foo' ), '' ); +strictEqual( wurl( '-2', 'http://www.domain.com/first/second/?test=foo' ), 'second' ); + +strictEqual( wurl( 'query', url ), 'query1=test&silly=willy' ); +//strictEqual( wurl( '?', url ), {'query1': 'test', 'silly': 'willy'} ); +strictEqual( wurl( '?silly', url ), 'willy' ); +strictEqual( wurl( '?poo', url ), undefined ); +strictEqual( wurl( '?poo', 'http://domain.com?poo=' ), '' ); +strictEqual( wurl( '?poo', 'http://domain.com/?poo' ), '' ); +strictEqual( wurl( '?poo', 'http://domain.com?poo' ), '' ); +strictEqual( wurl( '?poo', 'http://domain.com?' ), undefined ); +strictEqual( wurl( '?poo', 'http://domain.com' ), undefined ); +strictEqual( wurl( '?poo', 'http://domain.com?poo=a+b' ), 'a b' ); +strictEqual( wurl( '?poo', 'http://domain.com?poo=javascript%20decode%20uri%20%2B%20sign%20to%20space' ), 'javascript decode uri + sign to space' ); +strictEqual( wurl( '?key', 'http://domain.com?key=value=va?key2=value' ), 'value=va?key2=value'); +strictEqual( wurl( '?poo', 'http://domain.com:400?poo=a:b' ), 'a:b' ); +strictEqual( wurl( '?poo', 'http://domain.com:400? & & &' ), undefined ); + +strictEqual( wurl( '?field[0]', 'http://domain.com?field[0]=zero&field[1]=one' ), 'zero' ); +//strictEqual( wurl( '?field', 'http://domain.com?field[0]=zero&field[1]=one&var=test' ), ['zero', 'one'] ); +//strictEqual( wurl( '?field', 'http://domain.com?field[0]=zero&field[3]=one&var=test' ), ['zero', undefined, undefined, 'one'] ); +strictEqual( wurl( '?var', 'http://domain.com?field[0]=zero&field[3]=one&var=test' ), 'test' ); +//strictEqual( wurl( '?', 'http://domain.com?field[0]=zero&field[1]=one&var=test' ), {'field': ['zero', 'one'], 'var': 'test'} ); + +strictEqual( wurl( 'hash', url ), 'test=hash&chucky=cheese' ); +//strictEqual( wurl( '#', url ), {'chucky': 'cheese', 'test': 'hash'} ); +strictEqual( wurl( '#chucky', url ), 'cheese' ); +strictEqual( wurl( '#poo', url ), undefined ); +strictEqual( wurl( '#poo', 'http://domain.com#poo=' ), '' ); +strictEqual( wurl( '#poo', 'http://domain.com/#poo' ), '' ); +strictEqual( wurl( '#poo', 'http://domain.com#poo' ), '' ); +strictEqual( wurl( '#poo', 'http://domain.com#' ), undefined ); +strictEqual( wurl( '#poo', 'http://domain.com' ), undefined ); + +strictEqual( wurl( '#field[0]', 'http://domain.com#field[0]=zero&field[1]=one' ), 'zero' ); +//strictEqual( wurl( '#field', 'http://domain.com#field[0]=zero&field[1]=one&var=test' ), ['zero', 'one'] ); +//strictEqual( wurl( '#field', 'http://domain.com#field[0]=zero&field[3]=one&var=test' ), ['zero', undefined, undefined, 'one'] ); +strictEqual( wurl( '#var', 'http://domain.com#field[0]=zero&field[3]=one&var=test' ), 'test' ); +//strictEqual( wurl( '#', 'http://domain.com#field[0]=zero&field[1]=one&var=test' ), {'field': ['zero', 'one'], 'var': 'test'} ); diff --git a/resources/app/node_modules/wurl/wurl.js b/resources/app/node_modules/wurl/wurl.js new file mode 100644 index 0000000..0189811 --- /dev/null +++ b/resources/app/node_modules/wurl/wurl.js @@ -0,0 +1,180 @@ +module.exports = function (arg, url) { + + function _t() { + return new RegExp(/(.*?)\.?([^\.]*?)\.(gl|com|net|org|biz|ws|in|me|co\.uk|co|org\.uk|ltd\.uk|plc\.uk|me\.uk|edu|mil|br\.com|cn\.com|eu\.com|hu\.com|no\.com|qc\.com|sa\.com|se\.com|se\.net|us\.com|uy\.com|ac|co\.ac|gv\.ac|or\.ac|ac\.ac|af|am|as|at|ac\.at|co\.at|gv\.at|or\.at|asn\.au|com\.au|edu\.au|org\.au|net\.au|id\.au|be|ac\.be|adm\.br|adv\.br|am\.br|arq\.br|art\.br|bio\.br|cng\.br|cnt\.br|com\.br|ecn\.br|eng\.br|esp\.br|etc\.br|eti\.br|fm\.br|fot\.br|fst\.br|g12\.br|gov\.br|ind\.br|inf\.br|jor\.br|lel\.br|med\.br|mil\.br|net\.br|nom\.br|ntr\.br|odo\.br|org\.br|ppg\.br|pro\.br|psc\.br|psi\.br|rec\.br|slg\.br|tmp\.br|tur\.br|tv\.br|vet\.br|zlg\.br|br|ab\.ca|bc\.ca|mb\.ca|nb\.ca|nf\.ca|ns\.ca|nt\.ca|on\.ca|pe\.ca|qc\.ca|sk\.ca|yk\.ca|ca|cc|ac\.cn|com\.cn|edu\.cn|gov\.cn|org\.cn|bj\.cn|sh\.cn|tj\.cn|cq\.cn|he\.cn|nm\.cn|ln\.cn|jl\.cn|hl\.cn|js\.cn|zj\.cn|ah\.cn|gd\.cn|gx\.cn|hi\.cn|sc\.cn|gz\.cn|yn\.cn|xz\.cn|sn\.cn|gs\.cn|qh\.cn|nx\.cn|xj\.cn|tw\.cn|hk\.cn|mo\.cn|cn|cx|cz|de|dk|fo|com\.ec|tm\.fr|com\.fr|asso\.fr|presse\.fr|fr|gf|gs|co\.il|net\.il|ac\.il|k12\.il|gov\.il|muni\.il|ac\.in|co\.in|org\.in|ernet\.in|gov\.in|net\.in|res\.in|is|it|ac\.jp|co\.jp|go\.jp|or\.jp|ne\.jp|ac\.kr|co\.kr|go\.kr|ne\.kr|nm\.kr|or\.kr|li|lt|lu|asso\.mc|tm\.mc|com\.mm|org\.mm|net\.mm|edu\.mm|gov\.mm|ms|nl|no|nu|pl|ro|org\.ro|store\.ro|tm\.ro|firm\.ro|www\.ro|arts\.ro|rec\.ro|info\.ro|nom\.ro|nt\.ro|se|si|com\.sg|org\.sg|net\.sg|gov\.sg|sk|st|tf|ac\.th|co\.th|go\.th|mi\.th|net\.th|or\.th|tm|to|com\.tr|edu\.tr|gov\.tr|k12\.tr|net\.tr|org\.tr|com\.tw|org\.tw|net\.tw|ac\.uk|uk\.com|uk\.net|gb\.com|gb\.net|vg|sh|kz|ch|info|ua|gov|name|pro|ie|hk|com\.hk|org\.hk|net\.hk|edu\.hk|us|tk|cd|by|ad|lv|eu\.lv|bz|es|jp|cl|ag|mobi|eu|co\.nz|org\.nz|net\.nz|maori\.nz|iwi\.nz|io|la|md|sc|sg|vc|tw|travel|my|se|tv|pt|com\.pt|edu\.pt|asia|fi|com\.ve|net\.ve|fi|org\.ve|web\.ve|info\.ve|co\.ve|tel|im|gr|ru|net\.ru|org\.ru|hr|com\.hr|ly|xyz)$/); + } + + function _d(s) { + return decodeURIComponent(s.replace(/\+/g, ' ')); + } + + function _i(arg, str) { + var sptr = arg.charAt(0), + split = str.split(sptr); + + if (sptr === arg) { return split; } + + arg = parseInt(arg.substring(1), 10); + + return split[arg < 0 ? split.length + arg : arg - 1]; + } + + function _f(arg, str) { + var sptr = arg.charAt(0), + split = str.split('&'), + field = [], + params = {}, + tmp = [], + arg2 = arg.substring(1); + + for (var i = 0, ii = split.length; i < ii; i++) { + field = split[i].match(/(.*?)=(.*)/); + + // TODO: regex should be able to handle this. + if ( ! field) { + field = [split[i], split[i], '']; + } + + if (field[1].replace(/\s/g, '') !== '') { + field[2] = _d(field[2] || ''); + + // If we have a match just return it right away. + if (arg2 === field[1]) { return field[2]; } + + // Check for array pattern. + tmp = field[1].match(/(.*)\[([0-9]+)\]/); + + if (tmp) { + params[tmp[1]] = params[tmp[1]] || []; + + params[tmp[1]][tmp[2]] = field[2]; + } + else { + params[field[1]] = field[2]; + } + } + } + + if (sptr === arg) { return params; } + + return params[arg2]; + } + + var _l = {}, tmp, tmp2; + + if (arg === 'tld?') { return _t(); } + + url = url || window.location.toString(); + + if ( ! arg) { return url; } + + arg = arg.toString(); + + if (tmp = url.match(/^mailto:([^\/].+)/)) { + _l.protocol = 'mailto'; + _l.email = tmp[1]; + } + else { + + // Ignore Hashbangs. + if (tmp = url.match(/(.*?)\/#\!(.*)/)) { + url = tmp[1] + tmp[2]; + } + + // Hash. + if (tmp = url.match(/(.*?)#(.*)/)) { + _l.hash = tmp[2]; + url = tmp[1]; + } + + // Return hash parts. + if (_l.hash && arg.match(/^#/)) { return _f(arg, _l.hash); } + + // Query + if (tmp = url.match(/(.*?)\?(.*)/)) { + _l.query = tmp[2]; + url = tmp[1]; + } + + // Return query parts. + if (_l.query && arg.match(/^\?/)) { return _f(arg, _l.query); } + + // Protocol. + if (tmp = url.match(/(.*?)\:?\/\/(.*)/)) { + _l.protocol = tmp[1].toLowerCase(); + url = tmp[2]; + } + + // Path. + if (tmp = url.match(/(.*?)(\/.*)/)) { + _l.path = tmp[2]; + url = tmp[1]; + } + + // Clean up path. + _l.path = (_l.path || '').replace(/^([^\/])/, '/$1'); + + // Return path parts. + if (arg.match(/^[\-0-9]+$/)) { arg = arg.replace(/^([^\/])/, '/$1'); } + if (arg.match(/^\//)) { return _i(arg, _l.path.substring(1)); } + + // File. + tmp = _i('/-1', _l.path.substring(1)); + + if (tmp && (tmp = tmp.match(/(.*?)\.([^.]+)$/))) { + _l.file = tmp[0]; + _l.filename = tmp[1]; + _l.fileext = tmp[2]; + } + + // Port. + if (tmp = url.match(/(.*)\:([0-9]+)$/)) { + _l.port = tmp[2]; + url = tmp[1]; + } + + // Auth. + if (tmp = url.match(/(.*?)@(.*)/)) { + _l.auth = tmp[1]; + url = tmp[2]; + } + + // User and pass. + if (_l.auth) { + tmp = _l.auth.match(/(.*)\:(.*)/); + + _l.user = tmp ? tmp[1] : _l.auth; + _l.pass = tmp ? tmp[2] : undefined; + } + + // Hostname. + _l.hostname = url.toLowerCase(); + + // Return hostname parts. + if (arg.charAt(0) === '.') { return _i(arg, _l.hostname); } + + // Domain, tld and sub domain. + if (_t()) { + tmp = _l.hostname.match(_t()); + + if (tmp) { + _l.tld = tmp[3]; + _l.domain = tmp[2] ? tmp[2] + '.' + tmp[3] : undefined; + _l.sub = tmp[1] || undefined; + } + } + + // Set port and protocol defaults if not set. + _l.port = _l.port || (_l.protocol === 'https' ? '443' : '80'); + _l.protocol = _l.protocol || (_l.port === '443' ? 'https' : 'http'); + } + + // Return arg. + if (arg in _l) { return _l[arg]; } + + // Return everything. + if (arg === '{}') { return _l; } + + // Default to undefined for no match. + return undefined; +}; \ No newline at end of file |